%last edited: 31.12.2024 (or later) @article {Abels(1974), AUTHOR = {Abels, Herbert}, TITLE = {Parallelizability of proper actions, global ${K}$-slices and maximal compact subgroups}, JOURNAL = {Math. Ann.}, VOLUME = {212}, YEAR = {1974/75}, PAGES = {1--19}, MRCLASS = {54H05}, MRNUMBER = {51 \#11460}, MRREVIEWER = {L. King}, } @article {Abels(1978), AUTHOR = {Abels, Herbert}, TITLE = {A universal proper ${G}$-space}, JOURNAL = {Math. Z.}, VOLUME = {159}, YEAR = {1978}, NUMBER = {2}, PAGES = {143--158}, MRCLASS = {57E20}, MRNUMBER = {58 \#18504}, MRREVIEWER = {J. L. Koszul}, } @article {Abels-Manoussos-Noskov-proper-inv-metric(2011), AUTHOR = {Abels, H. and Manoussos, A. and Noskov, G.}, TITLE = {Proper actions and proper invariant metrics}, JOURNAL = {J. Lond. Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {83}, YEAR = {2011}, NUMBER = {3}, PAGES = {619--636}, ISSN = {0024-6107}, MRCLASS = {54H15 (37B05 54D45 54H20)}, MRNUMBER = {2802502}, MRREVIEWER = {Alica Miller}, DOI = {10.1112/jlms/jdq091}, URL = {https://doi.org/10.1112/jlms/jdq091}, } @article {Abert(2008), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s}, TITLE = {Less than continuum many translates of a compact nullset may cover any infinite profinite group}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {11}, YEAR = {2008}, NUMBER = {4}, PAGES = {545--553}, ISSN = {1433-5883}, CODEN = {JGTHFQ}, MRCLASS = {20E18 (03E17)}, MRNUMBER = {2429354 (2009d:20057)}, MRREVIEWER = {O. V. Belegradek}, DOI = {10.1515/JGT.2008.033}, URL = {http://dx.doi.org/10.1515/JGT.2008.033}, } @article {Abert(2006graphs), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s}, TITLE = {Representing graphs by the non-commuting relation}, JOURNAL = {Publ. Math. Debrecen}, FJOURNAL = {Publicationes Mathematicae Debrecen}, VOLUME = {69}, YEAR = {2006}, NUMBER = {3}, PAGES = {261--269}, ISSN = {0033-3883}, CODEN = {PUMAAR}, MRCLASS = {05C25 (20F69)}, MRNUMBER = {2273978 (2008j:05162)}, } @article {Abert(2006_probability, AUTHOR = {Ab{\'e}rt, Mikl{\'o}s}, TITLE = {On the probability of satisfying a word in a group}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {9}, YEAR = {2006}, NUMBER = {5}, PAGES = {685--694}, ISSN = {1433-5883}, CODEN = {JGTHFQ}, MRCLASS = {20F05 (20F69 20P05)}, MRNUMBER = {2253960 (2007j:20040)}, MRREVIEWER = {Robert H. Gilman}, DOI = {10.1515/JGT.2006.044}, URL = {http://dx.doi.org/10.1515/JGT.2006.044}, } @article {Abert(2005group_lawa), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s}, TITLE = {Group laws and free subgroups in topological groups}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {37}, YEAR = {2005}, NUMBER = {4}, PAGES = {525--534}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {20B07 (20E10)}, MRNUMBER = {2143732 (2006d:20005)}, MRREVIEWER = {Orazio Puglisi}, DOI = {10.1112/S002460930500425X}, URL = {http://dx.doi.org/10.1112/S002460930500425X}, } @article {Abert(2003), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s}, TITLE = {Symmetric presentations of abelian groups}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {131}, YEAR = {2003}, NUMBER = {1}, PAGES = {17--20 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {20F05 (20K01)}, MRNUMBER = {1929017 (2003g:20051)}, DOI = {10.1090/S0002-9939-02-06490-0}, URL = {http://dx.doi.org/10.1090/S0002-9939-02-06490-0}, } @article {Abert(2002), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s}, TITLE = {Symmetric groups as products of abelian subgroups}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {34}, YEAR = {2002}, NUMBER = {4}, PAGES = {451--456}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {20B30 (20D40)}, MRNUMBER = {1897424 (2002m:20006)}, MRREVIEWER = {Hiroyoshi Yamaki}, DOI = {10.1112/S0024609302001042}, URL = {http://dx.doi.org/10.1112/S0024609302001042}, } @article {Abert-Babai(2007), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Babai, L{\'a}szl{\'o}}, TITLE = {Finite groups of uniform logarithmic diameter}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {158}, YEAR = {2007}, PAGES = {193--203}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {20F65 (05C25 20F05)}, MRNUMBER = {2342463 (2008m:20070)}, MRREVIEWER = {Tullio G. Ceccherini-Silberstein}, DOI = {10.1007/s11856-007-0009-7}, URL = {http://dx.doi.org/10.1007/s11856-007-0009-7}, } @article {Abert-Bergeron-Biringer-Gelander-Nikolov-Raimbault-Samet(2017), AUTHOR = {Abert, Miklos and Bergeron, Nicolas and Biringer, Ian and Gelander, Tsachik and Nikolov, Nikolay and Raimbault, Jean and Samet, Iddo}, TITLE = {On the growth of {$L^2$}-invariants for sequences of lattices in {L}ie groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {185}, YEAR = {2017}, } @article {Abert-Bergeron-Biringer-Gelander-Nokolov_Raimbault-Samet(2011), AUTHOR = {Abert, Miklos and Bergeron, Nicolas and Biringer, Ian and Gelander, Tsachik and Nikolov, Nikolay and Raimbault, Jean and Samet, Iddo}, TITLE = {On the growth of {B}etti numbers of locally symmetric spaces}, JOURNAL = {C. R. Math. Acad. Sci. Paris}, FJOURNAL = {Comptes Rendus Math\'ematique. Acad\'emie des Sciences. Paris}, VOLUME = {349}, YEAR = {2011}, NUMBER = {15-16}, PAGES = {831--835}, ISSN = {1631-073X}, MRCLASS = {58J37 (22E40 53C35)}, MRNUMBER = {2835886 (2012j:58033)}, MRREVIEWER = {B. Sury}, DOI = {10.1016/j.crma.2011.07.013}, URL = {http://dx.doi.org/10.1016/j.crma.2011.07.013}, } @article {Abert-Weiss(2013), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Weiss, Benjamin}, TITLE = {Bernoulli actions are weakly contained in any free action}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {33}, YEAR = {2013}, NUMBER = {2}, PAGES = {323--333}, ISSN = {0143-3857}, MRCLASS = {37Axx}, MRNUMBER = {3035287}, DOI = {10.1017/S0143385711000988}, URL = {http://dx.doi.org/10.1017/S0143385711000988}, } @article {Abert-Elek(2012), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Elek, G{\'a}bor}, TITLE = {Dynamical properties of profinite actions}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {32}, YEAR = {2012}, NUMBER = {6}, PAGES = {1805--1835}, ISSN = {0143-3857}, MRCLASS = {37A20 (20F65)}, MRNUMBER = {2995875}, MRREVIEWER = {Nhan-Phu Chung}, DOI = {10.1017/S0143385711000654}, URL = {http://dx.doi.org/10.1017/S0143385711000654}, } @article {Abert-Glasner(2009_generic_groups), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Glasner, Yair}, TITLE = {Generic groups acting on regular trees}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {361}, YEAR = {2009}, NUMBER = {7}, PAGES = {3597--3610}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {20E08}, MRNUMBER = {2491892 (2010g:20043)}, MRREVIEWER = {Matt T. Clay}, DOI = {10.1090/S0002-9947-09-04662-5}, URL = {http://dx.doi.org/10.1090/S0002-9947-09-04662-5}, } @article {Abert-Glasner(2009most_actions), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Glasner, Yair}, TITLE = {Most actions on regular trees are almost free}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {3}, YEAR = {2009}, NUMBER = {2}, PAGES = {199--213}, ISSN = {1661-7207}, MRCLASS = {20E08 (05C05 20E05)}, MRNUMBER = {2486797 (2010j:20040)}, MRREVIEWER = {Ralf Gramlich}, DOI = {10.4171/GGD/54}, URL = {http://dx.doi.org/10.4171/GGD/54}, } @article {Abert-Heged(2007), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Heged{\H{u}}s, P{\'a}l}, TITLE = {On the number of generators needed for free profinite products of finite groups}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {162}, YEAR = {2007}, PAGES = {81--92}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {20E18}, MRNUMBER = {2365854 (2008k:20059)}, MRREVIEWER = {Karl Lorensen}, DOI = {10.1007/s11856-007-0089-4}, URL = {http://dx.doi.org/10.1007/s11856-007-0089-4}, } @article {Abert-Keleti(2002), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Keleti, Tam{\'a}s}, TITLE = {Shuffle the plane}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {130}, YEAR = {2002}, NUMBER = {2}, PAGES = {549--553 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {03E05 (20B30)}, MRNUMBER = {1862136 (2003g:03070)}, DOI = {10.1090/S0002-9939-01-06344-4}, URL = {http://dx.doi.org/10.1090/S0002-9939-01-06344-4}, } @article {Abert-Lubotzky-Pyber(2003), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Lubotzky, Alexander and Pyber, L{\'a}szl{\'o}}, TITLE = {Bounded generation and linear groups}, JOURNAL = {Internat. J. Algebra Comput.}, FJOURNAL = {International Journal of Algebra and Computation}, VOLUME = {13}, YEAR = {2003}, NUMBER = {4}, PAGES = {401--413}, ISSN = {0218-1967}, MRCLASS = {20D40 (20C99 20E18)}, MRNUMBER = {2022116 (2004k:20047)}, MRREVIEWER = {Daniel Segal}, DOI = {10.1142/S0218196703001493}, URL = {http://dx.doi.org/10.1142/S0218196703001493}, } @article {Abert-Jaikin-Zapirain-Nikolov(2011), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Jaikin-Zapirain, Andrei and Nikolov, Nikolay}, TITLE = {The rank gradient from a combinatorial viewpoint}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {5}, YEAR = {2011}, NUMBER = {2}, PAGES = {213--230}, ISSN = {1661-7207}, MRCLASS = {20F69 (20E06 20E26)}, MRNUMBER = {2782170}, DOI = {10.4171/GGD/124}, URL = {http://dx.doi.org/10.4171/GGD/124}, } @article {Abert-Nikolov(2012), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Nikolov, Nikolay}, TITLE = {Rank gradient, cost of groups and the rank versus {H}eegaard genus problem}, JOURNAL = {J. Eur. Math. Soc. (JEMS)}, FJOURNAL = {Journal of the European Mathematical Society (JEMS)}, VOLUME = {14}, YEAR = {2012}, NUMBER = {5}, PAGES = {1657--1677}, ISSN = {1435-9855}, MRCLASS = {Preliminary Data}, MRNUMBER = {2966663}, DOI = {10.4171/JEMS/344}, URL = {http://dx.doi.org/10.4171/JEMS/344}, } @article {Abert-Nikolov-Szegedy(2003), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Nikolov, Nikolay and Szegedy, Bal{\'a}zs}, TITLE = {Congruence subgroup growth of arithmetic groups in positive characteristic}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {117}, YEAR = {2003}, NUMBER = {2}, PAGES = {367--383}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {20H05 (17B45 20G30)}, MRNUMBER = {1971298 (2004a:20057)}, MRREVIEWER = {J. D. Dixon}, DOI = {10.1215/S0012-7094-03-11726-3}, URL = {http://dx.doi.org/10.1215/S0012-7094-03-11726-3}, } @article {Abert-Virag(2005), AUTHOR = {Ab{\'e}rt, Mikl{\'o}s and Vir{\'a}g, B{\'a}lint}, TITLE = {Dimension and randomness in groups acting on rooted trees}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {18}, YEAR = {2005}, NUMBER = {1}, PAGES = {157--192 (electronic)}, ISSN = {0894-0347}, MRCLASS = {20E08 (20E18 28A78 28A80 60J80)}, MRNUMBER = {2114819 (2005m:20058)}, MRREVIEWER = {Goulnara N. Arzhantseva}, DOI = {10.1090/S0894-0347-04-00467-9}, URL = {http://dx.doi.org/10.1090/S0894-0347-04-00467-9}, } @incollection {Abhau-Boedigheimer(2008), AUTHOR = {Abhau, Jochen and B{\"o}digheimer, Carl-Friedrich and Ehrenfried, Ralf}, TITLE = {Homology of the mapping class group {$\Gamma_{2,1}$} for surfaces of genus 2 with a boundary curve}, BOOKTITLE = {The {Z}ieschang {G}edenkschrift}, SERIES = {Geom. Topol. Monogr.}, VOLUME = {14}, PAGES = {1--25}, PUBLISHER = {Geom. Topol. Publ., Coventry}, YEAR = {2008}, MRCLASS = {57S05 (57N05 57S25)}, MRNUMBER = {2484693 (2010b:57044)}, MRREVIEWER = {Mustafa Korkmaz}, DOI = {10.2140/gtm.2008.14.1}, URL = {http://dx.doi.org/10.2140/gtm.2008.14.1}, } @book {Abramenko-Brown(2008), AUTHOR = {Abramenko, Peter and Brown, Kenneth S.}, TITLE = {Buildings}, SERIES = {Graduate Texts in Mathematics}, VOLUME = {248}, NOTE = {Theory and applications}, PUBLISHER = {Springer}, ADDRESS = {New York}, YEAR = {2008}, PAGES = {xxii+747}, ISBN = {978-0-387-78834-0}, MRCLASS = {20E42 (20F55 20J06 51E24 51F15)}, MRNUMBER = {2439729 (2009g:20055)}, MRREVIEWER = {Ralf Gramlich}, DOI = {10.1007/978-0-387-78835-7}, URL = {http://dx.doi.org/10.1007/978-0-387-78835-7}, } @book {Abraham-Marsden-Raitu(1988), AUTHOR = {Abraham, R. and Marsden, J. E. and Ratiu, T.}, TITLE = {Manifolds, tensor analysis, and applications}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1988}, PAGES = {x+654}, ISBN = {0-387-96790-7}, MRCLASS = {58-01}, MRNUMBER = {89f:58001}, } @article {Abresch(1983), AUTHOR = {Abresch, Uwe}, TITLE = {Isoparametric hypersurfaces with four or six distinct principal curvatures. {N}ecessary conditions on the multiplicities}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {264}, YEAR = {1983}, NUMBER = {3}, PAGES = {283--302}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {53C40}, MRNUMBER = {85g:53052b}, MRREVIEWER = {Th. Friedrich}, } @article {Abresch(1985), AUTHOR = {Abresch, Uwe}, TITLE = {Lower curvature bounds, {T}oponogov's theorem, and bounded topology}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {18}, YEAR = {1985}, NUMBER = {4}, PAGES = {651--670}, ISSN = {0012-9593}, CODEN = {ASENAH}, MRCLASS = {53C20 (53C21)}, MRNUMBER = {87j:53058}, MRREVIEWER = {Pierre B{\'e}rard}, } @article {Abresch(1987), AUTHOR = {Abresch, Uwe}, TITLE = {Lower curvature bounds, {T}oponogov's theorem, and bounded topology. {I}{I}}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {20}, YEAR = {1987}, NUMBER = {3}, PAGES = {475--502}, ISSN = {0012-9593}, CODEN = {ASENAH}, MRCLASS = {53C20 (53C21)}, MRNUMBER = {89d:53080}, MRREVIEWER = {Ji-Ping Sha}, } @article {Abresch-Meyer(1994a), AUTHOR = {Abresch, Uwe and Meyer, Wolfgang T.}, TITLE = {Pinching below $\frac14$, injectivity radius, and conjugate radius}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {40}, YEAR = {1994}, NUMBER = {3}, PAGES = {643--691}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C20 (53C21 58E10)}, MRNUMBER = {95j:53053}, MRREVIEWER = {Miroslav Lovri{\'c}}, } @article {Abresch-Meyer(1996c), AUTHOR = {Abresch, Uwe and Meyer, Wolfgang T.}, TITLE = {A sphere theorem with a pinching constant below ${1\over4}$}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {44}, YEAR = {1996}, NUMBER = {2}, PAGES = {214--261}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C20}, MRNUMBER = {97i:53036}, MRREVIEWER = {Miroslav Lovri{\'c}}, } @incollection {Abresch-Meyer(1997b), AUTHOR = {Abresch, Uwe and Meyer, Wolfgang T.}, TITLE = {Injectivity radius estimates and sphere theorems}, BOOKTITLE = {Comparison geometry (Berkeley, CA, 1993--94)}, PAGES = {1--47}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1997}, MRCLASS = {53C20}, MRNUMBER = {98e:53052}, MRREVIEWER = {Seong-Hun Paeng}, } @article {Adachi(1993), AUTHOR = {Adachi, Toshiaki}, TITLE = {A note on the {F}\o lner condition for amenability}, JOURNAL = {Nagoya Math. J.}, FJOURNAL = {Nagoya Mathematical Journal}, VOLUME = {131}, YEAR = {1993}, PAGES = {67--74}, ISSN = {0027-7630}, CODEN = {NGMJA2}, MRCLASS = {43A07 (58G25)}, MRNUMBER = {94h:43001}, MRREVIEWER = {Nobuaki Obata}, } @article {Adams(1955), AUTHOR = {Adams, J. F.}, TITLE = {A new proof of a theorem of {W}. {H}. {C}ockcroft}, JOURNAL = {J. London Math. Soc.}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {30}, YEAR = {1955}, PAGES = {482--488}, ISSN = {0024-6107}, MRCLASS = {55.0X}, MRNUMBER = {0076335 (17,883d)}, MRREVIEWER = {J. Adem}, } @article {Adams(1958), AUTHOR = {Adams, John Frank}, TITLE = {On the structure and applications of the {S}teenrod algebra}, JOURNAL = {Comment. Math. Helv.}, VOLUME = {32}, YEAR = {1958}, PAGES = {180--214}, MRCLASS = {55.00}, MRNUMBER = {20 \#2711}, MRREVIEWER = {F. P. Peterson}, } @article {Adams(1960), AUTHOR = {Adams, John Frank}, TITLE = {On the non-existence of elements of {H}opf invariant one}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {72}, YEAR = {1960}, PAGES = {20--104}, MRCLASS = {55.40}, MRNUMBER = {25 \#4530}, MRREVIEWER = {M. A. Kervaire}, } @incollection {Adams(1962ICM), AUTHOR = {Adams, J. F.}, TITLE = {Applications of the {G}rothendieck-{A}tiyah-{H}irzebruch functor {$K(X)$}}, BOOKTITLE = {Proc. {I}nternat. {C}ongr. {M}athematicians ({S}tockholm, 1962)}, PAGES = {435--441}, PUBLISHER = {Inst. Mittag-Leffler}, ADDRESS = {Djursholm}, YEAR = {1963}, MRCLASS = {57.30}, MRNUMBER = {0176488 (31 \#760)}, } @article {Adams(1962vector_fields_Annals), AUTHOR = {Adams, J. F.}, TITLE = {Vector fields on spheres}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {75}, YEAR = {1962}, PAGES = {603--632}, ISSN = {0003-486X}, MRCLASS = {57.30}, MRNUMBER = {0139178 (25 \#2614)}, MRREVIEWER = {M. F. Atiyah}, } @article {Adams(1962vector_fields_Topology), AUTHOR = {Adams, J. F.}, TITLE = {Vector fields on spheres}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {1}, YEAR = {1962}, PAGES = {63--65}, ISSN = {0040-9383}, MRCLASS = {57.34}, MRNUMBER = {0133838 (24 \#A3663)}, MRREVIEWER = {F. P. Peterson}, } @article {Adams(1962vector_fields_Bulletin), AUTHOR = {Adams, J. F.}, TITLE = {Vector fields on spheres}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {68}, YEAR = {1962}, PAGES = {39--41}, ISSN = {0002-9904}, MRCLASS = {57.34}, MRNUMBER = {0133837 (24 \#A3662)}, MRREVIEWER = {M. F. Atiyah}, } @article {Adams(1963_J(X)_I), AUTHOR = {Adams, J. F.}, TITLE = {On the groups {$J(X)$}. {I}}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {2}, YEAR = {1963}, PAGES = {181--195}, ISSN = {0040-9383}, MRCLASS = {55.40 (55.50)}, MRNUMBER = {0159336 (28 \#2553)}, MRREVIEWER = {E. Dyer}, } @article {Adams(1965_J(X)_II), AUTHOR = {Adams, J. F.}, TITLE = {On the groups {$J(X)$}. {II}}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {3}, YEAR = {1965}, PAGES = {137--171}, ISSN = {0040-9383}, MRCLASS = {55.40}, MRNUMBER = {0198468 (33 \#6626)}, MRREVIEWER = {E. Dyer}, } @article {Adams(1965_J(X)_III), AUTHOR = {Adams, J. F.}, TITLE = {On the groups {$J(X)$}. {III}}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {3}, YEAR = {1965}, PAGES = {193--222}, ISSN = {0040-9383}, MRCLASS = {55.40}, MRNUMBER = {0198469 (33 \#6627)}, MRREVIEWER = {E. Dyer}, } @incollection {Adams(1965), AUTHOR = {Adams, J. Frank}, TITLE = {On the groups {$J(X)$}}, BOOKTITLE = {Differential and {C}ombinatorial {T}opology ({A} {S}ymposium in {H}onor of {M}arston {M}orse)}, PAGES = {121--143}, PUBLISHER = {Princeton Univ. Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1965}, MRCLASS = {55.40 (55.45)}, MRNUMBER = {0189031 (32 \#6458)}, MRREVIEWER = {R. E. Stong}, } @article {Adams(1966_J(X)_IV), AUTHOR = {Adams, J. F.}, TITLE = {On the groups {$J(X)$}. {IV}}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {5}, YEAR = {1966}, PAGES = {21--71}, ISSN = {0040-9383}, MRCLASS = {55.40}, MRNUMBER = {0198470 (33 \#6628)}, MRREVIEWER = {E. Dyer}, } @article {Adams(1968_J(X)_IV_corrections), AUTHOR = {Adams, J. F.}, TITLE = {Correction to: ``{O}n the groups {$J(X)$}. {IV}''}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {7}, YEAR = {1968}, PAGES = {331}, ISSN = {0040-9383}, MRCLASS = {55.42}, MRNUMBER = {0230312 (37 \#5874)}, } @book {Adams(1969), AUTHOR = {Adams, John Frank}, TITLE = {Lectures on {L}ie groups}, PUBLISHER = {W. A. Benjamin, Inc., New York-Amsterdam}, YEAR = {1969}, PAGES = {xii+182}, MRCLASS = {22.50}, MRNUMBER = {40 \#5780}, MRREVIEWER = {N. R. Wallach}, } @incollection {Adams(1969b), AUTHOR = {Adams, J. F.}, TITLE = {Lectures on generalised cohomology}, BOOKTITLE = {Category Theory, Homology Theory and their Applications, III (Battelle Institute Conference, Seattle, Wash., 1968, Vol. Three)}, PAGES = {1--138}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1969}, MRCLASS = {55.30 (18.00)}, MRNUMBER = {40 \#4943}, MRREVIEWER = {J. Siegel}, } @book {Adams(1974), AUTHOR = {Adams, John Frank}, TITLE = {Stable homotopy and generalised homology}, NOTE = {Chicago Lectures in Mathematics}, PUBLISHER = {University of Chicago Press}, ADDRESS = {Chicago, Ill.}, YEAR = {1974}, PAGES = {x+373}, MRCLASS = {55B20 (55E10)}, MRNUMBER = {53 \#6534}, MRREVIEWER = {P. S. Landweber}, } @book {Adams(1978a), AUTHOR = {Adams, John Frank}, TITLE = {Infinite loop spaces}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1978}, PAGES = {x+214}, ISBN = {0-691-08207-3; 0-691-08206-5}, MRCLASS = {55-02 (55N20 55P47)}, MRNUMBER = {80d:55001}, MRREVIEWER = {Stewart B. Priddy}, } @article {Adams(1978b), AUTHOR = {Adams, John Frank}, TITLE = {Maps between classifying spaces. {I}{I}}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {49}, YEAR = {1978}, NUMBER = {1}, PAGES = {1--65}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {55R40 (55R35 55R50)}, MRNUMBER = {80e:55032}, MRREVIEWER = {C. B. Thomas}, } @article {Adams(1982), AUTHOR = {Adams, J. Frank}, TITLE = {Graeme {S}egal's {B}urnside ring conjecture}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {6}, YEAR = {1982}, NUMBER = {2}, PAGES = {201--210}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {55T15 (55Q55)}, MRNUMBER = {MR640946 (83d:55017)}, MRREVIEWER = {Gunnar Carlsson}, } @book {Adams(1992a), AUTHOR = {Adams, J. Frank}, TITLE = {The selected works of {J}. {F}rank {A}dams. {V}ol. {I}}, NOTE = {Edited and with an introduction and biographical data by J. P. May and C. B. Thomas}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1992}, PAGES = {xvi+536}, ISBN = {0-521-41063-0}, MRCLASS = {01A75 (55-03)}, MRNUMBER = {94d:01095a}, MRREVIEWER = {Donald M. Davis}, } @book {Adams(1992b), AUTHOR = {Adams, J. Frank}, TITLE = {The selected works of {J}. {F}rank {A}dams. {V}ol. {I}{I}}, NOTE = {Edited and with an introduction and biographical data by J. P. May and C. B. Thomas}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1992}, PAGES = {xvi+529}, ISBN = {0-521-41065-7}, MRCLASS = {01A75 (55-03)}, MRNUMBER = {94d:01095b}, MRREVIEWER = {Donald M. Davis}, } @article {Adams-Atiyah(1966), AUTHOR = {Adams, J. F. and Atiyah, M. F.}, TITLE = {{$K$}-theory and the {H}opf invariant}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {17}, YEAR = {1966}, PAGES = {31--38}, ISSN = {0033-5606}, MRCLASS = {55.40 (57.30)}, MRNUMBER = {0198460 (33 \#6618)}, MRREVIEWER = {E. Dyer}, } @article {Adams-Haeberly-Jackowski-May(1988Segal), AUTHOR = {Adams, J. F. and Haeberly, J.-P. and Jackowski, S. and May, J. P.}, TITLE = {A generalization of the {S}egal conjecture}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {27}, YEAR = {1988}, NUMBER = {1}, PAGES = {7--21}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P99}, MRNUMBER = {935524 (90e:55027)}, MRREVIEWER = {R. Kultze}, DOI = {10.1016/0040-9383(88)90003-1}, URL = {http://dx.doi.org/10.1016/0040-9383(88)90003-1}, } @article {Adams-Haeberly-Jackowski-May1988Atiyah+Segal), AUTHOR = {Adams, J. F. and Haeberly, J.-P. and Jackowski, S. and May, J. P.}, TITLE = {A generalization of the {A}tiyah-{S}egal completion theorem}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {27}, YEAR = {1988}, NUMBER = {1}, PAGES = {1--6}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P99}, MRNUMBER = {935523 (90e:55026)}, MRREVIEWER = {R. Kultze}, DOI = {10.1016/0040-9383(88)90002-X}, URL = {http://dx.doi.org/10.1016/0040-9383(88)90002-X}, } @article {Adem(1987), AUTHOR = {Adem, Alejandro}, TITLE = {{${\bf Z}/p{\bf Z}$} actions on {$(S\sp n)\sp k$}}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {300}, YEAR = {1987}, NUMBER = {2}, PAGES = {791--809}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57S17 (55R91 57S25)}, MRNUMBER = {MR876479 (88b:57037)}, MRREVIEWER = {Steven H. Weintraub}, } @article {Adem(1989), AUTHOR = {Adem, Alejandro}, TITLE = {On the exponent of cohomology of discrete groups}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {21}, YEAR = {1989}, NUMBER = {6}, PAGES = {585--590}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {55N20 (22E41)}, MRNUMBER = {91a:55005}, MRREVIEWER = {Ruth Charney}, } @article {Adem(1992a), AUTHOR = {Adem, Alejandro}, TITLE = {On the {$K$}-theory of the classifying space of a discrete group}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {292}, YEAR = {1992}, NUMBER = {2}, PAGES = {319--327}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {55R35 (19L47 55R50)}, MRNUMBER = {93i:55018a}, } @article {Adem(1992b), AUTHOR = {Adem, Alejandro}, TITLE = {Erratum: ``{O}n the {$K$}-theory of the classifying space of a discrete group''}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {293}, YEAR = {1992}, NUMBER = {2}, PAGES = {385--386}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {55R35 (19L47 55R50)}, MRNUMBER = {93i:55018b}, } @article {Adem(1993a), AUTHOR = {Adem, Alejandro}, TITLE = {Representations and ${K}$-theory of discrete groups}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {28}, YEAR = {1993}, NUMBER = {1}, PAGES = {95--98}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {55R35 (19L99 20C99)}, MRNUMBER = {93d:55020}, } @article {Adem(1993b), AUTHOR = {Adem, Alejandro}, TITLE = {Characters and ${K}$-theory of discrete groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {114}, YEAR = {1993}, NUMBER = {3}, PAGES = {489--514}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {55N15 (19L47 55N91 55R35 55R50)}, MRNUMBER = {95j:55006a}, MRREVIEWER = {Charles Weibel}, } @incollection {Adem(1994), AUTHOR = {Adem, Alejandro}, TITLE = {Cohomology and actions of finite groups}, BOOKTITLE = {Differential topology, foliations, and group actions (Rio de Janeiro, 1992)}, PAGES = {123--141}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1994}, MRCLASS = {57M07 (20J05)}, MRNUMBER = {95c:57001}, MRREVIEWER = {Jean-Claude Hausmann}, } @article {Adem(1994b), AUTHOR = {Adem, Alejandro}, TITLE = {Erratum: ``{C}haracters and ${K}$-theory of discrete groups''}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {117}, YEAR = {1994}, NUMBER = {2}, PAGES = {355--356}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {55N15 (19L47 55N91 55R35 55R50)}, MRNUMBER = {95j:55006b}, MRREVIEWER = {Charles Weibel}, } @incollection {Adem(1995b), AUTHOR = {Adem, Alejandro}, TITLE = {Discrete groups, {G}rothendieck rings and families of finite subgroups}, BOOKTITLE = {Homotopy theory and its applications (Cocoyoc, 1993)}, PAGES = {1--23}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1995}, MRCLASS = {19A22 (19A31 20C07 55R40)}, MRNUMBER = {97e:19001}, MRREVIEWER = {Kenneth A. Brown}, } @article {Adem(1997), AUTHOR = {Adem, Alejandro}, TITLE = {Recent developments in the cohomology of finite groups}, JOURNAL = {Notices Amer. Math. Soc.}, FJOURNAL = {Notices of the American Mathematical Society}, VOLUME = {44}, YEAR = {1997}, NUMBER = {7}, PAGES = {806--812}, ISSN = {0002-9920}, CODEN = {AMNOAN}, MRCLASS = {20J06}, MRNUMBER = {98j:20077}, MRREVIEWER = {Ian J. Leary}, } @incollection {Adem(2004a), AUTHOR = {Adem, Alejandro}, TITLE = {Constructing and deconstructing group actions}, BOOKTITLE = {Homotopy theory: relations with algebraic geometry, group cohomology, and algebraic $K$-theory}, SERIES = {Contemp. Math.}, VOLUME = {346}, PAGES = {1--8}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2004}, MRCLASS = {57S25 (20J06)}, MRNUMBER = {2 066 494}, } @incollection {Adem(2007), AUTHOR = {Adem, Alejandro}, TITLE = {Lectures on the cohomology of finite groups}, BOOKTITLE = {Interactions between homotopy theory and algebra}, SERIES = {Contemp. Math.}, VOLUME = {436}, PAGES = {317--334}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2007}, MRCLASS = {20J06 (57S25)}, MRNUMBER = {MR2355780 (2008j:20160)}, MRREVIEWER = {Christopher P. Bendel}, } @article {Adem-Carlson(1990), AUTHOR = {Adem, Alejandro and Carlson, Jon F.}, TITLE = {Discrete groups with large exponents in cohomology}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {66}, YEAR = {1990}, NUMBER = {2}, PAGES = {111--120}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20J05 (57M07)}, MRNUMBER = {92b:20060}, MRREVIEWER = {Jeanne Duflot}, } @proceedings {Adem-Carlsson-Cohen(2001), TITLE = {Topology, geometry, and algebra: interactions and new directions}, SERIES = {Contemporary Mathematics}, VOLUME = {279}, BOOKTITLE = {Proceedings of the conference held in honor of R. James Milgram at Stanford University, Stanford, CA, August 17--21, 1999}, EDITOR = {Adem, Alejandro and Carlsson, Gunnar and Cohen, Ralph}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {2001}, PAGES = {viii+255}, ISBN = {0-8218-2063-X}, MRCLASS = {57-06 (00B30 55-06)}, MRNUMBER = {2002c:57001}, } @article {Adem-Cohen-Cohen(2003), AUTHOR = {Adem, A. and Cohen, D. and Cohen, F. R.}, TITLE = {On representations and {$K$}-theory of the braid groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {326}, YEAR = {2003}, NUMBER = {3}, PAGES = {515--542}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {20F36 (55N15 55R50 57R20)}, MRNUMBER = {2004k:20075}, MRREVIEWER = {Alexander I. Suciu}, } @incollection {Adem-Davis(2002), AUTHOR = {Adem, Alejandro and Davis, James F.}, TITLE = {Topics in transformation groups}, BOOKTITLE = {Handbook of geometric topology}, PAGES = {1--54}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {2002}, MRCLASS = {57Sxx (55M35)}, MRNUMBER = {1 886 667}, MRREVIEWER = {Ian Hambleton}, } @article {Adem-Frederick(2007), AUTHOR = {Adem, Alejandro and Cohen, Frederick R.}, TITLE = {Commuting elements and spaces of homomorphisms}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {338}, YEAR = {2007}, NUMBER = {3}, PAGES = {587--626}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {55R40 (57S05)}, MRNUMBER = {MR2317932 (2008h:55028)}, MRREVIEWER = {Ian Hambleton}, DOI = {10.1007/s00208-007-0089-z}, URL = {http://dx.doi.org/10.1007/s00208-007-0089-z}, } @article {Adem-Ge-Pan-Petrosyan(2008), AUTHOR = {Adem, Alejandro and Ge, Jianquan and Pan, Jianzhong and Petrosyan, Nansen}, TITLE = {Compatible actions and cohomology of crystallographic groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {320}, YEAR = {2008}, NUMBER = {1}, PAGES = {341--353}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20J06 (20H15 55T10)}, MRNUMBER = {MR2417992 (2009k:20115)}, MRREVIEWER = {Juan Pablo Rossetti}, DOI = {10.1016/j.jalgebra.2008.02.012}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2008.02.012}, } @article {Adem-Hambleton(2023), AUTHOR = {Adem, Alejandro and Hambleton, Ian}, TITLE = {Minimal {E}uler characteristics for even-dimensional manifolds with finite fundamental group}, JOURNAL = {Forum Math. Sigma}, FJOURNAL = {Forum of Mathematics. Sigma}, VOLUME = {11}, YEAR = {2023}, PAGES = {Paper No. e24, 23}, ISSN = {2050-5094}, MRCLASS = {57S17 (20J06)}, MRNUMBER = {4568832}, DOI = {10.1017/fms.2023.18}, URL = {https://doi.org/10.1017/fms.2023.18}, } @book {Adem-Leida-Ruan(2007), AUTHOR = {Adem, Alejandro and Leida, Johann and Ruan, Yongbin}, TITLE = {Orbifolds and stringy topology}, SERIES = {Cambridge Tracts in Mathematics}, VOLUME = {171}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {2007}, PAGES = {xii+149}, ISBN = {978-0-521-87004-7; 0-521-87004-6}, MRCLASS = {57R19 (19L64 55N35)}, MRNUMBER = {MR2359514 (2009a:57044)}, MRREVIEWER = {Yunfeng Jiang}, DOI = {10.1017/CBO9780511543081}, URL = {http://dx.doi.org/10.1017/CBO9780511543081}, } @book {Adem-Milgram(1994), AUTHOR = {Adem, Alejandro and Milgram, R. James}, TITLE = {Cohomology of finite groups}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1994}, PAGES = {viii+327}, ISBN = {3-540-57025-X}, MRCLASS = {20J06 (20-01 55P20)}, MRNUMBER = {96f:20082}, MRREVIEWER = {David Benson}, } @article {Adem-Milgram(1995), AUTHOR = {Adem, Alejandro and Milgram, R. James}, TITLE = {The cohomology of the {M}athieu group ${M}\sb {22}$}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {34}, YEAR = {1995}, NUMBER = {2}, PAGES = {389--410}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {20J06 (20D08)}, MRNUMBER = {96c:20099}, MRREVIEWER = {Peter Fleischmann}, } @book {Adem-Milgram(2004), AUTHOR = {Adem, Alejandro and Milgram, R. James}, TITLE = {Cohomology of finite groups}, SERIES = {Grundlehren der Mathematischen Wissenschaften [Fundamental Principles of Mathematical Sciences]}, VOLUME = {309}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2004}, PAGES = {viii+324}, ISBN = {3-540-20283-8}, MRCLASS = {20J06 (18G99 55R35 55R40)}, MRNUMBER = {2004k:20109}, } @proceedings {Adem-Morava-Ruan(2002), TITLE = {Orbifolds in mathematics and physics}, SERIES = {Contemporary Mathematics}, VOLUME = {310}, BOOKTITLE = {Proceedings of the Conference on Mathematical Aspects of Orbifold String Theory held at the University of Wisconsin, Madison, WI, May 4--8, 2001}, EDITOR = {Adem, Alejandro and Morava, Jack and Ruan, Yongbin}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {2002}, PAGES = {viii+358}, ISBN = {0-8218-2990-4}, MRCLASS = {00B25 (14-06)}, MRNUMBER = {1 950 939}, } @proceedings {Adem-Morava-Ruan(2003), TITLE = {Orbifolds in mathematics and physics}, SERIES = {Contemporary Mathematics}, VOLUME = {310}, BOOKTITLE = {Proceedings of the Conference on Mathematical Aspects of Orbifold String Theory held at the University of Wisconsin, Madison, WI, May 4--8, 2001}, EDITOR = {Adem, Alejandro and Morava, Jack and Ruan, Yongbin}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {2002}, PAGES = {viii+358}, ISBN = {0-8218-2990-4}, MRCLASS = {00B25 (14-06)}, MRNUMBER = {2003g:00020}, } @article{Adem-Pan(2006), AUTHOR = {Adem, Alejandro and Pan, Jianzhong}, TITLE = {Toroidal orbifolds, {G}erbes and group cohomology}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {358}, YEAR = {2006}, NUMBER = {9}, PAGES = {3969--3983 (electronic)}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {20J06}, MRNUMBER = {2219005 (2007e:20108)}, MRREVIEWER = {Brita E. A. Nucinkis}, DOI = {10.1090/S0002-9947-06-04017-7}, URL = {http://dx.doi.org/10.1090/S0002-9947-06-04017-7}, } @article {Adem-Ruan(2003), AUTHOR = {Adem, Alejandro and Ruan, Yongbin}, TITLE = {Twisted orbifold {$K$}-theory}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {237}, YEAR = {2003}, NUMBER = {3}, PAGES = {533--556}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {19L47 (55N15 55R65 57R20)}, MRNUMBER = {2004e:19004}, MRREVIEWER = {Gabriele Vezzosi}, } @article {Adem-Smith(2000), AUTHOR = {Adem, Alejandro and Smith, Jeff H.}, TITLE = {On spaces with periodic cohomology}, JOURNAL = {Electron. Res. Announc. Amer. Math. Soc.}, FJOURNAL = {Electronic Research Announcements of the American Mathematical Society}, VOLUME = {6}, YEAR = {2000}, PAGES = {1--6 (electronic)}, ISSN = {1079-6762}, MRCLASS = {57S30 (20J06)}, MRNUMBER = {2001d:57043}, MRREVIEWER = {C. B. Thomas}, } @article {Adem-Smith(2001), AUTHOR = {Adem, Alejandro and Smith, Jeff H.}, TITLE = {Periodic complexes and group actions}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {154}, YEAR = {2001}, NUMBER = {2}, PAGES = {407--435}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57Q91 (55S40 57Q05 57S30)}, MRNUMBER = {2002i:57031}, MRREVIEWER = {Stratos Prassidis}, } @book {Aebischer-Borer-Kaelin-Leuenberger-Reimann(1994), AUTHOR = {Aebischer, B. and Borer, M. and K{\"a}lin, M. and Leuenberger, Ch. and Reimann, H. M.}, TITLE = {Symplectic geometry}, NOTE = {An introduction based on the seminar in Bern, 1992}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1994}, PAGES = {xii+239}, ISBN = {3-7643-5064-4}, MRCLASS = {58F05 (53C15 58E05)}, MRNUMBER = {96a:58082}, MRREVIEWER = {Hansj{\"o}rg Geiges}, } @article {Agol(2013), AUTHOR = {Agol, Ian}, TITLE = {The virtual {H}aken conjecture}, NOTE = {With an appendix by Agol, Groves, and Manning}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, VOLUME = {18}, YEAR = {2013}, PAGES = {1045--1087}, ISSN = {1431-0635}, MRCLASS = {20F67 (57Mxx)}, MRNUMBER = {3104553}, } @incollection {Agol(2011), AUTHOR = {Agol, Ian}, TITLE = {Ideal triangulations of pseudo-{A}nosov mapping tori}, BOOKTITLE = {Topology and geometry in dimension three}, SERIES = {Contemp. Math.}, VOLUME = {560}, PAGES = {1--17}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2011}, MRCLASS = {57M50 (37E30)}, MRNUMBER = {2866919 (2012m:57026)}, MRREVIEWER = {Jack O. Button}, DOI = {10.1090/conm/560/11087}, URL = {http://dx.doi.org/10.1090/conm/560/11087}, } @article {Agol(2010bounds), AUTHOR = {Agol, Ian}, TITLE = {Bounds on exceptional {D}ehn filling {II}}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {14}, YEAR = {2010}, NUMBER = {4}, PAGES = {1921--1940}, ISSN = {1465-3060}, MRCLASS = {57M50 (30F40)}, MRNUMBER = {2680207 (2011j:57024)}, MRREVIEWER = {James W. Anderson}, DOI = {10.2140/gt.2010.14.1921}, URL = {http://dx.doi.org/10.2140/gt.2010.14.1921}, } @article {Agol(2010minimal), AUTHOR = {Agol, Ian}, TITLE = {The minimal volume orientable hyperbolic 2-cusped 3-manifolds}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {138}, YEAR = {2010}, NUMBER = {10}, PAGES = {3723--3732}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57M50}, MRNUMBER = {2661571 (2011k:57023)}, DOI = {10.1090/S0002-9939-10-10364-5}, URL = {http://dx.doi.org/10.1090/S0002-9939-10-10364-5}, } @article {Agol(2009), AUTHOR = {Agol, Ian}, TITLE = {Pants immersed in hyperbolic 3-manifolds}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {241}, YEAR = {2009}, NUMBER = {2}, PAGES = {201--214}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {57M50 (30F40)}, MRNUMBER = {2507574 (2010k:57034)}, DOI = {10.2140/pjm.2009.241.201}, URL = {http://dx.doi.org/10.2140/pjm.2009.241.201}, } @article {Agol(2008), AUTHOR = {Agol, Ian}, TITLE = {Criteria for virtual fibering}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {1}, YEAR = {2008}, NUMBER = {2}, PAGES = {269--284}, ISSN = {1753-8416}, MRCLASS = {57M50 (57N10)}, MRNUMBER = {MR2399130 (2009b:57033)}, MRREVIEWER = {Darren D. Long}, } @article {Agol-Culler-Shalen(2010), AUTHOR = {Agol, Ian and Culler, Marc and Shalen, Peter B.}, TITLE = {Singular surfaces, mod 2 homology, and hyperbolic volume. {I}}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {362}, YEAR = {2010}, NUMBER = {7}, PAGES = {3463--3498}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57M50}, MRNUMBER = {2601597 (2011h:57017)}, MRREVIEWER = {Mario Eudave Mu{\~n}oz}, DOI = {10.1090/S0002-9947-10-04362-X}, URL = {http://dx.doi.org/10.1090/S0002-9947-10-04362-X}, } @article {Agol-Groves-Manning(2009), AUTHOR = {Agol, Ian and Groves, Daniel and Manning, Jason Fox}, TITLE = {Residual finiteness, {QCERF} and fillings of hyperbolic groups}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {13}, YEAR = {2009}, NUMBER = {2}, PAGES = {1043--1073}, ISSN = {1465-3060}, MRCLASS = {20E26 (20F67 57M07)}, MRNUMBER = {2470970 (2010f:20032)}, MRREVIEWER = {Zoran {\v{S}}uni{\'c}}, DOI = {10.2140/gt.2009.13.1043}, URL = {http://dx.doi.org/10.2140/gt.2009.13.1043}, } @article {Agol-Liu(2012), AUTHOR = {Agol, Ian and Liu, Yi}, TITLE = {Presentation length and {S}imon's conjecture}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {25}, YEAR = {2012}, NUMBER = {1}, PAGES = {151--187}, ISSN = {0894-0347}, MRCLASS = {57M25 (57N10)}, MRNUMBER = {2833481}, MRREVIEWER = {Bruno P. Zimmermann}, DOI = {10.1090/S0894-0347-2011-00711-X}, URL = {http://dx.doi.org/10.1090/S0894-0347-2011-00711-X}, } @book {Agricola-Friedrich(2001), AUTHOR = {Agricola, Ilka and Friedrich, Thomas}, TITLE = {Globale {A}nalysis}, NOTE = {Differentialformen in Analysis, Geometrie und Physik. [Differential forms in analysis, geometry and physics]}, PUBLISHER = {Friedr. Vieweg \& Sohn}, ADDRESS = {Braunschweig}, YEAR = {2001}, PAGES = {x+283}, ISBN = {3-528-03154-9}, MRCLASS = {58-01}, MRNUMBER = {1 823 409}, } @article {Aguade-Broto-Notbohm(1994), AUTHOR = {Aguad{\'e}, J. and Broto, C. and Notbohm, D.}, TITLE = {Homotopy classification of spaces with interesting cohomology and a conjecture of {C}ooke. {I}}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {33}, YEAR = {1994}, NUMBER = {3}, PAGES = {455--492}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P15 (55S10)}, MRNUMBER = {95i:55006}, MRREVIEWER = {Haynes R. Miller}, } @article {Aguade-Broto-Notbohm(1997), AUTHOR = {Aguad{\'e}, J. and Broto, C. and Notbohm, D.}, TITLE = {A mod two analogue of a conjecture of {C}ooke}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {The Journal of the London Mathematical Society. Second Series}, VOLUME = {55}, YEAR = {1997}, NUMBER = {1}, PAGES = {23--36}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {55P15 (55S10)}, MRNUMBER = {98b:55008}, MRREVIEWER = {J. P. C. Greenlees}, } @book {Ahlfors-Sario(1960), AUTHOR = {Ahlfors, Lars V. and Sario, Leo}, TITLE = {Riemann surfaces}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1960}, PAGES = {xi+382}, MRCLASS = {30.00}, MRNUMBER = {22 \#5729}, MRREVIEWER = {M. H. Heins}, } @article {Ai-Ni(2009), AUTHOR = {Ai, Yinghua and Ni, Yi}, TITLE = {Two applications of twisted {F}loer homology}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2009}, VOLUME = {19}, PAGES = {3726--3746}, ISSN = {1073-7928}, MRCLASS = {57R58 (57R15)}, MRNUMBER = {2539188 (2010m:57044)}, MRREVIEWER = {Stanislav Jabuka}, DOI = {10.1093/imrn/rnp070}, URL = {http://dx.doi.org/10.1093/imrn/rnp070}, } @book {Aigner(1979), AUTHOR = {Aigner, Martin}, TITLE = {Combinatorial theory}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1979}, PAGES = {viii+483}, ISBN = {0-387-90376-3}, MRCLASS = {05-02 (06-01)}, MRNUMBER = {80h:05002}, MRREVIEWER = {R. A. Brualdi}, } @book {Aigner(1997), AUTHOR = {Aigner, Martin}, TITLE = {Combinatorial theory}, SERIES = {Classics in Mathematics}, NOTE = {Reprint of the 1979 original}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1997}, PAGES = {viii+483}, ISBN = {3-540-61787-6}, MRCLASS = {05-01 (06-01)}, MRNUMBER = {1434477}, DOI = {10.1007/978-3-642-59101-3}, URL = {http://dx.doi.org/10.1007/978-3-642-59101-3}, } @book {Aigner-Ziegler(2014), AUTHOR = {Aigner, Martin and Ziegler, G{\"u}nter M.}, TITLE = {Proofs from {T}he {B}ook}, EDITION = {Fifth}, NOTE = {Including illustrations by Karl H. Hofmann}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2014}, PAGES = {viii+308}, ISBN = {978-3-662-44204-3; 978-3-662-44205-0}, MRCLASS = {00A05}, MRNUMBER = {3288091}, DOI = {10.1007/978-3-662-44205-0}, URL = {http://dx.doi.org/10.1007/978-3-662-44205-0}, } @article {Akin-Buchsbaum-Weyman(1982), AUTHOR = {Akin, Kaan and Buchsbaum, David A. and Weyman, Jerzy}, TITLE = {Schur functors and {S}chur complexes}, JOURNAL = {Adv. in Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {44}, YEAR = {1982}, NUMBER = {3}, PAGES = {207--278}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {20C30 (15A72 15A75 15A78)}, MRNUMBER = {658729 (84c:20021)}, MRREVIEWER = {A. Kh. Kushkule{\u\i}}, DOI = {10.1016/0001-8708(82)90039-1}, URL = {http://dx.doi.org/10.1016/0001-8708(82)90039-1}, } @article {Akbulut-King(1981), AUTHOR = {Akbulut, Selman and King, Henry C.}, TITLE = {The topology of real algebraic sets with isolated singularities}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {113}, YEAR = {1981}, NUMBER = {3}, PAGES = {425--446}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {58A07 (14G30 57R99)}, MRNUMBER = {83b:58003}, MRREVIEWER = {K. Lamotke}, } @article {Akbulut-King(1992), AUTHOR = {Akbulut, Selman and King, Henry C.}, TITLE = {On approximating submanifolds by algebraic sets and a solution to the {N}ash conjecture}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {107}, YEAR = {1992}, NUMBER = {1}, PAGES = {87--98}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57R19 (14P05)}, MRNUMBER = {93d:57051}, MRREVIEWER = {A. Tognoli}, } @book {Akbulut-McCarthy(1990), AUTHOR = {Akbulut, Selman and McCarthy, John D.}, TITLE = {Casson's invariant for oriented homology $3$-spheres}, NOTE = {An exposition}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {1990}, PAGES = {xviii+182}, ISBN = {0-691-08563-3}, MRCLASS = {57N10 (57M25)}, MRNUMBER = {90k:57017}, MRREVIEWER = {Paul A. Kirk}, } @book {Akhiezer(1995), AUTHOR = {Akhiezer, Dmitri N.}, TITLE = {Lie group actions in complex analysis}, PUBLISHER = {Friedr. Vieweg \& Sohn}, ADDRESS = {Braunschweig}, YEAR = {1995}, PAGES = {viii+201}, ISBN = {3-528-06420-X}, MRCLASS = {32M05 (22-02 22E10 32M10)}, MRNUMBER = {96g:32051}, MRREVIEWER = {B. Gilligan}, } @article {Aleksandrov(1957), AUTHOR = {Aleksandrov, A. D.}, TITLE = {\"{U}ber eine {V}erallgemeinerung der {R}iemannschen {G}eometrie}, JOURNAL = {Schr. Forschungsinst. Math.}, VOLUME = {1}, YEAR = {1957}, PAGES = {33--84}, MRCLASS = {50.0X}, MRNUMBER = {19,304h}, MRREVIEWER = {H. Busemann}, } @book {Aleksandrov-Zahlgaller(1967), AUTHOR = {Aleksandrov, A. D. and Zalgaller, V. A.}, TITLE = {Intrinsic geometry of surfaces}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, R.I.}, YEAR = {1967}, PAGES = {vi+327}, MRCLASS = {53.75}, MRNUMBER = {35 \#7267}, } @Article {Alexander(1923), author = {Alexander, J.W.}, title = {On the deformation of an $n$-cell}, journal = {Proc. Nat. Acad. Sci. USA}, volume = 9, pages = {406--407}, year = 1923, } @article {Alexander(1928), AUTHOR = {Alexander, James Waddell}, TITLE = {Topological invariants of knots and links}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {30}, YEAR = {1928}, NUMBER = {2}, PAGES = {275--306}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57M25}, MRNUMBER = {1 501 429}, } @book {Alexander-Conner-Hamrick(1977), AUTHOR = {Alexander, J. P. and Conner, P. E. and Hamrick, G. C.}, TITLE = {Odd order group actions and {W}itt classification of innerproducts}, NOTE = {Lecture Notes in Mathematics, Vol. 625}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1977}, PAGES = {i+202}, ISBN = {3-540-08528-9}, MRCLASS = {57E30 (10C05 15A63)}, MRNUMBER = {58 \#18509}, MRREVIEWER = {J. P. Levine}, } @article {Alexander-Hamrick(1967), AUTHOR = {Alexander, J. P. and Hamrick, G. C. and Vick, J. W.}, TITLE = {Linking forms and maps of odd prime order}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {221}, YEAR = {1976}, NUMBER = {1}, PAGES = {169--185}, ISSN = {0002-9947}, MRCLASS = {57E15 (57D85)}, MRNUMBER = {0402786}, MRREVIEWER = {R. E. Stong}, DOI = {10.2307/1997547}, URL = {https://doi-org.ezp.lib.unimelb.edu.au/10.2307/1997547}, } @article {Alexander-Hamrick(1974), AUTHOR = {Alexander, J. P. and Hamrick, G. C. and Vick, J. W.}, TITLE = {Involutions on homotopy spheres}, JOURNAL = {Invent. Math.}, VOLUME = {24}, YEAR = {1974}, PAGES = {35--50}, MRCLASS = {57D85 (55C35 57D60)}, MRNUMBER = {49 \#9857}, MRREVIEWER = {R. K. Lashof}, } @article {Alexander-Loeh(2020), AUTHOR = {Engel, Alexander and L\"{o}h, Clara}, TITLE = {Polynomially weighted {$\ell^p$}-completions and group homology}, JOURNAL = {J. Comb. Algebra}, FJOURNAL = {Journal of Combinatorial Algebra}, VOLUME = {4}, YEAR = {2020}, NUMBER = {1}, PAGES = {87--109}, ISSN = {2415-6302}, MRCLASS = {20J05 (20F65)}, MRNUMBER = {4073892}, DOI = {10.4171/jca/40}, URL = {https://doi.org/10.4171/jca/40}, } @article {Alexandrino(2006), AUTHOR = {Alexandrino, Marcos M.}, TITLE = {Proofs of conjectures about singular {R}iemannian foliations}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {119}, YEAR = {2006}, PAGES = {219--234}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {53C12 (57R30)}, MRNUMBER = {MR2247659 (2007g:53026)}, MRREVIEWER = {Anna M. Fino}, } @Unpublished{Alexandrino-Toeben(2007), author = {Kerin, Martin}, title = {Equifocality of a singular riemannian foliation}, note = {preprint, arXiv:0704.3251v2}, year = 2007, } @article {Alexandru-Rugina(1996), AUTHOR = {Alexandru-Rugin{\u{a}}, Dragomirna}, TITLE = {Harmonic forms and ${L}\sb p$-cohomology}, JOURNAL = {Tensor (N.S.)}, FJOURNAL = {The Tensor Society. Tensor. New Series}, VOLUME = {57}, YEAR = {1996}, NUMBER = {2}, PAGES = {176--191}, ISSN = {0040-3504}, CODEN = {TNSRAZ}, MRCLASS = {58A14 (58G20)}, MRNUMBER = {98d:58004}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @article {Alibegovic+Bestvina(2006), AUTHOR = {Alibegovi{\'c}, Emina and Bestvina, Mladen}, TITLE = {Limit groups are {$\rm CAT(0)$}}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {74}, YEAR = {2006}, NUMBER = {1}, PAGES = {259--272}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {57M07 (20F65)}, MRNUMBER = {MR2254564 (2007m:57004)}, MRREVIEWER = {Vincent Guirardel}, } @article {Allcock+Gersten(1999), AUTHOR = {Allcock, D. J. and Gersten, S. M.}, TITLE = {A homological characterization of hyperbolic groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {135}, YEAR = {1999}, NUMBER = {3}, PAGES = {723--742}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20F32 (20F05 57M07)}, MRNUMBER = {MR1669272 (99m:20078)}, MRREVIEWER = {Igor Belegradek}, } @article {Allday(1978), AUTHOR = {Allday, Christopher}, TITLE = {On the rational homotopy of fixed point sets of torus actions}, JOURNAL = {Topology}, VOLUME = {17}, YEAR = {1978}, NUMBER = {1}, PAGES = {95--100}, MRCLASS = {57E15 (55D15)}, MRNUMBER = {58 \#18501}, MRREVIEWER = {Jean-Michel Lemaire}, } @article {Allday-Hanke-Puppre(2003), AUTHOR = {Allday, Christopher and Hanke, Bernhard and Puppe, Volker}, TITLE = {Poincar\'e duality in {P}. {A}. {S}mith theory}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {131}, YEAR = {2003}, NUMBER = {10}, PAGES = {3275--3283 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57P10 (55N10 55N91 57S10)}, MRNUMBER = {1992869 (2004i:57029)}, MRREVIEWER = {Ian Hambleton}, DOI = {10.1090/S0002-9939-03-06856-4}, URL = {http://dx.doi.org/10.1090/S0002-9939-03-06856-4}, } @book {Allday-Puppe(1993), AUTHOR = {Allday, C. and Puppe, V.}, TITLE = {Cohomological methods in transformation groups}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1993}, PAGES = {xii+470}, ISBN = {0-521-35022-0}, MRCLASS = {55N91 (55-02 57-02 57S10)}, MRNUMBER = {94g:55009}, MRREVIEWER = {Allan Edmonds}, } @article {Allaud(1966), AUTHOR = {Allaud, Guy}, TITLE = {On the classification of fiber spaces}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {92}, YEAR = {1966}, PAGES = {110--125}, ISSN = {0025-5874}, MRCLASS = {55.50}, MRNUMBER = {189035}, MRREVIEWER = {J. Stasheff}, DOI = {10.1007/BF01312430}, URL = {https://doi.org/10.1007/BF01312430}, } @article {Almkvist(1973), AUTHOR = {Almkvist, Gert}, TITLE = {Endomorphisms of finitely generated projective modules over a commutative ring}, JOURNAL = {Ark. Mat.}, VOLUME = {11}, YEAR = {1973}, PAGES = {263--301}, MRCLASS = {13C10 (13D15)}, MRNUMBER = {54 \#12744}, MRREVIEWER = {Samuel H. Cox, Jr.}, } @article {Almkvist(1974), AUTHOR = {Almkvist, Gert}, TITLE = {The {G}rothendieck ring of the category of endomorphisms}, JOURNAL = {J. Algebra}, VOLUME = {28}, YEAR = {1974}, PAGES = {375--388}, MRCLASS = {18F30 (13C99)}, MRNUMBER = {55 \#5721}, MRREVIEWER = {C. Small}, } @article {Almkvist(1978), AUTHOR = {Almkvist, Gert}, TITLE = {${K}$-theory of endomorphisms}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {55}, YEAR = {1978}, NUMBER = {2}, PAGES = {308--340}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {18F25 (18E99 18F30)}, MRNUMBER = {80i:18018}, MRREVIEWER = {Jean-Louis Loday}, } @incollection {Alonsoetal(1991), AUTHOR = {Alonso, J. M. and et al.}, TITLE = {Notes on word hyperbolic groups}, BOOKTITLE = {Group theory from a geometrical viewpoint (Trieste, 1990)}, PAGES = {3--63}, NOTE = {Edited by H. Short}, PUBLISHER = {World Sci. Publishing}, ADDRESS = {River Edge, NJ}, YEAR = {1991}, MRCLASS = {57M07 (20F38)}, MRNUMBER = {93g:57001}, } @article {Alonso(1994), AUTHOR = {Alonso, Juan M.}, TITLE = {Finiteness conditions on groups and quasi-isometries}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {95}, YEAR = {1994}, NUMBER = {2}, PAGES = {121--129}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20J99 (20F32)}, MRNUMBER = {MR1293049 (95f:20083)}, MRREVIEWER = {Thomas Brady}, } @article {Alperin-Dennis(1979), AUTHOR = {Alperin, R. C. and Dennis, R. Keith}, TITLE = {{$K_{2}$} of quaternion algebras}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {56}, YEAR = {1979}, NUMBER = {1}, PAGES = {262--273}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16A39 (12A57 12A80)}, MRNUMBER = {MR527169 (80h:16020)}, MRREVIEWER = {Alan Candiotti}, DOI = {10.1016/0021-8693(79)90337-5}, URL = {http://dx.doi.org/10.1016/0021-8693(79)90337-5}, } @article {Alperin-Dennis-Oliver(1987), AUTHOR = {Alperin, Roger C. and Dennis, R. Keith and Oliver, R. and Stein, Michael R.}, TITLE = {{$SK_1$} of finite abelian groups. {II}}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {87}, YEAR = {1987}, NUMBER = {2}, PAGES = {253--302}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {18F25 (11R33 19B28 19M05)}, MRNUMBER = {MR870729 (88g:18010)}, MRREVIEWER = {Bruce A. Magurn}, DOI = {10.1007/BF01389416}, URL = {http://dx.doi.org/10.1007/BF01389416}, } @article {Alperin-Dennis-Stein(1985), AUTHOR = {Alperin, Roger C. and Dennis, R. Keith and Stein, Michael R.}, TITLE = {{$SK_1$} of finite abelian groups. {I}}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {82}, YEAR = {1985}, NUMBER = {1}, PAGES = {1--18}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {18F25 (19B28 20C10)}, MRNUMBER = {MR808105 (87c:18008)}, MRREVIEWER = {K. Vogtmann}, DOI = {10.1007/BF01394775}, URL = {http://dx.doi.org/10.1007/BF01394775}, } @inproceedings {Alperin-Dennis-Stein(1972), AUTHOR = {Alperin, Roger C. and Dennis, R. Keith and Stein, Michael R.}, TITLE = {The non-triviality of {$SK_{1}(Z\pi )$}}, BOOKTITLE = {Proceedings of the {C}onference on {O}rders, {G}roup {R}ings and {R}elated {T}opics ({O}hio {S}tate {U}niv., {C}olumbus, {O}hio, 1972)}, PAGES = {1--7. Lecture Notes in Math., Vol. 353}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1973}, MRCLASS = {18F25}, MRNUMBER = {MR0332929 (48 \#11254)}, MRREVIEWER = {T.-Y. Lam}, } @article {Altmann-Hille(1999), AUTHOR = {Altmann, Klaus and Hille, Lutz}, TITLE = {Strong exceptional sequences provided by quivers}, JOURNAL = {Algebr. Represent. Theory}, FJOURNAL = {Algebras and Representation Theory}, VOLUME = {2}, YEAR = {1999}, NUMBER = {1}, PAGES = {1--17}, ISSN = {1386-923X}, CODEN = {ARTHF4}, MRCLASS = {16G20 (14M25 52B20)}, MRNUMBER = {MR1688469 (2000h:16019)}, MRREVIEWER = {Christof Gei{\ss}}, } @article {AlvarezKordyukov(2001), AUTHOR = {{\'A}lvarez L{\'o}pez, Jes{\'u}s A. and Kordyukov, Yuri A.}, TITLE = {Long time behavior of leafwise heat flow for {R}iemannian foliations}, JOURNAL = {Compositio Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {125}, YEAR = {2001}, NUMBER = {2}, PAGES = {129--153}, ISSN = {0010-437X}, CODEN = {CMPMAF}, MRCLASS = {58J35 (53C12 58J10)}, MRNUMBER = {MR1815391 (2002a:58023)}, MRREVIEWER = {Patrick T. McDonald}, } @incollection {AlvarezKordyukov(2002), AUTHOR = {{\'A}lvarez L{\'o}pez, Jes{\'u}s A. and Kordyukov, Yuri A.}, TITLE = {Distributional {B}etti numbers of transitive foliations of codimension one}, BOOKTITLE = {Foliations: geometry and dynamics ({W}arsaw, 2000)}, PAGES = {159--183}, PUBLISHER = {World Sci. Publ., River Edge, NJ}, YEAR = {2002}, MRCLASS = {58J22 (57R30 58J42)}, MRNUMBER = {MR1882768 (2003j:58032)}, } @article {Alves-Ontaneda(2006), AUTHOR = {Alves, A. and Ontaneda, P.}, TITLE = {A formula for the {W}hitehead group of a three-dimensional crystallographic group}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {45}, YEAR = {2006}, NUMBER = {1}, PAGES = {1--25}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {19J10 (19B28 19D35)}, MRNUMBER = {MR2170492 (2006h:19006)}, MRREVIEWER = {Charles Weibel}, } @article {Ammann-Baer(1999a), AUTHOR = {Ammann, Bernd and B{\"a}r, Christian}, TITLE = {Dirac eigenvalues and total scalar curvature}, JOURNAL = {J. Geom. Phys.}, FJOURNAL = {Journal of Geometry and Physics}, VOLUME = {33}, YEAR = {2000}, NUMBER = {3-4}, PAGES = {229--234}, ISSN = {0393-0440}, CODEN = {JGPHE5}, MRCLASS = {58J50 (53C27)}, MRNUMBER = {2001d:58031}, MRREVIEWER = {Jean-Louis Milhorat}, } @book {Amoros-Burger-Corlette-Kotschick-Toledo(1996), AUTHOR = {Amor{\'o}s, J. and Burger, M. and Corlette, K. and Kotschick, D. and Toledo, D.}, TITLE = {Fundamental groups of compact {K}\"ahler manifolds}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {1996}, PAGES = {xii+140}, ISBN = {0-8218-0498-7}, MRCLASS = {32J27 (14F35 32C17 53C55)}, MRNUMBER = {97d:32037}, MRREVIEWER = {Raul Quiroga}, } @article {Amrani(2017), AUTHOR = {Amrani, Ilias}, TITLE = {A remark on the {F}arrell-{J}ones conjecture}, JOURNAL = {New York J. Math.}, FJOURNAL = {New York Journal of Mathematics}, VOLUME = {23}, YEAR = {2017}, PAGES = {1357--1362}, MRCLASS = {19D50 (18E30 18F25 55N20 55P20 55P47)}, MRNUMBER = {3723512}, MRREVIEWER = {Eugenia Ellis}, } @book {Anantharaman-Delaroche-Renault(2000), AUTHOR = {Anantharaman-Delaroche, C. and Renault, J.}, TITLE = {Amenable groupoids}, SERIES = {Monographies de L'Enseignement Math\'ematique}, VOLUME = {36}, NOTE = {With a foreword by Georges Skandalis and Appendix B by E. Germain}, PUBLISHER = {L'Enseignement Math\'ematique}, ADDRESS = {Geneva}, YEAR = {2000}, PAGES = {196}, ISBN = {2-940264-01-5}, MRCLASS = {22A22 (22D25 43A07 46L05 46L10 46L80)}, MRNUMBER = {2001m:22005}, MRREVIEWER = {Robert S. Doran}, } @incollection {Anantharaman-Renault(2001), AUTHOR = {Anantharaman, Claire and Renault, Jean}, TITLE = {Amenable groupoids}, BOOKTITLE = {Groupoids in analysis, geometry, and physics (Boulder, CO, 1999)}, SERIES = {Contemp. Math.}, VOLUME = {282}, PAGES = {35--46}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2001}, MRCLASS = {46L55 (22A22 22D25 58H05)}, MRNUMBER = {2002g:46110}, } @article {Ancel-Guilbault(1999), AUTHOR = {Ancel, Fredric D. and Guilbault, Craig R.}, TITLE = {{$\mathcal{Z}$}-compactifications of open manifolds}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {38}, YEAR = {1999}, NUMBER = {6}, PAGES = {1265--1280}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57N70 (57R80)}, MRNUMBER = {MR1690157 (2000i:57039)}, MRREVIEWER = {Alexander N. Dranishnikov}, DOI = {10.1016/S0040-9383(98)00053-6}, URL = {http://dx.doi.org/10.1016/S0040-9383(98)00053-6}, } @article {Anderson(1967), AUTHOR = {Anderson, R. D.}, TITLE = {On topological infinite deficiency}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {The Michigan Mathematical Journal}, VOLUME = {14}, YEAR = {1967}, PAGES = {365--383}, ISSN = {0026-2285}, MRCLASS = {54.60 (57.00)}, MRNUMBER = {0214041}, MRREVIEWER = {Ky Fan}, URL = {http://projecteuclid.org/euclid.mmj/1028999787}, } @article {Anderson(1972), AUTHOR = {Anderson, Douglas R.}, TITLE = {The {W}hitehead torsion of the total space of a fiber bundle}, JOURNAL = {Topology}, VOLUME = {11}, YEAR = {1972}, PAGES = {179--194}, MRCLASS = {55F10}, MRNUMBER = {45 \#4414}, MRREVIEWER = {R. K. Lashof}, } @article {Anderson(1973), AUTHOR = {Anderson, Douglas R.}, TITLE = {The obstruction to the finiteness of the total space of a flat bundle}, JOURNAL = {Amer. J. Math.}, VOLUME = {95}, YEAR = {1973}, PAGES = {281--293}, MRCLASS = {57C10}, MRNUMBER = {48 \#12546}, MRREVIEWER = {K. W. Kwun}, } @article {Anderson(1974), AUTHOR = {Anderson, Douglas R.}, TITLE = {The {W}hitehead torsion of a fiber-homotopy equivalence}, JOURNAL = {Michigan Math. J.}, VOLUME = {21}, YEAR = {1974}, PAGES = {171--180}, MRCLASS = {57C10}, MRNUMBER = {49 \#8025}, MRREVIEWER = {K. W. Kwun}, } @article {Anderson(1985), AUTHOR = {Anderson, Michael T.}, TITLE = {${L}\sp 2$ harmonic forms and a conjecture of {D}odziuk-{S}inger}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {13}, YEAR = {1985}, NUMBER = {2}, PAGES = {163--165}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {58G25 (53C20 58A14)}, MRNUMBER = {87a:58153}, } @incollection {Anderson(1988), AUTHOR = {Anderson, Michael T.}, TITLE = {${L}\sp 2$ harmonic forms on complete {R}iemannian manifolds}, BOOKTITLE = {Geometry and analysis on manifolds (Katata/Kyoto, 1987)}, PAGES = {1--19}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1988}, MRCLASS = {58A14 (53C21 58G25)}, MRNUMBER = {89j:58004}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @Article{Anderson-Bauer-Grodal-Pedersen(2004), author = {Andersen, Kasper K. S. and Bauer, Tilman and Grodal, Jesper and Pedersen, Erik Kj\ae{}r}, title = {A finite loop space not rationally equivalent to a compact {Lie} group}, journal = {Invent. Math.}, fjournal = {Inventiones Mathematicae}, volume = 157, year = 2004, pages = {1--10}, } @article {Anderson-Brown-Peterson(1966), AUTHOR = {Anderson, D. W. and Brown, Jr., E. H. and Peterson, F. P.}, TITLE = {${\rm {S}{U}}$-cobordism, ${\rm {K}{O}}$-characteristic numbers, and the {K}ervaire invariant}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {83}, YEAR = {1966}, PAGES = {54--67}, MRCLASS = {57.10}, MRNUMBER = {32 \#6470}, MRREVIEWER = {M. F. Atiyah}, } @article {Anderson-Brown-Peterson(1967), AUTHOR = {Anderson, D. W. and Brown, Jr., E. H. and Peterson, F. P.}, TITLE = {The structure of the {S}pin cobordism ring}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {86}, YEAR = {1967}, PAGES = {271--298}, MRCLASS = {57.10}, MRNUMBER = {36 \#2160}, MRREVIEWER = {P. S. Landweber}, } @article {Anderson-Connolly(1993), AUTHOR = {Anderson, Douglas R. and Connolly, Frank X.}, TITLE = {Finiteness obstructions and cocompact actions on ${S}\sp m\times {\mathbf{R}}\sp n$}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {68}, YEAR = {1993}, NUMBER = {1}, PAGES = {85--110}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57Q12 (19J35 57S30)}, MRNUMBER = {93k:57053}, MRREVIEWER = {A. A. Ranicki}, } @article {Anderson-Connolly-Ferry-Pedersen(1994), AUTHOR = {Anderson, Douglas R. and Connolly, Frank X. and Ferry, Steven C. and Pedersen, Erik K.}, TITLE = {Algebraic ${K}$-theory with continuous control at infinity}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {94}, YEAR = {1994}, NUMBER = {1}, PAGES = {25--47}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {19J99 (19D23 55N20)}, MRNUMBER = {95b:19003}, MRREVIEWER = {Charles Weibel}, } @article {Anderson-Connolly-Munkholm(1996), AUTHOR = {Anderson, Douglas R. and Connolly, Francis X. and Munkholm, Hans J.}, TITLE = {A comparison of continuously controlled and controlled ${K}$-theory}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {71}, YEAR = {1996}, NUMBER = {1}, PAGES = {9--46}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {57R67 (19D35 19D55)}, MRNUMBER = {97h:57054}, MRREVIEWER = {A. A. Ranicki}, } @book {Andersen-Dupont-Pedersen-Swann(1997), TITLE = {Geometry and physics}, EDITOR = {Andersen, J{\o}rgen Ellegaard and Dupont, Johan and Pedersen, Henrik and Swann, Andrew}, NOTE = {Papers from the Special Session held at the University of Aarhus, Aarhus, 1995}, PUBLISHER = {Marcel Dekker Inc.}, ADDRESS = {New York}, YEAR = {1997}, PAGES = {xiv+745}, ISBN = {0-8247-9791-4}, MRCLASS = {00B25 (57-06 58-06 81-06)}, MRNUMBER = {97i:00013}, } @article {Anderson-Hsiang(1977), AUTHOR = {Anderson, Douglas R. and Hsiang, Wu Chung}, TITLE = {The functors ${K}\sb{-i}$ and pseudo-isotopies of polyhedra}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {105}, YEAR = {1977}, NUMBER = {2}, PAGES = {201--223}, MRCLASS = {57D50 (57C25)}, MRNUMBER = {55 \#13447}, MRREVIEWER = {L. Guillou}, } @book {Anderson-Munkholm(1988), AUTHOR = {Anderson, Douglas R. and Munkholm, Hans J.}, TITLE = {Boundedly controlled topology}, NOTE = {Foundations of algebraic topology and simple homotopy theory}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1988}, PAGES = {xii+309}, ISBN = {3-540-19397-9}, MRCLASS = {57R80 (57Q10)}, MRNUMBER = {89h:57029}, MRREVIEWER = {Frank Quinn}, } @article {Anderson-Munkholm(1990), AUTHOR = {Anderson, Douglas R. and Munkholm, Hans J.}, TITLE = {Geometric modules and algebraic ${K}$-homology theory}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {3}, YEAR = {1990}, NUMBER = {6}, PAGES = {561--602}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {57R67 (18F25 19M05)}, MRNUMBER = {91g:57033}, MRREVIEWER = {A. A. Ranicki}, } @article {Anderson-Munkholm(1993), AUTHOR = {Anderson, Douglas R. and Munkholm, Hans J.}, TITLE = {Geometric modules and {Q}uinn homology theory}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {7}, YEAR = {1993}, NUMBER = {5}, PAGES = {443--475}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {55N20 (57R67)}, MRNUMBER = {95f:55003}, MRREVIEWER = {Roland Schw{\"a}nzl}, } @article {Anderson-Munkholm(1993a), AUTHOR = {Anderson, Douglas R. and Munkholm, Hans J.}, TITLE = {The bounded and thin {W}hitehead theorems}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {117}, YEAR = {1993}, NUMBER = {2}, PAGES = {551--560}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {19J10 (55P10)}, MRNUMBER = {93d:19007}, MRREVIEWER = {A. A. Ranicki}, } @article {Anderson-Pedersen(1983), AUTHOR = {Anderson, Douglas R. and Pedersen, Erik K.}, TITLE = {Semifree topological actions of finite groups on spheres}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {265}, YEAR = {1983}, NUMBER = {1}, PAGES = {23--44}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {57S25 (57R67)}, MRNUMBER = {85c:57046}, MRREVIEWER = {A. A. Ranicki}, } @article {Anderson-Davis(2000), AUTHOR = {Anderson, Laura and Davis, James F.}, TITLE = {Mod 2 cohomology of combinatorial {G}rassmannians}, JOURNAL = {Selecta Math. (N.S.)}, FJOURNAL = {Selecta Mathematica. New Series}, VOLUME = {8}, YEAR = {2002}, NUMBER = {2}, PAGES = {161--200}, ISSN = {1022-1824}, CODEN = {SMATF6}, MRCLASS = {55R25 (18F15 52C40 57R20 57R22)}, MRNUMBER = {MR1913295 (2003g:55023)}, MRREVIEWER = {Wolfgang K{\"u}hnel}, } @article {Ando-Blumberg-Gepner-Hopkins_Rezk(2014), AUTHOR = {Ando, Matthew and Blumberg, Andrew J. and Gepner, David and Hopkins, Michael J. and Rezk, Charles}, TITLE = {An {$\infty$}-categorical approach to {$R$}-line bundles, {$R$}-module {T}hom spectra, and twisted {$R$}-homology}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {7}, YEAR = {2014}, NUMBER = {3}, PAGES = {869--893}, ISSN = {1753-8416}, MRCLASS = {55Pxx}, MRNUMBER = {3252967}, DOI = {10.1112/jtopol/jtt035}, URL = {http://dx.doi.org/10.1112/jtopol/jtt035}, } @incollection {Ando-Blumberg-Gepner(2010), AUTHOR = {Ando, Matthew and Blumberg, Andrew J. and Gepner, David}, TITLE = {Twists of {$K$}-theory and {TMF}}, BOOKTITLE = {Superstrings, geometry, topology, and {$C^\ast$}-algebras}, SERIES = {Proc. Sympos. Pure Math.}, VOLUME = {81}, PAGES = {27--63}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2010}, MRCLASS = {55N34 (19L50 55N20 55P43)}, MRNUMBER = {2681757 (2011j:55011)}, MRREVIEWER = {Tyler D. Lawson}, DOI = {10.1090/pspum/081/2681757}, URL = {http://dx.doi.org/10.1090/pspum/081/2681757}, } @inproceedings{Andrzejewski(1986), AUTHOR = {Andrzejewski, Pawe{\l}}, TITLE = {The equivariant {W}all finiteness obstruction and {W}hitehead torsion}, BOOKTITLE = {Transformation groups, Pozna\'n 1985}, PAGES = {11--25}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1986}, MRCLASS = {57Q12 (18F25 19M05)}, MRNUMBER = {88c:57020}, MRREVIEWER = {Gunnar Carlsson}, } @incollection {Andrzejewski(1991), AUTHOR = {Andrzejewski, Pawe{\l}}, TITLE = {Equivariant finiteness obstruction and its geometric applications---a survey}, BOOKTITLE = {Algebraic topology {P}ozna\'n 1989}, SERIES = {Lecture Notes in Math.}, VOLUME = {1474}, PAGES = {20--37}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1991}, MRCLASS = {57Q12 (57Q91 57S15)}, MRNUMBER = {1133890 (93d:57041)}, MRREVIEWER = {S{\"o}ren Illman}, DOI = {10.1007/BFb0084735}, URL = {http://dx.doi.org/10.1007/BFb0084735}, } @article {Angelveit-Gerhardt-Hesselholt(2009), AUTHOR = {Angeltveit, Vigleik and Gerhardt, Teena and Hesselholt, Lars}, TITLE = {On the {$K$}-theory of truncated polynomial algebras over the integers}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {2}, YEAR = {2009}, NUMBER = {2}, PAGES = {277--294}, ISSN = {1753-8416}, MRCLASS = {19D55 (19D50 55Q91)}, MRNUMBER = {2529297 (2011d:19007)}, DOI = {10.1112/jtopol/jtp011}, URL = {http://dx.doi.org/10.1112/jtopol/jtp011}, } @article {Anghel(1990), AUTHOR = {Anghel, Nicolae}, TITLE = {${L}\sp 2$-index formulae for perturbed {D}irac operators}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {128}, YEAR = {1990}, NUMBER = {1}, PAGES = {77--97}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G12}, MRNUMBER = {91b:58243}, MRREVIEWER = {John Roe}, } @book {Anosov-Arnold(1988), TITLE = {Dynamical systems. {I}}, EDITOR = {Anosov, D. V. and Arnol{\cprime}d, Vladimir I.}, NOTE = {Ordinary differential equations and smooth dynamical systems, Translated from the Russian [MR 86i:58037]}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1988}, PAGES = {x+233}, ISBN = {3-540-17000-6}, MRCLASS = {58Fxx (34Cxx)}, MRNUMBER = {89g:58060}, } @article {Antieau-Gepner-Heller(2019), AUTHOR = {Antieau, Benjamin and Gepner, David and Heller, Jeremiah}, TITLE = {{$K$}-theoretic obstructions to bounded {$t$}-structures}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {216}, YEAR = {2019}, NUMBER = {1}, PAGES = {241--300}, ISSN = {0020-9910}, MRCLASS = {18E10 (16E45 16P40 18E30 19D35 55P43)}, MRNUMBER = {3935042}, DOI = {10.1007/s00222-018-00847-0}, URL = {https://doi.org/10.1007/s00222-018-00847-0}, } @article {Antolin-Coulon-Gandini(2018), AUTHOR = {Antol\'{i}n, Yago and Coulon, R\'{e}mi and Gandini, Giovanni}, TITLE = {Farrell--{J}ones via {D}ehn fillings}, JOURNAL = {J. Topol. Anal.}, FJOURNAL = {Journal of Topology and Analysis}, VOLUME = {10}, YEAR = {2018}, NUMBER = {4}, PAGES = {873--895}, ISSN = {1793-5253}, MRCLASS = {57M07 (19M05 20E22 20E26 20F67)}, MRNUMBER = {3881043}, DOI = {10.1142/S1793525318500292}, URL = {https://doi.org/10.1142/S1793525318500292}, } @article {Antolin-Flores(2023), AUTHOR = {Antol\'{\i}n, Yago and Flores, Ram\'{o}n}, TITLE = {Bredon homology of {A}rtin groups of dihedral type}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {227}, YEAR = {2023}, NUMBER = {11}, PAGES = {Paper No. 107376, 26}, ISSN = {0022-4049,1873-1376}, MRCLASS = {19E20 (19A31 19B28 20F36)}, MRNUMBER = {4580455}, DOI = {10.1016/j.jpaa.2023.107376}, URL = {https://doi.org/10.1016/j.jpaa.2023.107376}, } @article {Antonini-Azzali-Skandalis(2020), AUTHOR = {Antonini, Paolo and Azzali, Sara and Skandalis, Georges}, TITLE = {The {B}aum-{C}onnes conjecture localised at the unit element of a discrete group}, JOURNAL = {Compos. Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {156}, YEAR = {2020}, NUMBER = {12}, PAGES = {2536--2559}, ISSN = {0010-437X,1570-5846}, MRCLASS = {19K35 (46L80 58J22)}, MRNUMBER = {4202454}, MRREVIEWER = {Sayan\ Chakraborty}, DOI = {10.1112/s0010437x20007502}, URL = {https://doi.org/10.1112/s0010437x20007502}, } @incollection {Gomez-Aparicio-Julg-Valette(2019), AUTHOR = {Gomez Aparicio, Maria Paula and Julg, Pierre and Valette, Alain}, TITLE = {The {B}aum-{C}onnes conjecture: an extended survey}, BOOKTITLE = {Advances in noncommutative geometry---on the occasion of {A}lain {C}onnes' 70th birthday}, PAGES = {127--244}, PUBLISHER = {Springer, Cham}, YEAR = {[2019] \copyright 2019}, ISBN = {978-3-030-29596-7; 978-3-030-29597-4}, MRCLASS = {58B34 (19K35)}, MRNUMBER = {4300553}, DOI = {10.1007/978-3-030-29597-4\_3}, URL = {https://doi.org/10.1007/978-3-030-29597-4_3}, } @article {Ara-Goodearl(2017), AUTHOR = {Ara, P. and Goodearl, K. R.}, TITLE = {The realization problem for some wild monoids and the {A}tiyah problem}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {369}, YEAR = {2017}, NUMBER = {8}, PAGES = {5665--5710}, ISSN = {0002-9947,1088-6850}, MRCLASS = {16D40 (16D70 16E50 19A13 20M25)}, MRNUMBER = {3646775}, MRREVIEWER = {Markus\ Schmidmeier}, DOI = {10.1090/tran/6889}, URL = {https://doi.org/10.1090/tran/6889}, } @article {Ara-Meara-Perera(2002), AUTHOR = {Ara, Pere and O'Meara, Kevin C. and Perera, Francesc}, TITLE = {Stable finiteness of group rings in arbitrary characteristic}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {170}, YEAR = {2002}, NUMBER = {2}, PAGES = {224--238}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {16S34 (16P20 16S35)}, MRNUMBER = {MR1932330 (2003j:16035)}, MRREVIEWER = {Donald S. Passman}, } @article {Ara-Goldstein(1993), AUTHOR = {Ara, Pere and Goldstein, Dmitry}, TITLE = {A solution of the matrix problem for {R}ickart ${C}\sp *$-algebras}, JOURNAL = {Math. Nachr.}, FJOURNAL = {Mathematische Nachrichten}, VOLUME = {164}, YEAR = {1993}, PAGES = {259--270}, ISSN = {0025-584X}, CODEN = {MTMNAQ}, MRCLASS = {46L05}, MRNUMBER = {95b:46076}, MRREVIEWER = {Gottfried T. R{\"u}ttimann}, } @article {Aramayona-Juan-Pineda-Trujillo-Negrete(2018), AUTHOR = {Aramayona, Javier and Juan-Pineda, Daniel and Trujillo-Negrete, Alejandra}, TITLE = {On the virtually cyclic dimension of mapping class groups of punctured spheres}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {18}, YEAR = {2018}, NUMBER = {4}, PAGES = {2471--2495}, ISSN = {1472-2747,1472-2739}, MRCLASS = {20F65 (20F36 55R35)}, MRNUMBER = {3797073}, MRREVIEWER = {Sang-hyun\ Kim}, DOI = {10.2140/agt.2018.18.2471}, URL = {https://doi.org/10.2140/agt.2018.18.2471}, } @article{Arano-Kubota(2018), AUTHOR = {Arano, Yuki and Kubota, Yosuke}, TITLE = {A categorical perspective on the {A}tiyah-{S}egal completion theorem in {KK}-theory}, JOURNAL = {J. Noncommut. Geom.}, FJOURNAL = {Journal of Noncommutative Geometry}, VOLUME = {12}, YEAR = {2018}, NUMBER = {2}, PAGES = {779--821}, ISSN = {1661-6952,1661-6960}, MRCLASS = {19K35 (18E30 19L47 46L80)}, MRNUMBER = {3825201}, MRREVIEWER = {Guillermo\ Corti\~{n}as}, DOI = {10.4171/JNCG/291}, URL = {https://doi.org/10.4171/JNCG/291}, } @article {Arapura-Bressler-Ramachandran(1992), AUTHOR = {Arapura, D. and Bressler, P. and Ramachandran, M.}, TITLE = {On the fundamental group of a compact {K}\"ahler manifold}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {68}, YEAR = {1992}, NUMBER = {3}, PAGES = {477--488}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {57R19 (32J27 53C55)}, MRNUMBER = {94e:57040}, MRREVIEWER = {Elmer G. Rees}, } @article {Aravinda-Farrell(1994), AUTHOR = {Aravinda, C. Sastry and Farrell, F. Thomas}, TITLE = {Rank $1$ aspherical manifolds which do not support any nonpositively curved metric}, JOURNAL = {Comm. Anal. Geom.}, FJOURNAL = {Communications in Analysis and Geometry}, VOLUME = {2}, YEAR = {1994}, NUMBER = {1}, PAGES = {65--78}, ISSN = {1019-8385}, MRCLASS = {53C20 (57R55)}, MRNUMBER = {96e:53045}, MRREVIEWER = {Viktor Schroeder}, } @article {Aravinda-Farrell-Roushon(1997), AUTHOR = {Aravinda, C. Sastry and Farrell, F. Thomas and Roushon, Sayed K.}, TITLE = {Surgery groups of knot and link complements}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {29}, YEAR = {1997}, NUMBER = {4}, PAGES = {400--406}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {57R67 (57M25 57Q45)}, MRNUMBER = {98e:57047}, MRREVIEWER = {Masayuki Yamasaki}, } @article {Aravinda-Farrell-Roushon(2000), AUTHOR = {Aravinda, C. S. and Farrell, F. T. and Roushon, S. K.}, TITLE = {Algebraic {$K$}-theory of pure braid groups}, JOURNAL = {Asian J. Math.}, FJOURNAL = {The Asian Journal of Mathematics}, VOLUME = {4}, YEAR = {2000}, NUMBER = {2}, PAGES = {337--343}, ISSN = {1093-6106}, MRCLASS = {19B28 (19A31 20F36 20H15)}, MRNUMBER = {2002a:19002}, MRREVIEWER = {Ross Staffeldt}, } @article {Aravinda-Leuzinger(1995), AUTHOR = {Aravinda, C. S. and Leuzinger, Enrico}, TITLE = {Bounded geodesics in rank-{$1$} locally symmetric spaces}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {15}, YEAR = {1995}, NUMBER = {5}, PAGES = {813--820}, ISSN = {0143-3857}, MRCLASS = {53C22 (58F17)}, MRNUMBER = {MR1356615 (96h:53050)}, MRREVIEWER = {Edoh Amiran}, } @article{Arf(1941), AUTHOR = {Arf, Cahit}, TITLE = {Untersuchungen \"uber quadratische {F}ormen in {K}\"orpern der {C}harakteristik 2. {I}}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {183}, YEAR = {1941}, PAGES = {148--167}, ISSN = {0075-4102}, MRCLASS = {09.0X}, MRNUMBER = {0008069 (4,237f)}, MRREVIEWER = {O. F. G. Schilling}, } @book {Arhanelskii(1995), EDITOR = {Arhangel\cprime skii, A.V.}, TITLE = {General topology. {I}{I}{I}}, NOTE = {Paracompactness, function spaces, descriptive theory, A translation of {\it Current problems in mathematics. Fundamental directions. Vol. 51} (Russian), Akad. Nauk SSSR, Vsesoyuz. Inst. Nauchn. i Tekhn. Inform., Moscow, 1989 [MR 91e:54001], Translation by G. G. Gould, Translation edited by A. V. Arhangel\cprime skii [A. V. Arkhangel\cprime ski\u\i]}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1995}, PAGES = {vi+229}, ISBN = {3-540-54698-7}, MRCLASS = {54-02 (54-06)}, MRNUMBER = {97f:54001}, } @incollection {Arhanelskii(1996), AUTHOR = {Arhangel{\cprime}skii, A. V.}, TITLE = {Compactness [{M}{R} 90g:54017]}, BOOKTITLE = {General topology, II}, PAGES = {1--117, 247--256}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1996}, MRCLASS = {54D30 (54-02)}, MRNUMBER = {1 392 481}, } @book {Arkowitz(2011), AUTHOR = {Arkowitz, Martin}, TITLE = {Introduction to homotopy theory}, SERIES = {Universitext}, PUBLISHER = {Springer}, ADDRESS = {New York}, YEAR = {2011}, PAGES = {xiv+344}, ISBN = {978-1-4419-7328-3}, MRCLASS = {55-02 (55Pxx)}, MRNUMBER = {2814476 (2012f:55001)}, MRREVIEWER = {Samuel B. Smith}, DOI = {10.1007/978-1-4419-7329-0}, URL = {http://dx.doi.org/10.1007/978-1-4419-7329-0}, } @article {Armentrout(1969), AUTHOR = {Armentrout, Steve}, TITLE = {Cellular decompositions of {$3$}-manifolds that yield {$3$}-manifolds}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {75}, YEAR = {1969}, PAGES = {453--456}, ISSN = {0002-9904}, MRCLASS = {54.78}, MRNUMBER = {0239578}, MRREVIEWER = {M.-E. Hamstrom}, } @book {Armentrout(1971), AUTHOR = {Armentrout, Steve}, TITLE = {Cellular decompositions of {$3$}-manifolds that yield {$3$}-manifolds}, NOTE = {Memoirs of the American Mathematical Society, No. 107}, PUBLISHER = {American Mathematical Society, Providence, R. I.}, YEAR = {1971}, PAGES = {72}, MRCLASS = {57A10}, MRNUMBER = {0413104}, MRREVIEWER = {E. H. Anderson}, } @article {Armstrong-Zeeman(1967Topo), AUTHOR = {Armstrong, M. A. and Zeeman, E. C.}, TITLE = {Transversality for piecewise linear manifolds}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {6}, YEAR = {1967}, PAGES = {433--466}, ISSN = {0040-9383}, MRCLASS = {57.05 (55.00)}, MRNUMBER = {0219074 (36 \#2157)}, MRREVIEWER = {R. B. Sher}, } @article {Armstrong-Zeeman(1967Bull), AUTHOR = {Armstrong, M. A. and Zeeman, E. C.}, TITLE = {Piecewise linear transversality}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {73}, YEAR = {1967}, PAGES = {184--188}, ISSN = {0002-9904}, MRCLASS = {57.10 (55.60)}, MRNUMBER = {0206964 (34 \#6780)}, MRREVIEWER = {R. B. Sher}, } @book {Arnold(1989), AUTHOR = {Arnol{\cprime}d, Vladimir I.}, TITLE = {Mathematical methods of classical mechanics}, EDITION = {Second}, NOTE = {Translated from the Russian by K. Vogtmann and A. Weinstein}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1989}, PAGES = {xvi+508}, ISBN = {0-387-96890-3}, MRCLASS = {58Fxx (70-02 70H05)}, MRNUMBER = {90c:58046}, } @book {Arnold(1993a), EDITOR = {Arnol\cprime d, Vladimir I.}, TITLE = {Dynamical systems. {I}{I}{I}}, EDITION = {Second}, NOTE = {Mathematical aspects of classical and celestial mechanics, A translation of {\it Current problems in mathematics. Fundamental directions, Vol.\ 3} (Russian), Akad.\ Nauk SSSR, Vsesoyuz.\ Inst.\ Nauchn.\ i Tekhn.\ Inform., Moscow, 1985 [MR 87i:58151], Translation by A. Iacob, Translation edited by V. I. Arnol\cprime d}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1993}, PAGES = {xiv+291}, ISBN = {3-540-57241-4}, MRCLASS = {58Fxx (58-03 70Fxx 70Hxx 70Jxx 70Kxx)}, MRNUMBER = {95d:58043a}, } @book {Arnold(1993c), EDITOR = {Arnol\cprime d, Vladimir I.}, TITLE = {Dynamical systems. {V}{I}{I}{I}}, NOTE = {Singularity theory. II. Applications, A translation of {\it Current problems in mathematics. Fundamental directions, Vol.\ 39 (Russian)}, Akad.\ Nauk SSSR, Vsesoyuz.\ Inst.\ Nauchn.\ i Tekhn.\ Inform., Moscow, 1989 [MR 91h:58010c], Translated by J. S. Joel, Translation edited by V. I. Arnol\cprime d}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1993}, PAGES = {iv+235}, ISBN = {3-540-53376-1}, MRCLASS = {58C27}, MRNUMBER = {93k:58028}, } @book {Arnold(1993d), EDITOR = {Arnol\cprime d, Vladimir I.}, TITLE = {Dynamical systems. {V}{I}}, NOTE = {Singularity theory. I, A translation of {\it Current problems in mathematics. Fundamental directions, Vol.\ 6 (Russian)}, Akad.\ Nauk SSSR, Vsesoyuz.\ Inst.\ Nauchn.\ i Tekhn.\ Inform., Moscow, 1988 [MR 91h:58010a], Translation by A. Iacob, Translation edited by V. I. Arnol\cprime d}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1993}, PAGES = {iv+245}, ISBN = {3-540-50583-0}, MRCLASS = {58C27 (32Sxx)}, MRNUMBER = {94b:58018}, } @book {Arnold(1994), EDITOR = {Arnol\cprime d, Vladimir I.}, TITLE = {Dynamical systems. {V}}, NOTE = {Bifurcation theory and catastrophe theory, A translation of {\it Current problems in mathematics. Fundamental directions. Vol.\ 5 (Russian)}, Akad.\ Nauk SSSR, Vsesoyuz.\ Inst.\ Nauchn.\ i Tekhn.\ Inform., Moscow, 1986 [MR 89a:58088], Translation by N. D. Kazarinoff}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1994}, PAGES = {viii+271}, ISBN = {3-540-18173-3}, MRCLASS = {58Fxx}, MRNUMBER = {95c:58058}, } @book {Arnold(1997), AUTHOR = {Anosov, D. V. and Aranson, S. Kh. and Arnold, V. I. and Bronshtein, I. U. and Grines, V. Z. and Il{\cprime}yashenko, Yu. S.}, TITLE = {Ordinary differential equations and smooth dynamical systems}, NOTE = {Translated from the 1985 Russian original by E. R. Dawson and D. O'Shea, Third printing of the 1988 translation [{\it Dynamical systems. I}, Encyclopaedia Math.\ Sci., 1, Springer-Verlag, Berlin, 1988; MR 89g:58060], Translated from the Russian [MR 86i:58037]}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1997}, PAGES = {vi+233}, ISBN = {3-540-61220-3}, MRCLASS = {58Fxx (34Axx 34Cxx 54H20)}, MRNUMBER = {99h:58053}, MRREVIEWER = {Robert Roussarie}, } } @article {Arnold(1969), AUTHOR = {Arnold, V. I.}, TITLE = {The cohomology ring of the group of dyed braids}, JOURNAL = {Mat. Zametki}, FJOURNAL = {Akademiya Nauk SSSR. Matematicheskie Zametki}, VOLUME = {5}, YEAR = {1969}, PAGES = {227--231}, ISSN = {0025-567X}, MRCLASS = {57.60}, MRNUMBER = {0242196 (39 \#3529)}, MRREVIEWER = {C. Teleman}, } @book {Arnold-Novikov(1990), TITLE = {Dynamical systems. {I}{V}}, EDITOR = {Novikov, Sergei P.}, NOTE = {Symplectic geometry and its applications, A translation of Sovremennye problemy matematiki. Fundamentalnye napravleniya, Tom 4, Akad. Nauk SSSR, Vsesoyuz. Inst. Nauchn. i Tekhn. Inform., Moscow, 1985 [MR 87j:58032], Translation by G. Wassermann, Translation edited by V. I. Arnol\cprime d and S. P. Novikov}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1990}, PAGES = {vi+283}, ISBN = {3-540-17003-0}, MRCLASS = {58Fxx}, MRNUMBER = {90j:58039}, } @book {Arnold-Novikov(1994), TITLE = {Dynamical systems. {V}{I}{I}}, EDITOR = {Arnol\cprime d, Vladimir I. and Novikov, Sergei P.}, NOTE = {Integrable systems, nonholonomic dynamical systems, A translation of {\it Current problems in mathematics. Fundamental directions, Vol.\ 16 (Russian)}, Akad.\ Nauk SSSR, Vsesoyuz.\ Inst.\ Nauchn.\ i Tekhn.\ Inform., Moscow, 1987 [MR 88g:58004], Translation by A. G. Reyman [A. G. Re\u\i man] and M. A. Semenov-Tian-Shansky [M. A. Semenov-Tyan-Shanski\u\i], Translation edited by V. I. Arnol\cprime d and S. P. Novikov}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1994}, PAGES = {vi+341}, ISBN = {3-540-18176-8}, MRCLASS = {58Fxx (58-06)}, MRNUMBER = {94h:58069}, } @incollection{Arone(2006), AUTHOR = {Arone, Gregory}, TITLE = {A note on the homology of {$\Sigma_n$}, the {S}chwartz genus, and solving polynomial equations}, BOOKTITLE = {An alpine anthology of homotopy theory}, SERIES = {Contemp. Math.}, VOLUME = {399}, PAGES = {1--10}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2006}, MRCLASS = {55R80}, MRNUMBER = {2222501 (2006m:55039)}, MRREVIEWER = {Samuel B. Smith}, DOI = {10.1090/conm/399/07509}, URL = {http://dx.doi.org/10.1090/conm/399/07509}, } @article {Arthur(1989), AUTHOR = {Arthur, James}, TITLE = {The ${L}\sp 2$-{L}efschetz numbers of {H}ecke operators}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {97}, YEAR = {1989}, NUMBER = {2}, PAGES = {257--290}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {22E55}, MRNUMBER = {91i:22024}, MRREVIEWER = {Stephen Gelbart}, } @book {Artin(1993), AUTHOR = {Artin, Michael}, TITLE = {Algebra}, NOTE = {Translated from the 1991 English original by Annette A'Campo}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1993}, PAGES = {xiv+705}, ISBN = {3-7643-2927-0}, MRCLASS = {00A05 (11-01 12-01 13-01 20-01)}, MRNUMBER = {94k:00001}, } @book {Artin(1998), AUTHOR = {Artin, Emil}, TITLE = {Galois theory}, EDITION = {second}, NOTE = {Edited and with a supplemental chapter by Arthur N. Milgram}, PUBLISHER = {Dover Publications Inc.}, ADDRESS = {Mineola, NY}, YEAR = {1998}, PAGES = {iv+82}, ISBN = {0-486-62342-4}, MRCLASS = {12F10 (01A75 11R32)}, MRNUMBER = {98k:12001}, } @book {Artin-Mazur(1969), AUTHOR = {Artin, M. and Mazur, B.}, TITLE = {Etale homotopy}, SERIES = {Lecture Notes in Mathematics, No. 100}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1969}, PAGES = {iii+169}, MRCLASS = {14.55 (18.00)}, MRNUMBER = {39 \#6883}, MRREVIEWER = {J. S. Milne}, } @article {Artin-Mazur(1977), AUTHOR = {Artin, M. and Mazur, B.}, TITLE = {Formal groups arising from algebraic varieties}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, VOLUME = {10}, YEAR = {1977}, NUMBER = {1}, PAGES = {87--131}, MRCLASS = {14L05 (14D15 14F20 14J25)}, MRNUMBER = {56 \#15663}, MRREVIEWER = {Michiel Hazewinkel}, } @book {Artin-Mazur(1986), AUTHOR = {Artin, M. and Mazur, B.}, TITLE = {Etale homotopy}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {100}, NOTE = {Reprint of the 1969 original}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1986}, PAGES = {iv+169}, ISBN = {3-540-04619-4}, MRCLASS = {14F35 (55P65 55Q70)}, MRNUMBER = {88a:14024}, } @book {Arveson(1976), AUTHOR = {Arveson, William}, TITLE = {An invitation to {$C\sp*$}-algebras}, NOTE = {Graduate Texts in Mathematics, No. 39}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1976}, PAGES = {x+106}, MRCLASS = {46L05}, MRNUMBER = {0512360 (58 \#23621)}, MRREVIEWER = {V. Ptak}, } @article {Arzhantseva-Bridson-Januszkiewicz-Leary-Minasyan-Swiatkowski(2009), AUTHOR = {Arzhantseva, Goulnara and Bridson, Martin R. and Januszkiewicz, Tadeusz and Leary, Ian J. and Minasyan, Ashot and {\'S}wi{\c{a}}tkowski, Jacek}, TITLE = {Infinite groups with fixed point properties}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {13}, YEAR = {2009}, NUMBER = {3}, PAGES = {1229--1263}, ISSN = {1465-3060}, MRCLASS = {20F65 (20F67)}, MRNUMBER = {2496045 (2010b:20069)}, MRREVIEWER = {Vassilis Metaftsis}, DOI = {10.2140/gt.2009.13.1229}, URL = {http://dx.doi.org/10.2140/gt.2009.13.1229}, } @article {Arzhantseva-Guentner(2012), AUTHOR = {Arzhantseva, Goulnara and Guentner, Erik}, TITLE = {Coarse non-amenability and covers with small eigenvalues}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {354}, YEAR = {2012}, NUMBER = {3}, PAGES = {863--870}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {53Cxx}, MRNUMBER = {2983071}, DOI = {10.1007/s00208-011-0759-8}, URL = {http://dx.doi.org/10.1007/s00208-011-0759-8}, } @article {Arzhantseva-Tessera(2015), AUTHOR = {Arzhantseva, Goulnara and Tessera, Romain}, TITLE = {Relative expanders}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {25}, YEAR = {2015}, NUMBER = {2}, PAGES = {317--341}, ISSN = {1016-443X}, MRCLASS = {46B85 (20E22 20F69 22D10)}, MRNUMBER = {3334230}, DOI = {10.1007/s00039-015-0316-9}, URL = {http://dx.doi.org/10.1007/s00039-015-0316-9}, } @article {Aschenbrenner-Friedl(2013), AUTHOR = {Aschenbrenner, Matthias and Friedl, Stefan}, TITLE = {3-manifold groups are virtually residually {$p$}}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {225}, YEAR = {2013}, NUMBER = {1058}, PAGES = {viii+100}, ISSN = {0065-9266}, ISBN = {978-0-8218-8801-8}, MRCLASS = {57M05 (20E26 20F38)}, MRNUMBER = {3100378}, MRREVIEWER = {Bruno P. Zimmermann}, DOI = {10.1090/S0065-9266-2013-00682-X}, URL = {http://dx.doi.org/10.1090/S0065-9266-2013-00682-X}, } @Book{Aschenbrenner-Friedl-Wilton(2015), Author = {Matthias {Aschenbrenner} and Stefan {Friedl} and Henry {Wilton}}, Title = {{3-manifold groups.}}, ISBN = {978-3-03719-154-5/pbk}, Pages = {xiv + 215}, Year = {2015}, Publisher = {Z\"urich: European Mathematical Society (EMS)}, Language = {English}, DOI = {10.4171/154}, MSC2010 = {57-02 57M50 57N10 20F65}, Zbl = {1326.57001} } @article {Askitas(1996), AUTHOR = {Askitas, Nikolaos}, TITLE = {Embeddings of $2$-spheres in $4$-manifolds}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {89}, YEAR = {1996}, NUMBER = {1}, PAGES = {35--47}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {57R95 (57N13 57R40)}, MRNUMBER = {97a:57036}, MRREVIEWER = {Terry Lawson}, } @article {Ash-Doud-Pollack(2002), AUTHOR = {Ash, Avner and Doud, Darrin and Pollack, David}, TITLE = {Galois representations with conjectural connections to arithmetic cohomology}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {112}, YEAR = {2002}, NUMBER = {3}, PAGES = {521--579}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {11F75 (11F60 11F80 11R39)}, MRNUMBER = {1896473 (2003g:11055)}, MRREVIEWER = {Gebhard B{\"o}ckle}, DOI = {10.1215/S0012-9074-02-11235-6}, URL = {http://dx.doi.org/10.1215/S0012-9074-02-11235-6}, } @article {Askitas(1996a), AUTHOR = {Askitas, Nikolaos}, TITLE = {Erratum: ``{E}mbeddings of $2$-spheres in $4$-manifolds'' [{M}anuscripta {M}ath.\ {\bf 89} (1996), no.\ 1, 35--47; 97a:57036]}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {90}, YEAR = {1996}, NUMBER = {1}, PAGES = {137--138}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {57N13 (57Q35 57R40 57R95)}, MRNUMBER = {97c:57020}, MRREVIEWER = {Terry Lawson}, } @article {Askitas(1998), AUTHOR = {Askitas, Nikolaos}, TITLE = {On pairs of locally flat $2$-spheres in simply connected $4$-manifolds}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {228}, YEAR = {1998}, NUMBER = {1}, PAGES = {131--153}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {57N13}, MRNUMBER = {99e:57032}, MRREVIEWER = {A. A. Ranicki}, } @article {Atiyah(1961), AUTHOR = {Atiyah, Michael F.}, TITLE = {Characters and cohomology of finite groups}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, VOLUME = {9}, YEAR = {1961}, PAGES = {23--64}, MRCLASS = {18.20}, MRNUMBER = {26 \#6228}, MRREVIEWER = {F. Hirzebruch}, } @article {Atiyah(1961Thom), AUTHOR = {Atiyah, M. F.}, TITLE = {Thom complexes}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {11}, YEAR = {1961}, PAGES = {291--310}, ISSN = {0024-6115}, MRCLASS = {57.30}, MRNUMBER = {0131880 (24 \#A1727)}, MRREVIEWER = {R. Bott}, } @article {Atiyah(1962), AUTHOR = {Atiyah, M. F.}, TITLE = {Vector bundles and the {K}\"unneth formula}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {1}, YEAR = {1962}, PAGES = {245--248}, ISSN = {0040-9383}, MRCLASS = {55.50}, MRNUMBER = {0150780 (27 \#767)}, MRREVIEWER = {E. H. Brown}, } @article {Atiyah(1966), AUTHOR = {Atiyah, M. F.}, TITLE = {{$K$}-theory and reality}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {17}, YEAR = {1966}, PAGES = {367--386}, ISSN = {0033-5606}, MRCLASS = {55.30 (57.30)}, MRNUMBER = {0206940 (34 \#6756)}, MRREVIEWER = {J. F. Adams}, } @book {Atiyah(1967), AUTHOR = {Atiyah, Michael F.}, TITLE = {${K}$-theory}, PUBLISHER = {W. A. Benjamin, Inc., New York-Amsterdam}, YEAR = {1967}, PAGES = {v+166+xlix}, MRCLASS = {55.30 (57.00)}, MRNUMBER = {36 \#7130}, } @incollection {Atiyah(1969), AUTHOR = {Atiyah, Michael F.}, TITLE = {The signature of fibre-bundles}, BOOKTITLE = {Global Analysis (Papers in Honor of K. Kodaira)}, PAGES = {73--84}, PUBLISHER = {Univ. Tokyo Press}, ADDRESS = {Tokyo}, YEAR = {1969}, MRCLASS = {57.30}, MRNUMBER = {40 \#8071}, MRREVIEWER = {K. H. Mayer}, } @incollection {Atiyah(1969a), AUTHOR = {Atiyah, M. F.}, TITLE = {Global theory of elliptic operators}, BOOKTITLE = {Proc. Internat. Conf. on Functional Analysis and Related Topics (Tokyo, 1969)}, PAGES = {21--30}, PUBLISHER = {Univ. of Tokyo Press, Tokyo}, YEAR = {1970}, MRCLASS = {57.50 (55.00)}, MRNUMBER = {42 \#1154}, MRREVIEWER = {K. H. Mayer}, } @incollection {Atiyah(1969b), AUTHOR = {Atiyah, M. F.}, TITLE = {Algebraic topology and operators in {H}ilbert space}, BOOKTITLE = {Lectures in {M}odern {A}nalysis and {A}pplications. {I}}, PAGES = {101--121}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1969}, MRCLASS = {55.30 (47.00)}, MRNUMBER = {0248803 (40 \#2053)}, MRREVIEWER = {K. H. Mayer}, } @incollection {Atiyah(1969signature), AUTHOR = {Atiyah, M. F.}, TITLE = {The signature of fibre-bundles}, BOOKTITLE = {Global {A}nalysis ({P}apers in {H}onor of {K}. {K}odaira)}, PAGES = {73--84}, PUBLISHER = {Univ. Tokyo Press, Tokyo}, YEAR = {1969}, MRCLASS = {57.30}, MRNUMBER = {0254864}, MRREVIEWER = {K. H. Mayer}, } @article {Atiyah(1976), AUTHOR = {Atiyah, Michael F.}, TITLE = {Elliptic operators, discrete groups and von {N}eumann algebras}, BOOKTITLE = {Colloque ``Analyse et Topologie'' en l'Honneur de Henri Cartan (Orsay, 1974)}, PAGES = {43--72}, JOURNAL = {Ast\'erisque}, VOLUME = {32-33}, PUBLISHER = {Soc. Math. France}, ADDRESS = {Paris}, YEAR = {1976}, MRCLASS = {58G10 (46L10 22E45)}, MRNUMBER = {54 \#8741}, MRREVIEWER = {R. D. Moyer}, } @incollection {Atiyah(1977), AUTHOR = {Atiyah, M. F.}, TITLE = {A survey of {$K$}-theory}, BOOKTITLE = {{$K$}-theory and operator algebras ({P}roc. {C}onf., {U}niv. {G}eorgia, {A}thens, {G}a., 1975)}, PAGES = {1--9. Lecture Notes in Math., Vol. 575}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1977}, MRCLASS = {55F50 (46M20 58B15 58G10)}, MRNUMBER = {0474299 (57 \#13946)}, MRREVIEWER = {K. H. Mayer}, } @book {Atiyah(1988a), AUTHOR = {Atiyah, Michael F.}, TITLE = {Collected works. {V}ol. 1}, NOTE = {Early papers: general papers}, PUBLISHER = {The Clarendon Press Oxford University Press}, ADDRESS = {New York}, YEAR = {1988}, PAGES = {xxiv+364}, ISBN = {0-19-853275-X}, MRCLASS = {01A75}, MRNUMBER = {91h:01094a}, MRREVIEWER = {Daniel M. Burns, Jr.}, } @book {Atiyah(1988b), AUTHOR = {Atiyah, Michael F.}, TITLE = {Collected works. {V}ol. 2}, NOTE = {$K$-theory}, PUBLISHER = {The Clarendon Press Oxford University Press}, ADDRESS = {New York}, YEAR = {1988}, PAGES = {xxiv+829}, ISBN = {0-19-853276-8}, MRCLASS = {01A75}, MRNUMBER = {91h:01094b}, MRREVIEWER = {Daniel M. Burns, Jr.}, } @book {Atiyah(1988c), AUTHOR = {Atiyah, Michael F.}, TITLE = {Collected works. {V}ol. 3}, NOTE = {Index theory: 1}, PUBLISHER = {The Clarendon Press Oxford University Press}, ADDRESS = {New York}, YEAR = {1988}, PAGES = {xxiv+593}, ISBN = {0-19-853277-6}, MRCLASS = {01A75}, MRNUMBER = {91h:01094c}, MRREVIEWER = {Daniel M. Burns, Jr.}, } @book {Atiyah(1988d), AUTHOR = {Atiyah, Michael F.}, TITLE = {Collected works. {V}ol. 4}, NOTE = {Index theory: 2}, PUBLISHER = {The Clarendon Press Oxford University Press}, ADDRESS = {New York}, YEAR = {1988}, PAGES = {xxiv+617}, ISBN = {0-19-853278-4}, MRCLASS = {01A75}, MRNUMBER = {91h:01094d}, MRREVIEWER = {Daniel M. Burns, Jr.}, } @book {Atiyah(1988e), AUTHOR = {Atiyah, Michael F.}, TITLE = {Collected works. {V}ol. 5}, NOTE = {Gauge theories}, PUBLISHER = {The Clarendon Press Oxford University Press}, ADDRESS = {New York}, YEAR = {1988}, PAGES = {xxiv+685}, ISBN = {0-19-853279-2}, MRCLASS = {01A75}, MRNUMBER = {91h:01094e}, MRREVIEWER = {Daniel M. Burns, Jr.}, } @book {Atiyah(1989K-theory), AUTHOR = {Atiyah, M. F.}, TITLE = {{$K$}-theory}, SERIES = {Advanced Book Classics}, EDITION = {Second}, NOTE = {Notes by D. W. Anderson}, PUBLISHER = {Addison-Wesley Publishing Company Advanced Book Program}, ADDRESS = {Redwood City, CA}, YEAR = {1989}, PAGES = {xx+216}, ISBN = {0-201-09394-4}, MRCLASS = {18F25 (19-01 55R50 57-02)}, MRNUMBER = {1043170 (90m:18011)}, } @article {Atiyah(1989), AUTHOR = {Atiyah, Michael F.}, TITLE = {Topological quantum field theories}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {68}, YEAR = {1988}, PAGES = {175--186 (1989)}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {57R55 (58E15 81E13 81E40)}, MRNUMBER = {90e:57059}, MRREVIEWER = {Matthias Blau}, } @incollection {Atiyah(2001), AUTHOR = {Atiyah, Michael}, TITLE = {{$K$}-theory past and present}, BOOKTITLE = {Sitzungsberichte der {B}erliner {M}athematischen {G}esellschaft}, PAGES = {411--417}, PUBLISHER = {Berliner Math. Gesellschaft}, ADDRESS = {Berlin}, YEAR = {2001}, MRCLASS = {19-02 (01A60 19-03)}, MRNUMBER = {2091892}, } @incollection {Atiyah-Bott(1964), AUTHOR = {Atiyah, Michael F. and Bott, Raoul}, TITLE = {The index problem for manifolds with boundary}, BOOKTITLE = {Differential Analysis, Bombay Colloq., 1964}, PAGES = {175--186}, PUBLISHER = {Oxford Univ. Press}, ADDRESS = {London}, YEAR = {1964}, MRCLASS = {57.50 (35.00)}, MRNUMBER = {32 \#3069}, MRREVIEWER = {R. T. Seeley}, } @article {Atiyah-Bott(1966), AUTHOR = {Atiyah, Michael F. and Bott, Raoul}, TITLE = {A {L}efschetz fixed point formula for elliptic differential operators}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {72}, YEAR = {1966}, PAGES = {245--250}, MRCLASS = {57.50}, MRNUMBER = {32 \#8360}, MRREVIEWER = {R. S. Palais}, } @article {Atiyah-Bott(1967LefI), AUTHOR = {Atiyah, Michael F. and Bott, Raoul}, TITLE = {A {L}efschetz fixed point formula for elliptic complexes. {I}}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {86}, YEAR = {1967}, PAGES = {374--407}, MRCLASS = {57.50}, MRNUMBER = {35 \#3701}, MRREVIEWER = {R. S. Palais}, } @article {Atiyah-Bott(1967LefII), AUTHOR = {Atiyah, M. F. and Bott, R.}, TITLE = {A {L}efschetz fixed point formula for elliptic complexes. {II}. {A}pplications}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {88}, YEAR = {1968}, PAGES = {451--491}, ISSN = {0003-486X}, MRCLASS = {57.50}, MRNUMBER = {0232406}, MRREVIEWER = {R. S. Palais}, DOI = {10.2307/1970721}, URL = {http://dx.doi.org/10.2307/1970721}, } @article {Atiyah-Bott(1968), AUTHOR = {Atiyah, Michael F. and Bott, Raoul}, TITLE = {A {L}efschetz fixed point formula for elliptic complexes. {I}{I}. {A}pplications}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {88}, YEAR = {1968}, PAGES = {451--491}, MRCLASS = {57.50}, MRNUMBER = {38 \#731}, MRREVIEWER = {R. S. Palais}, } @article {Atiyah-Bott(1984), AUTHOR = {Atiyah, Michael F. and Bott, Raoul}, TITLE = {The moment map and equivariant cohomology}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {23}, YEAR = {1984}, NUMBER = {1}, PAGES = {1--28}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {58F05 (55N91 57R20 57R22)}, MRNUMBER = {85e:58041}, MRREVIEWER = {G. J. Heckman}, } @article {Atiyah-Bott-Patodi(1973), AUTHOR = {Atiyah, Michael F. and Bott, Raoul and Patodi, Vijay Kumar}, TITLE = {On the heat equation and the index theorem}, JOURNAL = {Invent. Math.}, VOLUME = {19}, YEAR = {1973}, PAGES = {279--330}, MRCLASS = {58G10 (35K05)}, MRNUMBER = {58 \#31287}, } @article {Atiyah-Bott-Patodi(1975), AUTHOR = {Atiyah, Michael F. and Bott, Raoul and Patodi, Vijay Kumar}, TITLE = {Errata to: ``{O}n the heat equation and the index theorem'' ({I}nvent. {M}ath. {\bf 19} (1973), 279--330)}, JOURNAL = {Invent. Math.}, VOLUME = {28}, YEAR = {1975}, PAGES = {277--280}, MRCLASS = {58G10}, MRNUMBER = {58 \#31288}, } @article {Atiyah-Bott-Shapiro(1964), AUTHOR = {Atiyah, Michael F. and Bott, Raoul and Shapiro, A.}, TITLE = {Clifford modules}, JOURNAL = {Topology}, VOLUME = {3}, YEAR = {1964}, NUMBER = {suppl. 1}, PAGES = {3--38}, MRCLASS = {57.30 (55.30)}, MRNUMBER = {29 \#5250}, MRREVIEWER = {J. F. Adams}, } @article {Atiyah-Donnelly-Singer(1983), AUTHOR = {Atiyah, Michael F. and Donnelly, Harold and Singer, Isadore M.}, TITLE = {Eta invariants, signature defects of cusps, and values of ${L}$-functions}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {118}, YEAR = {1983}, NUMBER = {1}, PAGES = {131--177}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {58G11 (11F41 11G40 11R42 58G10)}, MRNUMBER = {86g:58134a}, MRREVIEWER = {R. Sczech}, } @incollection {Atiyah-Hirzebruch(1970), AUTHOR = {Atiyah, Michael F. and Hirzebruch, Friedrich}, TITLE = {Spin-manifolds and group actions}, BOOKTITLE = {Essays on Topology and Related Topics (M\'emoires d\'edi\'es \`a Georges de Rham)}, PAGES = {18--28}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1970}, MRCLASS = {57.47}, MRNUMBER = {43 \#4064}, MRREVIEWER = {R. Z. Goldstein}, } @book {Atiyah-McDonald(1969), AUTHOR = {Atiyah, Michael F. and Macdonald, Ian G.}, TITLE = {Introduction to commutative algebra}, PUBLISHER = {Addison-Wesley Publishing Co., Reading, Mass.-London-Don Mills, Ont.}, YEAR = {1969}, PAGES = {ix+128}, MRCLASS = {13.00}, MRNUMBER = {39 \#4129}, MRREVIEWER = {J. A. Johnson}, } @article {Atiyah-Patodi-Singer(1975a), AUTHOR = {Atiyah, Michael F. and Patodi, Vijay Kumar and Singer, Isadore M.}, TITLE = {Spectral asymmetry and {R}iemannian geometry. {I}}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, VOLUME = {77}, YEAR = {1975}, PAGES = {43--69}, MRCLASS = {58G10 (57E15 57D85)}, MRNUMBER = {53 \#1655a}, MRREVIEWER = {Kh. Knapp}, } @article {Atiyah-Patodi-Singer(1975b), AUTHOR = {Atiyah, Michael F. and Patodi, Vijay Kumar and Singer, Isadore M.}, TITLE = {Spectral asymmetry and {R}iemannian geometry. {I}{I}}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, VOLUME = {78}, YEAR = {1975}, NUMBER = {3}, PAGES = {405--432}, MRCLASS = {58G10 (57E15 57D85)}, MRNUMBER = {53 \#1655b}, MRREVIEWER = {Kh. Knapp}, } @article {Atiyah-Patodi-Singer(1976), AUTHOR = {Atiyah, Michael F. and Patodi, Vijay Kumar and Singer, Isadore M.}, TITLE = {Spectral asymmetry and {R}iemannian geometry. {I}{I}{I}}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, VOLUME = {79}, YEAR = {1976}, NUMBER = {1}, PAGES = {71--99}, MRCLASS = {58G10 (57E15 57D85)}, MRNUMBER = {53 \#1655c}, MRREVIEWER = {Kh. Knapp}, } @article {Atiyah-Schmid(1977), AUTHOR = {Atiyah, Michael F. and Schmid, Wilfried}, TITLE = {A geometric construction of the discrete series for semisimple {L}ie groups}, JOURNAL = {Invent. Math.}, VOLUME = {42}, YEAR = {1977}, PAGES = {1--62}, MRCLASS = {22E45}, MRNUMBER = {57 \#3310}, MRREVIEWER = {P. C. Trombi}, } @article {Atiyah-Schmid(1979), AUTHOR = {Atiyah, Michael F. and Schmid, Wilfried}, TITLE = {Erratum: ``{A} geometric construction of the discrete series for semisimple {L}ie groups''\ [{I}nvent. {M}ath. {\bf 42} (1977), 1--62;\ {M}{R} {\bf 57} \#3310]}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {54}, YEAR = {1979}, NUMBER = {2}, PAGES = {189--192}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {22E45}, MRNUMBER = {81d:22015}, MRREVIEWER = {P. C. Trombi}, } @incollection {Atiyah-Segal(2006), AUTHOR = {Atiyah, Michael and Segal, Graeme}, TITLE = {Twisted {$K$}-theory and cohomology}, BOOKTITLE = {Inspired by {S}. {S}. {C}hern}, SERIES = {Nankai Tracts Math.}, VOLUME = {11}, PAGES = {5--43}, PUBLISHER = {World Sci. Publ., Hackensack, NJ}, YEAR = {2006}, MRCLASS = {55N15 (19L99 55R40 55S25 55S30 55T25)}, MRNUMBER = {2307274 (2008j:55003)}, MRREVIEWER = {Francis Clarke}, DOI = {10.1142/9789812772688_0002}, URL = {http://dx.doi.org/10.1142/9789812772688_0002}, } } @article {Atiyah-Segal(2004), AUTHOR = {Atiyah, Michael and Segal, Graeme}, TITLE = {Twisted {$K$}-theory}, JOURNAL = {Ukr. Mat. Visn.}, FJOURNAL = {Ukra\"\i ns ki\u\i\ Matematichni\u\i\ V\=\i snik}, VOLUME = {1}, YEAR = {2004}, NUMBER = {3}, PAGES = {287--330}, ISSN = {1810-3200}, MRCLASS = {55N15 (19K99 19L47 46L80 55N91)}, MRNUMBER = {2172633 (2006m:55017)}, MRREVIEWER = {Gregory D. Landweber}, } @article {Atiyah-Segal(1989), AUTHOR = {Atiyah, Michael and Segal, Graeme}, TITLE = {On equivariant {E}uler characteristics}, JOURNAL = {J. Geom. Phys.}, FJOURNAL = {Journal of Geometry and Physics}, VOLUME = {6}, YEAR = {1989}, NUMBER = {4}, PAGES = {671--677}, ISSN = {0393-0440}, MRCLASS = {19L47 (55N15 57S17 81T30)}, MRNUMBER = {1076708 (92c:19005)}, MRREVIEWER = {Ian Hambleton}, DOI = {10.1016/0393-0440(89)90032-6}, URL = {http://dx.doi.org/10.1016/0393-0440(89)90032-6}, } @article {Atiyah-Segal(1969), AUTHOR = {Atiyah, Michael F. and Segal, Graeme B.}, TITLE = {Equivariant ${K}$-theory and completion}, JOURNAL = {J. Differential Geometry}, VOLUME = {3}, YEAR = {1969}, PAGES = {1--18}, MRCLASS = {57.40 (18.00)}, MRNUMBER = {41 \#4575}, MRREVIEWER = {S. Y. Husseini}, } @article {Atiyah-Segal(1968), AUTHOR = {Atiyah, Michael F. and Segal, Graeme B.}, TITLE = {The index of elliptic operators. {I}{I}}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {87}, YEAR = {1968}, PAGES = {531--545}, MRCLASS = {57.50}, MRNUMBER = {38 \#5244}, MRREVIEWER = {F. Hirzebruch}, } @article {Atiyah-Singer(1968a), AUTHOR = {Atiyah, Michael F. and Singer, Isadore M.}, TITLE = {The index of elliptic operators. {I}}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {87}, YEAR = {1968}, PAGES = {484--530}, MRCLASS = {57.50}, MRNUMBER = {38 \#5243}, MRREVIEWER = {F. Hirzebruch}, } @article {Atiyah-Singer(1968b), AUTHOR = {Atiyah, Michael F. and Singer, Isadore M.}, TITLE = {The index of elliptic operators. {I}{I}{I}}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {87}, YEAR = {1968}, PAGES = {546--604}, MRCLASS = {57.50}, MRNUMBER = {38 \#5245}, MRREVIEWER = {F. Hirzebruch}, } @article {Atiyah-Singer(1969), AUTHOR = {Atiyah, M. F. and Singer, I. M.}, TITLE = {Index theory for skew-adjoint {F}redholm operators}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, volume = {37}, YEAR = {1969}, PAGES = {5--26}, ISSN = {0073-8301}, MRCLASS = {57.50}, MRNUMBER = {0285033 (44 \#2257)}, MRREVIEWER = {F. Hirzebruch}, } @article {Atiyah-Singer(1971a), AUTHOR = {Atiyah, Michael F. and Singer, Isadore M.}, TITLE = {The index of elliptic operators. {I}{V}}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {93}, YEAR = {1971}, PAGES = {119--138}, MRCLASS = {57.50}, MRNUMBER = {43 \#5554}, MRREVIEWER = {F. Hirzebruch}, } @article {Atiyah-Singer(1971b), AUTHOR = {Atiyah, Michael F. and Singer, Isadore M.}, TITLE = {The index of elliptic operators. {V}}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {93}, YEAR = {1971}, PAGES = {139--149}, MRCLASS = {57.50}, MRNUMBER = {43 \#5555}, MRREVIEWER = {F. Hirzebruch}, } @article {Atiyah-Tall(1969), AUTHOR = {Atiyah, Michael F. and Tall, D. O.}, TITLE = {Group representations, $\lambda $-rings and the ${J}$-homomorphism}, JOURNAL = {Topology}, VOLUME = {8}, YEAR = {1969}, PAGES = {253--297}, MRCLASS = {20.50 (55.00)}, MRNUMBER = {39 \#5702}, MRREVIEWER = {H. Bass}, } @proceedings {Atiyah-et.al.(1979), TITLE = {Representation theory of {L}ie groups}, BOOKTITLE = {Proceedings of the SRC/LMS Research Symposium held in Oxford, June 28--July 15, 1977}, EDITOR = {Luke, G. L.}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1979}, PAGES = {v+341}, ISBN = {0-521-22636-8}, MRCLASS = {22-06 (81C40)}, MRNUMBER = {81j:22001}, MRREVIEWER = {A. U. Klimyk}, } @book {Atlas(1985), AUTHOR = {Conway, J. H. and Curtis, R. T. and Norton, S. P. and Parker, R. A. and Wilson, R. A.}, TITLE = {{$\Bbb{ATLAS}$} of finite groups}, NOTE = {Maximal subgroups and ordinary characters for simple groups, With computational assistance from J. G. Thackray}, PUBLISHER = {Oxford University Press, Eynsham}, YEAR = {1985}, PAGES = {xxxiv+252}, ISBN = {0-19-853199-0}, MRCLASS = {20D05 (20-02)}, MRNUMBER = {827219}, MRREVIEWER = {R.\ L.\ Griess}, } @proceedings {Atlas(1998), TITLE = {The atlas of finite groups: ten years on}, SERIES = {London Mathematical Society Lecture Note Series}, VOLUME = {249}, BOOKTITLE = {Proceedings of the {C}onference on {G}roup {T}heory and its {A}pplications held in {B}irmingham, {J}uly 10--13, 1995}, EDITOR = {Curtis, Robert and Wilson, Robert}, PUBLISHER = {Cambridge University Press, Cambridge}, YEAR = {1998}, PAGES = {xviii+293}, ISBN = {0-521-57587-7}, MRCLASS = {20-06 (20Dxx)}, MRNUMBER = {1647408}, DOI = {10.1017/CBO9780511565830}, URL = {https://doi.org/10.1017/CBO9780511565830}, } @article {Attie(1994), AUTHOR = {Attie, Oliver}, TITLE = {Quasi-isometry classification of some manifolds of bounded geometry}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {216}, YEAR = {1994}, NUMBER = {4}, PAGES = {501--527}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {53C23 (53C20 57Q10 57R05 57R65)}, MRNUMBER = {95k:53051}, MRREVIEWER = {Christopher W. Stark}, } @article {Attie-Block-Weinberger(1992), AUTHOR = {Attie, Oliver and Block, Jonathan and Weinberger, Shmuel}, TITLE = {Characteristic classes and distortion of diffeomorphisms}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {5}, YEAR = {1992}, NUMBER = {4}, PAGES = {919--921}, ISSN = {0894-0347}, MRCLASS = {53C21 (57R20)}, MRNUMBER = {93a:53027}, MRREVIEWER = {Christophe Bavard}, } @article {Attie-Hurder(1996), AUTHOR = {Attie, Oliver and Hurder, Steven}, TITLE = {Manifolds which cannot be leaves of foliations}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {35}, YEAR = {1996}, NUMBER = {2}, PAGES = {335--353}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57R30}, MRNUMBER = {96m:57037}, MRREVIEWER = {R. E. Stong}, } @article {Aubin(1976), AUTHOR = {Aubin, Thierry}, TITLE = {Espaces de {S}obolev sur les vari\'et\'es riemanniennes}, JOURNAL = {Bull. Sci. Math. (2)}, VOLUME = {100}, YEAR = {1976}, NUMBER = {2}, PAGES = {149--173}, MRCLASS = {58D15 (46E35)}, MRNUMBER = {58 \#7692}, MRREVIEWER = {Jozef Dodziuk}, } @book {Audine-Lafontaine(1994), TITLE = {Holomorphic curves in symplectic geometry}, EDITOR = {Audin, Mich{\`e}le and Lafontaine, Jacques}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1994}, PAGES = {xii+328}, ISBN = {3-7643-2997-1}, MRCLASS = {58-06 (53C15 57R57 58D10 58D27 58E12 58F05)}, MRNUMBER = {95i:58005}, MRREVIEWER = {Hansj{\"o}rg Geiges}, } @book {Auslander-Buchsbaum(1974), AUTHOR = {Auslander, Maurice and Buchsbaum, David A.}, TITLE = {Groups, rings, modules}, NOTE = {Harper's Series in Modern Mathematics}, PUBLISHER = {Harper \& Row Publishers}, ADDRESS = {New York}, YEAR = {1974}, PAGES = {x+470}, MRCLASS = {16-02 (13-02)}, MRNUMBER = {51 \#3205}, MRREVIEWER = {Chr. U. Jensen}, } @article{Auslander-Johnson(1976), AUTHOR = {Auslander, L. and Johnson, F. E. A.}, TITLE = {On a conjecture of {C}. {T}. {C}. {W}all}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {14}, YEAR = {1976}, NUMBER = {2}, PAGES = {331--332}, ISSN = {0024-6107,1469-7750}, MRCLASS = {57D15 (22E25 22E40)}, MRNUMBER = {423362}, MRREVIEWER = {R.\ K.\ Lashof}, DOI = {10.1112/jlms/s2-14.2.331}, URL = {https://doi.org/10.1112/jlms/s2-14.2.331}, } @Book{Ausoni-Hess-Johnson-Lueck_Scherer(2014), Editor = {Christian {Ausoni} and Kathryn {Hess} and Brenda {Johnson} and Wolfgang {L\"uck} and J\'er\^ome {Scherer}}, Title = {{An Alpine expedition through algebraic topology. Proceedings of the fourth Arolla conference on algebraic topology, Arolla, Switzerland, August 20-25, 2012.}}, ISBN = {978-0-8218-9145-2/pbk; 978-1-4704-1685-0/ebook}, Pages = {xv + 296}, Year = {2014}, Publisher = {Providence, RI: American Mathematical Society (AMS)}, Language = {English}, DOI = {10.1090/conm/617}, MSC2010 = {55-06 55Nxx 55Pxx 55Qxx 55Uxx 57R19 18G10 18G15 19D10 19D35 19L41 00B25}, Zbl = {1291.55002} } @article {Ausoni-Rognes(2012), AUTHOR = {Ausoni, Christian and Rognes, John}, TITLE = {Rational algebraic {$K$}-theory of topological {$K$}-theory}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {16}, YEAR = {2012}, NUMBER = {4}, PAGES = {2037--2065}, ISSN = {1465-3060}, MRCLASS = {19Lxx}, MRNUMBER = {2975299}, MRREVIEWER = {Carla Farsi}, DOI = {10.2140/gt.2012.16.2037}, URL = {http://dx.doi.org/10.2140/gt.2012.16.2037}, } @article {Ausoni-Rognes(2002), AUTHOR = {Ausoni, Christian and Rognes, John}, TITLE = {Algebraic {$K$}-theory of topological {$K$}-theory}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {188}, YEAR = {2002}, NUMBER = {1}, PAGES = {1--39}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {19D55 (19L20)}, MRNUMBER = {1947457 (2004f:19007)}, MRREVIEWER = {Charles Weibel}, DOI = {10.1007/BF02392794}, URL = {http://dx.doi.org/10.1007/BF02392794}, } @article {Austin(2013), AUTHOR = {Austin, Tim}, TITLE = {Rational group ring elements with kernels having irrational dimension}, JOURNAL = {Proc. Lond. Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {107}, YEAR = {2013}, NUMBER = {6}, PAGES = {1424--1448}, ISSN = {0024-6115}, MRCLASS = {20F65 (05C25 58J22)}, MRNUMBER = {3149852}, MRREVIEWER = {Qihui Li}, DOI = {10.1112/plms/pdt029}, URL = {http://dx.doi.org/10.1112/plms/pdt029}, } @article {Avez(1970), AUTHOR = {Avez, Andr{\'e}}, TITLE = {Vari\'et\'es riemanniennes sans points focaux}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. A-B}, VOLUME = {270}, YEAR = {1970}, PAGES = {A188--A191}, MRCLASS = {53.72}, MRNUMBER = {41 \#961}, MRREVIEWER = {I. Chavel}, } @article {Avramidi(2018), AUTHOR = {Avramidi, Grigori}, TITLE = {Rational manifold models for duality groups}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {28}, YEAR = {2018}, NUMBER = {4}, PAGES = {965--994}, ISSN = {1016-443X}, MRCLASS = {57P10 (20J05 55P62)}, MRNUMBER = {3820436}, MRREVIEWER = {Mahan Mj}, DOI = {10.1007/s00039-018-0449-8}, URL = {https://doi.org/10.1007/s00039-018-0449-8}, } @article {Avramidi(2014), AUTHOR = {Avramidi, Grigori}, TITLE = {Smith theory, {$L^2$}-cohomology, isometries of locally symmetric manifolds, and moduli spaces of curves}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {163}, YEAR = {2014}, NUMBER = {1}, PAGES = {1--34}, ISSN = {0012-7094}, MRCLASS = {57R50 (53C35 58D27)}, MRNUMBER = {3161310}, MRREVIEWER = {Christoforos Neofytidis}, DOI = {10.1215/00127094-2382340}, URL = {http://dx.doi.org/10.1215/00127094-2382340}, } @article {Avramidi-Davis-Okun-Schreve(2016), AUTHOR = {Avramidi, Grigori and Davis, Michael W. and Okun, Boris and Schreve, Kevin}, TITLE = {The action dimension of right-angled {A}rtin groups}, JOURNAL = {Bull. Lond. Math. Soc.}, FJOURNAL = {Bulletin of the London Mathematical Society}, VOLUME = {48}, YEAR = {2016}, NUMBER = {1}, PAGES = {115--126}, ISSN = {0024-6093}, MRCLASS = {57S30 (20F36 20J06 55N35 57Q35)}, MRNUMBER = {3455755}, MRREVIEWER = {Juan Gonz\'alez-Meneses}, DOI = {10.1112/blms/bdv083}, URL = {http://dx.doi.org/10.1112/blms/bdv083}, } @article{Avramidi-Okun-Schreve(2021), AUTHOR = {Avramidi, Grigori and Okun, Boris and Schreve, Kevin}, TITLE = {Mod {$p$} and torsion homology growth in nonpositive curvature}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {226}, YEAR = {2021}, NUMBER = {3}, PAGES = {711--723}, ISSN = {0020-9910,1432-1297}, MRCLASS = {20F65 (57M07)}, MRNUMBER = {4337971}, MRREVIEWER = {John\ M.\ Mackay}, DOI = {10.1007/s00222-021-01057-x}, URL = {https://doi.org/10.1007/s00222-021-01057-x}, } @article {Avramidi-Okun-Schreve(2024), AUTHOR = {Avramidi, Grigori and Okun, Boris and Schreve, Kevin}, TITLE = {Homology {G}rowth, {H}yperbolization, and {F}ibering}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {34}, YEAR = {2024}, NUMBER = {2}, PAGES = {303--376}, ISSN = {1016-443X,1420-8970}, MRCLASS = {20F65 (20F67 57)}, MRNUMBER = {4715365}, DOI = {10.1007/s00039-024-00667-w}, URL = {https://doi.org/10.1007/s00039-024-00667-w}, } @article {Azzali-Goette-Schick(2015), AUTHOR = {Azzali, Sara and Goette, Sebastian and Schick, Thomas}, TITLE = {Large time limit and local {$L^2$}-index theorems for families}, JOURNAL = {J. Noncommut. Geom.}, FJOURNAL = {Journal of Noncommutative Geometry}, VOLUME = {9}, YEAR = {2015}, NUMBER = {2}, PAGES = {621--664}, ISSN = {1661-6952}, MRCLASS = {Preliminary Data}, MRNUMBER = {3359023}, DOI = {10.4171/JNCG/203}, URL = {http://dx.doi.org/10.4171/JNCG/203}, } @article {Bacher-Harpe-Jones(1995), AUTHOR = {Bacher, Roland and de la Harpe, Pierre and Jones, Vaughan}, TITLE = {Carr\'es commutatifs et invariants de structures combinatoires}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {320}, YEAR = {1995}, NUMBER = {9}, PAGES = {1049--1054}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {16E50 (05B20 05C25)}, MRNUMBER = {96h:16014}, } @article {Bacher-Harpe-Nagnibeda(1997), AUTHOR = {Bacher, Roland and de la Harpe, Pierre and Nagnibeda, Tatiana}, TITLE = {The lattice of integral flows and the lattice of integral cuts on a finite graph}, JOURNAL = {Bull. Soc. Math. France}, FJOURNAL = {Bulletin de la Soci\'et\'e Math\'ematique de France}, VOLUME = {125}, YEAR = {1997}, NUMBER = {2}, PAGES = {167--198}, ISSN = {0037-9484}, CODEN = {BSMFAA}, MRCLASS = {05C38 (11H06)}, MRNUMBER = {99c:05111}, MRREVIEWER = {Valentin E. Brimkov}, } @article{Bader-Caprace-Gelander-Mozes(2012), AUTHOR = {Bader, Uri and Caprace, Pierre-Emmanuel and Gelander, Tsachik and Mozes, Shahar}, TITLE = {Simple groups without lattices}, JOURNAL = {Bull. Lond. Math. Soc.}, FJOURNAL = {Bulletin of the London Mathematical Society}, VOLUME = {44}, YEAR = {2012}, NUMBER = {1}, PAGES = {55--67}, ISSN = {0024-6093}, MRCLASS = {22E40 (20E08)}, MRNUMBER = {2881324 (2012m:22017)}, MRREVIEWER = {B. Sury}, DOI = {10.1112/blms/bdr061}, URL = {http://dx.doi.org/10.1112/blms/bdr061}, } @article {Bader-Furman(2012), AUTHOR = {Bader, Uri and Furman, Alex}, TITLE = {Boundaries, {W}eyl groups, and superrigidity}, JOURNAL = {Electron. Res. Announc. Math. Sci.}, FJOURNAL = {Electronic Research Announcements in Mathematical Sciences}, VOLUME = {19}, YEAR = {2012}, PAGES = {41--48}, ISSN = {1935-9179}, MRCLASS = {22Fxx (20Gxx 37Axx)}, MRNUMBER = {2929597}, } @article {Bader-Furman-Gelander-Monod(2007), AUTHOR = {Bader, Uri and Furman, Alex and Gelander, Tsachik and Monod, Nicolas}, TITLE = {Property ({T}) and rigidity for actions on {B}anach spaces}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {198}, YEAR = {2007}, NUMBER = {1}, PAGES = {57--105}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {22D12 (22E41 37A15 46B04 46L99)}, MRNUMBER = {2316269 (2008g:22007)}, MRREVIEWER = {Alain Valette}, DOI = {10.1007/s11511-007-0013-0}, URL = {http://dx.doi.org/10.1007/s11511-007-0013-0}, } @article {Bader-Furman-Sauer(2013Inventiones), AUTHOR = {Bader, Uri and Furman, Alex and Sauer, Roman}, TITLE = {Integrable measure equivalence and rigidity of hyperbolic lattices}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {194}, YEAR = {2013}, NUMBER = {2}, PAGES = {313--379}, ISSN = {0020-9910}, MRCLASS = {22E40 (58D19)}, MRNUMBER = {3117525}, MRREVIEWER = {A. I. Danilenko}, DOI = {10.1007/s00222-012-0445-9}, URL = {http://dx.doi.org/10.1007/s00222-012-0445-9}, } @article {Bader-Furman-Sauer(2013efficient), AUTHOR = {Bader, Uri and Furman, Alex and Sauer, Roman}, TITLE = {Efficient subdivision in hyperbolic groups and applications}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {7}, YEAR = {2013}, NUMBER = {2}, PAGES = {263--292}, ISSN = {1661-7207}, MRCLASS = {20F67 (55N99)}, MRNUMBER = {3054570}, MRREVIEWER = {R{\'e}mi Bernard Coulon}, DOI = {10.4171/GGD/182}, URL = {http://dx.doi.org/10.4171/GGD/182}, } @article {Bader-Furman-Sauer(2014notions), AUTHOR = {Bader, Uri and Furman, Alex and Sauer, Roman}, TITLE = {Weak notions of normality and vanishing up to rank in {$L^2$}-cohomology}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2014}, NUMBER = {12}, PAGES = {3177--3189}, ISSN = {1073-7928}, MRCLASS = {20J06}, MRNUMBER = {3217658}, MRREVIEWER = {Alain Valette}, } @article {Bader-Furman-Sauer(2014cohomology), AUTHOR = {Bader, Uri and Rosendal, Christian and Sauer, Roman}, TITLE = {On the cohomology of weakly almost periodic group representations}, JOURNAL = {J. Topol. Anal.}, FJOURNAL = {Journal of Topology and Analysis}, VOLUME = {6}, YEAR = {2014}, NUMBER = {2}, PAGES = {153--165}, ISSN = {1793-5253}, MRCLASS = {22E41 (22A25)}, MRNUMBER = {3191647}, MRREVIEWER = {Tobias Hartnick}, DOI = {10.1142/S1793525314500125}, URL = {http://dx.doi.org/10.1142/S1793525314500125}, } @article {Bader-Furman-Sauer(2015), AUTHOR = {Bader, Uri and Furman, Alex and Sauer, Roman}, TITLE = {On the structure and arithmeticity of lattice envelopes}, JOURNAL = {C. R. Math. Acad. Sci. Paris}, FJOURNAL = {Comptes Rendus Math\'ematique. Acad\'emie des Sciences. Paris}, VOLUME = {353}, YEAR = {2015}, NUMBER = {5}, PAGES = {409--413}, ISSN = {1631-073X}, MRCLASS = {22D05 (20F99 22E40)}, MRNUMBER = {3334993}, MRREVIEWER = {Pierre-Emmanuel Caprace}, DOI = {10.1016/j.crma.2015.02.010}, URL = {http://dx.doi.org/10.1016/j.crma.2015.02.010}, } @article {Bader-Gelander-Monod(2012), AUTHOR = {Bader, U. and Gelander, T. and Monod, N.}, TITLE = {A fixed point theorem for {$L^1$} spaces}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {189}, YEAR = {2012}, NUMBER = {1}, PAGES = {143--148}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {47H10 (46B04 46L05)}, MRNUMBER = {2929085}, DOI = {10.1007/s00222-011-0363-2}, URL = {http://dx.doi.org/10.1007/s00222-011-0363-2}, } @article{Bader-Furman-Sauer(2019), AUTHOR = {Bader, Uri and Furman, Alex and Sauer, Roman}, TITLE = {An adelic arithmeticity theorem for lattices in products}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {293}, YEAR = {2019}, NUMBER = {3-4}, PAGES = {1181--1199}, ISSN = {0025-5874,1432-1823}, MRCLASS = {22E40 (20G25 22D05)}, MRNUMBER = {4024582}, MRREVIEWER = {Pierre-Emmanuel\ Caprace}, DOI = {10.1007/s00209-019-02241-9}, URL = {https://doi.org/10.1007/s00209-019-02241-9}, } @article{Bader-Lubotzky-Sauer-Weinberger(2023), AUTHOR = {Bader, Uri and Lubotzky, Alexander and Sauer, Roman and Weinberger, Shmuel}, TITLE = {Stability and instability of lattices in semisimple groups}, JOURNAL = {J. Anal. Math.}, FJOURNAL = {Journal d'Analyse Math\'ematique}, VOLUME = {151}, YEAR = {2023}, NUMBER = {1}, PAGES = {1--23}, ISSN = {0021-7670,1565-8538}, MRCLASS = {22E40}, MRNUMBER = {4682943}, DOI = {10.1007/s11854-023-0329-5}, URL = {https://doi.org/10.1007/s11854-023-0329-5}, } @article {Badzioch-Dorabia-Klein-Williams(2011), AUTHOR = {Badzioch, Bernard and Dorabia{\l}a, Wojciech and Klein, John R. and Williams, Bruce}, TITLE = {Equivalence of higher torsion invariants}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {226}, YEAR = {2011}, NUMBER = {3}, PAGES = {2192--2232}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {57Q10 (19J10)}, MRNUMBER = {2739777 (2012d:57040)}, MRREVIEWER = {Stefan Haller}, DOI = {10.1016/j.aim.2010.09.017}, URL = {http://dx.doi.org/10.1016/j.aim.2010.09.017}, } @article {Baer(1993), AUTHOR = {B{\"a}r, Christian}, TITLE = {Real {K}illing spinors and holonomy}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {154}, YEAR = {1993}, NUMBER = {3}, PAGES = {509--521}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {53C25 (58G30)}, MRNUMBER = {94i:53042}, MRREVIEWER = {Oussama Hijazi}, } @article {Baer(1994), AUTHOR = {B{\"a}r, Christian}, TITLE = {A remark on positively curved $4$-manifolds}, JOURNAL = {Differential Geom. Appl.}, FJOURNAL = {Differential Geometry and its Applications}, VOLUME = {4}, YEAR = {1994}, NUMBER = {1}, PAGES = {71--75}, ISSN = {0926-2245}, CODEN = {DGAPEO}, MRCLASS = {53C20 (53C21)}, MRNUMBER = {95j:53054}, MRREVIEWER = {Oussama Hijazi}, } @article {Baer(1996a), AUTHOR = {B{\"a}r, Christian}, TITLE = {The {D}irac operator on space forms of positive curvature}, JOURNAL = {J. Math. Soc. Japan}, FJOURNAL = {Journal of the Mathematical Society of Japan}, VOLUME = {48}, YEAR = {1996}, NUMBER = {1}, PAGES = {69--83}, ISSN = {0025-5645}, CODEN = {NISUBC}, MRCLASS = {58G25}, MRNUMBER = {96k:58223}, MRREVIEWER = {J. Alfredo Jim{\'e}nez}, } @article {Baer(1996b), AUTHOR = {B{\"a}r, Christian}, TITLE = {Metrics with harmonic spinors}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {6}, YEAR = {1996}, NUMBER = {6}, PAGES = {899--942}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G25 (53C20)}, MRNUMBER = {98a:58162}, MRREVIEWER = {Patrick T. McDonald}, } @article {Baer(1997), AUTHOR = {B{\"a}r, Christian}, TITLE = {On nodal sets for {D}irac and {L}aplace operators}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {188}, YEAR = {1997}, NUMBER = {3}, PAGES = {709--721}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G25 (58G03)}, MRNUMBER = {98g:58179}, MRREVIEWER = {Uwe Semmelmann}, } @article {Baer(1997b), AUTHOR = {B{\"a}r, Christian}, TITLE = {Harmonic spinors for twisted {D}irac operators}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {309}, YEAR = {1997}, NUMBER = {2}, PAGES = {225--246}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {58G25 (53C20)}, MRNUMBER = {99a:58156}, MRREVIEWER = {Jean-Louis Milhorat}, } @article {Baer(1998a), AUTHOR = {B{\"a}r, Christian}, TITLE = {Heat operator and $\zeta$-function estimates for surfaces}, JOURNAL = {Arch. Math. (Basel)}, FJOURNAL = {Archiv der Mathematik. Archives of Mathematics. Archives Math\'ematiques}, VOLUME = {71}, YEAR = {1998}, NUMBER = {1}, PAGES = {63--70}, ISSN = {0003-889X}, CODEN = {ACVMAL}, MRCLASS = {58G26 (11M06 11M41 58G11 58G25)}, MRNUMBER = {99i:58151}, MRREVIEWER = {Friedbert Pr{\"u}fer}, } @article {Baer(1998b), AUTHOR = {Ammann, Bernd and B{\"a}r, Christian}, TITLE = {The {D}irac operator on nilmanifolds and collapsing circle bundles}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {16}, YEAR = {1998}, NUMBER = {3}, PAGES = {221--253}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {58G25 (53C25 53C30 58G30)}, MRNUMBER = {99h:58194}, MRREVIEWER = {Uwe Semmelmann}, } @article {Baer(1998d), AUTHOR = {B{\"a}r, Christian}, TITLE = {Extrinsic bounds for eigenvalues of the {D}irac operator}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {16}, YEAR = {1998}, NUMBER = {6}, PAGES = {573--596}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {58G25}, MRNUMBER = {99k:58183}, MRREVIEWER = {Jean-Louis Milhorat}, } @article {Baer(1998c), AUTHOR = {B{\"a}r, Christian}, TITLE = {The {D}irac operator on hyperbolic manifolds of finite volume}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {54}, YEAR = {2000}, NUMBER = {3}, PAGES = {439--488}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58J50 (53C27)}, MRNUMBER = {MR1823312 (2002c:58048)}, MRREVIEWER = {Thomas Schick}, } @article {Baer(1999), AUTHOR = {B{\"a}r, Christian}, TITLE = {Zero sets of solutions to semilinear elliptic systems of first order}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {138}, YEAR = {1999}, NUMBER = {1}, PAGES = {183--202}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {58Jxx (35Axx 35Jxx)}, MRNUMBER = {1 714 341}, } @article {Baer(1999b), AUTHOR = {B{\"a}r, Christian}, TITLE = {Elliptic symbols}, JOURNAL = {Math. Nachr.}, FJOURNAL = {Mathematische Nachrichten}, VOLUME = {201}, YEAR = {1999}, PAGES = {7--35}, ISSN = {0025-584X}, MRCLASS = {58J60 (58J05 58J20)}, MRNUMBER = {2000i:58063}, MRREVIEWER = {Uwe Semmelmann}, } @incollection {Baer(1999c), AUTHOR = {B{\"a}r, Christian}, TITLE = {Harmonic spinors and topology}, BOOKTITLE = {New developments in differential geometry, Budapest 1996}, PAGES = {53--66}, PUBLISHER = {Kluwer Acad. Publ.}, ADDRESS = {Dordrecht}, YEAR = {1999}, MRCLASS = {53C21 (58A14 58G30)}, MRNUMBER = {99m:53074}, MRREVIEWER = {Hans-Bert Rademacher}, } @article {Baer(2000), AUTHOR = {B{\"a}r, Christian}, TITLE = {Localization and semibounded energy---a weak unique continuation theorem}, JOURNAL = {J. Geom. Phys.}, FJOURNAL = {Journal of Geometry and Physics}, VOLUME = {34}, YEAR = {2000}, NUMBER = {2}, PAGES = {155--161}, ISSN = {0393-0440}, CODEN = {JGPHE5}, MRCLASS = {58J05 (35B05 35B60)}, MRNUMBER = {2001e:58025}, MRREVIEWER = {Hans-Bert Rademacher}, } @incollection {Baer-Bleeker(1999a), AUTHOR = {B{\"a}r, Christian and Bleecker, David}, TITLE = {The {D}irac operator and the scalar curvature of continuously deformed algebraic varieties}, BOOKTITLE = {Geometric aspects of partial differential equations (Roskilde, 1998)}, PAGES = {3--24}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1999}, MRCLASS = {53C21 (53C27 58J60)}, MRNUMBER = {2000h:53043}, MRREVIEWER = {Bernd Ammann}, } @article {Baer-Dahl(2001), AUTHOR = {B{\"a}r, Christian and Dahl, Mattias}, TITLE = {Surgery and the spectrum of the {D}irac operator}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {552}, YEAR = {2002}, PAGES = {53--76}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {58J50 (53C27)}, MRNUMBER = {MR1940432 (2003h:58041)}, MRREVIEWER = {Thomas Schick}, } @article {Baer-Strohmaier(2000), AUTHOR = {B{\"a}r, Christian and Strohmaier, Alexander}, TITLE = {Semi-bounded restrictions of {D}irac type operators and the unique continuation property}, JOURNAL = {Differential Geom. Appl.}, FJOURNAL = {Differential Geometry and its Applications}, VOLUME = {15}, YEAR = {2001}, NUMBER = {2}, PAGES = {175--182}, ISSN = {0926-2245}, CODEN = {DGAPEO}, MRCLASS = {58J05 (35B05 35B60 58J60 81T20)}, MRNUMBER = {MR1857562 (2003b:58031)}, MRREVIEWER = {Uwe Semmelmann}, } @article {Bagley-Peyrovian(1986), AUTHOR = {Bagley, R. W. and Peyrovian, M. R.}, TITLE = {A note on compact subgroups of topological groups}, JOURNAL = {Bull. Austral. Math. Soc.}, FJOURNAL = {Bulletin of the Australian Mathematical Society}, VOLUME = {33}, YEAR = {1986}, NUMBER = {2}, PAGES = {273--278}, ISSN = {0004-9727}, CODEN = {ALNBAB}, MRCLASS = {22D05}, MRNUMBER = {832529 (87i:22016)}, MRREVIEWER = {Kwang Chul Ha}, DOI = {10.1017/S0004972700003142}, URL = {http://dx.doi.org/10.1017/S0004972700003142}, } @article {Bahtirin-Olshansskii(2011), AUTHOR = {Bahturin, Yuri and Olshanskii, Alexander}, TITLE = {Filtrations and distortion in infinite-dimensional algebras}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {327}, YEAR = {2011}, PAGES = {251--291}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16W70 (16P90 17B65 20F69)}, MRNUMBER = {2746038 (2012f:16106)}, MRREVIEWER = {Vesselin Drensky}, DOI = {10.1016/j.jalgebra.2010.09.019}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2010.09.019}, } @article {Baik-Howie-Pride(1993), AUTHOR = {Baik, Young-Gheel and Howie, James and Pride, Stephen J.}, TITLE = {The identity problem for graph products of groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {162}, YEAR = {1993}, NUMBER = {1}, PAGES = {168--177}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20F05 (20F32)}, MRNUMBER = {94i:20049}, MRREVIEWER = {Carl Droms}, } @article {Bak(1974), AUTHOR = {Bak, Anthony}, TITLE = {The computation of surgery groups of odd torsion groups}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {80}, YEAR = {1974}, NUMBER = {6}, PAGES = {1113--1116}, ISSN = {0002-9904}, MRCLASS = {57D65 (10C05 18F25)}, MRNUMBER = {MR0494156 (58 \#13083)}, } @article {Bak(1975), AUTHOR = {Bak, Anthony}, TITLE = {Odd dimension surgery groups of odd torsion groups vanish}, JOURNAL = {Topology}, VOLUME = {14}, YEAR = {1975}, NUMBER = {4}, PAGES = {367--374}, MRCLASS = {57D65 (18F25)}, MRNUMBER = {53 \#4098}, MRREVIEWER = {A. A. Ranicki}, } @incollection {Bak(1976), AUTHOR = {Bak, Anthony}, TITLE = {The computation of surgery groups of finite groups with abelian $2$-hyperelementary subgroups}, BOOKTITLE = {Algebraic $K$-theory (Proc. Conf., Northwestern Univ., Evanston, Ill., 1976)}, PAGES = {384--409. Lecture Notes in Math., Vol. 551}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1976}, MRCLASS = {18F25 (57D65)}, MRNUMBER = {57 \#9800}, MRREVIEWER = {A. A. Ranicki}, } @article {Bak(1977), AUTHOR = {Bak, Anthony}, TITLE = {The involution on {W}hitehead torsion}, JOURNAL = {General Topology and Appl.}, FJOURNAL = {General Topology and its Applications}, VOLUME = {7}, YEAR = {1977}, NUMBER = {2}, PAGES = {201--206}, ISSN = {0016-660X}, MRCLASS = {57C10}, MRNUMBER = {451249}, MRREVIEWER = {V.\ P.\ Snaith}, } @article {Bak(1978), AUTHOR = {Bak, Anthony}, TITLE = {The computation of even dimension surgery groups of odd torsion groups}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {6}, YEAR = {1978}, NUMBER = {14}, PAGES = {1393--1458}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {18F25 (57R67)}, MRNUMBER = {MR507109 (80b:18010)}, MRREVIEWER = {A. A. Ranicki}, } @book {Bak(1981), AUTHOR = {Bak, Anthony}, TITLE = {${K}$-theory of forms}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1981}, PAGES = {viii+268}, ISBN = {0-691-08274-X; 0-691-08275-8}, MRCLASS = {10C05 (18F25)}, MRNUMBER = {84m:10012}, } @article {Bak-Kolster(1982), AUTHOR = {Bak, Anthony and Kolster, Manfred}, TITLE = {The computation of odd-dimensional projective surgery groups of finite groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {21}, YEAR = {1982}, NUMBER = {1}, PAGES = {35--63}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57R67 (10C05 18F25)}, MRNUMBER = {82j:57032}, MRREVIEWER = {A. A. Ranicki}, } @article {Bak-Morimoto(1994), AUTHOR = {Bak, Anthony and Morimoto, Masaharu}, TITLE = {${K}$-theoretic groups with positioning map and equivariant surgery}, JOURNAL = {Proc. Japan Acad. Ser. A Math. Sci.}, FJOURNAL = {Japan Academy. Proceedings. Series A. Mathematical Sciences}, VOLUME = {70}, YEAR = {1994}, NUMBER = {1}, PAGES = {6--11}, ISSN = {0386-2194}, CODEN = {PJAADT}, MRCLASS = {19G12 (57S17)}, MRNUMBER = {95e:19006}, MRREVIEWER = {Ian Hambleton}, } @article {Bak-Morimoto(1996), AUTHOR = {Bak, Anthony and Morimoto, Masaharu}, TITLE = {Equivariant surgery with middle-dimensional singular sets. {I}}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {8}, YEAR = {1996}, NUMBER = {3}, PAGES = {267--302}, ISSN = {0933-7741}, CODEN = {FOMAEF}, MRCLASS = {57S17 (19G24 19J25 57R67 57R91)}, MRNUMBER = {97b:57031}, MRREVIEWER = {A. A. Ranicki}, } @Article{Bak-Muranov(2012), Author = {Bak, A. and Muranov, Y. V.}, Title = {Surgery on a pair of transversal manifolds}, FJournal = {Journal of Homotopy and Related Structures}, Journal = {J. Homotopy Relat. Struct.}, ISSN = {2193-8407}, Volume = {7}, Number = {2}, Pages = {255--279}, Year = {2012}, Language = {English}, DOI = {10.1007/s40062-012-0009-0}, Keywords = {57R67,19J25,57N99}, zbMATH = {6111452}, Zbl = {1257.57034} } @Article{Balko-Macko-Niepel-Rusin(2019a), Author = {Balko, L'udov{\'{\i}}t and Macko, Tibor and Niepel, Martin and Rusin, Tom{\'a}{\v{s}}}, Title = {Higher simple structure sets of {Lens} spaces with the fundamental group of order {{\(2^K\)}}}, FJournal = {Topology and its Applications}, Journal = {Topology Appl.}, ISSN = {0166-8641}, Volume = {263}, Pages = {299--320}, Year = {2019}, Language = {English}, DOI = {10.1016/j.topol.2019.06.042}, Keywords = {57R65,57S25}, zbMATH = {7081140}, Zbl = {1421.57043} } @Article{Balko-Macko-Niepel-Rusin(2019b), Author = {Balko, L'udov{\'{\i}}t and Macko, Tibor and Niepel, Martin and Rusin, Tom{\'a}{\v{s}}}, Title = {Higher simple structure sets of lens spaces with the fundamental group of arbitrary order}, FJournal = {Archivum Mathematicum}, Journal = {Arch. Math., Brno},       ISSN = {0044-8753},       Volume = {55},       Number = {5},       Pages = {267--280}, Year = {2019}, Language = {English},       DOI = {10.5817/AM2019-5-267},       Keywords = {57R65,57S25},       zbMATH = {7144742},       Zbl = {1488.57006} } @book {Balanov-Kushkuley(1996), AUTHOR = {Kushkuley, Alexander and Balanov, Zalman}, TITLE = {Geometric methods in degree theory for equivariant maps}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1996}, PAGES = {vi+136}, ISBN = {3-540-61529-6}, MRCLASS = {58C30 (47H11 55M25 55M35 57S15)}, MRNUMBER = {97m:58024}, MRREVIEWER = {Christian Fenske}, } @book {Ballmann(1995), AUTHOR = {Ballmann, Werner}, TITLE = {Lectures on spaces of nonpositive curvature}, NOTE = {With an appendix by M.~Brin}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1995}, PAGES = {viii+112}, ISBN = {3-7643-5242-6}, MRCLASS = {53C21 (58F17)}, MRNUMBER = {97a:53053}, MRREVIEWER = {Boris Hasselblatt}, } @article {Ballmann-Bruening(2001), AUTHOR = {Ballmann, Werner and Br{\"u}ning, Jochen}, TITLE = {On the spectral theory of manifolds with cusps}, JOURNAL = {J. Math. Pures Appl. (9)}, FJOURNAL = {Journal de Math\'ematiques Pures et Appliqu\'ees. Neuvi\`eme S\'erie}, VOLUME = {80}, YEAR = {2001}, NUMBER = {6}, PAGES = {593--625}, ISSN = {0021-7824}, CODEN = {JMPAAM}, MRCLASS = {58Jxx}, MRNUMBER = {1 842 292}, } @article {Ballmann-Eberlein(1987), AUTHOR = {Ballmann, Werner and Eberlein, Patrick B.}, TITLE = {Fundamental groups of manifolds of nonpositive curvature}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {25}, YEAR = {1987}, NUMBER = {1}, PAGES = {1--22}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C20}, MRNUMBER = {88b:53047}, MRREVIEWER = {Viktor Schroeder}, } @book {Ballmann-Gromov-Schroeder(1985), AUTHOR = {Ballmann, Werner and Gromov, Mikhael and Schroeder, Viktor}, TITLE = {Manifolds of nonpositive curvature}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1985}, PAGES = {vi+263}, ISBN = {0-8176-3181-X}, MRCLASS = {53C20}, MRNUMBER = {87h:53050}, MRREVIEWER = {Gudlaugur Thorbergsson}, } @article {Ballmann-Swiatowski(1997), AUTHOR = {Ballmann, Werner and {\'S}wi{\polhk{a}}tkowski, Jacek}, TITLE = {On ${L}\sp 2$-cohomology and property ({T}) for automorphism groups of polyhedral cell complexes}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {7}, YEAR = {1997}, NUMBER = {4}, PAGES = {615--645}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {20F32 (20J05 22D10 53C23 57M07)}, MRNUMBER = {98m:20043}, MRREVIEWER = {Alain Valette}, } @article {Balm-Friedl-Kalfagianni-Powell(2012), AUTHOR = {Balm, Cheryl and Friedl, Stefan and Kalfagianni, Efstratia and Powell, Mark}, TITLE = {Cosmetic crossings and {S}eifert matrices}, JOURNAL = {Comm. Anal. Geom.}, FJOURNAL = {Communications in Analysis and Geometry}, VOLUME = {20}, YEAR = {2012}, NUMBER = {2}, PAGES = {235--253}, ISSN = {1019-8385}, MRCLASS = {57M25 (57M27)}, MRNUMBER = {2928712}, MRREVIEWER = {Dale P. O. Rolfsen}, } @article {Balmer-Matthey(2004a), AUTHOR = {Balmer, Paul and Matthey, Michel}, TITLE = {Codescent theory. {I}. {F}oundations}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {145}, YEAR = {2004}, NUMBER = {1-3}, PAGES = {11--59}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {18E10 (19K35 19L47)}, MRNUMBER = {MR2100543}, } @article {Balmer-Matthey(2004b), AUTHOR = {Balmer, Paul and Matthey, Michel}, TITLE = {Model theoretic reformulation of the {B}aum-{C}onnes and {F}arrell-{J}ones conjectures}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {189}, YEAR = {2004}, NUMBER = {2}, PAGES = {495--500}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {19B28 (19D35 19G24 19K35 57R67)}, MRNUMBER = {MR2101228}, } @article {Balmer-Matthey(2006), AUTHOR = {Balmer, Paul and Matthey, Michel}, TITLE = {Codescent theory. {II}. {C}ofibrant approximations}, JOURNAL = {Homology, Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {8}, YEAR = {2006}, NUMBER = {1}, PAGES = {211--242 (electronic)}, ISSN = {1532-0073}, MRCLASS = {18Gxx (55Uxx)}, MRNUMBER = {MR2205219}, } @article {Balmer-Schlichting(2001), AUTHOR = {Balmer, Paul and Schlichting, Marco}, TITLE = {Idempotent completion of triangulated categories}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {236}, YEAR = {2001}, NUMBER = {2}, PAGES = {819--834}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {18E30}, MRNUMBER = {MR1813503 (2002a:18013)}, DOI = {10.1006/jabr.2000.8529}, URL = {http://dx.doi.org/10.1006/jabr.2000.8529}, } @article {Banagl(2008), AUTHOR = {Banagl, Markus}, TITLE = {The signature of partially defined local coefficient systems}, JOURNAL = {J. Knot Theory Ramifications}, FJOURNAL = {Journal of Knot Theory and its Ramifications}, VOLUME = {17}, YEAR = {2008}, NUMBER = {12}, PAGES = {1455--1481}, ISSN = {0218-2165}, MRCLASS = {55N33 (57N80 57R40)}, MRNUMBER = {MR2477588 (2010d:55009)}, MRREVIEWER = {Harry Tamvakis}, DOI = {10.1142/S0218216508006701}, URL = {http://dx.doi.org/10.1142/S0218216508006701}, } @book {Banagl(2007), AUTHOR = {Banagl, M.}, TITLE = {Topological invariants of stratified spaces}, SERIES = {Springer Monographs in Mathematics}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2007}, PAGES = {xii+259}, ISBN = {978-3-540-38585-1; 3-540-38585-1}, MRCLASS = {55N33 (32S60)}, MRNUMBER = {MR2286904 (2007j:55007)}, MRREVIEWER = {Laurentiu G. Maxim}, } @article {Banagl(2006walks), AUTHOR = {Banagl, Markus}, TITLE = {Combinatorial random walks on 3-manifolds}, JOURNAL = {Experiment. Math.}, FJOURNAL = {Experimental Mathematics}, VOLUME = {15}, YEAR = {2006}, NUMBER = {3}, PAGES = {367--381}, ISSN = {1058-6458}, MRCLASS = {60C05 (57N10 60G50)}, MRNUMBER = {MR2264473}, URL = {http://projecteuclid.org/getRecord?id=euclid.em/1175789765}, } @article {Banagl(2006Witt), AUTHOR = {Banagl, Markus}, TITLE = {The {$L$}-class of non-{W}itt spaces}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {163}, YEAR = {2006}, NUMBER = {3}, PAGES = {743--766}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {55N33 (32S60 57R20)}, MRNUMBER = {MR2215133 (2007m:55006)}, DOI = {10.4007/annals.2006.163.743}, URL = {http://dx.doi.org/10.4007/annals.2006.163.743}, } @article {Banagl(2006twisted), AUTHOR = {Banagl, Markus}, TITLE = {Computing twisted signatures and {$L$}-classes of non-{W}itt spaces}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {92}, YEAR = {2006}, NUMBER = {2}, PAGES = {428--470}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {57R20 (55N33)}, MRNUMBER = {MR2205724 (2006j:57057)}, MRREVIEWER = {Laurentiu G. Maxim}, DOI = {10.1112/S0024611505015546}, URL = {http://dx.doi.org/10.1112/S0024611505015546}, } @article {Banagl(2006stratified), AUTHOR = {Banagl, Markus}, TITLE = {On topological invariants of stratified maps with non-{W}itt target}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {358}, YEAR = {2006}, NUMBER = {5}, PAGES = {1921--1935 (electronic)}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {55N33 (32S60 57R20)}, MRNUMBER = {MR2197435 (2006k:55012)}, MRREVIEWER = {Laurentiu G. Maxim}, DOI = {10.1090/S0002-9947-05-04129-2}, URL = {http://dx.doi.org/10.1090/S0002-9947-05-04129-2}, } @article {Banagl-Kulkarni(2004), AUTHOR = {Banagl, Markus and Kulkarni, Rajesh S.}, TITLE = {Self-dual sheaves on reductive {B}orel-{S}erre compactifications of {H}ilbert modular surfaces}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {105}, YEAR = {2004}, PAGES = {121--141}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {32S60 (11F75 14F43 22E46)}, MRNUMBER = {MR2057248 (2005d:32053)}, MRREVIEWER = {Alexander Caspar}, DOI = {10.1023/B:GEOM.0000024686.51668.c7}, URL = {http://dx.doi.org/10.1023/B:GEOM.0000024686.51668.c7}, } @article {Banagl(2002), AUTHOR = {Banagl, Markus}, TITLE = {Extending intersection homology type invariants to non-{W}itt spaces}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {160}, YEAR = {2002}, NUMBER = {760}, PAGES = {x+83}, ISSN = {0065-9266}, CODEN = {MAMCAU}, MRCLASS = {55N33 (32S60 57N80)}, MRNUMBER = {MR1937924 (2004e:55005)}, MRREVIEWER = {R. E. Stong}, } @article {Banagl-Cappell-Shaneson(2003), AUTHOR = {Banagl, Markus and Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Computing twisted signatures and {$L$}-classes of stratified spaces}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {326}, YEAR = {2003}, NUMBER = {3}, PAGES = {589--623}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {32S60 (55N25 55N33 57R20 57R45)}, MRNUMBER = {MR1992279 (2004i:32047)}, MRREVIEWER = {Burt Totaro}, } @article {Banagl-Friedman(2004), AUTHOR = {Banagl, Markus and Friedman, Greg}, TITLE = {Triangulations of 3-dimensional pseudomanifolds with an application to state-sum invariants}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {4}, YEAR = {2004}, PAGES = {521--542}, ISSN = {1472-2747}, MRCLASS = {57Q15 (57M27 57N80 57P05 57Q25)}, MRNUMBER = {MR2077675 (2005h:57034)}, MRREVIEWER = {Masahico Saito}, DOI = {10.2140/agt.2004.4.521}, URL = {http://dx.doi.org/10.2140/agt.2004.4.521}, } @article {Banagl-Ranicki(2006), AUTHOR = {Banagl, Markus and Ranicki, Andrew}, TITLE = {Generalized {A}rf invariants in algebraic {$L$}-theory}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {199}, YEAR = {2006}, NUMBER = {2}, PAGES = {542--668}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {57R67 (19J25)}, MRNUMBER = {MR2189218 (2006i:57061)}, MRREVIEWER = {Erik K. Pedersen}, DOI = {10.1016/j.aim.2005.08.003}, URL = {http://dx.doi.org/10.1016/j.aim.2005.08.003}, } @proceedings {Banaszak-Gajda-Krason(1996), TITLE = {Algebraic ${K}$-theory}, BOOKTITLE = {Proceedings of the Research Conference held at Adam Mickiewicz University, Pozna\'n, September 4--8, 1995}, EDITOR = {Banaszak, Grzegorz and Gajda, Wojciech and Kraso{\'n}, Piotr}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {1996}, PAGES = {xviii+210}, ISBN = {0-8218-0511-8}, MRCLASS = {19-06}, MRNUMBER = {97d:19001}, } @article {Banchoff(1967), AUTHOR = {Banchoff, Thomas}, TITLE = {Critical points and curvature for embedded polyhedra}, JOURNAL = {J. Differential Geometry}, VOLUME = {1}, YEAR = {1967}, PAGES = {245--256}, MRCLASS = {57.05}, MRNUMBER = {37 \#921}, MRREVIEWER = {S. S. Cairns}, } @article {Banyaga-Hurtubise(2009), AUTHOR = {Banyaga, Augustin and Hurtubise, David E.}, TITLE = {The {M}orse-{B}ott inequalities via a dynamical systems approach}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {29}, YEAR = {2009}, NUMBER = {6}, PAGES = {1693--1703}, ISSN = {0143-3857}, MRCLASS = {37D15 (37B30 58E05)}, MRNUMBER = {2563088}, MRREVIEWER = {James F. Reineck}, DOI = {10.1017/S0143385708000928}, URL = {http://dx.doi.org/10.1017/S0143385708000928}, } @article {Bar-Natan(1995), AUTHOR = {Bar-Natan, Dror}, TITLE = {On the {V}assiliev knot invariants}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {34}, YEAR = {1995}, NUMBER = {2}, PAGES = {423--472}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57M25}, MRNUMBER = {97d:57004}, MRREVIEWER = {Simon Willerton}, } @article {Baralic-Pruvlovic-Vrecica_zivaljevic(2012), AUTHOR = {Barali{\'c}, D. and Prvulovi{\'c},B. and Stojanovi{\'c}, G. and Vre{\'c}ica, S. and Zivaljevi{\'c}, R.}, TITLE = {Topological obstructions to totally skew embeddings}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {364}, YEAR = {2012}, NUMBER = {4}, PAGES = {2213--2226}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57R40 (55R40 57R20)}, MRNUMBER = {2869204}, MRREVIEWER = {J{\'u}lius Korba{\v{s}}}, DOI = {10.1090/S0002-9947-2011-05499-1}, URL = {http://dx.doi.org/10.1090/S0002-9947-2011-05499-1}, } @article {Barany-Blagojevic(2010), AUTHOR = {B{\'a}r{\'a}ny, Imre and Blagojevi{\'c}, Pavle and Sz{\H{u}}cs, Andr{\'a}s}, TITLE = {Equipartitioning by a convex 3-fan}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {223}, YEAR = {2010}, NUMBER = {2}, PAGES = {579--593}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {52A38}, MRNUMBER = {2565542 (2010j:52019)}, DOI = {10.1016/j.aim.2009.08.016}, URL = {http://dx.doi.org/10.1016/j.aim.2009.08.016}, } @article {Barbasch-Moscovici(1983), AUTHOR = {Barbasch, Dan and Moscovici, Henri}, TITLE = {${L}\sp{2}$-index and the {S}elberg trace formula}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {53}, YEAR = {1983}, NUMBER = {2}, PAGES = {151--201}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G10 (22E46)}, MRNUMBER = {85j:58137}, MRREVIEWER = {Roberto J. Miatello}, } @article {Barcenas(2014Brown), AUTHOR = {B{\'a}rcenas, No{\'e}}, TITLE = {Brown representability and spaces over a category}, JOURNAL = {Rev. Colombiana Mat.}, FJOURNAL = {Revista Colombiana de Matem\'aticas}, VOLUME = {48}, YEAR = {2014}, NUMBER = {1}, PAGES = {55--77}, ISSN = {0034-7426}, MRCLASS = {55Nxx (18B30)}, MRNUMBER = {3230797}, DOI = {10.15446/recolma.v48n1.45195}, URL = {http://dx.doi.org/10.15446/recolma.v48n1.45195}, } @article {Barcenas(2014stable), AUTHOR = {B{\'a}rcenas, No{\'e}}, TITLE = {Equivariant stable homotopy theory for proper actions of discrete groups}, JOURNAL = {Math. J. Okayama Univ.}, FJOURNAL = {Mathematical Journal of Okayama University}, VOLUME = {56}, YEAR = {2014}, PAGES = {91--115}, ISSN = {0030-1566}, MRCLASS = {55N91 (22F99 55Q10 55Q91)}, MRNUMBER = {3155084}, MRREVIEWER = {Steven R. Costenoble}, } @article {Barcenas(2013), AUTHOR = {B{\'a}rcenas Torres, No{\'e}}, TITLE = {Nonlinearity, proper actions and equivariant stable cohomotopy}, JOURNAL = {Pure Appl. Math. Q.}, FJOURNAL = {Pure and Applied Mathematics Quarterly}, VOLUME = {9}, YEAR = {2013}, NUMBER = {3}, PAGES = {387--416}, ISSN = {1558-8599}, MRCLASS = {55P91 (47A15 47H14)}, MRNUMBER = {3138468}, MRREVIEWER = {Steven R. Costenoble}, DOI = {10.4310/PAMQ.2013.v9.n3.a1}, URL = {http://dx.doi.org/10.4310/PAMQ.2013.v9.n3.a1}, } @article {Barcenas-Degrijse-Patchkoria(2017), AUTHOR = {B\'{a}rcenas, No\'{e} and Degrijse, Dieter and Patchkoria, Irakli}, TITLE = {Stable finiteness properties of infinite discrete groups}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {10}, YEAR = {2017}, NUMBER = {4}, PAGES = {1169--1196}, ISSN = {1753-8416}, MRCLASS = {55P91 (20J05 55P42)}, MRNUMBER = {3743073}, MRREVIEWER = {Samik Basu}, DOI = {10.1112/topo.12035}, URL = {https://doi.org/10.1112/topo.12035}, } @article {Barcenas-Espinoza-Joachim-Uribe(2014), AUTHOR = {B{\'a}rcenas, No{\'e} and Espinoza, Jes{\'u}s and Joachim, Michael and Uribe, Bernardo}, TITLE = {Universal twist in equivariant {$K$}-theory for proper and discrete actions}, JOURNAL = {Proc. Lond. Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {108}, YEAR = {2014}, NUMBER = {5}, PAGES = {1313--1350}, ISSN = {0024-6115}, MRCLASS = {19L50 (19L47 55M35)}, MRNUMBER = {3214681}, MRREVIEWER = {Charles Weibel}, DOI = {10.1112/plms/pdt061}, URL = {http://dx.doi.org/10.1112/plms/pdt061}, } @article {Barcenas-Velasquez(2014, AUTHOR = {B{\'a}rcenas, No{\'e} and Vel{\'a}squez, Mario}, TITLE = {Twisted equivariant {$K$}-theory and {$K$}-homology of {${\rm Sl}_3\Bbb Z$}}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {14}, YEAR = {2014}, NUMBER = {2}, PAGES = {823--852}, ISSN = {1472-2747}, MRCLASS = {19L47 (55N91)}, MRNUMBER = {3160604}, MRREVIEWER = {El-ka{\"{\i}}oum Mohamed Moutuou}, DOI = {10.2140/agt.2014.14.823}, URL = {http://dx.doi.org/10.2140/agt.2014.14.823}, } @article {Barnea-Schlage-Puchta(2013), AUTHOR = {Barnea, Yiftach and Schlage-Puchta, Jan-Christoph}, TITLE = {On {$p$}-deficiency in groups}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {16}, YEAR = {2013}, NUMBER = {4}, PAGES = {497--517}, ISSN = {1433-5883}, CODEN = {JGTHFQ}, MRCLASS = {Preliminary Data}, MRNUMBER = {3100997}, DOI = {10.1515/jgt-2013-0003}, URL = {http://dx.doi.org/10.1515/jgt-2013-0003}, } @article {Barrat-Gugenheim-Moore(1959), AUTHOR = {Barratt, M. G. and Gugenheim, V. K. A. M. and Moore, J. C.}, TITLE = {On semisimplicial fibre-bundles}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {81}, YEAR = {1959}, PAGES = {639--657}, ISSN = {0002-9327}, MRCLASS = {55.00}, MRNUMBER = {0111028 (22 \#1895)}, MRREVIEWER = {P. J. Hilton}, } @article {Barratt-Jones-Mahowald(1984), AUTHOR = {Barratt, M. G. and Jones, J. D. S. and Mahowald, M. E.}, TITLE = {Relations amongst {T}oda brackets and the {K}ervaire invariant in dimension $62$}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {The Journal of the London Mathematical Society. Second Series}, VOLUME = {30}, YEAR = {1984}, NUMBER = {3}, PAGES = {533--550}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {55Q45 (55T15)}, MRNUMBER = {87g:55025}, MRREVIEWER = {Haynes R. Miller}, } @article {Bartels(2001singularslice), AUTHOR = {Bartels, Arthur}, TITLE = {Higher dimensional links are singular slice}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {320}, YEAR = {2001}, NUMBER = {3}, PAGES = {547--576}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {57Q45}, MRNUMBER = {MR1846777 (2002e:57031)}, MRREVIEWER = {Uwe Kaiser}, } @article {Bartels(2003a), AUTHOR = {Bartels, Arthur C.}, TITLE = {Squeezing and higher algebraic {$K$}-theory}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {28}, YEAR = {2003}, NUMBER = {1}, PAGES = {19--37}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19D50 (19A31 19B28 19D55 19E20)}, MRNUMBER = {MR1988817 (2004f:19006)}, MRREVIEWER = {Charles Weibel}, } @article {Bartels(2003b), AUTHOR = {Bartels, Arthur C.}, TITLE = {On the domain of the assembly map in algebraic {$K$}-theory}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {3}, YEAR = {2003}, PAGES = {1037--1050 (electronic)}, ISSN = {1472-2747}, MRCLASS = {19D50 (19A31 19B28)}, MRNUMBER = {MR2012963 (2004h:19002)}, } @incollection {Bartels(2016), AUTHOR = {Bartels, Arthur}, TITLE = {On proofs of the {F}arrell-{J}ones conjecture}, BOOKTITLE = {Topology and geometric group theory}, SERIES = {Springer Proc. Math. Stat.}, VOLUME = {184}, PAGES = {1--31}, PUBLISHER = {Springer, [Cham]}, YEAR = {2016}, MRCLASS = {19D50 (19A31 19B28 19G24 20F67)}, MRNUMBER = {3598160}, DOI = {10.1007/978-3-319-43674-6_1}, URL = {https://doi.org/10.1007/978-3-319-43674-6_1}, } @article {Bartels(2017), AUTHOR = {Bartels, A.}, TITLE = {Coarse flow spaces for relatively hyperbolic groups}, JOURNAL = {Compos. Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {153}, YEAR = {2017}, NUMBER = {4}, PAGES = {745--779}, ISSN = {0010-437X}, MRCLASS = {20F65 (18F25 19D55 19G24 20F67)}, MRNUMBER = {3631229}, MRREVIEWER = {Peter A. Linnell}, DOI = {10.1112/S0010437X16008216}, URL = {https://doi.org/10.1112/S0010437X16008216}, } @inproceedings {Bartels(2018), AUTHOR = {Bartels, Arthur}, TITLE = {{$K$}-theory and actions on {E}uclidean retracts}, BOOKTITLE = {Proceedings of the {I}nternational {C}ongress of {M}athematicians---{R}io de {J}aneiro 2018. {V}ol. {II}. {I}nvited lectures}, PAGES = {1041--1062}, PUBLISHER = {World Sci. Publ., Hackensack, NJ}, YEAR = {2018}, MRCLASS = {19G24 (18F25 20F65 20F67)}, MRNUMBER = {3966799}, } @article {Bartels-Bestvina(2019), AUTHOR = {Bartels, Arthur and Bestvina, Mladen}, TITLE = {The {F}arrell-{J}ones conjecture for mapping class groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {215}, YEAR = {2019}, NUMBER = {2}, PAGES = {651--712}, ISSN = {0020-9910}, MRCLASS = {20F65 (18F25 32G15)}, MRNUMBER = {3910072}, DOI = {10.1007/s00222-018-0834-9}, URL = {https://doi.org/10.1007/s00222-018-0834-9}, } @incollection {Bartels-Echterhoff-Lueck(2008colim), author = {Bartels, A. and Echterhoff, S. and L\"uck, W.}, title = {Inheritance of Isomorphism Conjectures under colimits}, BOOKTITLE = {{K}-Theory and noncommutative geometry}, SERIES = {EMS-Series of Congress Reports}, PUBLISHER = {European Mathematical Society}, EDITOR = {Cortinaz and Cuntz and Karoubi and Nest and Weibel}, PAGES = {41--70}, YEAR = {2008}, } @incollection {Bartels-Farrell-Jones-Reich(2003), AUTHOR = {Bartels, Arthur and Farrell, Tom and Jones, Lowell and Reich, Holger}, TITLE = {A foliated squeezing theorem for geometric modules}, BOOKTITLE = {High-dimensional manifold topology}, PAGES = {1--21}, PUBLISHER = {World Sci. Publishing}, ADDRESS = {River Edge, NJ}, YEAR = {2003}, MRCLASS = {57N15 (19J10 57R80)}, MRNUMBER = {MR2048714 (2004m:57046)}, MRREVIEWER = {C. Bruce Hughes}, } @article {Bartels-Farrell-Jones-Reich(2004), AUTHOR = {Bartels, Arthur and Farrell, Tom and Jones, Lowell and Reich, Holger}, TITLE = {On the isomorphism conjecture in algebraic {$K$}-theory}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {43}, YEAR = {2004}, NUMBER = {1}, PAGES = {157--213}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {19D50 (19A31 19B28)}, MRNUMBER = {MR2030590 (2004m:19004)}, MRREVIEWER = {Stanis{\l}aw Betley}, } @article {Bartels-Farrell-Lueck(2014), AUTHOR = {Bartels, A. and Farrell, F. T. and L{\"u}ck, W.}, TITLE = {The {F}arrell-{J}ones {C}onjecture for cocompact lattices in virtually connected {L}ie groups}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {27}, YEAR = {2014}, NUMBER = {2}, PAGES = {339--388}, ISSN = {0894-0347}, MRCLASS = {Preliminary Data}, MRNUMBER = {3164984}, DOI = {10.1090/S0894-0347-2014-00782-7}, URL = {http://dx.doi.org/10.1090/S0894-0347-2014-00782-7}, } @article {Bartels-Lueck(2006), AUTHOR = {Bartels, Arthur and L{\"u}ck, Wolfgang}, TITLE = {Isomorphism conjecture for homotopy {$K$}-theory and groups acting on trees}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {205}, YEAR = {2006}, NUMBER = {3}, PAGES = {660--696}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {19D35 (19D55 57M07)}, MRNUMBER = {MR2210223}, } @article {Bartels-Lueck(2007ind), AUTHOR = {Bartels, Arthur and L{\"u}ck, Wolfgang}, TITLE = {Induction Theorems and Isomorphism Conjectures for {$K$}- and {$L$}-Theory}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {19}, YEAR = {2007}, PAGES = {379--406}, } @incollection {Bartels-Lueck(2009coeff), AUTHOR = {Bartels, Arthur and L{\"u}ck, Wolfgang}, TITLE = {On crossed product rings with twisted involutions, their module categories and {$L$}-theory}, BOOKTITLE = {Cohomology of groups and algebraic {$K$}-theory}, SERIES = {Adv. Lect. Math. (ALM)}, VOLUME = {12}, PAGES = {1--54}, PUBLISHER = {Int. Press, Somerville, MA}, YEAR = {2010}, MRCLASS = {19G24 (18F25 57R67)}, MRNUMBER = {2655174}, } @article {Bartels-Lueck(2012annals), AUTHOR = {Bartels, Arthur and L{\"u}ck, Wolfgang}, TITLE = {The {B}orel Conjecture for hyperbolic and {CAT(0)}-groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {175}, YEAR = {2012}, PAGES = {631--689}, } @article{Bartels-Lueck(2012CAT(0)flow), author = {Bartels, A. and L{\"u}ck, W.}, title = {Geodesic flow for {C}{A}{T}(0)-groups}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {16}, YEAR = {2012}, PAGES = {1345-1391}, } @article {Bartels-Lueck(2012FJmethod), AUTHOR = {Bartels, A. and L{\"u}ck, W.}, TITLE = {The {F}arrell-{H}siang method revisited}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {354}, YEAR = {2012}, NUMBER = {1}, PAGES = {209--226}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {19Gxx (19Bxx)}, MRNUMBER = {2957625}, DOI = {10.1007/s00208-011-0727-3}, URL = {http://dx.doi.org/10.1007/s00208-011-0727-3}, } @incollection {Bartels-Lueck(2023forward), AUTHOR = {Bartels, Arthur and L\"{u}ck, Wolfgang}, TITLE = {On the {A}lgebraic {K}-{T}heory of {H}ecke {A}lgebras}, BOOKTITLE = {Mathematics {G}oing {F}orward}, SERIES = {Lecture Notes in Math.}, VOLUME = {2313}, PAGES = {241--277}, PUBLISHER = {Springer, Cham}, YEAR = {2023}, ISBN = {978-3-031-12243-9; 9783031122446}, MRCLASS = {99-06}, MRNUMBER = {4627963}, DOI = {10.1007/978-3-031-12244-6\_19}, URL = {https://doi.org/10.1007/978-3-031-12244-6_19}, } @article{Bartels-Lueck(2024vanishing), AUTHOR= {Bartels, A. and L{\"u}ck, W.}, TITLE={Vanishing of {N}il-terms and negative {$K$}-theory for additive categories}, DOI={10.1017/prm.2024.103}, JOURNAL={Proceedings of the Royal Society of Edinburgh: Section A Mathematics}, Note = {First view, published online}, YEAR={2024}, PAGES={1--79}, } @article {Bartels-Lueck-Reich(2008cover), AUTHOR = {Bartels, Arthur and L{\"u}ck, Wolfgang and Reich, Holger}, TITLE = {Equivariant covers for hyperbolic groups}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {12}, YEAR = {2008}, NUMBER = {3}, PAGES = {1799--1882}, MRCLASS = {20F67 (20F65 37D40 57M07)}, MRNUMBER = {MR2421141}, } @article {Bartels-Lueck-Reich(2008hyper), AUTHOR = {Bartels, Arthur and L{\"u}ck, Wolfgang and Reich, Holger}, TITLE = {The {$K$}-theoretic {F}arrell-{J}ones conjecture for hyperbolic groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {172}, YEAR = {2008}, NUMBER = {1}, PAGES = {29--70}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {19D10 (19A31 19B28 20F67)}, MRNUMBER = {MR2385666}, } @article {Bartels-Lueck-Reich(2008appl), author = {Bartels, A. and L\"uck, W. and Reich, H.}, title = {On the {F}arrell-{J}ones {C}onjecture and its applications}, JOURNAL = {Journal of Topology}, VOLUME = {1}, YEAR = {2008}, PAGES = {57--86}, } @Article{Bartels-Lueck-Reich-Rueping(2014), Author = {Arthur {Bartels} and Wolfgang {L\"uck} and Holger {Reich} and Henrik {R\"uping}}, Title = {{K- and L-theory of group rings over $\mathrm{GL}_n(\mathbf Z)$.}}, FJournal = {{Publications Math\'ematiques}}, Journal = {{Publ. Math., Inst. Hautes \'Etud. Sci.}}, ISSN = {0073-8301; 1618-1913/e}, Volume = {119}, Pages = {97--125}, Year = {2014}, Publisher = {Institut des Hautes \'Etudes Scientifiques, Bures-sur-Yvette; Springer Verlag, Heidelberg}, Language = {English}, DOI = {10.1007/s10240-013-0055-0}, MSC2010 = {19 18 20} } @article{Bartels-Lueck-Weinberger(2010), author = {Bartels, A. and L\"uck, W. and Weinberger, S.}, title = {On hyperbolic groups with spheres as boundary}, JOURNAL = {Journal of Differential Geometry}, VOLUME = {86}, YEAR = {2010}, NUMBER = {1}, PAGES = {1--16}, } @article {Bartels-Reich(2005jams), AUTHOR = {Bartels, Arthur and Reich, Holger}, TITLE = {On the {F}arrell-{J}ones conjecture for higher algebraic {$K$}-theory}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {18}, YEAR = {2005}, NUMBER = {3}, PAGES = {501--545}, ISSN = {0894-0347}, MRCLASS = {19D50 (53C21)}, MRNUMBER = {MR2138135 (2006e:19004)}, MRREVIEWER = {Erik K. Pedersen}, } @article{Bartels-Reich(2007coeff), AUTHOR = {Bartels, Arthur and Reich, Holger}, TITLE = {Coefficients for the {F}arrell-{J}ones {C}onjecture}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {209}, YEAR = {2007}, NUMBER = {1}, PAGES = {337--362}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {19D50 (19J10 20F67 57R80)}, MRNUMBER = {MR2294225}, MRREVIEWER = {Stratos Prassidis}, } @article {Bartels-Rosenthal(2008asympdim), AUTHOR = {Bartels, Arthur and Rosenthal, David}, TITLE = {On the {$K$}-theory of groups with finite asymptotic dimension}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {612}, YEAR = {2007}, PAGES = {35--57}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {19Lxx (16E20)}, MRNUMBER = {MR2364073}, } @article {Bartels-Teichner(1999nullhomotopic), AUTHOR = {Bartels, Arthur and Teichner, Peter}, TITLE = {All two-dimensional links are null homotopic}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {3}, YEAR = {1999}, PAGES = {235--252 (electronic)}, ISSN = {1465-3060}, MRCLASS = {57Q45 (57M07 57Q60)}, MRNUMBER = {MR1714911 (2000i:57043)}, MRREVIEWER = {J. S. Birman}, } @book {Barth-Narasimhan(1990), TITLE = {Several complex variables. {V}{I}}, EDITOR = {Barth, Wolf and Narasimhan, Raghavan}, NOTE = {Complex manifolds, A translation of Sovremennye problemy matematiki. Fundamentalnye napravleniya, Tom 69, Akad. Nauk SSSR, Vsesoyuz. Inst. Nauchn. i Tekhn. Inform., Moscow}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1990}, PAGES = {viii+310}, ISBN = {3-540-52788-5}, MRCLASS = {32-06}, MRNUMBER = {91i:32001}, } @book {Barth-Peters-Ven(1984), AUTHOR = {Barth, Wolf and Peters, Chris and Van de Ven, Antonius}, TITLE = {Compact complex surfaces}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1984}, PAGES = {x+304}, ISBN = {3-540-12172-2}, MRCLASS = {32Jxx (14Jxx)}, MRNUMBER = {86c:32026}, MRREVIEWER = {I. Dolgachev}, } @article {Bartholdi-Kielak(2019), AUTHOR = {Bartholdi, Laurent}, TITLE = {Amenability of groups is characterized by {M}yhill's theorem}, NOTE = {With an appendix by Dawid Kielak}, JOURNAL = {J. Eur. Math. Soc. (JEMS)}, FJOURNAL = {Journal of the European Mathematical Society (JEMS)}, VOLUME = {21}, YEAR = {2019}, NUMBER = {10}, PAGES = {3191--3197}, ISSN = {1435-9855}, MRCLASS = {37B15 (16U20 43A07)}, MRNUMBER = {3994103}, MRREVIEWER = {Alexey Yakovlevich Kanel-Belov}, DOI = {10.4171/JEMS/900}, URL = {https://doi.org/10.4171/JEMS/900}, } @incollection {Bartholdi(2019), AUTHOR = {Bartholdi, Laurent}, TITLE = {Amenability of groups and {$G$}-sets}, BOOKTITLE = {Sequences, groups, and number theory}, SERIES = {Trends Math.}, PAGES = {433--544}, PUBLISHER = {Birkh\"{a}user/Springer, Cham}, YEAR = {2018}, MRCLASS = {43A07 (20-02 20E22)}, MRNUMBER = {3799933}, MRREVIEWER = {Phillip Richard Wesolek}, } @article {Bartholdi(2013), AUTHOR = {Bartholdi, Laurent}, TITLE = {({S}elf-)similar groups and the {F}arrell-{J}ones conjectures}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {7}, YEAR = {2013}, NUMBER = {1}, PAGES = {1--11}, ISSN = {1661-7207}, MRCLASS = {20E08 (19D10 20F65)}, MRNUMBER = {3019074}, DOI = {10.4171/GGD/175}, URL = {http://dx.doi.org/10.4171/GGD/175}, } @article {Bartholdi(2010), AUTHOR = {Bartholdi, Laurent}, TITLE = {Gardens of {E}den and amenability on cellular automata}, JOURNAL = {J. Eur. Math. Soc. (JEMS)}, FJOURNAL = {Journal of the European Mathematical Society (JEMS)}, VOLUME = {12}, YEAR = {2010}, NUMBER = {1}, PAGES = {241--248}, ISSN = {1435-9855}, MRCLASS = {05E15 (28D05 37B15 43A07 68Q80)}, MRNUMBER = {2578610 (2011e:05282)}, MRREVIEWER = {Dan Emanuel Popovici}, DOI = {10.4171/JEMS/196}, URL = {http://dx.doi.org/10.4171/JEMS/196}, } @article {Bartholdi-Erschler(2012), AUTHOR = {Bartholdi, Laurent and Erschler, Anna}, TITLE = {Growth of permutational extensions}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {189}, YEAR = {2012}, NUMBER = {2}, PAGES = {431--455}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20E22 (20F05)}, MRNUMBER = {2947548}, MRREVIEWER = {Matthew B. Day}, DOI = {10.1007/s00222-011-0368-x}, URL = {http://dx.doi.org/10.1007/s00222-011-0368-x}, } @incollection {Bartholdi-Grigorchuk-Suni(2003), AUTHOR = {Bartholdi, Laurent and Grigorchuk, Rostislav I. and {\v{S}}uni{\'k}, Zoran}, TITLE = {Branch groups}, BOOKTITLE = {Handbook of algebra, {V}ol. 3}, SERIES = {Handb. Algebr.}, VOLUME = {3}, PAGES = {989--1112}, PUBLISHER = {Elsevier/North-Holland, Amsterdam}, YEAR = {2003}, MRCLASS = {20E08 (05C25 20F10 20F65 22D10 37B05 43A07 68Q70)}, MRNUMBER = {2035113 (2005f:20046)}, MRREVIEWER = {Tullio G. Ceccherini-Silberstein}, DOI = {10.1016/S1570-7954(03)80078-5}, URL = {http://dx.doi.org/10.1016/S1570-7954(03)80078-5}, } @book {Bartsch(1993a), AUTHOR = {Bartsch, Thomas}, TITLE = {Topological methods for variational problems with symmetries}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1993}, PAGES = {x+152}, ISBN = {3-540-57378-X}, MRCLASS = {58E40 (34C23 35B32 47H15 55M30 55N91 58E05)}, MRNUMBER = {96a:58078}, MRREVIEWER = {James F. Reineck}, } @article {Bartsch(1993b), AUTHOR = {Bartsch, Thomas}, TITLE = {A simple proof of the degree formula for $({\mathbf {Z}}/p)$-equivariant maps}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {212}, YEAR = {1993}, NUMBER = {2}, PAGES = {285--292}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {55M25 (55M30)}, MRNUMBER = {94e:55007}, MRREVIEWER = {Heinrich Steinlein}, } @article {Bartsch-Clapp-Puppe(1991), AUTHOR = {Bartsch, Thomas and Clapp, M{\'o}nica and Puppe, Dieter}, TITLE = {A mountain pass theorem for actions of compact {L}ie groups}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {419}, YEAR = {1991}, PAGES = {55--66}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {58E05 (55P91 57S99 58B05 58E40)}, MRNUMBER = {93d:58023}, MRREVIEWER = {Annamaria Canino}, } @article {Bartsch-Willem(1994), AUTHOR = {Bartsch, Thomas and Willem, Michel}, TITLE = {Periodic solutions of nonautonomous {H}amiltonian systems with symmetries}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {451}, YEAR = {1994}, PAGES = {149--159}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {58E05 (34C25 58F05 58F22 70H05)}, MRNUMBER = {95i:58039}, MRREVIEWER = {Mario Girardi}, } @unpublished{Barwick(2013), AUTHOR = {Barwick, Clark}, TITLE = {On the {Q} construction for exact quasicategories}, NOTE = {Preprint, arXiv:1301.4725 [math.KT]}, YEAR = {2013}, } @Article{Barwick(2016), AUTHOR = {Barwick, Clark}, TITLE = {On the algebraic {{\(K\)}}-theory of higher categories}, FJOURNAL = {Journal of Topology}, JOURNAL = {J. Topol.}, ISSN = {1753-8416}, VOLUME = {9}, NUMBER = {1}, PAGES = {245--347}, YEAR = {2016}, DOI = {10.1112/jtopol/jtv042}, } @article {Barwick(2017), AUTHOR = {Barwick, Clark}, TITLE = {Spectral {M}ackey functors and equivariant algebraic {$K$}-theory ({I})}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {304}, YEAR = {2017}, PAGES = {646--727}, ISSN = {0001-8708,1090-2082}, MRCLASS = {19L47 (19D99 55P91)}, MRNUMBER = {3558219}, MRREVIEWER = {Anna\ Marie\ Bohmann}, DOI = {10.1016/j.aim.2016.08.043}, URL = {https://doi.org/10.1016/j.aim.2016.08.043}, } @article {Barwick-Glasman-Shah(2020), AUTHOR = {Barwick, Clark and Glasman, Saul and Shah, Jay}, TITLE = {Spectral {M}ackey functors and equivariant algebraic {$K$}-theory, {II}}, JOURNAL = {Tunis. J. Math.}, FJOURNAL = {Tunisian Journal of Mathematics}, VOLUME = {2}, YEAR = {2020}, NUMBER = {1}, PAGES = {97--146}, ISSN = {2576-7658,2576-7666}, MRCLASS = {19D99 (55P91)}, MRNUMBER = {3933393}, MRREVIEWER = {Marco\ Varisco}, DOI = {10.2140/tunis.2020.2.97}, URL = {https://doi.org/10.2140/tunis.2020.2.97}, } @article {Bass(1964), AUTHOR = {Bass, Hyman}, TITLE = {Projective modules over free groups are free}, JOURNAL = {J. Algebra}, VOLUME = {1}, YEAR = {1964}, PAGES = {367--373}, MRCLASS = {18.20 (13.90)}, MRNUMBER = {31 \#2290}, MRREVIEWER = {D. S. Rim}, } @book {Bass(1968), AUTHOR = {Bass, Hyman}, TITLE = {Algebraic ${K}$-theory}, PUBLISHER = {W. A. Benjamin, Inc., New York-Amsterdam}, YEAR = {1968}, PAGES = {xx+762}, MRCLASS = {18.20}, MRNUMBER = {40 \#2736}, MRREVIEWER = {A. Heller}, } @article {Bass(1972), AUTHOR = {Bass, Hyman}, TITLE = {The degree of polynomial growth of finitely generated nilpotent groups}, JOURNAL = {Proc. London Math. Soc. (3)}, VOLUME = {25}, YEAR = {1972}, PAGES = {603--614}, MRCLASS = {20F05}, MRNUMBER = {52 \#577}, MRREVIEWER = {I. B. S. Passi}, } @incollection {Bass(1973), AUTHOR = {Bass, Hyman}, TITLE = {Some problems in ``classical'' algebraic {$K$}-theory}, BOOKTITLE = {Algebraic $K$-theory, II: ``Classical'' algebraic $K$-theory and connections with arithmetic (Proc. Conf., Battelle Memorial Inst., Seattle, Wash., 1972)}, PAGES = {3--73. Lecture Notes in Math., Vol. 342}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1973}, MRCLASS = {18F25 (13D15 16A54)}, MRNUMBER = {53 \#13358}, MRREVIEWER = {Manuel Ojanguren}, } @article {Bass(1973a), AUTHOR = {Baas, Nils Andreas}, TITLE = {On bordism theory of manifolds with singularities}, JOURNAL = {Math. Scand.}, VOLUME = {33}, YEAR = {1973}, PAGES = {279--302 (1974)}, MRCLASS = {57D90}, MRNUMBER = {49 \#11547b}, MRREVIEWER = {R. E. Stong}, } @article {Bass(1973b), AUTHOR = {Baas, Nils Andreas}, TITLE = {On formal groups and singularities in complex cobordism theory}, JOURNAL = {Math. Scand.}, VOLUME = {33}, YEAR = {1973}, PAGES = {303--313 (1974)}, MRCLASS = {57D90 (14L05)}, MRNUMBER = {49 \#11547c}, MRREVIEWER = {R. E. Stong}, } @article {Baas-Dundas-Richter-Rognes(2013), AUTHOR = {Baas, Nils A. and Dundas, Bj{\o}rn Ian and Richter, Birgit and Rognes, John}, TITLE = {Ring completion of rig categories}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {674}, YEAR = {2013}, PAGES = {43--80}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {18Dxx}, MRNUMBER = {3010546}, } @article {Baas-Dundas-Richter-Rognes(2011), AUTHOR = {Baas, Nils A. and Dundas, Bj{\o}rn Ian and Richter, Birgit and Rognes, John}, TITLE = {Stable bundles over rig categories}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {4}, YEAR = {2011}, NUMBER = {3}, PAGES = {623--640}, ISSN = {1753-8416}, MRCLASS = {19D23 (18D10 19L41 55R65)}, MRNUMBER = {2832571 (2012k:19002)}, MRREVIEWER = {Daniel A. Ramras}, DOI = {10.1112/jtopol/jtr016}, URL = {http://dx.doi.org/10.1112/jtopol/jtr016}, } @incollection {Baas-Dundas-Rognes(2004), AUTHOR = {Baas, Nils A. and Dundas, Bj{\o}rn Ian and Rognes, John}, TITLE = {Two-vector bundles and forms of elliptic cohomology}, BOOKTITLE = {Topology, geometry and quantum field theory}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {308}, PAGES = {18--45}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {2004}, MRCLASS = {55N34 (18D05 57T30)}, MRNUMBER = {2079370 (2005e:55007)}, MRREVIEWER = {Mark Hovey}, DOI = {10.1017/CBO9780511526398.005}, URL = {http://dx.doi.org/10.1017/CBO9780511526398.005}, } @article {Bass(1976), AUTHOR = {Bass, Hyman}, TITLE = {Euler characteristics and characters of discrete groups}, JOURNAL = {Invent. Math.}, VOLUME = {35}, YEAR = {1976}, PAGES = {155--196}, MRCLASS = {20J05 (22E40)}, MRNUMBER = {55 \#5764}, MRREVIEWER = {Kenneth S. Brown}, } @incollection {Bass(1979), AUTHOR = {Bass, Hyman}, TITLE = {Traces and {E}uler characteristics}, BOOKTITLE = {Homological group theory (Proc. Sympos., Durham, 1977)}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {36}, PAGES = {1--26}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1979}, MRCLASS = {20J05}, MRNUMBER = {MR564418 (82i:20063)}, MRREVIEWER = {Ian M. Chiswell}, } @article {Bass(1993), AUTHOR = {Bass, Hyman}, TITLE = {Covering theory for graphs of groups}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {89}, YEAR = {1993}, NUMBER = {1-2}, PAGES = {3--47}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20E08 (57M07)}, MRNUMBER = {94j:20028}, MRREVIEWER = {Alexander Lubotzky}, } @article {Bass-Heller-Swan(1964), AUTHOR = {Bass, Hyman and Heller, Alex and Swan, Richard G.}, TITLE = {The {W}hitehead group of a polynomial extension}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, VOLUME = {22}, YEAR = {1964}, PAGES = {61--79}, MRCLASS = {18.20 (16.90)}, MRNUMBER = {30 \#4806}, MRREVIEWER = {J. F. Adams}, } @article {Bass-Lubotzky(1983), AUTHOR = {Bass, Hyman and Lubotzky, Alexander}, TITLE = {Automorphisms of groups and of schemes of finite type}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {44}, YEAR = {1983}, NUMBER = {1}, PAGES = {1--22}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {14L30 (20F34 57S30)}, MRNUMBER = {MR693651 (84i:14031)}, MRREVIEWER = {Klaus Pommerening}, } @article {Bass-Murthy(1967), AUTHOR = {Bass, Hyman and Murthy, M. Pavaman}, TITLE = {Grothendieck groups and {P}icard groups of abelian group rings}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {86}, YEAR = {1967}, PAGES = {16--73}, MRCLASS = {18.20 (13.00)}, MRNUMBER = {36 \#2671}, MRREVIEWER = {R. G. Swan}, } @article {Basu-Farrell(2016), AUTHOR = {Basu, Somnath and Farrell, F. Thomas}, TITLE = {Realizing congruence subgroups inside the diffeomorphism group of a product of homotopy spheres}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {202}, YEAR = {2016}, PAGES = {205--215}, ISSN = {0166-8641}, MRCLASS = {57S05}, MRNUMBER = {3464161}, MRREVIEWER = {Ricardo Berlanga Zubiaga}, DOI = {10.1016/j.topol.2016.01.002}, URL = {http://dx.doi.org/10.1016/j.topol.2016.01.002}, } @article {Basu-Kasilingam(2022), AUTHOR = {Basu, Samik and Kasilingam, Ramesh}, TITLE = {Inertia groups and smooth structures on quaternionic projective spaces}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {34}, YEAR = {2022}, NUMBER = {2}, PAGES = {369--383}, ISSN = {0933-7741}, MRCLASS = {57R60 (55P25 55P42 57R55)}, MRNUMBER = {4388343}, DOI = {10.1515/forum-2020-0125}, URL = {https://doi.org/10.1515/forum-2020-0125}, } @article {Basu-Kasilingam(2018), AUTHOR = {Basu, Samik and Kasilingam, Ramesh}, TITLE = {Inertia groups of high-dimensional complex projective spaces}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {18}, YEAR = {2018}, NUMBER = {1}, PAGES = {387--408}, ISSN = {1472-2747}, MRCLASS = {57R55 (55P25 55P42 57R60)}, MRNUMBER = {3748247}, MRREVIEWER = {Donald M. Davis}, DOI = {10.2140/agt.2018.18.387}, URL = {https://doi.org/10.2140/agt.2018.18.387}, } @article {Battikh(2007), AUTHOR = {Battikh, Naoufel}, TITLE = {Relation entre les conjectures de {F}arrell-{J}ones en {$K$}-th\'eories alg\'ebrique et hermitienne}, JOURNAL = {Ann. Inst. Fourier (Grenoble)}, FJOURNAL = {Universit\'e de Grenoble. Annales de l'Institut Fourier}, VOLUME = {57}, YEAR = {2007}, NUMBER = {1}, PAGES = {197--207}, ISSN = {0373-0956}, CODEN = {AIFUA7}, MRCLASS = {19D99 (19G38)}, MRNUMBER = {2313090 (2008g:19003)}, MRREVIEWER = {Ian Hambleton}, URL = {http://aif.cedram.org/item?id=AIF_2007__57_1_197_0}, } @article {Batyrev(1994), AUTHOR = {Batyrev, Victor V.}, TITLE = {Dual polyhedra and mirror symmetry for {C}alabi-{Y}au hypersurfaces in toric varieties}, JOURNAL = {J. Algebraic Geom.}, FJOURNAL = {Journal of Algebraic Geometry}, VOLUME = {3}, YEAR = {1994}, NUMBER = {3}, PAGES = {493--535}, ISSN = {1056-3911}, MRCLASS = {14J32 (14M25)}, MRNUMBER = {MR1269718 (95c:14046)}, MRREVIEWER = {I. Dolgachev}, } @book {Bauer(1978), AUTHOR = {Bauer, Heinz}, TITLE = {Wahrscheinlichkeitstheorie und {G}rundz\"uge der {M}asstheorie}, EDITION = {revised}, NOTE = {de Gruyter Lehrbuch}, PUBLISHER = {Walter de Gruyter, Berlin-New York}, YEAR = {1978}, PAGES = {408}, ISBN = {3-11-007698-5}, MRCLASS = {60-01 (28-01)}, MRNUMBER = {80b:60001}, } @article {Bauer(1989), AUTHOR = {Bauer, Stefan}, TITLE = {On the {S}egal conjecture for compact {L}ie groups}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {400}, YEAR = {1989}, PAGES = {134--145}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {55R35 (55Q10 55Q55 57S15)}, MRNUMBER = {90j:55023}, MRREVIEWER = {Gunnar Carlsson}, } @article {Bauer(1991), AUTHOR = {Bauer, Stefan}, TITLE = {Parabolic bundles, elliptic surfaces and ${\rm {S}{U}}(2)$-representation spaces of genus zero {F}uchsian groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {290}, YEAR = {1991}, NUMBER = {3}, PAGES = {509--526}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {14D20 (14H60 14J60)}, MRNUMBER = {92h:14007}, MRREVIEWER = {Dave Auckly}, } @article {Bauer(1992), AUTHOR = {Bauer, Stefan}, TITLE = {Some nonreduced moduli of bundles and {D}onaldson invariants for {D}olgachev surfaces}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {424}, YEAR = {1992}, PAGES = {149--180}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {14J27 (14J60 57M50 57R20)}, MRNUMBER = {93e:14043}, MRREVIEWER = {Jean-Marc Drezet}, } @article {Bauer(1993), AUTHOR = {Bauer, Stefan}, TITLE = {The diffeomorphism classification of non-simply connected {D}olgachev surfaces}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {442}, YEAR = {1993}, PAGES = {149--161}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {14J27 (57R55)}, MRNUMBER = {94h:14038}, MRREVIEWER = {James E. Alexander}, } @article {Bauer(1994), AUTHOR = {Bauer, Stefan}, TITLE = {Diffeomorphism types of elliptic surfaces with $p\sb g=1$}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {451}, YEAR = {1994}, PAGES = {89--148}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {14J27 (14D20 14J60 55R55 57R57)}, MRNUMBER = {95d:14031}, MRREVIEWER = {Zhenbo Qin}, } @Article{bauer-pedersen(2006), author = {Bauer, Tilman and Pedersen, Erik Kj\ae{}r}, title = {The realizability of local loop spaces as manifolds}, journal = {K-theory}, volume = {37/3}, year = 2006, note = {Preprint} } @article {bauer+kitchloo+notbohm+pedersen(2004), AUTHOR = {Bauer, Tilman and Kitchloo, Nitu and Notbohm, Dietrich and Pedersen, Erik Kj{\ae}r}, TITLE = {Finite loop spaces are manifolds}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {192}, YEAR = {2004}, NUMBER = {1}, PAGES = {5--31}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {57R19 (55P35 55P45 57R10 57R65)}, MRNUMBER = {MR2079597 (2005i:57035)}, MRREVIEWER = {Steven R. Costenoble}, } @book {Baues(1999), AUTHOR = {Baues, Hans Joachim}, TITLE = {Combinatorial foundation of homology and homotopy}, NOTE = {Applications to spaces, diagrams, transformation groups, compactifications, differential algebras, algebraic theories, simplicial objects, and resolutions}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1999}, PAGES = {xvi+362}, ISBN = {3-540-64984-0}, MRCLASS = {55-02 (18-02)}, MRNUMBER = {2000h:55001}, MRREVIEWER = {Teimuraz Pirashvili}, } @book {Baues(1977), AUTHOR = {Baues, Hans J.}, TITLE = {Obstruction theory on homotopy classification of maps}, SERIES = {Lecture Notes in Mathematics, Vol. 628}, PUBLISHER = {Springer-Verlag, Berlin-New York}, YEAR = {1977}, PAGES = {xi+387}, ISBN = {3-540-08534-3}, MRCLASS = {55G35}, MRNUMBER = {0467748}, MRREVIEWER = {Donald M. Davis}, } @article {Baues(1994), AUTHOR = {Baues, Hans Joachim}, TITLE = {Quadratic functors and metastable homotopy}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {91}, YEAR = {1994}, NUMBER = {1-3}, PAGES = {49--107}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55U35 (55Q40)}, MRNUMBER = {1255923 (94j:55022)}, MRREVIEWER = {Donald M. Davis}, DOI = {10.1016/0022-4049(94)90135-X}, URL = {http://dx.doi.org/10.1016/0022-4049(94)90135-X}, } @book {Baues(1991), AUTHOR = {Baues, Hans Joachim}, TITLE = {Combinatorial homotopy and $4$-dimensional complexes}, NOTE = {With a preface by Ronald Brown}, PUBLISHER = {Walter de Gruyter \& Co.}, ADDRESS = {Berlin}, YEAR = {1991}, PAGES = {xxviii+380}, ISBN = {3-11-012488-2}, MRCLASS = {55P15 (55-02 55N25 55Q05 55U15)}, MRNUMBER = {92h:55008}, MRREVIEWER = {Peter J. Eccles}, } @article {Baues-Grunewald(2006), AUTHOR = {Baues, Oliver and Grunewald, Fritz}, TITLE = {Automorphism groups of polycyclic-by-finite groups and arithmetic groups}, JOURNAL = {Publ. Math. Inst. Hautes \'Etudes Sci.}, FJOURNAL = {Publications Math\'ematiques. Institut de Hautes \'Etudes Scientifiques}, VOLUME = {104}, YEAR = {2006}, PAGES = {213--268}, ISSN = {0073-8301}, MRCLASS = {20F28 (20G15 22E40)}, MRNUMBER = {MR2264837 (2008c:20070)}, MRREVIEWER = {Karel Dekimpe}, } @article {Baues-Peyerimhoff(2001), AUTHOR = {Baues, Oliver and Peyerimhoff, Norbert}, TITLE = {Curvature and geometry of tessellating plane graphs}, JOURNAL = {Discrete Comput. Geom.}, FJOURNAL = {Discrete \& Computational Geometry. An International Journal of Mathematics and Computer Science}, VOLUME = {25}, YEAR = {2001}, NUMBER = {1}, PAGES = {141--159}, ISSN = {0179-5376}, CODEN = {DCGEER}, MRCLASS = {57M15 (05B45 52Cxx)}, MRNUMBER = {1 797 301}, } @article {Baum-Connes(1982), AUTHOR = {Baum, Paul and Connes, Alain}, TITLE = {Geometric ${K}$-theory for {L}ie groups and foliations}, JOURNAL = {Enseign. Math. (2)}, FJOURNAL = {L'Enseignement Math\'ematique. Revue Internationale. IIe S\'erie}, VOLUME = {46}, YEAR = {2000}, NUMBER = {1-2}, PAGES = {3--42}, ISSN = {0013-8584}, CODEN = {ENMAAR}, MRCLASS = {46Lxx (22Dxx 58Jxx)}, MRNUMBER = {1 769 535}, } @incollection {Baum-Connes(1988a), AUTHOR = {Baum, Paul and Connes, Alain}, TITLE = {Chern character for discrete groups}, BOOKTITLE = {A f\^ete of topology}, PAGES = {163--232}, PUBLISHER = {Academic Press}, ADDRESS = {Boston, MA}, YEAR = {1988}, MRCLASS = {58G12 (19L10 19L47 55N91)}, MRNUMBER = {90e:58149}, MRREVIEWER = {Jonathan M. Rosenberg}, } @incollection {Baum-Connes(1988b), AUTHOR = {Baum, Paul and Connes, Alain}, TITLE = {${K}$-theory for discrete groups}, BOOKTITLE = {Operator algebras and applications, Vol.\ 1}, PAGES = {1--20}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1988}, MRCLASS = {46L80 (19K99 22E40 58G12)}, MRNUMBER = {91i:46083}, MRREVIEWER = {Jean N. Renault}, } @incollection {Baum-Connes-Higson(1994), AUTHOR = {Baum, Paul and Connes, Alain and Higson, Nigel}, TITLE = {Classifying space for proper actions and ${K}$-theory of group ${C}\sp \ast$-algebras}, BOOKTITLE = {$C\sp \ast$-algebras: 1943--1993 (San Antonio, TX, 1993)}, PAGES = {240--291}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1994}, MRCLASS = {46L80 (19K56 22D25 46L85)}, MRNUMBER = {96c:46070}, MRREVIEWER = {Ronghui Ji}, } @book {Baum-Cortinas-Meyer-Sanchez-Garcia-Schlichting-Toen(2011), AUTHOR = {Baum, Paul Frank and Corti{\~n}as, Guillermo and Meyer, Ralf and S{\'a}nchez-Garc{\'{\i}}a, Rub{\'e}n and Schlichting, Marco and To{\"e}n, Bertrand}, TITLE = {Topics in algebraic and topological {$K$}-theory}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {2008}, NOTE = {Edited by Corti{\~n}as}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2011}, PAGES = {xvi+302}, ISBN = {978-3-642-15707-3}, MRCLASS = {19-06 (46L80)}, MRNUMBER = {2761828 (2011i:19001)}, DOI = {10.1007/978-3-642-15708-0}, URL = {http://dx.doi.org/10.1007/978-3-642-15708-0}, } @incollection {Baum-Douglas(1982), AUTHOR = {Baum, Paul and Douglas, Ronald G.}, TITLE = {${K}$-homology and index theory}, BOOKTITLE = {Operator algebras and applications, Part I (Kingston, Ont., 1980)}, PAGES = {117--173}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1982}, MRCLASS = {58G12 (46L05 46M20 55N15)}, MRNUMBER = {84d:58075}, MRREVIEWER = {N. J. Hitchin}, } @article {Baum-Douglas-Taylor(1989), AUTHOR = {Baum, Paul and Douglas, Ronald G. and Taylor, Michael E.}, TITLE = {Cycles and relative cycles in analytic ${K}$-homology}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {30}, YEAR = {1989}, NUMBER = {3}, PAGES = {761--804}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G12 (19K56 32F20 35J99 46L80 47F05 58G20)}, MRNUMBER = {91b:58244}, MRREVIEWER = {Jerome Kaminker}, } @article {Baum-Fulton-MacPherson(1979), AUTHOR = {Baum, Paul and Fulton, William and MacPherson, Robert}, TITLE = {Riemann-{R}och and topological ${K}$\ theory for singular varieties}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {143}, YEAR = {1979}, NUMBER = {3-4}, PAGES = {155--192}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {14F12 (14C40)}, MRNUMBER = {82c:14021}, MRREVIEWER = {Allen B. Altman}, } @article {Baum-Fulton-Quart(1979), AUTHOR = {Baum, Paul and Fulton, William and Quart, George}, TITLE = {Lefschetz-{R}iemann-{R}och for singular varieties}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {143}, YEAR = {1979}, NUMBER = {3-4}, PAGES = {193--211}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {14F12 (14C40)}, MRNUMBER = {MR549774 (82c:14022a)}, MRREVIEWER = {Allen B. Altman}, } @incollection {Baum-Guentner-Willet(2016Kadison), AUTHOR = {Baum, Paul and Guentner, Erik and Willett, Rufus}, TITLE = {Exactness and the {K}adison-{K}aplansky conjecture}, BOOKTITLE = {Operator algebras and their applications}, SERIES = {Contemp. Math.}, VOLUME = {671}, PAGES = {1--33}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2016}, MRCLASS = {46L80 (22D25 46L05)}, MRNUMBER = {3546676}, MRREVIEWER = {Jonathan H. Brown}, DOI = {10.1090/conm/671/13501}, URL = {https://doi.org/10.1090/conm/671/13501}, } @article {Baum-Guentner-Willet(2016expanders), AUTHOR = {Baum, Paul and Guentner, Erik and Willett, Rufus}, TITLE = {Expanders, exact crossed products, and the {B}aum-{C}onnes conjecture}, JOURNAL = {Ann. K-Theory}, FJOURNAL = {Annals of K-Theory}, VOLUME = {1}, YEAR = {2016}, NUMBER = {2}, PAGES = {155--208}, ISSN = {2379-1683}, MRCLASS = {46L85 (22D25 46L80 58B34)}, MRNUMBER = {3514939}, MRREVIEWER = {Vladimir Manuilov}, DOI = {10.2140/akt.2016.1.155}, URL = {https://doi.org/10.2140/akt.2016.1.155}, } @article {Baum-Higson-Plymen(1997), AUTHOR = {Baum, Paul and Higson, Nigel and Plymen, Roger}, TITLE = {A proof of the {B}aum-{C}onnes conjecture for $p$-adic ${\rm {G}{L}}(n)$}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {325}, YEAR = {1997}, NUMBER = {2}, PAGES = {171--176}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {46L80 (19K56)}, MRNUMBER = {98m:46087}, MRREVIEWER = {Hiroshi Takai}, } @incollection {Baum-Higson-Plymen(2000a), AUTHOR = {Baum, Paul and Higson, Nigel and Plymen, Roger}, TITLE = {Representation theory of $p$-adic groups: a view from operator algebras}, BOOKTITLE = {The mathematical legacy of Harish-Chandra (Baltimore, MD, 1998)}, PAGES = {111--149}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2000}, MRCLASS = {22E35 (19Kxx)}, MRNUMBER = {1 767 895}, } @incollection {Baum-Higson-Schick(2010), AUTHOR = {Baum, Paul and Higson, Nigel and Schick, Thomas}, TITLE = {A geometric description of equivariant {$K$}-homology for proper actions}, BOOKTITLE = {Quanta of maths}, SERIES = {Clay Math. Proc.}, VOLUME = {11}, PAGES = {1--22}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2010}, MRCLASS = {19K33 (19K35 19L47 58J22)}, MRNUMBER = {2732043 (2012g:19017)}, MRREVIEWER = {Jonathan M. Rosenberg}, } @article {Baum-Higson-Schick(2007), AUTHOR = {Baum, Paul and Higson, Nigel and Schick, Thomas}, TITLE = {On the equivalence of geometric and analytic {$K$}-homology}, JOURNAL = {Pure Appl. Math. Q.}, FJOURNAL = {Pure and Applied Mathematics Quarterly}, VOLUME = {3}, YEAR = {2007}, NUMBER = {1, part 3}, PAGES = {1--24}, ISSN = {1558-8599}, MRCLASS = {58J22 (19K33 19K35 46L80)}, MRNUMBER = {2330153 (2008d:58015)}, MRREVIEWER = {Yuri A. Kordyukov}, DOI = {10.4310/PAMQ.2007.v3.n1.a1}, URL = {http://dx.doi.org/10.4310/PAMQ.2007.v3.n1.a1}, } @article {Baum-Karoubi(2004), AUTHOR = {Baum, Paul and Karoubi, Max}, TITLE = {On the {B}aum-{C}onnes conjecture in the real case}, JOURNAL = {Q. J. Math.}, FJOURNAL = {The Quarterly Journal of Mathematics}, VOLUME = {55}, YEAR = {2004}, NUMBER = {3}, PAGES = {231--235}, ISSN = {0033-5606}, MRCLASS = {19K35 (46L80 53C21)}, MRNUMBER = {MR2082090 (2005d:19005)}, MRREVIEWER = {Uuye Otgonbayar}, } @article {Baum-Millington-Plymen(2003), AUTHOR = {Baum, Paul and Millington, Stephen and Plymen, Roger}, TITLE = {Local-global principle for the {B}aum-{C}onnes conjecture with coefficients}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {28}, YEAR = {2003}, NUMBER = {1}, PAGES = {1--18}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {46L80 (19K35 22E55)}, MRNUMBER = {MR1988816 (2004d:46085)}, MRREVIEWER = {Jean-Louis Tu}, } @article {Baumgartner-Laca-Ramagge-Willis(2009, AUTHOR = {Baumgartner, Udo and Laca, Marcelo and Ramagge, Jacqui and Willis, George}, TITLE = {Hecke algebras from groups acting on trees and {HNN} extensions}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {321}, YEAR = {2009}, NUMBER = {11}, PAGES = {3065--3088}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20C08 (20E08 46L05)}, MRNUMBER = {2510040 (2011b:20012)}, DOI = {10.1016/j.jalgebra.2008.12.008}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2008.12.008}, } @article {Baumslag(1962), AUTHOR = {Baumslag, Gilbert}, TITLE = {On generalised free products}, JOURNAL = {Math. Z.}, VOLUME = {78}, YEAR = {1962}, PAGES = {423--438}, MRCLASS = {20.10}, MRNUMBER = {25 \#3980}, MRREVIEWER = {Hanna Neumann}, } @article {Baumslag(1963), AUTHOR = {Baumslag, Gilbert}, TITLE = {Automorphism groups of residually finite groups}, JOURNAL = {J. London Math. Soc.}, VOLUME = {38}, YEAR = {1963}, PAGES = {117--118}, MRCLASS = {20.22}, MRNUMBER = {26 \#3793}, MRREVIEWER = {Hanna Neumann}, } @article {Baumslag(1967), AUTHOR = {Baumslag, Benjamin}, TITLE = {Residually free groups}, JOURNAL = {Proc. London Math. Soc. (3)}, VOLUME = {17}, YEAR = {1967}, PAGES = {402--418}, MRCLASS = {20.10}, MRNUMBER = {35 \#6738}, MRREVIEWER = {P. J. Higgins}, } @article {Baumslag(1967a), AUTHOR = {Baumslag, Gilbert}, TITLE = {Some groups that are just about free}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {73}, YEAR = {1967}, PAGES = {621--622}, MRCLASS = {20.10}, MRNUMBER = {35 \#2954}, MRREVIEWER = {R. C. Lyndon}, } @article {Baumslag(1968), AUTHOR = {Baumslag, Gilbert}, TITLE = {On the residual nilpotence of certain one-relator groups}, JOURNAL = {Comm. Pure Appl. Math.}, VOLUME = {21}, YEAR = {1968}, PAGES = {491--506}, MRCLASS = {20.10}, MRNUMBER = {38 \#3327}, MRREVIEWER = {B. H. Neumann}, } @article {Baumslag(1971), AUTHOR = {Baumslag, Gilbert}, TITLE = {Positive one-relator groups}, JOURNAL = {Trans. Amer. Math. Soc.}, VOLUME = {156}, YEAR = {1971}, PAGES = {165--183}, MRCLASS = {20.10}, MRNUMBER = {43 \#325}, MRREVIEWER = {Hanna Neumann}, } @book {Baumslag(1993), AUTHOR = {Baumslag, Gilbert}, TITLE = {Topics in combinatorial group theory}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1993}, PAGES = {viii+164}, ISBN = {3-7643-2921-1}, MRCLASS = {20F05 (20E06 20E08 20F34)}, MRNUMBER = {94j:20034}, MRREVIEWER = {S. Andreadakis}, } @article {Baumslag(1999), AUTHOR = {Baumslag, Gilbert}, TITLE = {Finitely generated residually torsion-free nilpotent groups. {I}}, JOURNAL = {J. Austral. Math. Soc. Ser. A}, FJOURNAL = {Australian Mathematical Society. Journal. Series A. Pure Mathematics and Statistics}, VOLUME = {67}, YEAR = {1999}, NUMBER = {3}, PAGES = {289--317}, ISSN = {0263-6115}, CODEN = {JAMADS}, MRCLASS = {20F18 (20F14)}, MRNUMBER = {2001c:20073}, MRREVIEWER = {Roger C. Alperin}, } @article {Baumslag-Dyer-Heller(1980), AUTHOR = {Baumslag, Gilbert and Dyer, Eldon and Heller, Alex}, TITLE = {The topology of discrete groups}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {16}, YEAR = {1980}, NUMBER = {1}, PAGES = {1--47}, ISSN = {0022-4049}, MRCLASS = {55P99 (20F06 55U99)}, MRNUMBER = {81i:55012}, MRREVIEWER = {W. D. Neumann}, } @incollection {Baumslag-Gersten-Shapiro-Short(1992), AUTHOR = {Baumslag, G. and Gersten, S. M. and Shapiro, M. and Short, H.}, TITLE = {Automatic groups and amalgams---a survey}, BOOKTITLE = {Algorithms and classification in combinatorial group theory ({B}erkeley, {CA}, 1989)}, SERIES = {Math. Sci. Res. Inst. Publ.}, VOLUME = {23}, PAGES = {179--194}, PUBLISHER = {Springer, New York}, YEAR = {1992}, MRCLASS = {20F10 (20F32 57M07)}, MRNUMBER = {1230634}, MRREVIEWER = {Susan Hermiller}, DOI = {10.1007/978-1-4613-9730-4_8}, URL = {http://dx.doi.org/10.1007/978-1-4613-9730-4_8}, } @article {Baumslag-Gersten-Shapiro-Short(1991), AUTHOR = {Baumslag, G. and Gersten, S. M. and Shapiro, M. and Short, H.}, TITLE = {Automatic groups and amalgams}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {76}, YEAR = {1991}, NUMBER = {3}, PAGES = {229--316}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20F10 (20F32 57M07)}, MRNUMBER = {1147304}, MRREVIEWER = {D. F. Holt}, DOI = {10.1016/0022-4049(91)90139-S}, URL = {http://dx.doi.org/10.1016/0022-4049(91)90139-S}, } @article {Baumslag-Miller-Short(1993), AUTHOR = {Baumslag, Gilbert and Miller, III, Charles F. and Short, Hamish}, TITLE = {Isoperimetric inequalities and the homology of groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {113}, YEAR = {1993}, NUMBER = {3}, PAGES = {531--560}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57M07 (20J05)}, MRNUMBER = {95b:57004}, } @article {Baumslag-Pride(1979), AUTHOR = {Baumslag, Benjamin and Pride, Stephen J.}, TITLE = {Groups with one more generator than relators}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {167}, YEAR = {1979}, NUMBER = {3}, PAGES = {279--281}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {20F05}, MRNUMBER = {80i:20014}, MRREVIEWER = {Benjamin Fine}, } @article {Baumslag-Shalen(1990), AUTHOR = {Baumslag, Gilbert and Shalen, Peter B.}, TITLE = {Amalgamated products and finitely presented groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {65}, YEAR = {1990}, NUMBER = {2}, PAGES = {243--254}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {20E06}, MRNUMBER = {91j:20071}, MRREVIEWER = {Stephen J. Pride}, } @article {Baumslag-Solitar(1962), AUTHOR = {Baumslag, Gilbert and Solitar, Donald}, TITLE = {Some two-generator one-relator non-{H}opfian groups}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {68}, YEAR = {1962}, PAGES = {199--201}, MRCLASS = {20.99}, MRNUMBER = {26 \#204}, MRREVIEWER = {B. H. Neumann}, } @article {Baur-Ginzburg-Gordon-Stroppel(2009), AUTHOR = {Baur, Karin and Ginzburg, Victor and Gordon, Iain and Parker, Alison and Stroppel, Catharina}, TITLE = {Preface [{C}herednik algebras]}, JOURNAL = {Selecta Math. (N.S.)}, FJOURNAL = {Selecta Mathematica. New Series}, VOLUME = {14}, YEAR = {2009}, NUMBER = {3-4}, PAGES = {323}, ISSN = {1022-1824}, CODEN = {SMATF6}, MRCLASS = {16-06}, MRNUMBER = {2511187}, DOI = {10.1007/s00029-009-0510-4}, URL = {http://dx.doi.org/10.1007/s00029-009-0510-4}, } @article{Bass-Milnor-Serre(1967), AUTHOR = {Bass, H. and Milnor, J. and Serre, J.-P.}, TITLE = {Solution of the congruence subgroup problem for {${\rm SL}\sb{n}\,(n\geq 3)$} and {${\rm Sp}\sb{2n}\,(n\geq 2)$}}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {33}, YEAR = {1967}, PAGES = {59--137}, ISSN = {0073-8301}, MRCLASS = {14.50 (20.00)}, MRNUMBER = {MR0244257 (39 \#5574)}, MRREVIEWER = {R. Steinberg}, } @article {Bavard-Pansu(1986), AUTHOR = {Bavard, Christophe and Pansu, Pierre}, TITLE = {Sur le volume minimal de $\mathbb{{R}}\sp 2$}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {19}, YEAR = {1986}, NUMBER = {4}, PAGES = {479--490}, ISSN = {0012-9593}, CODEN = {ASENAH}, MRCLASS = {53C20}, MRNUMBER = {88b:53048}, MRREVIEWER = {Gudlaugur Thorbergsson}, } @book {Baxter(1982), AUTHOR = {Baxter, Rodney J.}, TITLE = {Exactly solved models in statistical mechanics}, PUBLISHER = {Academic Press Inc. [Harcourt Brace Jovanovich Publishers]}, ADDRESS = {London}, YEAR = {1982}, PAGES = {xii+486}, ISBN = {0-12-083180-5}, MRCLASS = {82-02 (82A05 82A68)}, MRNUMBER = {86i:82002a}, MRREVIEWER = {J. Groeneveld}, } @article {Bazaikin(1996a), AUTHOR = {Baza{\u\i}kin, Ya. V.}, TITLE = {On a family of $13$-dimensional closed {R}iemannian manifolds of positive curvature}, JOURNAL = {Sibirsk. Mat. Zh.}, FJOURNAL = {Rossi\u\i skaya Akademiya Nauk. Sibirskoe Otdelenie. Institut Matematiki im. S. L. Soboleva. Sibirski\u\i\ Matematicheski\u\i\ Zhurnal}, VOLUME = {37}, YEAR = {1996}, NUMBER = {6}, PAGES = {1219--1237, ii}, ISSN = {0037-4474}, MRCLASS = {53C20 (53C21)}, MRNUMBER = {98c:53045}, MRREVIEWER = {Iskander A. Taimanov}, } @book {Beardon(1983), AUTHOR = {Beardon, Alan F.}, TITLE = {The geometry of discrete groups}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1983}, PAGES = {xii+337}, ISBN = {0-387-90788-2}, MRCLASS = {22E40 (11F06 20H15 30F35 57N10)}, MRNUMBER = {85d:22026}, MRREVIEWER = {Norbert Wielenberg}, } @article {Bechtluft-Sachs-Hien(1999), AUTHOR = {Bechtluft-Sachs, Stefan and Hien, Marco}, TITLE = {The global defect index}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {202}, YEAR = {1999}, NUMBER = {2}, PAGES = {403--409}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {82D99 (55Q99 55R99)}, MRNUMBER = {2001a:82079}, MRREVIEWER = {J. Stasheff}, } @article {Bechtluft-Sachs-Hien(2000), AUTHOR = {Bechtluft-Sachs, Stefan and Hien, Marco}, TITLE = {Sets of fibre homotopy classes and twisted order parameter spaces}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {211}, YEAR = {2000}, NUMBER = {2}, PAGES = {407--412}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {55R10 (57R22)}, MRNUMBER = {2001e:55020}, MRREVIEWER = {Donald M. Davis}, } @article {Becker-Casson-Gottlieb(1975), AUTHOR = {Becker, James C. and Casson, Andrew J. and Gottlieb, Daniel Henry}, TITLE = {The {L}efschetz number and fiber preserving maps}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {81}, YEAR = {1975}, PAGES = {425--427}, MRCLASS = {55C20 (55D05 57A65)}, MRNUMBER = {53 \#14474}, MRREVIEWER = {I. Pop}, } @article {Becker-Gottlieb(1975), AUTHOR = {Becker, James C. and Gottlieb, Daniel Henry}, TITLE = {The transfer map and fiber bundles}, JOURNAL = {Topology}, VOLUME = {14}, YEAR = {1975}, PAGES = {1--12}, MRCLASS = {55E50 (55F10)}, MRNUMBER = {51 \#14042}, MRREVIEWER = {J. P. May}, } @article {Becker-Gottlieb(1976), AUTHOR = {Becker, James C. and Gottlieb, Daniel Henry}, TITLE = {Transfer maps for fibrations and duality}, JOURNAL = {Compositio Math.}, VOLUME = {33}, YEAR = {1976}, NUMBER = {2}, PAGES = {107--133}, MRCLASS = {55E10 (55F05)}, MRNUMBER = {55 \#9087}, MRREVIEWER = {S. Gitler}, } @article {Becker-Schultz(1982), AUTHOR = {Becker, James C. and Schultz, Reinhard E.}, TITLE = {The real semicharacteristic of a fibered manifold}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {33}, YEAR = {1982}, NUMBER = {132}, PAGES = {385--403}, ISSN = {0033-5606}, CODEN = {QJMAAT}, MRCLASS = {57R20 (57R22 57S17)}, MRNUMBER = {84a:57022}, MRREVIEWER = {R. E. Stong}, } @article {Beeker-Cordes-Gardam{2022), AUTHOR = {Beeker, Benjamin and Cordes, Matthew and Gardam, Giles and Gupta, Radhika and Stark, Emily}, TITLE = {Cannon-{T}hurston maps for {${\rm CAT}(0)$} groups with isolated flats}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {384}, YEAR = {2022}, NUMBER = {1-2}, PAGES = {963--987}, ISSN = {0025-5831,1432-1807}, MRCLASS = {20F65 (20E07 20F67 57K31 57M07)}, MRNUMBER = {4476223}, MRREVIEWER = {Jingyin\ Huang}, DOI = {10.1007/s00208-021-02245-z}, URL = {https://doi.org/10.1007/s00208-021-02245-z}, } @article {Beguin-Bettaib-Valette(1999), AUTHOR = {B{\'e}guin, C{\'e}dric and Bettaieb, Hela and Valette, Alain}, TITLE = {${K}$-theory for ${C}\sp \ast$-algebras of one-relator groups}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {16}, YEAR = {1999}, NUMBER = {3}, PAGES = {277--298}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {46L80 (19K35 20F05 55N15)}, MRNUMBER = {2000c:46133}, MRREVIEWER = {Guoliang Yu}, } @article {Beguin-Valette-Zuk(1997), AUTHOR = {B{\'e}guin, C{\'e}dric and Valette, Alain and {\.Z}uk, Andrzej}, TITLE = {On the spectrum of a random walk on the discrete {H}eisenberg group and the norm of {H}arper's operator}, JOURNAL = {J. Geom. Phys.}, FJOURNAL = {Journal of Geometry and Physics}, VOLUME = {21}, YEAR = {1997}, NUMBER = {4}, PAGES = {337--356}, ISSN = {0393-0440}, CODEN = {JGPHE5}, MRCLASS = {60B15 (39A70 60J15)}, MRNUMBER = {99e:60025}, MRREVIEWER = {Nobuaki Obata}, } @book {Behrens-Kalmar-Kim-Powell-Ray(2021), TITLE = {The disc embedding theorem}, EDITOR = {Behrens, Stefan and Kalm\'{a}r, Boldizs\'{a}r and Kim, Min Hoon and Powell, Mark and Ray, Arunima}, PUBLISHER = {Oxford University Press, Oxford}, YEAR = {2021}, PAGES = {xvii+473}, ISBN = {978-0-19-884131-9}, MRCLASS = {57K40 (57-02 57R40 57R60)}, MRNUMBER = {4519498}, } @article {Behrens-Hill-Hopkins-Mahowald(2020), AUTHOR = {Behrens, M. and Hill, M. and Hopkins, M. J. and Mahowald, M.}, TITLE = {Detecting exotic spheres in low dimensions using coker {$J$}}, JOURNAL = {J. Lond. Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {101}, YEAR = {2020}, NUMBER = {3}, PAGES = {1173--1218}, ISSN = {0024-6107}, MRCLASS = {57R55 (55N34 55Q45 55Q51 55T15 57R60)}, MRNUMBER = {4111938}, DOI = {10.1112/jlms.12301}, URL = {https://doi-org.ezp.lib.unimelb.edu.au/10.1112/jlms.12301}, } @article {Behrens-Hopkins(2011), AUTHOR = {Behrens, M. and Hopkins, M. J.}, TITLE = {Higher real {$K$}-theories and topological automorphic forms}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {4}, YEAR = {2011}, NUMBER = {1}, PAGES = {39--72}, ISSN = {1753-8416}, MRCLASS = {55N20 (11G18 16K50 55N15 55N34 55P43)}, MRNUMBER = {2783377 (2012k:55007)}, MRREVIEWER = {Niko Naumann}, DOI = {10.1112/jtopol/jtq034}, URL = {http://dx.doi.org/10.1112/jtopol/jtq034}, } @article {Behrens-Hill-Hopkins(2008), AUTHOR = {Behrens, M. and Hill, M. and Hopkins, M. J. and Mahowald, M.}, TITLE = {On the existence of a {$v^{32}_2$}-self map on {$M(1,4)$} at the prime 2}, JOURNAL = {Homology, Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {10}, YEAR = {2008}, NUMBER = {3}, PAGES = {45--84}, ISSN = {1532-0073}, MRCLASS = {55Q51 (55Q40 55T15)}, MRNUMBER = {2475617 (2009j:55015)}, MRREVIEWER = {Donald M. Davis}, URL = {http://projecteuclid.org/euclid.hha/1251832467}, } @article {Behrstock(2006), AUTHOR = {Behrstock, Jason A.}, TITLE = {Asymptotic geometry of the mapping class group and {T}eichm\"uller space}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {10}, YEAR = {2006}, PAGES = {1523--1578}, ISSN = {1465-3060}, MRCLASS = {20F69 (20F67 30F60 32G15 57M07)}, MRNUMBER = {2255505 (2008f:20108)}, MRREVIEWER = {Gabriela Schmith{\"u}sen}, DOI = {10.2140/gt.2006.10.1523}, URL = {http://dx.doi.org/10.2140/gt.2006.10.1523}, } @article {Behrstock-Bestvina(2010), AUTHOR = {Behrstock, Jason and Bestvina, Mladen and Clay, Matt}, TITLE = {Growth of intersection numbers for free group automorphisms}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {3}, YEAR = {2010}, NUMBER = {2}, PAGES = {280--310}, ISSN = {1753-8416}, MRCLASS = {20E36 (20E05 20F65)}, MRNUMBER = {2651361}, MRREVIEWER = {Llu{\'{\i}}s Bacardit}, DOI = {10.1112/jtopol/jtq008}, URL = {http://dx.doi.org/10.1112/jtopol/jtq008}, } @article {Behrstock-Drutu(2011), AUTHOR = {Behrstock, Jason and Dru{\c{t}}u, Cornelia and Sapir, Mark}, TITLE = {Addendum. {M}edian structures on asymptotic cones and homomorphisms into mapping class groups [MR2783135]}, JOURNAL = {Proc. Lond. Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {102}, YEAR = {2011}, NUMBER = {3}, PAGES = {555--562}, ISSN = {0024-6115}, MRCLASS = {20F65 (57Mxx)}, MRNUMBER = {2783136}, DOI = {10.1112/plms/pdr008}, URL = {http://dx.doi.org/10.1112/plms/pdr008}, } @article {Behrstock-Drutu-Sapir(2011), AUTHOR = {Behrstock, Jason and Dru{\c{t}}u, Cornelia and Sapir, Mark}, TITLE = {Median structures on asymptotic cones and homomorphisms into mapping class groups}, JOURNAL = {Proc. Lond. Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {102}, YEAR = {2011}, NUMBER = {3}, PAGES = {503--554}, ISSN = {0024-6115}, MRCLASS = {20F65 (57Mxx)}, MRNUMBER = {2783135}, DOI = {10.1112/plms/pdq025}, URL = {http://dx.doi.org/10.1112/plms/pdq025}, } @article {Behrstock-Drutu(2009), AUTHOR = {Behrstock, Jason and Dru{\c{t}}u, Cornelia and Mosher, Lee}, TITLE = {Thick metric spaces, relative hyperbolicity, and quasi-isometric rigidity}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {344}, YEAR = {2009}, NUMBER = {3}, PAGES = {543--595}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {20F67 (57M07 57M50)}, MRNUMBER = {2501302 (2010h:20094)}, DOI = {10.1007/s00208-008-0317-1}, URL = {http://dx.doi.org/10.1007/s00208-008-0317-1}, } @article {Behrstock-Januszkiewicz-Neumann(2010), AUTHOR = {Behrstock, Jason A. and Januszkiewicz, Tadeusz and Neumann, Walter D.}, TITLE = {Quasi-isometric classification of some high dimensional right-angled {A}rtin groups}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {4}, YEAR = {2010}, NUMBER = {4}, PAGES = {681--692}, ISSN = {1661-7207}, MRCLASS = {20F65 (20F36)}, MRNUMBER = {2727658}, DOI = {10.4171/GGD/100}, URL = {http://dx.doi.org/10.4171/GGD/100}, } @article {Behrstock-Januszkiewicz-Neumann(2009), AUTHOR = {Behrstock, Jason A. and Januszkiewicz, Tadeusz and Neumann, Walter D.}, TITLE = {Commensurability and {QI} classification of free products of finitely generated abelian groups}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {137}, YEAR = {2009}, NUMBER = {3}, PAGES = {811--813}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {20E06 (20F36 20F65)}, MRNUMBER = {2457418 (2009i:20051)}, MRREVIEWER = {Fran{\c{c}}ois Dahmani}, DOI = {10.1090/S0002-9939-08-09559-2}, URL = {http://dx.doi.org/10.1090/S0002-9939-08-09559-2}, } @article {Behrstock-Kleiner-Minsky(2012), AUTHOR = {Behrstock, Jason and Kleiner, Bruce and Minsky, Yair and Mosher, Lee}, TITLE = {Geometry and rigidity of mapping class groups}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {16}, YEAR = {2012}, NUMBER = {2}, PAGES = {781--888}, ISSN = {1465-3060}, MRCLASS = {20F65 (30F60 57M50)}, MRNUMBER = {2928983}, MRREVIEWER = {Andy Wand}, DOI = {10.2140/gt.2012.16.781}, URL = {http://dx.doi.org/10.2140/gt.2012.16.781}, } @article {Behrstock_Magalit(2006), AUTHOR = {Behrstock, Jason and Margalit, Dan}, TITLE = {Curve complexes and finite index subgroups of mapping class groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {118}, YEAR = {2006}, PAGES = {71--85}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {57M99 (20F38 57M07)}, MRNUMBER = {2239449 (2007d:57031)}, MRREVIEWER = {Alessia Cattabriga}, DOI = {10.1007/s10711-005-9022-3}, URL = {http://dx.doi.org/10.1007/s10711-005-9022-3}, } @article {Behrstock-Minsky(2008mappclassgr), AUTHOR = {Behrstock, Jason A. and Minsky, Yair N.}, TITLE = {Dimension and rank for mapping class groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {167}, YEAR = {2008}, NUMBER = {3}, PAGES = {1055--1077}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57M50 (20F65 20F69)}, MRNUMBER = {2415393 (2009d:57031)}, MRREVIEWER = {Javier Aramayona}, DOI = {10.4007/annals.2008.167.1055}, URL = {http://dx.doi.org/10.4007/annals.2008.167.1055}, } @article {Behrstock-Minsky(2011), AUTHOR = {Behrstock, Jason A. and Minsky, Yair N.}, TITLE = {Centroids and the rapid decay property in mapping class groups}, JOURNAL = {J. Lond. Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {84}, YEAR = {2011}, NUMBER = {3}, PAGES = {765--784}, ISSN = {0024-6107}, MRCLASS = {20F65 (20F36 20F67 57M50)}, MRNUMBER = {2855801 (2012k:20074)}, MRREVIEWER = {Athanase Papadopoulos}, DOI = {10.1112/jlms/jdr027}, URL = {http://dx.doi.org/10.1112/jlms/jdr027}, } @article {Behrstock-Neumann(2008), AUTHOR = {Behrstock, Jason A. and Neumann, Walter D.}, TITLE = {Quasi-isometric classification of graph manifold groups}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {141}, YEAR = {2008}, NUMBER = {2}, PAGES = {217--240}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {20F65 (57M07 57N10)}, MRNUMBER = {2376814 (2009c:20070)}, MRREVIEWER = {Richard Weidmann}, DOI = {10.1215/S0012-7094-08-14121-3}, URL = {http://dx.doi.org/10.1215/S0012-7094-08-14121-3}, } @article {Beligiannis-Reiten(2007), AUTHOR = {Beligiannis, Apostolos and Reiten, Idun}, TITLE = {Homological and homotopical aspects of torsion theories}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {188}, YEAR = {2007}, NUMBER = {883}, PAGES = {viii+207}, ISSN = {0065-9266}, MRCLASS = {18G55 (20J05 55U35)}, MRNUMBER = {2327478}, DOI = {10.1090/memo/0883}, URL = {https://doi.org/10.1090/memo/0883}, } @incollection {Bekka-Cherix-Valette(1995), AUTHOR = {Bekka, Mohammed E. B. and Cherix, Pierre-Alain and Valette, Alain}, TITLE = {Proper affine isometric actions of amenable groups}, BOOKTITLE = {Novikov conjectures, index theorems and rigidity, Vol.\ 2 (Oberwolfach, 1993)}, PAGES = {1--4}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1995}, MRCLASS = {43A07 (22D10)}, MRNUMBER = {97e:43001}, MRREVIEWER = {Jean-Paul Pier}, } @article {Bekka-Cowling-Harpe(1994a), AUTHOR = {Bekka, Mohammed E. B. and Cowling, Michael and de la Harpe, Pierre}, TITLE = {Simplicity of the reduced ${C}\sp *$-algebra of ${\rm {P}{S}{L}}(n,{\mathbf{Z}})$}, JOURNAL = {Internat. Math. Res. Notices}, FJOURNAL = {International Mathematics Research Notices}, YEAR = {1994}, VOLUME = {7}, PAGES = {285ff., approx.\ 7 pp.\ (electronic)}, ISSN = {1073-7928}, MRCLASS = {22D25 (22E40 46L05)}, MRNUMBER = {95h:22005}, MRREVIEWER = {Alain Valette}, } @article {Bekka-Cowling-Harpe(1994b), AUTHOR = {Bekka, Mohammed E. B. and Cowling, Michael and de la Harpe, Pierre}, TITLE = {Some groups whose reduced ${C}\sp *$-algebra is simple}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {80}, YEAR = {1994}, PAGES = {117--134 (1995)}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {22E40 (22D25 46L05)}, MRNUMBER = {96a:22020}, MRREVIEWER = {Paul Jolissaint}, } @book {Bekka_delaHarpe_Valette(2008), AUTHOR = {Bekka, Bachir and de la Harpe, Pierre and Valette, Alain}, TITLE = {Kazhdan's property ({T})}, SERIES = {New Mathematical Monographs}, VOLUME = {11}, PUBLISHER = {Cambridge University Press, Cambridge}, YEAR = {2008}, PAGES = {xiv+472}, ISBN = {978-0-521-88720-5}, MRCLASS = {22-02 (22E40 28D15 37A15 43A07 43A35)}, MRNUMBER = {2415834}, MRREVIEWER = {Markus\ Neuhauser}, DOI = {10.1017/CBO9780511542749}, URL = {https://doi.org/10.1017/CBO9780511542749}, } @article {Bekka-Valette(1993), AUTHOR = {Bekka, Mohammed E. B. and Valette, Alain}, TITLE = {On duals of {L}ie groups made discrete}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {439}, YEAR = {1993}, PAGES = {1--10}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {22D10 (22E40 43A35)}, MRNUMBER = {94k:22003}, MRREVIEWER = {Michael Cowling}, } @article {Bekka-Valette(1997), AUTHOR = {Bekka, Mohammed E. B. and Valette, Alain}, TITLE = {Group cohomology, harmonic functions and the first ${L}\sp 2$-{B}etti number}, JOURNAL = {Potential Anal.}, FJOURNAL = {Potential Analysis. An International Journal Devoted to the Interactions between Potential Theory, Probability Theory, Geometry and Functional Analysis}, VOLUME = {6}, YEAR = {1997}, NUMBER = {4}, PAGES = {313--326}, ISSN = {0926-2601}, CODEN = {POANE2}, MRCLASS = {20J05 (31C05 58G12)}, MRNUMBER = {98e:20056}, MRREVIEWER = {William Paschke}, } @article {Belegradek(2006), AUTHOR = {Belegradek, Igor}, TITLE = {Aspherical manifolds, relative hyperbolicity, simplicial volume and assembly maps}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {6}, YEAR = {2006}, PAGES = {1341--1354 (electronic)}, ISSN = {1472-2747}, MRCLASS = {57M07 (20F65)}, MRNUMBER = {MR2253450 (2007f:57004)}, MRREVIEWER = {Fran{\c{c}}ois Dahmani}, } @article {Belegradek(2007), AUTHOR = {Belegradek, Igor}, TITLE = {Aspherical manifolds with relatively hyperbolic fundamental groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {129}, YEAR = {2007}, PAGES = {119--144}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F65 (52Bxx 57Nxx)}, MRNUMBER = {MR2353987}, } @article {Belegradek-Farrell-Kapovitch(2017), AUTHOR = {Belegradek, Igor and Farrell, F. Thomas and Kapovitch, Vitali}, TITLE = {Space of nonnegatively curved metrics and pseudoisotopies}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {105}, YEAR = {2017}, NUMBER = {3}, PAGES = {345--374}, ISSN = {0022-040X}, MRCLASS = {57R52 (53C21)}, MRNUMBER = {3619306}, URL = {http://projecteuclid.org/euclid.jdg/1488503001}, } @article {Bell(2005), AUTHOR = {Bell, Robert W.}, TITLE = {Three-dimensional {FC} {A}rtin groups are {CAT}(0)}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {113}, YEAR = {2005}, PAGES = {21--53}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F36 (20F65)}, MRNUMBER = {MR2171297 (2006e:20063)}, MRREVIEWER = {Daan Krammer}, } @article {Bell-Dranishnikov(2008), AUTHOR = {Bell, G. and Dranishnikov, A.}, TITLE = {Asymptotic dimension}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {155}, YEAR = {2008}, NUMBER = {12}, PAGES = {1265--1296}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {55M10 (20F69)}, MRNUMBER = {MR2423966 (2009d:55001)}, MRREVIEWER = {Piotr W. Nowak}, DOI = {10.1016/j.topol.2008.02.011}, URL = {http://dx.doi.org/10.1016/j.topol.2008.02.011}, } @article {Bell-Dranishnikov(2006), AUTHOR = {Bell, G. C. and Dranishnikov, A. N.}, TITLE = {A {H}urewicz-type theorem for asymptotic dimension and applications to geometric group theory}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {358}, YEAR = {2006}, NUMBER = {11}, PAGES = {4749--4764 (electronic)}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {20F69 (20E08 20F65 57M07)}, MRNUMBER = {MR2231870 (2007e:20092)}, MRREVIEWER = {Athanase Papadopoulos}, DOI = {10.1090/S0002-9947-06-04088-8}, URL = {http://dx.doi.org/10.1090/S0002-9947-06-04088-8}, } @article {Bell-Dranishnikov(2004symdimfreeprod), AUTHOR = {Bell, G. C. and Dranishnikov, A. N. and Keesling, J. E.}, TITLE = {On a formula for the asymptotic dimension of free products}, JOURNAL = {Fund. Math.}, FJOURNAL = {Fundamenta Mathematicae}, VOLUME = {183}, YEAR = {2004}, NUMBER = {1}, PAGES = {39--45}, ISSN = {0016-2736}, MRCLASS = {20F69 (20E06)}, MRNUMBER = {MR2098148 (2005g:20064)}, MRREVIEWER = {Fran{\c{c}}ois Dahmani}, DOI = {10.4064/fm183-1-2}, URL = {http://dx.doi.org/10.4064/fm183-1-2}, } @article {Bell-Dranishnikov(2004asymdimtrees), AUTHOR = {Bell, G. and Dranishnikov, A.}, TITLE = {On asymptotic dimension of groups acting on trees}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {103}, YEAR = {2004}, PAGES = {89--101}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F69 (20E08)}, MRNUMBER = {MR2034954 (2005b:20078)}, MRREVIEWER = {Brent Everitt}, DOI = {10.1023/B:GEOM.0000013843.53884.77}, URL = {http://dx.doi.org/10.1023/B:GEOM.0000013843.53884.77}, } @article {Bell-Dranishnikov(2001), AUTHOR = {Bell, G. and Dranishnikov, A.}, TITLE = {On asymptotic dimension of groups}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {1}, YEAR = {2001}, PAGES = {57--71 (electronic)}, ISSN = {1472-2747}, MRCLASS = {20F69 (20E06 20F34)}, MRNUMBER = {MR1808331 (2001m:20062)}, MRREVIEWER = {Brent Everitt}, DOI = {10.2140/agt.2001.1.57}, URL = {http://dx.doi.org/10.2140/agt.2001.1.57}, } @article {Bella-Baci(1998), AUTHOR = {Bella Baci, Abderrazak}, TITLE = {Homologie cyclique du produit crois\'e alg\'ebrique et groupes de surfaces}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {132}, YEAR = {1998}, NUMBER = {3}, PAGES = {259--273}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {16E40 (18G40)}, MRNUMBER = {99k:16015}, MRREVIEWER = {Thorsten Holm}, } @article {Benakli(1999), AUTHOR = {Benakli, N.}, TITLE = {Boundary of {${\rm CAT}(-1)$} {C}oxeter groups}, NOTE = {With an appendix by Benakli and Z. Sela}, JOURNAL = {Internat. J. Algebra Comput.}, FJOURNAL = {International Journal of Algebra and Computation}, VOLUME = {9}, YEAR = {1999}, NUMBER = {2}, PAGES = {169--178}, ISSN = {0218-1967}, MRCLASS = {20F65 (57M07)}, MRNUMBER = {MR1703072 (2000d:20055)}, MRREVIEWER = {Alexander N. Dranishnikov}, } @article {Ben-Arabi(2013), AUTHOR = {Ben Aribi, Fathi}, TITLE = {The {$L^2$}-{A}lexander invariant detects the unknot}, JOURNAL = {C. R. Math. Acad. Sci. Paris}, FJOURNAL = {Comptes Rendus Math\'ematique. Acad\'emie des Sciences. Paris}, VOLUME = {351}, YEAR = {2013}, NUMBER = {5-6}, PAGES = {215--219}, ISSN = {1631-073X}, MRCLASS = {57M27}, MRNUMBER = {3089681}, DOI = {10.1016/j.crma.2013.03.009}, URL = {http://dx.doi.org/10.1016/j.crma.2013.03.009}, } @Article{Ben-Aribi(2016), Author = {Fathi {Ben Aribi}}, Title = {{The $L^2$-Alexander invariant detects the unknot.}}, FJournal = {{Annali della Scuola Normale Superiore di Pisa. Classe di Scienze. Serie V}}, Journal = {{Ann. Sc. Norm. Super. Pisa, Cl. Sci. (5)}}, ISSN = {0391-173X; 2036-2145/e}, Volume = {15}, Pages = {683--708}, Year = {2016}, Publisher = {Scuola Normale Superiore, Pisa}, Language = {English}, DOI = {10.2422/2036-2145.201402_002}, MSC2010 = {57M25 57M27} } @book {Benedetti-Petronio(1992), AUTHOR = {Benedetti, Riccardo and Petronio, Carlo}, TITLE = {Lectures on hyperbolic geometry}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1992}, PAGES = {xiv+330}, ISBN = {3-540-55534-X}, MRCLASS = {57M50 (30F40 30F60 51M10 57N10)}, MRNUMBER = {94e:57015}, MRREVIEWER = {Colin C. Adams}, } @article{Ben-Moshe-Carmeli-Schlank-Yanovski(2024), AUTHOR = {Ben-Moshe, Shay and Carmeli, Shachar and Schlank, Tomer M. and Yanovski, Lior}, TITLE = {Chromatic cardinalities via redshift}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2024}, Volume = {14}, PAGES = {10918--10924}, ISSN = {1073-7928,1687-0247}, MRCLASS = {18F25 (19D99 55P43)}, MRNUMBER = {4776197}, DOI = {10.1093/imrn/rnae109}, URL = {https://doi.org/10.1093/imrn/rnae109}, } @article {Benedetti-Ziegler(2011), AUTHOR = {Benedetti, Bruno and Ziegler, G{\"u}nter M.}, TITLE = {On locally constructible spheres and balls}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {206}, YEAR = {2011}, NUMBER = {2}, PAGES = {205--243}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {83Cxx (57M99)}, MRNUMBER = {2810852}, DOI = {10.1007/s11511-011-0062-2}, URL = {http://dx.doi.org/10.1007/s11511-011-0062-2}, } @book {Benson(1998a), AUTHOR = {Benson, David J.}, TITLE = {Representations and cohomology. {I}}, EDITION = {Second}, NOTE = {Basic representation theory of finite groups and associative algebras}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1998}, PAGES = {xii+246}, ISBN = {0-521-63653-1}, MRCLASS = {20-02 (20Cxx 20J06)}, MRNUMBER = {99f:20001a}, } @book {Benson(1998b), AUTHOR = {Benson, David J.}, TITLE = {Representations and cohomology. {I}{I}}, EDITION = {Second}, NOTE = {Cohomology of groups and modules}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1998}, PAGES = {xii+279}, ISBN = {0-521-63652-3}, MRCLASS = {20-02 (19-02 20Cxx 20Jxx 55-02)}, MRNUMBER = {99f:20001b}, } @book {Benson(1991), AUTHOR = {Benson, D. J.}, TITLE = {Representations and cohomology. {II}}, SERIES = {Cambridge Studies in Advanced Mathematics}, VOLUME = {31}, NOTE = {Cohomology of groups and modules}, PUBLISHER = {Cambridge University Press, Cambridge}, YEAR = {1991}, PAGES = {x+278}, ISBN = {0-521-36135-4}, MRCLASS = {20J06 (19D55 20C20 55P20)}, MRNUMBER = {1156302}, MRREVIEWER = {K.\ W.\ Roggenkamp}, } @article {Benson-Feshbach(1992), AUTHOR = {Benson, D. J. and Feshbach, M.}, TITLE = {Stable splittings of classifying spaces of finite groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {31}, YEAR = {1992}, NUMBER = {1}, PAGES = {157--176}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P42}, MRNUMBER = {93d:55013}, MRREVIEWER = {John C. Harris}, } @article {Benson-Greenlees(1993), AUTHOR = {Benson, David J. and Greenlees, John P. C.}, TITLE = {The action of the {S}teenrod algebra on {T}ate cohomology}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {85}, YEAR = {1993}, NUMBER = {1}, PAGES = {21--26}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55S10 (20J06)}, MRNUMBER = {94b:55023}, MRREVIEWER = {Jin Kun Lin}, } @article {Benson-Greenlees(1997), AUTHOR = {Benson, David J. and Greenlees, John P. C.}, TITLE = {Commutative algebra for cohomology rings of virtual duality groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {192}, YEAR = {1997}, NUMBER = {2}, PAGES = {678--700}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20J05 (20G10 55M05)}, MRNUMBER = {98d:20057}, MRREVIEWER = {Ian J. Leary}, } @article {Benson-Greenlees(1997b), AUTHOR = {Benson, David J. and Greenlees, John P. C.}, TITLE = {Commutative algebra for cohomology rings of classifying spaces of compact {L}ie groups}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {122}, YEAR = {1997}, NUMBER = {1-2}, PAGES = {41--53}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {57T10 (13H10 14B15 55N10)}, MRNUMBER = {98j:57054}, MRREVIEWER = {Mark Hovey}, } @incollection {Benson-Kropholler(1995), AUTHOR = {Benson, David J. and Kropholler, Peter H.}, TITLE = {Cohomology of groups}, BOOKTITLE = {Handbook of algebraic topology}, PAGES = {917--950}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {1995}, MRCLASS = {20Jxx (18G15 19D06 55M05 57M07)}, MRNUMBER = {96j:20072}, MRREVIEWER = {Ian J. Leary}, } @article {Bentzen(1987), AUTHOR = {Bentzen, Steffen}, TITLE = {Some numerical results on space forms}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {54}, YEAR = {1987}, NUMBER = {3}, PAGES = {559--576}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {57R67 (57S25)}, MRNUMBER = {MR879398 (88h:57029)}, MRREVIEWER = {Ian Hambleton}, } @article {Benoist(1995), AUTHOR = {Benoist, Yves}, TITLE = {Une nilvari\'et\'e non affine}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {41}, YEAR = {1995}, NUMBER = {1}, PAGES = {21--52}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C30 (22E25)}, MRNUMBER = {MR1316552 (96c:53077)}, MRREVIEWER = {A. L. Onishchik}, } @article {Bentzen-Madsen(1983), AUTHOR = {Bentzen, Steffen and Madsen, Ib}, TITLE = {On the {S}wan subgroup of certain periodic groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {264}, YEAR = {1983}, NUMBER = {4}, PAGES = {447--474}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {57S17 (20F38 57S25)}, MRNUMBER = {MR716260 (86b:57019)}, MRREVIEWER = {C. B. Thomas}, } @article {Berard-Bergery(1978), AUTHOR = {B{\'e}rard-Bergery, Lionel}, TITLE = {Sur la courbure des m\'etriques riemanniennes invariantes des groupes de {L}ie et des espaces homog\`enes}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {11}, YEAR = {1978}, NUMBER = {4}, PAGES = {543--576}, ISSN = {0012-9593}, CODEN = {ENAQAF}, MRCLASS = {53C30 (22E20)}, MRNUMBER = {80k:53078}, MRREVIEWER = {Rolf Sulanke}, } @book {Berberian(1972), AUTHOR = {Berberian, Sterling K.}, TITLE = {Baer *-rings}, NOTE = {Die Grundlehren der mathematischen Wissenschaften, Band 195}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1972}, PAGES = {xiii+296}, MRCLASS = {16A28 (46L10)}, MRNUMBER = {55 \#2983}, MRREVIEWER = {S. S. Holland Jr.}, } @article {Berberian(1982), AUTHOR = {Berberian, Sterling K.}, TITLE = {The maximal ring of quotients of a finite von {N}eumann algebra}, JOURNAL = {Rocky Mountain J. Math.}, FJOURNAL = {The Rocky Mountain Journal of Mathematics}, VOLUME = {12}, YEAR = {1982}, NUMBER = {1}, PAGES = {149--164}, ISSN = {0035-7596}, CODEN = {RMJMAE}, MRCLASS = {16A08 (16A30 46L10)}, MRNUMBER = {83i:16005}, MRREVIEWER = {David Handelman}, } @article {Berestovskii-Guijarro(2000), AUTHOR = {Berestovskii, V. N. and Guijarro, Luis}, TITLE = {A metric characterization of {R}iemannian submersions}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {18}, YEAR = {2000}, NUMBER = {6}, PAGES = {577--588}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {53C20 (53C21)}, MRNUMBER = {MR1800594 (2002b:53041)}, MRREVIEWER = {Krishnan Shankar}, } @article {Berg-Gilkey(1994), AUTHOR = {van den Berg, Michiel and Gilkey, Peter B.}, TITLE = {Heat content asymptotics of a {R}iemannian manifold with boundary}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {120}, YEAR = {1994}, NUMBER = {1}, PAGES = {48--71}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G11 (58G18 58G20)}, MRNUMBER = {94m:58215}, MRREVIEWER = {Patrice Sawyer}, } @article {Berger(1960), AUTHOR = {Berger, Marcel}, TITLE = {Les vari\'et\'es {R}iemanniennes $(1/4)$-pinc\'ees}, JOURNAL = {Ann. Scuola Norm. Sup. Pisa (3)}, VOLUME = {14}, YEAR = {1960}, PAGES = {161--170}, MRCLASS = {53.72}, MRNUMBER = {25 \#3478}, MRREVIEWER = {K. Yano}, } @article {Berger(1983), AUTHOR = {Berger, Marcel}, TITLE = {Sur les vari\'et\'es riemanniennes pinc\'ees juste au-dessous de $1/4$}, JOURNAL = {Ann. Inst. Fourier (Grenoble)}, FJOURNAL = {Universit\'e de Grenoble. Annales de l'Institut Fourier}, VOLUME = {33}, YEAR = {1983}, NUMBER = {2}, PAGES = {135--150 (loose errata)}, ISSN = {0373-0956}, CODEN = {AIFUA7}, MRCLASS = {53C20}, MRNUMBER = {85d:53017}, MRREVIEWER = {Paul E. Ehrlich}, } @book {Berger(2003), AUTHOR = {Berger, Marcel}, TITLE = {A panoramic view of {R}iemannian geometry}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2003}, PAGES = {xxiv+824}, ISBN = {3-540-65317-1}, MRCLASS = {53-02}, MRNUMBER = {2 002 701}, } @article {Bergeron(2008), AUTHOR = {Bergeron, Nicolas}, TITLE = {Virtual fibering of certain cover of {$\Bbb S^3$}, branched over the figure eight knot}, JOURNAL = {C. R. Math. Acad. Sci. Paris}, FJOURNAL = {Comptes Rendus Math\'ematique. Acad\'emie des Sciences. Paris}, VOLUME = {346}, YEAR = {2008}, NUMBER = {19-20}, PAGES = {1073--1078}, ISSN = {1631-073X}, MRCLASS = {57M12 (57M25)}, MRNUMBER = {2462051 (2009m:57003)}, MRREVIEWER = {Chichen M. Tsau}, DOI = {10.1016/j.crma.2008.09.014}, URL = {http://dx.doi.org/10.1016/j.crma.2008.09.014}, } @article {Berberon-Gelander(2004), AUTHOR = {Bergeron, N. and Gelander, T.}, TITLE = {A note on local rigidity}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {107}, YEAR = {2004}, PAGES = {111--131}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {22E40 (53C24)}, MRNUMBER = {2110758 (2005k:22015)}, MRREVIEWER = {Bachir Bekka}, DOI = {10.1023/B:GEOM.0000049122.75284.06}, URL = {http://dx.doi.org/10.1023/B:GEOM.0000049122.75284.06}, } @article {Bergeron-Haglund-Wise(2011), AUTHOR = {Bergeron, Nicolas and Haglund, Fr{\'e}d{\'e}ric and Wise, Daniel T.}, TITLE = {Hyperplane sections in arithmetic hyperbolic manifolds}, JOURNAL = {J. Lond. Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {83}, YEAR = {2011}, NUMBER = {2}, PAGES = {431--448}, ISSN = {0024-6107}, MRCLASS = {57M50 (11F75 53C23)}, MRNUMBER = {2776645}, MRREVIEWER = {Pablo Su{\'a}rez-Serrato}, DOI = {10.1112/jlms/jdq082}, URL = {http://dx.doi.org/10.1112/jlms/jdq082}, } @article {Bergeron-Gaboriau(2004), AUTHOR = {Bergeron, N. and Gaboriau, Damien}, TITLE = {Asymptotique des nombres de {B}etti, invariants {$l\sp 2$} et laminations}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {79}, YEAR = {2004}, NUMBER = {2}, PAGES = {362--395}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {58J22 (37A15 55N99 57R30)}, MRNUMBER = {MR2059438 (2005d:58041)}, MRREVIEWER = {Bachir Bekka}, } @Article{Bergeron-Linnell-Lueck-Sauer(2014), Author = {Nicolas {Bergeron} and Peter {Linnell} and Wolfgang {L\"uck} and Roman {Sauer}}, Title = {{On the growth of Betti numbers in $p$-adic analytic towers.}}, FJournal = {{Groups, Geometry, and Dynamics}}, Journal = {{Groups Geom. Dyn.}}, ISSN = {1661-7207; 1661-7215/e}, Volume = {8}, Number = {2}, Pages = {311--329}, Year = {2014}, Publisher = {European Mathematical Society Publishing House, Z\"urich}, Language = {English}, DOI = {10.4171/GGD/227}, MSC2010 = {55P99} } @article {Berger+Leinster(2008), AUTHOR = {Berger, Clemens and Leinster, Tom}, TITLE = {The {E}uler characteristic of a category as the sum of a divergent series}, JOURNAL = {Homology, Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {10}, YEAR = {2008}, NUMBER = {1}, PAGES = {41--51}, ISSN = {1532-0073}, MRCLASS = {18G99 (40A05)}, MRNUMBER = {MR2369022 (2008k:18017)}, MRREVIEWER = {G{\'a}bor Braun}, } @article {Bergeron-Lipnowski(2017), AUTHOR = {Bergeron, Nicolas and Lipnowski, Michael}, TITLE = {Twisted limit formula for torsion and cyclic base change}, JOURNAL = {J. \'{E}c. polytech. Math.}, FJOURNAL = {Journal de l'\'{E}cole polytechnique. Math\'{e}matiques}, VOLUME = {4}, YEAR = {2017}, PAGES = {435--471}, ISSN = {2429-7100,2270-518X}, MRCLASS = {11F75 (11F70 22E40 22E41 22E45 58J52)}, MRNUMBER = {3646025}, MRREVIEWER = {Matthew\ Stover}, DOI = {10.5802/jep.47}, URL = {https://doi.org/10.5802/jep.47}, } @article {Bergeron-Venkatesh(2013), AUTHOR = {Bergeron, Nicolas and Venkatesh, Akshay}, TITLE = {The asymptotic growth of torsion homology for arithmetic groups}, JOURNAL = {J. Inst. Math. Jussieu}, FJOURNAL = {Journal of the Institute of Mathematics of Jussieu. JIMJ. Journal de l'Institut de Math\'ematiques de Jussieu}, VOLUME = {12}, YEAR = {2013}, NUMBER = {2}, PAGES = {391--447}, ISSN = {1474-7480}, MRCLASS = {57M25 (22E47)}, MRNUMBER = {3028790}, } @article {Bergeron-Sengun-Venkatesh(2016), AUTHOR = {Bergeron, Nicolas and {\c{S}}eng{\"u}n, Mehmet Haluk and Venkatesh, Akshay}, TITLE = {Torsion homology growth and cycle complexity of arithmetic manifolds}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {165}, YEAR = {2016}, NUMBER = {9}, PAGES = {1629--1693}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {11F67 (57M50)}, MRNUMBER = {3513571}, DOI = {10.1215/00127094-3450429}, URL = {http://dx.doi.org/10.1215/00127094-3450429}, } @article {Berglund-Madsen(2013), AUTHOR = {Berglund, Alexander and Madsen, Ib}, TITLE = {Homological stability of diffeomorphism groups}, JOURNAL = {Pure Appl. Math. Q.}, FJOURNAL = {Pure and Applied Mathematics Quarterly}, VOLUME = {9}, YEAR = {2013}, NUMBER = {1}, PAGES = {1--48}, ISSN = {1558-8599}, MRCLASS = {55P62 (57R50)}, MRNUMBER = {3126499}, MRREVIEWER = {John F. Oprea}, DOI = {10.4310/PAMQ.2013.v9.n1.a1}, URL = {http://dx.doi.org/10.4310/PAMQ.2013.v9.n1.a1}, } @article {Bergman(1974), AUTHOR = {Bergman, George M.}, TITLE = {Modules over coproducts of rings}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {200}, YEAR = {1974}, PAGES = {1--32}, ISSN = {0002-9947}, MRCLASS = {16A64}, MRNUMBER = {0357502 (50 \#9970)}, MRREVIEWER = {K. W. Roggenkamp}, } @article {Berkove-Farrell-Pineda-Pearson(2000), AUTHOR = {Berkove, E. and Farrell, F. T. and Juan-Pineda, D. and Pearson, K.}, TITLE = {The {F}arrell-{J}ones isomorphism conjecture for finite covolume hyperbolic actions and the algebraic ${K}$-theory of {B}ianchi groups}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {352}, YEAR = {2000}, NUMBER = {12}, PAGES = {5689--5702}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57N37 (19A31 19B28 19D35)}, MRNUMBER = {2001b:57052}, MRREVIEWER = {A. A. Ranicki}, } @article {Berkove-Juan-Pineda-Pearson(2001), AUTHOR = {Berkove, Ethan and Juan-Pineda, Daniel and Pearson, Kimberly}, TITLE = {The lower algebraic ${K}$-theory of {F}uchsian groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {76}, YEAR = {2001}, NUMBER = {2}, PAGES = {339--352}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {19Axx (19Bxx 19Dxx 20Hxx)}, MRNUMBER = {1 839 350}, } @article {Berkove-Juan-Pineda-Lu(2004), AUTHOR = {Berkove, Ethan and Juan-Pineda, Daniel and Lu, Qin}, TITLE = {Algebraic {$K$}-theory of mapping class groups}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {32}, YEAR = {2004}, NUMBER = {1}, PAGES = {83--100}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19B28 (19A31 19D35 19J10 20F36)}, MRNUMBER = {2079607 (2005g:19002)}, MRREVIEWER = {Ross Staffeldt}, DOI = {10.1023/B:KTHE.0000035022.89851.9b}, URL = {http://dx.doi.org/10.1023/B:KTHE.0000035022.89851.9b}, } @book {Berline-Getzler-Vergne(1992), AUTHOR = {Berline, Nicole and Getzler, Ezra and Vergne, Mich{\`e}le}, TITLE = {Heat kernels and {D}irac operators}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1992}, PAGES = {viii+369}, ISBN = {3-540-53340-0}, MRCLASS = {58G10 (58G11)}, MRNUMBER = {94e:58130}, MRREVIEWER = {Alejandro Uribe}, } @incollection {Bernstein(1984), AUTHOR = {Bernstein, Joseph N.}, TITLE = {Le ``centre'' de {B}ernstein}, BOOKTITLE = {Representations of reductive groups over a local field}, PAGES = {1--32}, NOTE = {Edited by P. Deligne}, PUBLISHER = {Hermann}, ADDRESS = {Paris}, YEAR = {1984}, MRCLASS = {22E50}, MRNUMBER = {86e:22028}, MRREVIEWER = {Fran{\c{c}}ois Rodier}, } @article {Bernstein-Bezrukavnikov-Kazhdan(2018), AUTHOR = {Bernstein, Joseph and Bezrukavnikov, Roman and Kazhdan, David}, TITLE = {Deligne-{L}usztig duality and wonderful compactification}, JOURNAL = {Selecta Math. (N.S.)}, FJOURNAL = {Selecta Mathematica. New Series}, VOLUME = {24}, YEAR = {2018}, NUMBER = {1}, PAGES = {7--20}, ISSN = {1022-1824}, MRCLASS = {20G05 (14M27 20G25 20J05 22E35)}, MRNUMBER = {3769724}, MRREVIEWER = {Zhe Chen}, DOI = {10.1007/s00029-018-0391-5}, URL = {https://doi.org/10.1007/s00029-018-0391-5}, } @article {Bernstein-Braverman-Gaitsgory(1997), AUTHOR = {Bernstein, Joseph and Braverman, Alexander and Gaitsgory, Dennis}, TITLE = {The {C}ohen-{M}acaulay property of the category of {$(\germ g,K)$}-modules}, JOURNAL = {Selecta Math. (N.S.)}, FJOURNAL = {Selecta Mathematica. New Series}, VOLUME = {3}, YEAR = {1997}, NUMBER = {3}, PAGES = {303--314}, ISSN = {1022-1824}, MRCLASS = {20G05 (13C14)}, MRNUMBER = {1481131}, MRREVIEWER = {Eric N. Sommers}, DOI = {10.1007/s000290050012}, URL = {https://doi.org/10.1007/s000290050012}, } @book {Bernstein-Luntz(1994), AUTHOR = {Bernstein, Joseph and Lunts, Valery}, TITLE = {Equivariant sheaves and functors}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {1578}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1994}, PAGES = {iv+139}, ISBN = {3-540-58071-9}, MRCLASS = {55N91 (14M25 18E30 54B40 55N30)}, MRNUMBER = {MR1299527 (95k:55012)}, MRREVIEWER = {Yi Hu}, } @article {Berrick(2011), AUTHOR = {Berrick, A. J.}, TITLE = {The acyclic group dichotomy}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {326}, YEAR = {2011}, PAGES = {47--58}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20F38 (19E20 57Mxx)}, MRNUMBER = {2746051}, DOI = {10.1016/j.jalgebra.2010.05.009}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2010.05.009}, } @book {Berrick(1982), AUTHOR = {Berrick, A. Jon}, TITLE = {An approach to algebraic ${K}$-theory}, PUBLISHER = {Pitman (Advanced Publishing Program)}, ADDRESS = {Boston, Mass.}, YEAR = {1982}, PAGES = {iii+108}, ISBN = {0-273-08529-8}, MRCLASS = {18F25 (55N15)}, MRNUMBER = {84g:18028}, MRREVIEWER = {K. Vogtmann}, } @article {Berrick-Hesselholt(2015), AUTHOR = {Berrick, A. J. and Hesselholt, Lars}, TITLE = {Topological {H}ochschild homology and the {B}ass trace conjecture}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {704}, YEAR = {2015}, PAGES = {169--185}, ISSN = {0075-4102}, MRCLASS = {Preliminary Data}, MRNUMBER = {3365777}, DOI = {10.1515/crelle-2013-0051}, URL = {http://dx.doi.org/10.1515/crelle-2013-0051}, } @article {Berrick-Chatterji-Mislin(2004), AUTHOR = {Berrick, A. J. and Chatterji, I. and Mislin, G.}, TITLE = {From acyclic groups to the {B}ass conjecture for amenable groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {329}, YEAR = {2004}, NUMBER = {4}, PAGES = {597--621}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {19B28 (16E20 16S34)}, MRNUMBER = {MR2076678}, } @inproceedings {Berrick-Chatterji-Mislin(2007), AUTHOR = {Berrick, A. J. and Chatterji, I. and Mislin, G.}, TITLE = {Homotopy idempotents on manifolds and {B}ass' conjectures}, BOOKTITLE = {Proceedings of the {N}ishida {F}est ({K}inosaki 2003)}, SERIES = {Geom. Topol. Monogr.}, VOLUME = {10}, PAGES = {41--62}, PUBLISHER = {Geom. Topol. Publ., Coventry}, YEAR = {2007}, MRCLASS = {57N50 (19A31 46L10 55M20)}, MRNUMBER = {2402776 (2010j:57031)}, MRREVIEWER = {Bernhard A. Hanke}, DOI = {10.2140/gtm.2007.10.41}, URL = {http://dx.doi.org/10.2140/gtm.2007.10.41}, } @article {Berick-Karoubi-Oestvaer(2001), AUTHOR = {Berrick, A. Jon and Karoubi, Max and {\O}stv{\ae}r, Paul Arne}, TITLE = {Hermitian {$K$}-theory and 2-regularity for totally real number fields}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {349}, YEAR = {2011}, NUMBER = {1}, PAGES = {117--159}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {19Gxx (11R70)}, MRNUMBER = {2753799}, DOI = {10.1007/s00208-010-0503-9}, URL = {http://dx.doi.org/10.1007/s00208-010-0503-9}, } @article {Berrick-Keating(1995), AUTHOR = {Berrick, A. Jon and Keating, Michael E.}, TITLE = {The localization sequence in ${K}$-theory}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {9}, YEAR = {1995}, NUMBER = {6}, PAGES = {577--589}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19A49 (16U20 19B28)}, MRNUMBER = {96j:19001}, MRREVIEWER = {Charles Weibel}, } @article {Berrick-Matthey(2009stable), AUTHOR = {Berrick, A. J. and Matthey, M.}, TITLE = {Stable classical groups and strongly torsion generated groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {84}, YEAR = {2009}, NUMBER = {4}, PAGES = {909--928}, ISSN = {0010-2571}, MRCLASS = {20F28 (19C99 22F50 57M07)}, MRNUMBER = {2534484 (2010k:20056)}, MRREVIEWER = {Matthew B. Day}, DOI = {10.4171/CMH/185}, URL = {http://dx.doi.org/10.4171/CMH/185}, } @article {Berrick-Matthey(2009real), AUTHOR = {Berrick, A. J. and Matthey, M.}, TITLE = {Strongly torsion generated groups from {$K$}-theory of real {$C^*$}-algebras}, JOURNAL = {J. K-Theory}, FJOURNAL = {Journal of K-Theory. K-Theory and its Applications in Algebra, Geometry, Analysis \& Topology}, VOLUME = {3}, YEAR = {2009}, NUMBER = {2}, PAGES = {309--326}, ISSN = {1865-2433}, MRCLASS = {19K56 (19D99 46L80)}, MRNUMBER = {2496450 (2010h:19009)}, MRREVIEWER = {Ioannis Emmanouil}, DOI = {10.1017/is008001012jkt039}, URL = {http://dx.doi.org/10.1017/is008001012jkt039}, } @article {Berridge-Dunwoody(1979), AUTHOR = {Berridge, P. H. and Dunwoody, M. J.}, TITLE = {Nonfree projective modules for torsion-free groups}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {The Journal of the London Mathematical Society. Second Series}, VOLUME = {19}, YEAR = {1979}, NUMBER = {3}, PAGES = {433--436}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {20F34 (57M25)}, MRNUMBER = {MR540056 (80k:20041)}, MRREVIEWER = {J. S. Birman}, } @book {Besse(1987), AUTHOR = {Besse, Arthur L.}, TITLE = {Einstein manifolds}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1987}, PAGES = {xii+510}, ISBN = {3-540-15279-2}, MRCLASS = {53C25 (53-02 53C21 53C30 53C55 58D17 58E11)}, MRNUMBER = {88f:53087}, MRREVIEWER = {S. M. Salamon}, } @article {Bessieres(1998), AUTHOR = {Bessi{\`e}res, Laurent}, TITLE = {Un th\'eor\`eme de rigidit\'e diff\'erentielle}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {73}, YEAR = {1998}, NUMBER = {3}, PAGES = {443--479}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {53C23 (53C20 57R55)}, MRNUMBER = {99m:53085}, MRREVIEWER = {S{\'e}rgio J. Mendon{\c{c}}a}, } @article {Besson-Courtois-Gallot(1991), AUTHOR = {Besson, G{\'e}rard and Courtois, Gilles and Gallot, Sylvestre}, TITLE = {Volume et entropie minimale des espaces localement sym\'etriques}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {103}, YEAR = {1991}, NUMBER = {2}, PAGES = {417--445}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {58D17 (53C23 58E11)}, MRNUMBER = {92d:58027}, MRREVIEWER = {Robert Brooks}, } @article {Besson-Courtois-Gallot(1994a), AUTHOR = {Besson, G{\'e}rard and Courtois, Gilles and Gallot, Sylvestre}, TITLE = {Les vari\'et\'es hyperboliques sont des minima locaux de l'entropie topologique}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {117}, YEAR = {1994}, NUMBER = {3}, PAGES = {403--445}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {53C20 (53C21 58D17 58F17 58G32)}, MRNUMBER = {95d:53034}, MRREVIEWER = {Vadim A. Ka{\u\i}manovich}, } @article {Besson-Courtois-Gallot(1994b), AUTHOR = {Besson, G{\'e}rard and Courtois, Gilles and Gallot, Sylvestre}, TITLE = {Volumes, entropies et rigidit\'es des espaces localement sym\'etriques de courbure strictement n\'egative}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {319}, YEAR = {1994}, NUMBER = {1}, PAGES = {81--84}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {53C20 (53C21)}, MRNUMBER = {95e:53049}, MRREVIEWER = {Noureddine Rahmani}, } @article {Besson-Courtois-Gallot(1995), AUTHOR = {Besson, G{\'e}rard and Courtois, Gilles and Gallot, Sylvestre}, TITLE = {Entropies et rigidit\'es des espaces localement sym\'etriques de courbure strictement n\'egative}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {5}, YEAR = {1995}, NUMBER = {5}, PAGES = {731--799}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58F17 (53C21 53C35)}, MRNUMBER = {96i:58136}, MRREVIEWER = {Boris Hasselblatt}, } @article {Besson-Courtois-Gallot(1996), AUTHOR = {Besson, G{\'e}rard and Courtois, Gilles and Gallot, Sylvestre}, TITLE = {Minimal entropy and {M}ostow's rigidity theorems}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {16}, YEAR = {1996}, NUMBER = {4}, PAGES = {623--649}, ISSN = {0143-3857}, MRCLASS = {58F17 (53C20 53C35 58F11 58F18)}, MRNUMBER = {97e:58177}, MRREVIEWER = {Boris Hasselblatt}, } @incollection{Bestvina(1993), AUTHOR = {Bestvina, Mladen}, TITLE = {The virtual cohomological dimension of {C}oxeter groups}, BOOKTITLE = {Geometric group theory, {V}ol. 1 ({S}ussex, 1991)}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {181}, PAGES = {19--23}, PUBLISHER = {Cambridge Univ. Press, Cambridge}, YEAR = {1993}, MRCLASS = {20F55 (57M07)}, MRNUMBER = {1238512}, DOI = {10.1017/CBO9780511661860.003}, URL = {https://doi.org/10.1017/CBO9780511661860.003}, } @article {Bestvina(1996localhomology), AUTHOR = {Bestvina, Mladen}, TITLE = {Local homology properties of boundaries of groups}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {The Michigan Mathematical Journal}, VOLUME = 43, YEAR = 1996, NUMBER = 1, PAGES = {123--139}, ISSN = {0026-2285}, MRCLASS = {57P10 (20J05 54C56 57N25)}, MRNUMBER = {MR1381603 (97a:57022)}, MRREVIEWER = {Fr{\'e}d{\'e}ric Paulin}, } @article {Bestvina(1996), AUTHOR = {Bestvina, Mladen}, TITLE = {Local homology properties of boundaries of groups}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {Michigan Mathematical Journal}, VOLUME = {43}, YEAR = {1996}, NUMBER = {1}, PAGES = {123--139}, ISSN = {0026-2285}, MRCLASS = {57P10 (20J05 54C56 57N25)}, MRNUMBER = {1381603}, MRREVIEWER = {Fr\'ed\'eric Paulin}, DOI = {10.1307/mmj/1029005393}, URL = {http://dx.doi.org/10.1307/mmj/1029005393}, } @inproceedings {Bestvina(2002a), AUTHOR = {Bestvina, Mladen}, TITLE = {The topology of {${\rm Out}(F\sb n)$}}, BOOKTITLE = {Proceedings of the International Congress of Mathematicians, Vol. II (Beijing, 2002)}, PAGES = {373--384}, PUBLISHER = {Higher Ed. Press}, ADDRESS = {Beijing}, YEAR = {2002}, MRCLASS = {57M07 (20E08 20F65)}, MRNUMBER = {MR1957048 (2004a:57002)}, } @incollection {Bestvina(2002b), AUTHOR = {Bestvina, Mladen}, TITLE = {{$\Bbb R$}-trees in topology, geometry, and group theory}, BOOKTITLE = {Handbook of geometric topology}, PAGES = {55--91}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {2002}, MRCLASS = {20E08 (20F65 57M07)}, MRNUMBER = {MR1886668 (2003b:20040)}, MRREVIEWER = {Fr{\'e}d{\'e}ric Paulin}, } @incollection {Bestvina(2006), AUTHOR = {Bestvina, Mladen}, TITLE = {Four questions about mapping class groups}, BOOKTITLE = {Problems on mapping class groups and related topics}, SERIES = {Proc. Sympos. Pure Math.}, VOLUME = {74}, PAGES = {3--9}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2006}, MRCLASS = {32G15 (20F34 20F65 30F45 30F60 57M50)}, MRNUMBER = {MR2264129 (2007h:32020)}, MRREVIEWER = {Jason A. Behrstock}, } @article {Bestvina-Brady(1997), AUTHOR = {Bestvina, Mladen and Brady, Noel}, TITLE = {Morse theory and finiteness properties of groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {129}, YEAR = {1997}, NUMBER = {3}, PAGES = {445--470}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20F36 (20J05 57M07)}, MRNUMBER = {98i:20039}, MRREVIEWER = {John Meier}, } @article {Bestvina-Bux-Margalit(2007), AUTHOR = {Bestvina, Mladen and Bux, Kai-Uwe and Margalit, Dan}, TITLE = {Dimension of the {T}orelli group for {${\rm Out}(F\sb n)$}}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {170}, YEAR = {2007}, NUMBER = {1}, PAGES = {1--32}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57Mxx}, MRNUMBER = {MR2336078}, } @article {Bestvina-Feighn(1991), AUTHOR = {Bestvina, Mladen and Feighn, Mark}, TITLE = {Bounding the complexity of simplicial group actions on trees}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {103}, YEAR = {1991}, NUMBER = {3}, PAGES = {449--469}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20E08 (57M07)}, MRNUMBER = {92c:20044}, MRREVIEWER = {Roger C. Alperin}, } @article {Bestvina-Feighn(1995), AUTHOR = {Bestvina, Mladen and Feighn, Mark}, TITLE = {Stable actions of groups on real trees}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {121}, YEAR = {1995}, NUMBER = {2}, PAGES = {287--321}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20E08 (57M07 57R30)}, MRNUMBER = {96h:20056}, MRREVIEWER = {Fr{\'e}d{\'e}ric Paulin}, } @article {Bestvina-Feighn(2002), AUTHOR = {Bestvina, Mladen and Feighn, Mark}, TITLE = {Proper actions of lattices on contractible manifolds}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {150}, YEAR = {2002}, NUMBER = {2}, PAGES = {237--256}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57S30 (22E40 57M07)}, MRNUMBER = {MR1933585 (2004d:57042)}, MRREVIEWER = {Vyacheslav S. Krushkal}, } @article {Bestvina-Feign(2005), AUTHOR = {Bestvina, M. and Feighn, M.}, TITLE = {Counting maps from a surface to a graph}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {15}, YEAR = {2005}, NUMBER = {5}, PAGES = {939--961}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {20F65 (57M05)}, MRNUMBER = {MR2221155 (2007f:20070)}, MRREVIEWER = {Andrei Yu. Vesnin}, } @article {Bestvina-Feign-Handel(2005), AUTHOR = {Bestvina, Mladen and Feighn, Mark and Handel, Michael}, TITLE = {The {T}its alternative for {${\rm Out}(F\sb n)$}. {II}. {A} {K}olchin type theorem}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {161}, YEAR = {2005}, NUMBER = {1}, PAGES = {1--59}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {20E36 (20E05 57M07)}, MRNUMBER = {MR2150382 (2006f:20030)}, MRREVIEWER = {S. Andreadakis}, } @article {Bestvina-Feign-Handel(2004), AUTHOR = {Bestvina, Mladen and Feighn, Mark and Handel, Michael}, TITLE = {Solvable subgroups of {${\rm Out}(F\sb n)$} are virtually {A}belian}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {104}, YEAR = {2004}, PAGES = {71--96}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F65 (20F28 57M07)}, MRNUMBER = {MR2043955 (2005b:20073)}, MRREVIEWER = {S. Andreadakis}, } @article {Bestvina-Feign-Handel(2000), AUTHOR = {Bestvina, Mladen and Feighn, Mark and Handel, Michael}, TITLE = {The {T}its alternative for {${\rm Out}(F_n)$}. {I}. {D}ynamics of exponentially-growing automorphisms}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {151}, YEAR = {2000}, NUMBER = {2}, PAGES = {517--623}, ISSN = {0003-486X}, MRCLASS = {20E36 (20E05 57M07)}, MRNUMBER = {1765705}, MRREVIEWER = {K. Vogtmann}, URL = {https://doi.org/10.2307/121043}, } @article {Bestvina-Fujiwara-Wigglesworth(2023), AUTHOR = {Bestvina, Mladen and Fujiwara, Koji and Wigglesworth, Derrick}, TITLE = {The {F}arrell-{J}ones conjecture for hyperbolic-by-cyclic groups}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2023}, Volume = {7}, PAGES = {5887--5904}, ISSN = {1073-7928,1687-0247}, MRCLASS = {20F67 (20F28 20F65)}, MRNUMBER = {4565703}, DOI = {10.1093/imrn/rnac012}, URL = {https://doi.org/10.1093/imrn/rnac012}, } @article {Bestvina-Guirardel-Horbez(2022), AUTHOR = {Bestvina, Mladen and Guirardel, Vincent and Horbez, Camille}, TITLE = {Boundary amenability of {${\rm Out}(F_N)$}}, JOURNAL = {Ann. Sci. \'{E}c. Norm. Sup\'{e}r. (4)}, FJOURNAL = {Annales Scientifiques de l'\'{E}cole Normale Sup\'{e}rieure. Quatri\`eme S\'{e}rie}, VOLUME = {55}, YEAR = {2022}, NUMBER = {5}, PAGES = {1379--1431}, ISSN = {0012-9593,1873-2151}, MRCLASS = {20E36 (20E05 20F36 20F67 57K20)}, MRNUMBER = {4517690}, DOI = {10.24033/asens.2519}, URL = {https://doi.org/10.24033/asens.2519}, } @article {Bestvina-Kapovich-Kleiner(2002), AUTHOR = {Bestvina, Mladen and Kapovich, Michael and Kleiner, Bruce}, TITLE = {Van {K}ampen's embedding obstruction for discrete groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {150}, YEAR = {2002}, NUMBER = {2}, PAGES = {219--235}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57S30 (57M07)}, MRNUMBER = {MR1933584 (2004c:57060)}, MRREVIEWER = {Vyacheslav S. Krushkal}, } @article {Bestvina-Koji(2007), AUTHOR = {Bestvina, Mladen and Fujiwara, Koji}, TITLE = {Quasi-homomorphisms on mapping class groups}, JOURNAL = {Glas. Mat. Ser. III}, FJOURNAL = {Glasnik Matemati\v cki. Serija III}, VOLUME = {42(62)}, YEAR = {2007}, NUMBER = {1}, PAGES = {213--236}, ISSN = {0017-095X}, CODEN = {GLMAB2}, MRCLASS = {57M07 (57S30)}, MRNUMBER = {MR2332668}, } @article {Bestvina-Mess(1991), AUTHOR = {Bestvina, Mladen and Mess, Geoffrey}, TITLE = {The boundary of negatively curved groups}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {4}, YEAR = {1991}, NUMBER = {3}, PAGES = {469--481}, ISSN = {0894-0347}, MRCLASS = {20F32 (57M40)}, MRNUMBER = {93j:20076}, MRREVIEWER = {Jerzy Dydak}, } @article {Betley(1986), AUTHOR = {Betley, Stanis{\l}aw}, TITLE = {On the homotopy groups of ${A}({X})$}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {98}, YEAR = {1986}, NUMBER = {3}, PAGES = {495--498}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {18F25 (19D10)}, MRNUMBER = {87m:18015}, MRREVIEWER = {Ian Hambleton}, } @article {Bettaieb-Valette(1996), AUTHOR = {Bettaieb, Hela and Valette, Alain}, TITLE = {Sur le groupe ${K}\sb 1$ des ${C}\sp *$-alg\`ebres r\'eduites de groupes discrets}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {322}, YEAR = {1996}, NUMBER = {10}, PAGES = {925--928}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {46L80 (19K56 19L64 22D15 46L05)}, MRNUMBER = {98b:46090}, MRREVIEWER = {Judith A. Packer}, } @incollection {Beulinson-Bernstein-Deligne(1982), AUTHOR = {Be\u{\i}linson, A. A. and Bernstein, J. and Deligne, P.}, TITLE = {Faisceaux pervers}, BOOKTITLE = {Analysis and topology on singular spaces, {I} ({L}uminy, 1981)}, SERIES = {Ast\'{e}risque}, VOLUME = {100}, PAGES = {5--171}, PUBLISHER = {Soc. Math. France, Paris}, YEAR = {1982}, MRCLASS = {32C38}, MRNUMBER = {751966}, MRREVIEWER = {Zoghman Mebkhout}, } @article {Bezrukavnikov-Kazhdan(2015), AUTHOR = {Bezrukavnikov, Roman and Kazhdan, David}, TITLE = {Geometry of second adjointness for {$p$}-adic groups}, NOTE = {With an appendix by Yakov Varshavsky, Bezrukavnikov and Kazhdan}, JOURNAL = {Represent. Theory}, FJOURNAL = {Representation Theory. An Electronic Journal of the American Mathematical Society}, VOLUME = {19}, YEAR = {2015}, PAGES = {299--332}, ISSN = {1088-4165}, MRCLASS = {20G15 (14G20 14L15 14L24 20G25 22E35 22E50)}, MRNUMBER = {3430373}, MRREVIEWER = {Marko Tadi\"A‡}, DOI = {10.1090/ert/471}, URL = {http://dx.doi.org/10.1090/ert/471}, } @article {Bhatt-Scholze(2015pretale), AUTHOR = {Bhatt, Bhargav and Scholze, Peter}, TITLE = {The pro-\'etale topology for schemes}, JOURNAL = {Ast\'erisque}, FJOURNAL = {Ast\'erisque}, NUMBER = {369}, YEAR = {2015}, PAGES = {99--201}, ISSN = {0303-1179}, ISBN = {978-2-85629-805-3}, MRCLASS = {14F05 (14F20 14F35 14H30 18B25)}, MRNUMBER = {3379634}, MRREVIEWER = {Pieter Belmans}, } @article {Bhatt-Scholze(2015Hodge), AUTHOR = {Bhatt, B. and Morrow, M. and Scholze, P.}, TITLE = {Integral {$p$}-adic {H}odge theory---announcement}, JOURNAL = {Math. Res. Lett.}, FJOURNAL = {Mathematical Research Letters}, VOLUME = {22}, YEAR = {2015}, NUMBER = {6}, PAGES = {1601--1612}, ISSN = {1073-2780}, MRCLASS = {14F20 (11G25 14F30 14F40 14G20 14G22)}, MRNUMBER = {3507252}, MRREVIEWER = {Christopher David Lazda}, DOI = {10.4310/MRL.2015.v22.n6.a3}, URL = {http://dx.doi.org/10.4310/MRL.2015.v22.n6.a3}, } @article {Bier-Greenlees(1993a), AUTHOR = {Bier, Thomas and Greenlees, John P. C.}, TITLE = {The lattice spanned by the cosets of subgroups in the integral group ring of a finite group}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {The Journal of the London Mathematical Society. Second Series}, VOLUME = {47}, YEAR = {1993}, NUMBER = {3}, PAGES = {433--449}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {20C10 (20D08)}, MRNUMBER = {94f:20009}, MRREVIEWER = {J{\"u}rgen Ritter}, } @book {Bieri(1976a), AUTHOR = {Bieri, Robert}, TITLE = {Homological dimension of discrete groups}, NOTE = {Queen Mary College Mathematics Notes}, PUBLISHER = {Mathematics Department, Queen Mary College, London}, YEAR = {1976}, PAGES = {iii+190}, MRCLASS = {20J05}, MRNUMBER = {57 \#6224}, MRREVIEWER = {Kenneth S. Brown}, } @article {Bieri(1976b), AUTHOR = {Bieri, Robert}, TITLE = {A group with torsion-free $2$-divisible homology and {C}appell's result on the {N}ovikov conjecture}, JOURNAL = {Invent. Math.}, VOLUME = {33}, YEAR = {1976}, NUMBER = {2}, PAGES = {181--184}, MRCLASS = {57D20 (57D65)}, MRNUMBER = {55 \#11263}, } @article {Bieri(1980), AUTHOR = {Bieri, Robert}, TITLE = {A connection between the integral homology and the centre of a rational linear group}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {170}, YEAR = {1980}, NUMBER = {3}, PAGES = {263--266}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {20J05}, MRNUMBER = {81h:20064}, MRREVIEWER = {Mauricio Guti{\'e}rrez}, } @incollection {Bieri(1993), AUTHOR = {Bieri, Robert}, TITLE = {The geometric invariants of a group. {A} survey with emphasis on the homotopical approach}, BOOKTITLE = {Geometric group theory, Vol.\ 1 (Sussex, 1991)}, PAGES = {24--36}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1993}, MRCLASS = {57M07 (20J05)}, MRNUMBER = {95a:57003}, MRREVIEWER = {Ross Geoghegan}, } @incollection {Bieri(1999), AUTHOR = {Bieri, Robert}, TITLE = {Finiteness length and connectivity length for groups}, BOOKTITLE = {Geometric group theory down under (Canberra, 1996)}, PAGES = {9--22}, PUBLISHER = {de Gruyter}, ADDRESS = {Berlin}, YEAR = {1999}, MRCLASS = {20F65 (57M07)}, MRNUMBER = {2000g:20070}, MRREVIEWER = {Gilbert Levitt}, } @article {Bieri(2007), AUTHOR = {Bieri, Robert}, TITLE = {Deficiency and the geometric invariants of a group}, NOTE = {With an appendix by Pascal Schweitzer}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {208}, YEAR = {2007}, NUMBER = {3}, PAGES = {951--959}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20J05 (20F65)}, MRNUMBER = {MR2283437 (2008a:20081)}, MRREVIEWER = {J. R. J. Groves}, } @article {Bieri+Eckmann(1973), AUTHOR = {Bieri, Robert and Eckmann, Beno}, TITLE = {Groups with homological duality generalizing {P}oincar\'e duality}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {20}, YEAR = {1973}, PAGES = {103--124}, ISSN = {0020-9910}, MRCLASS = {20J05}, MRNUMBER = {MR0340449 (49 \#5204)}, MRREVIEWER = {L. Ribes}, } @article {Bieri+Eckmann(1978), AUTHOR = {Bieri, Robert and Eckmann, Beno}, TITLE = {Relative homology and {P}oincar\'e duality for group pairs}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {13}, YEAR = {1978}, NUMBER = {3}, PAGES = {277--319}, ISSN = {0022-4049}, MRCLASS = {20J10 (57P10)}, MRNUMBER = {MR509165 (80k:20048)}, MRREVIEWER = {Kenneth S. Brown}, } @article {Bieri+Eckmann(1974), AUTHOR = {Bieri, Robert and Eckmann, Beno}, TITLE = {Finiteness properties of duality groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {49}, YEAR = {1974}, PAGES = {74--83}, ISSN = {0010-2571}, MRCLASS = {20J05}, MRNUMBER = {MR0340450 (49 \#5205)}, MRREVIEWER = {L. Ribes}, } @incollection {Bieri+Eckmann(1979), AUTHOR = {Bieri, Robert and Eckmann, Beno}, TITLE = {Two-dimensional {P}oincar\'e duality groups and pairs}, BOOKTITLE = {Homological group theory (Proc. Sympos., Durham, 1977)}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {36}, PAGES = {225--230}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1979}, MRCLASS = {55U30}, MRNUMBER = {MR564425 (81f:55027)}, MRREVIEWER = {Mauricio Guti{\'e}rrez}, } @article {Bieri-Groves(1982), AUTHOR = {Bieri, Robert and Groves, John R. J.}, TITLE = {Metabelian groups of type $({\rm {F}{P}})\sb{\infty }$\ are virtually of type $({\rm {F}{P}})$}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {45}, YEAR = {1982}, NUMBER = {2}, PAGES = {365--384}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {20K05 (20F99)}, MRNUMBER = {83m:20070}, MRREVIEWER = {D. E. Cohen}, } @article {Bieri-Groves(1984), AUTHOR = {Bieri, Robert and Groves, John R. J.}, TITLE = {The geometry of the set of characters induced by valuations}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {347}, YEAR = {1984}, PAGES = {168--195}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {14A20 (12J20 13A18 52A25)}, MRNUMBER = {86c:14001}, MRREVIEWER = {Ralph Strebel}, } @article {Bieri-Neumann-Strebel(1987), AUTHOR = {Bieri, Robert and Neumann, Walter D. and Strebel, Ralph}, TITLE = {A geometric invariant of discrete groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {90}, YEAR = {1987}, NUMBER = {3}, PAGES = {451--477}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20J05 (22E40 57R19)}, MRNUMBER = {89b:20108}, MRREVIEWER = {P. Kropholler}, } @article {Bieri-Renz(1988), AUTHOR = {Bieri, Robert and Renz, Burkhardt}, TITLE = {Valuations on free resolutions and higher geometric invariants of groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {63}, YEAR = {1988}, NUMBER = {3}, PAGES = {464--497}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {20J05 (20F32 57M99)}, MRNUMBER = {90a:20106}, MRREVIEWER = {Ralph Strebel}, } @article {Bieri-Strebel(1978), AUTHOR = {Bieri, Robert and Strebel, Ralph}, TITLE = {Almost finitely presented soluble groups}, JOURNAL = {Comment. Math. Helv.}, VOLUME = {53}, YEAR = {1978}, NUMBER = {2}, PAGES = {258--278}, MRCLASS = {20F05}, MRNUMBER = {58 \#16890}, MRREVIEWER = {B. Hartley}, } @article {Bieri-Strebel(1980), AUTHOR = {Bieri, Robert and Strebel, Ralph}, TITLE = {Valuations and finitely presented metabelian groups}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {41}, YEAR = {1980}, NUMBER = {3}, PAGES = {439--464}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {20K99}, MRNUMBER = {81j:20080}, MRREVIEWER = {R. G{\"o}bel}, } @article {Bieri-Strebel(1981), AUTHOR = {Bieri, Robert and Strebel, Ralph}, TITLE = {On the existence of finitely generated normal subgroups with infinite cyclic quotients}, JOURNAL = {Arch. Math. (Basel)}, FJOURNAL = {Archiv der Mathematik. Archives of Mathematics. Archives Math\'ematiques}, VOLUME = {36}, YEAR = {1981}, NUMBER = {5}, PAGES = {401--403}, ISSN = {0003-889X}, CODEN = {ACVMAL}, MRCLASS = {20F05}, MRNUMBER = {84c:20038}, MRREVIEWER = {J. R. J. Groves}, } @article {Bigelow(2001), AUTHOR = {Bigelow, Stephen J.}, TITLE = {Braid groups are linear}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {14}, YEAR = {2001}, NUMBER = {2}, PAGES = {471--486 (electronic)}, ISSN = {0894-0347}, MRCLASS = {20F36 (57M07)}, MRNUMBER = {2002a:20043}, MRREVIEWER = {Darryl McCullough}, } @article {Birkhoff(1936), AUTHOR = {Birkhoff, Garrett}, TITLE = {A note on topological groups}, JOURNAL = {Compositio Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {3}, YEAR = {1936}, PAGES = {427--430}, ISSN = {0010-437X}, CODEN = {CMPMAF}, MRCLASS = {Contributed Item}, MRNUMBER = {1556955}, URL = {http://www.numdam.org/item?id=CM_1936__3__427_0}, } @book {Birman(1974), AUTHOR = {Birman, Joan S.}, TITLE = {Braids, links, and mapping class groups}, NOTE = {Annals of Mathematics Studies, No. 82}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1974}, PAGES = {ix+228}, MRCLASS = {55A25}, MRNUMBER = {51 \#11477}, MRREVIEWER = {Wilbur Whitten}, } @article {Birman(1993), AUTHOR = {Birman, Joan S.}, TITLE = {New points of view in knot theory}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {28}, YEAR = {1993}, NUMBER = {2}, PAGES = {253--287}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {57M25 (20F36 57-02)}, MRNUMBER = {94b:57007}, MRREVIEWER = {Louis H. Kauffman}, } @article {Birman-Lin(1993), AUTHOR = {Birman, Joan S. and Lin, Xiao-Song}, TITLE = {Knot polynomials and {V}assiliev's invariants}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {111}, YEAR = {1993}, NUMBER = {2}, PAGES = {225--270}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57M25}, MRNUMBER = {94d:57010}, MRREVIEWER = {J{\'o}zef H. Przytycki}, } @article {Birman-Menasco(1993), AUTHOR = {Birman, Joan S. and Menasco, William W.}, TITLE = {Studying links via closed braids. {I}{I}{I}. {C}lassifying links which are closed $3$-braids}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {161}, YEAR = {1993}, NUMBER = {1}, PAGES = {25--113}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {57M25}, MRNUMBER = {94i:57005}, MRREVIEWER = {Hugh Reynolds Morton}, } @article {Birman-Wenzel(1989), AUTHOR = {Birman, Joan S. and Wenzl, Hans}, TITLE = {Braids, link polynomials and a new algebra}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {313}, YEAR = {1989}, NUMBER = {1}, PAGES = {249--273}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57M25 (17B99 20F36)}, MRNUMBER = {90g:57004}, MRREVIEWER = {Mark E. Kidwell}, } @article {Birmingham-Blau-Rakowski-Thompson(1991), AUTHOR = {Birmingham, Danny and Blau, Matthias and Rakowski, Mark and Thompson, George}, TITLE = {Topological field theory}, JOURNAL = {Phys. Rep.}, FJOURNAL = {Physics Reports. A Review Section of Physics Letters}, VOLUME = {209}, YEAR = {1991}, NUMBER = {4-5}, PAGES = {129--340}, ISSN = {0370-1573}, CODEN = {PRPLCM}, MRCLASS = {81-02 (57-02 57M99 57R99 58D27 58D29 81T13 81T40)}, MRNUMBER = {93c:81003}, MRREVIEWER = {Bogus{\l}aw Broda}, } @book {Bishop-Crittenden(1964), AUTHOR = {Bishop, Richard L. and Crittenden, Richard J.}, TITLE = {Geometry of manifolds}, PUBLISHER = {Academic Press}, ADDRESS = {New York}, YEAR = {1964}, PAGES = {ix+273}, MRCLASS = {53.00}, MRNUMBER = {29 \#6401}, MRREVIEWER = {W. Klingenberg}, } @article {Biss-Dugger-Isaksen(2008), AUTHOR = {Biss, Daniel K. and Dugger, Daniel and Isaksen, Daniel C.}, TITLE = {Large annihilators in {C}ayley-{D}ickson algebras}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {36}, YEAR = {2008}, NUMBER = {2}, PAGES = {632--664}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {17A01 (17B30)}, MRNUMBER = {MR2388028 (2009b:17001)}, MRREVIEWER = {Santos Gonz{\'a}lez}, } @article {Biss-Farb(2009), AUTHOR = {Biss, Daniel and Farb, Benson}, TITLE = {Erratum: {$K_g$} is not finitely generated}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {178}, YEAR = {2009}, NUMBER = {1}, PAGES = {229}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57M99 (20F29 20F34 20F38)}, MRNUMBER = {MR2534096}, MRREVIEWER = {Darryl McCullough}, DOI = {10.1007/s00222-009-0202-x}, URL = {http://dx.doi.org/10.1007/s00222-009-0202-x}, } @article {Bismut(1985), AUTHOR = {Bismut, Jean-Michel}, TITLE = {The {A}tiyah-{S}inger index theorem for families of {D}irac operators: two heat equation proofs}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {83}, YEAR = {1985}, NUMBER = {1}, PAGES = {91--151}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {58G10 (58G11 58G32)}, MRNUMBER = {87g:58117}, MRREVIEWER = {Peter Haskell}, } @incollection {Bismut(1993), AUTHOR = {Bismut, Jean-Michel}, TITLE = {From {Q}uillen metrics to {R}eidemeister metrics: some aspects of the {R}ay-{S}inger analytic torsion}, BOOKTITLE = {Topological methods in modern mathematics (Stony Brook, NY, 1991)}, PAGES = {273--324}, PUBLISHER = {Publish or Perish}, ADDRESS = {Houston, TX}, YEAR = {1993}, MRCLASS = {58G26 (58-02 58G10 58G11)}, MRNUMBER = {94e:58144}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article {Bismut(1995), AUTHOR = {Bismut, Jean-Michel}, TITLE = {Equivariant immersions and {Q}uillen metrics}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {41}, YEAR = {1995}, NUMBER = {1}, PAGES = {53--157}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G26 (32L10)}, MRNUMBER = {96m:58261}, MRREVIEWER = {K. Dabrowski}, } @article {Bismut(1997), AUTHOR = {Bismut, Jean-Michel}, TITLE = {Quillen metrics and singular fibres in arbitrary relative dimension}, JOURNAL = {J. Algebraic Geom.}, FJOURNAL = {Journal of Algebraic Geometry}, VOLUME = {6}, YEAR = {1997}, NUMBER = {1}, PAGES = {19--149}, ISSN = {1056-3911}, MRCLASS = {58J52 (14C40 32L10 57R20 58J22)}, MRNUMBER = {2000a:58084}, MRREVIEWER = {Steven Rosenberg}, } @article {Bismut(1997fam), AUTHOR = {Bismut, Jean-Michel}, TITLE = {Holomorphic families of immersions and higher analytic torsion forms}, JOURNAL = {Ast\'erisque}, FJOURNAL = {Ast\'erisque}, VOLUME = {244}, YEAR = {1997}, PAGES = {viii+275}, ISSN = {0303-1179}, MRCLASS = {58J52 (19E20 32L10 58J20)}, MRNUMBER = {1623496 (2000b:58057)}, MRREVIEWER = {Kai K{\"o}hler}, } @inproceedings {Bismut(1998), AUTHOR = {Bismut, Jean-Michel}, TITLE = {Local index theory and higher analytic torsion}, BOOKTITLE = {Proceedings of the {I}nternational {C}ongress of {M}athematicians, {V}ol. {I} ({B}erlin, 1998)}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, YEAR = {1998}, VOLUME = {Extra Vol. I}, PAGES = {143--162 (electronic)}, ISSN = {1431-0635}, MRCLASS = {58J52 (14C40 32L10 58J20)}, MRNUMBER = {1648029 (2000e:58049)}, MRREVIEWER = {I-Hsun Tsai}, } @article {Bismut-Cheeger(1989), AUTHOR = {Bismut, Jean-Michel and Cheeger, Jeff}, TITLE = {$\eta$-invariants and their adiabatic limits}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {2}, YEAR = {1989}, NUMBER = {1}, PAGES = {33--70}, ISSN = {0894-0347}, MRCLASS = {58G10 (58C50 58G12 58G20)}, MRNUMBER = {89k:58269}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article {Bismut-Cheeger(1990), AUTHOR = {Bismut, Jean-Michel and Cheeger, Jeff}, TITLE = {Families index for manifolds with boundary, superconnections, and cones. {I}. {F}amilies of manifolds with boundary and {D}irac operators}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {89}, YEAR = {1990}, NUMBER = {2}, PAGES = {313--363}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G10 (58G11 58G32)}, MRNUMBER = {91e:58180}, MRREVIEWER = {Steven Rosenberg}, } @article {Bismut-Freed(1986a), AUTHOR = {Bismut, Jean-Michel and Freed, Daniel S.}, TITLE = {The analysis of elliptic families. {I}{I}. {D}irac operators, eta invariants, and the holonomy theorem}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {107}, YEAR = {1986}, NUMBER = {1}, PAGES = {103--163}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G11 (58G10 58G32)}, MRNUMBER = {88h:58110b}, MRREVIEWER = {Ezra Getzler}, } @article {Bismut-Freed(1986b), AUTHOR = {Bismut, Jean-Michel and Freed, Daniel S.}, TITLE = {The analysis of elliptic families. {I}. {M}etrics and connections on determinant bundles}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {106}, YEAR = {1986}, NUMBER = {1}, PAGES = {159--176}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G11 (58G10 58G32)}, MRNUMBER = {88h:58110a}, MRREVIEWER = {Ezra Getzler}, } @article {Bismut-Gillet-Soule(1988a), AUTHOR = {Bismut, Jean-Michel and Gillet, Henri and Soul{\'e}, Christophe}, TITLE = {Analytic torsion and holomorphic determinant bundles. {I}. {B}ott-{C}hern forms and analytic torsion}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {115}, YEAR = {1988}, NUMBER = {1}, PAGES = {49--78}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G10 (14F05 32L10 58G11)}, MRNUMBER = {89g:58192a}, MRREVIEWER = {Peter Haskell}, } @article {Bismut-Gillet-Soule(1988b), AUTHOR = {Bismut, Jean-Michel and Gillet, Henri and Soul{\'e}, Christophe}, TITLE = {Analytic torsion and holomorphic determinant bundles. {I}{I}. {D}irect images and {B}ott-{C}hern forms}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {115}, YEAR = {1988}, NUMBER = {1}, PAGES = {79--126}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G10 (14F05 32L10 58G11)}, MRNUMBER = {89g:58192b}, MRREVIEWER = {Peter Haskell}, } @article {Bismut-Gillet-Soule(1988c), AUTHOR = {Bismut, Jean-Michel and Gillet, Henri and Soul{\'e}, Christophe}, TITLE = {Analytic torsion and holomorphic determinant bundles. {I}{I}{I}. {Q}uillen metrics on holomorphic determinants}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {115}, YEAR = {1988}, NUMBER = {2}, PAGES = {301--351}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G10 (14F05 32L10 58G11)}, MRNUMBER = {89g:58192c}, MRREVIEWER = {Peter Haskell}, } @article {Bismut-Goette(2000a), AUTHOR = {Bismut, Jean-Michel and Goette, Sebastian}, TITLE = {Formes de torsion analytique en th\'eorie de de {R}ham et fonctions de {M}orse}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {330}, YEAR = {2000}, NUMBER = {6}, PAGES = {479--484}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {58J52 (58E05)}, MRNUMBER = {1756962 (2002d:58040)}, DOI = {10.1016/S0764-4442(00)00204-4}, URL = {http://dx.doi.org/10.1016/S0764-4442(00)00204-4}, } @article {Bismut-Goette(2000b), AUTHOR = {Bismut, Jean-Michel and Goette, Sebastian}, TITLE = {Rigidit\'e des formes de torsion analytique en th\'eorie de de {R}ham}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {330}, YEAR = {2000}, NUMBER = {6}, PAGES = {471--477}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {58J52}, MRNUMBER = {1756961 (2002d:58039)}, DOI = {10.1016/S0764-4442(00)00205-6}, URL = {http://dx.doi.org/10.1016/S0764-4442(00)00205-6}, } @article {Bismut-Goette(2001), AUTHOR = {Bismut, Jean-Michel and Goette, Sebastian}, TITLE = {Torsions analytiques \'equivariantes en th\'eorie de de {R}ham}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {332}, YEAR = {2001}, NUMBER = {1}, PAGES = {33--39}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {58J52 (58J20 58J35)}, MRNUMBER = {1805624 (2001m:58068)}, MRREVIEWER = {Xiaonan Ma}, DOI = {10.1016/S0764-4442(00)01772-9}, URL = {http://dx.doi.org/10.1016/S0764-4442(00)01772-9}, } @article {Bismut-Koehler(1992), AUTHOR = {Bismut, Jean-Michel and K{\"o}hler, Kai}, TITLE = {Higher analytic torsion forms for direct images and anomaly formulas}, JOURNAL = {J. Algebraic Geom.}, FJOURNAL = {Journal of Algebraic Geometry}, VOLUME = {1}, YEAR = {1992}, NUMBER = {4}, PAGES = {647--684}, ISSN = {1056-3911}, MRCLASS = {58G26 (32L10 58G10)}, MRNUMBER = {94a:58209}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article {Bismut-Lott(1993), AUTHOR = {Bismut, Jean-Michel and Lott, John}, TITLE = {Fibr\'es plats, images directes et formes de torsion analytique}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {316}, YEAR = {1993}, NUMBER = {5}, PAGES = {477--482}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {58G26 (57R20 58G05)}, MRNUMBER = {94f:58134}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article {Bismut-Lott(1995), AUTHOR = {Bismut, Jean-Michel and Lott, John}, TITLE = {Flat vector bundles, direct images and higher real analytic torsion}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {8}, YEAR = {1995}, NUMBER = {2}, PAGES = {291--363}, ISSN = {0894-0347}, MRCLASS = {58G26 (58G11)}, MRNUMBER = {96g:58202}, MRREVIEWER = {Matthias Lesch}, } @article {Bismut-Lott(1997), AUTHOR = {Bismut, Jean-Michel and Lott, John}, TITLE = {Torus bundles and the group cohomology of ${\rm {G}{L}}({N},\bold {Z})$}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {47}, YEAR = {1997}, NUMBER = {2}, PAGES = {196--236}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58J22 (57R20 58J35)}, MRNUMBER = {2000b:58040}, MRREVIEWER = {John G. Miller}, } @article {Bismut-Zhang(1992), AUTHOR = {Bismut, Jean-Michel and Zhang, Weiping}, TITLE = {An extension of a theorem by {C}heeger and {M}\"uller}, NOTE = {With an appendix by F.~Laudenbach}, JOURNAL = {Ast\'erisque}, FJOURNAL = {Ast\'erisque}, VOLUME = {205}, YEAR = {1992}, PAGES = {235}, ISSN = {0303-1179}, MRCLASS = {58G26 (57Q10 57R57 58G11)}, MRNUMBER = {93j:58138}, MRREVIEWER = {Steven Rosenberg}, } @article {Bismut-Zhang(1993), AUTHOR = {Bismut, Jean-Michel and Zhang, Weiping}, TITLE = {Real embeddings and eta invariants}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {295}, YEAR = {1993}, NUMBER = {4}, PAGES = {661--684}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {58G10 (57R20 58G26)}, MRNUMBER = {94e:58131}, MRREVIEWER = {Steven Rosenberg}, } @article {Bismut-Zhang(1994), AUTHOR = {Bismut, Jean-Michel and Zhang, Weiping}, TITLE = {Milnor and {R}ay-{S}inger metrics on the equivariant determinant of a flat vector bundle}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {4}, YEAR = {1994}, NUMBER = {2}, PAGES = {136--212}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G26 (57Q10)}, MRNUMBER = {96f:58179}, MRREVIEWER = {Friedbert Pr{\"u}fer}, } @article {Biswas-Holla-Schumacher(2000), AUTHOR = {Biswas, Indranil and Holla, Yogish I. and Schumacher, Georg}, TITLE = {On a characterization of finite vector bundles as vector bundles admitting a flat connection with finite monodromy group}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {128}, YEAR = {2000}, NUMBER = {12}, PAGES = {3661--3669}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {32L05 (14J60 32J27 53C07)}, MRNUMBER = {2001b:32036}, MRREVIEWER = {Hans U. Boden}, } @article {Biswas-Schumacher(1999c), AUTHOR = {Biswas, Indranil and Schumacher, Georg}, TITLE = {Determinant bundle, {Q}uillen metric, and {P}etersson-{W}eil form on moduli spaces}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {9}, YEAR = {1999}, NUMBER = {2}, PAGES = {226--255}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {32G13 (32L05 32Q15 58J52)}, MRNUMBER = {2001e:32015}, MRREVIEWER = {Philip A. Foth}, } @incollection {Biswas-Schumacher(2000), AUTHOR = {Biswas, Indranil and Schumacher, Georg}, TITLE = {Generalized {P}etersson-{W}eil metric on the {D}ouady space of embedded manifolds}, BOOKTITLE = {Complex analysis and algebraic geometry}, PAGES = {109--115}, PUBLISHER = {de Gruyter}, ADDRESS = {Berlin}, YEAR = {2000}, MRCLASS = {32G10 (32J27 32Q15)}, MRNUMBER = {2001c:32010}, MRREVIEWER = {Daniel Barlet}, } @incollection {Bjoerner-Garsia-Stanley(1981), AUTHOR = {Bj{\"o}rner, A. and Garsia, A. M. and Stanley, R. P.}, TITLE = {An introduction to {C}ohen-{M}acaulay partially ordered sets}, BOOKTITLE = {Ordered sets ({B}anff, {A}lta., 1981)}, SERIES = {NATO Adv. Study Inst. Ser. C: Math. Phys. Sci.}, VOLUME = {83}, PAGES = {583--615}, PUBLISHER = {Reidel}, ADDRESS = {Dordrecht}, YEAR = {1982}, MRCLASS = {06A10 (13H10 14M05 52A25)}, MRNUMBER = {661307 (83i:06001)}, MRREVIEWER = {Michael E. Detlefsen}, } @article {Bjoerner-Welker(1995), AUTHOR = {Bj{\"o}rner, Anders and Welker, Volkmar}, TITLE = {The homology of ``{$k$}-equal'' manifolds and related partition lattices}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {110}, YEAR = {1995}, NUMBER = {2}, PAGES = {277--313}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {52B30 (06B99)}, MRNUMBER = {1317619 (95m:52029)}, MRREVIEWER = {Hiroaki Terao}, DOI = {10.1006/aima.1995.1012}, URL = {http://dx.doi.org/10.1006/aima.1995.1012}, } @book {Blackadar(1986), AUTHOR = {Blackadar, Bruce}, TITLE = {${K}$-theory for operator algebras}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1986}, PAGES = {viii+338}, ISBN = {0-387-96391-X}, MRCLASS = {46L80 (18F25 19Kxx 46M20 58G12)}, MRNUMBER = {88g:46082}, MRREVIEWER = {Vern Paulsen}, } @incollection {Blackadar(1993), AUTHOR = {Blackadar, Bruce}, TITLE = {Matricial and ultramatricial topology}, BOOKTITLE = {Operator algebras, mathematical physics, and low-dimensional topology (Istanbul, 1991)}, PAGES = {11--38}, PUBLISHER = {A K Peters}, ADDRESS = {Wellesley, MA}, YEAR = {1993}, MRCLASS = {46L85 (19K99 46L35 54C35 55R55)}, MRNUMBER = {95i:46102}, MRREVIEWER = {Ronghui Ji}, } @book {Blackadar(1998), AUTHOR = {Blackadar, Bruce}, TITLE = {{$K$}-theory for operator algebras}, SERIES = {Mathematical Sciences Research Institute Publications}, VOLUME = {5}, EDITION = {Second}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1998}, PAGES = {xx+300}, ISBN = {0-521-63532-2}, MRCLASS = {46L80 (19Kxx 58G12)}, MRNUMBER = {99g:46104}, } @book {Blackadar(2006), AUTHOR = {Blackadar, B.}, TITLE = {Operator algebras}, SERIES = {Encyclopaedia of Mathematical Sciences}, VOLUME = {122}, NOTE = {Theory of $C{^{*}}$-algebras and von Neumann algebras, Operator Algebras and Non-commutative Geometry, III}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2006}, PAGES = {xx+517}, ISBN = {978-3-540-28486-4; 3-540-28486-9}, MRCLASS = {46L05 (46L10 46L80)}, MRNUMBER = {2188261 (2006k:46082)}, MRREVIEWER = {Paul Jolissaint}, } @article {Blackadar-Dadarlat-Roerdam(1991), AUTHOR = {Blackadar, Bruce and D{\u{a}}d{\u{a}}rlat, Marius and R{\o}rdam, Mikael}, TITLE = {The real rank of inductive limit ${C}\sp *$-algebras}, JOURNAL = {Math. Scand.}, FJOURNAL = {Mathematica Scandinavica}, VOLUME = {69}, YEAR = {1991}, NUMBER = {2}, PAGES = {211--216 (1992)}, ISSN = {0025-5521}, CODEN = {MTSCAN}, MRCLASS = {46L05 (46M40)}, MRNUMBER = {93e:46067}, MRREVIEWER = {Ronghui Ji}, } @incollection {Blagojevic(2007), AUTHOR = {Blagojevi{\'c}, Pavle V. M.}, TITLE = {Equivariant methods in combinatorial geometry}, BOOKTITLE = {Algebra and algebraic topology}, PAGES = {117--155}, PUBLISHER = {Nova Sci. Publ.}, ADDRESS = {New York}, YEAR = {2007}, MRCLASS = {52A37 (28A12 55P91)}, MRNUMBER = {2352246 (2009b:52019)}, } @article {Blagojevic(2001), AUTHOR = {Blagojevi{\'c}, Pavle V. M.}, TITLE = {Homotopy colimit of quasi-join diagrams}, JOURNAL = {Publ. Inst. Math. (Beograd) (N.S.)}, FJOURNAL = {Institut Math\'ematique. Publications. Nouvelle S\'erie}, VOLUME = {69(83)}, YEAR = {2001}, PAGES = {113--121}, ISSN = {0350-1302}, MRCLASS = {55P15 (18G30 52B22 55P10)}, MRNUMBER = {1847832 (2002e:55010)}, } @article {Blagojevic-Blagojevic-McCleary(2008), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Blagojevi{\'c}, Aleksandra S. Dimitrijevi{\'c} and McCleary, John}, TITLE = {Equilateral triangles on a {J}ordan curve and a generalization of a theorem of {D}old}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {156}, YEAR = {2008}, NUMBER = {1}, PAGES = {16--23}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {55R80 (05B30 53A04 55N91)}, MRNUMBER = {2463819 (2009h:55019)}, MRREVIEWER = {Igor Rivin}, DOI = {10.1016/j.topol.2008.04.008}, URL = {http://dx.doi.org/10.1016/j.topol.2008.04.008}, } @Book{{Blagojevic-Cohen-Crabb-Lueck-Ziegler(2016), Author = {Pavle V. M. {Blagojevi\'c} and Frederick R. {Cohen} and Michael {Crabb} and Wolfgang {L\"uck} and G\"unter M. {Ziegler}}, Title = {{Equivariant cohomology of configuration spaces mod 2. The state of the art (to appear)}}, FJournal = {{Lecture Notes in Mathematics}}, Journal = {{Lect. Notes Math.}}, ISSN = {0075-8434}, Volume = {2282}, ISBN = {978-3-030-84137-9; 978-3-030-84138-6}, Pages = {x + 196}, Year = {2021}, Publisher = {Cham: Springer}, Language = {English}, DOI = {10.1007/978-3-030-84138-6}, MSC2010 = {55-02 55N91 55R80 52C35} } @Book{Blagojevic-Cohen-Crabb-Lueck-Ziegler(2021), Author = {Pavle V. M. {Blagojevi\'c} and Frederick R. {Cohen} and Michael {Crabb} and Wolfgang {L\"uck} and G\"unter M. {Ziegler}}, Title = {{Equivariant cohomology of configuration spaces mod 2. The state of the art (to appear)}}, FJournal = {{Lecture Notes in Mathematics}}, Journal = {{Lect. Notes Math.}}, ISSN = {0075-8434}, Volume = {2282}, ISBN = {978-3-030-84137-9; 978-3-030-84138-6}, Pages = {x + 196}, Year = {2021}, Publisher = {Cham: Springer}, Language = {English}, DOI = {10.1007/978-3-030-84138-6}, MSC2010 = {55-02 55N91 55R80 52C35} } @article {Blagojevic-Cohen-Lueck-Ziegler(2016), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Cohen, Frederick R. and L{\"u}ck, Wolfgang and Ziegler, G{\"u}nter M.}, TITLE = {On complex highly regular embeddings and the extended {V}assiliev conjecture}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2016}, VOLUME = {20}, PAGES = {6151--6199}, ISSN = {1073-7928}, MRCLASS = {55R80 (32H99 57R40 57R42)}, MRNUMBER = {3579962}, DOI = {10.1093/imrn/rnv341}, URL = {http://dx.doi.org/10.1093/imrn/rnv341}, } @article {Blagojevic-Dimitijevic(2011), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Dimitrijevi{\'c} Blagojevi{\'c}, Aleksandra and McCleary, John}, TITLE = {Spectral sequences in combinatorial geometry: cheeses, inscribed sets, and {B}orsuk-{U}lam type theorems}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {158}, YEAR = {2011}, NUMBER = {15}, PAGES = {1920--1936}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {52Bxx (55Pxx)}, MRNUMBER = {2825346}, } @article {Blagojevic-Dimitrijevic(2007), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Dimitrijevi{\'c} Blagojevi{\'c}, Aleksandra S.}, TITLE = {Using equivariant obstruction theory in combinatorial geometry}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {154}, YEAR = {2007}, NUMBER = {14}, PAGES = {2635--2655}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {55S35 (52B55 52C35 68U05)}, MRNUMBER = {2340948 (2008j:55022)}, MRREVIEWER = {Donald M. Davis}, DOI = {10.1016/j.topol.2007.04.007}, URL = {http://dx.doi.org/10.1016/j.topol.2007.04.007}, } @article {Blagojevic-Dimitrijevic(2006weighted), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Dimitrijevi{\'c} Blagojevi{\'c}, Aleksandra S. and Milo{\v{s}}evi{\'c}, Marko S.}, TITLE = {Weighted partitions of sphere measures by hyperplanes}, JOURNAL = {Filomat}, FJOURNAL = {Univerzitet u Ni\v su. Prirodno-Matemati\v cki Fakultet. Filomat}, VOLUME = {20, part 1}, YEAR = {2006}, PAGES = {13--22}, ISSN = {0354-5180}, MRCLASS = {52A37 (28A75 55R99)}, MRNUMBER = {2311569 (2008c:52009)}, MRREVIEWER = {Hossein Movahedi-Lankarani}, } @article {Blagojevic-Dimitrijevic(2006equipartitions), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Dimitrijevi{\'c} Blagojevi{\'c}, Aleksandra S. and Milo{\v{s}}evi{\'c}, Marko S.}, TITLE = {Equipartition of sphere measures by hyperplanes}, JOURNAL = {Filomat}, FJOURNAL = {Univerzitet u Ni\v su. Prirodno-Matemati\v cki Fakultet. Filomat}, VOLUME = {20, part 1}, YEAR = {2006}, PAGES = {1--11}, ISSN = {0354-5180}, MRCLASS = {52A37 (28A75)}, MRNUMBER = {2311568 (2008c:52008)}, MRREVIEWER = {Hossein Movahedi-Lankarani}, } @article {Blagojevic-Grujic-Zivaljevic(2005), AUTHOR = {Blagojevi{\'c}, Pavle and Gruji{\'c}, Vladimir and {\v{Z}}ivaljevi{\'c}, Rade}, TITLE = {Arrangements of symmetric products of spaces}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {148}, YEAR = {2005}, NUMBER = {1-3}, PAGES = {213--232}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {55S15 (52C35)}, MRNUMBER = {2118966 (2005m:55023)}, MRREVIEWER = {Hiroaki Terao}, DOI = {10.1016/j.topol.2004.09.001}, URL = {http://dx.doi.org/10.1016/j.topol.2004.09.001}, } @article {Blagojevic-Lueck-Ziegler(2016), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and L{\"u}ck, Wolfgang and Ziegler, G{\"u}nter M.}, TITLE = {On highly regular embeddings}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {368}, YEAR = {2016}, NUMBER = {4}, PAGES = {2891--2912}, ISSN = {0002-9947}, MRCLASS = {55R80 (57N35 57R20)}, MRNUMBER = {3449261}, DOI = {10.1090/tran/6559}, URL = {http://dx.doi.org/10.1090/tran/6559}, } @article {Blagojevic-Lueck-Ziegler(2015), AUTHOR = {Blagojevi{\'c}, Pavle and L\"uck, Wolfgang and Ziegler, G\"unter}, TITLE = {Equivariant Topology of Configuration Spaces}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {8}, YEAR = {2015}, NUMBER = {2}, PAGES = {414--456}, } @article{Blagojevic-Matschke-Ziegler(2011tight), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Matschke, Benjamin and Ziegler, G{\"u}nter M.}, TITLE = {A tight colored {T}verberg theorem for maps to manifolds}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {158}, YEAR = {2011}, NUMBER = {12}, PAGES = {1445--1452}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {52B70 (05D05)}, MRNUMBER = {2812494}, DOI = {10.1016/j.topol.2011.05.016}, URL = {http://dx.doi.org/10.1016/j.topol.2011.05.016}, } @article {Blagojevic-Matschke-Ziegler(2011optimal), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Matschke, Benjamin and Ziegler, G{\"u}nter M.}, TITLE = {Optimal bounds for a colorful {T}verberg-{V}re\'cica type problem}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {226}, YEAR = {2011}, NUMBER = {6}, PAGES = {5198--5215}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {05D15 (52A35)}, MRNUMBER = {2775898}, DOI = {10.1016/j.aim.2011.01.009}, URL = {http://dx.doi.org/10.1016/j.aim.2011.01.009}, } @article {Blagojevic-Vrecica-Siniva-Zivaljevic(2009), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Vre{\'c}ica, Sini{\v{s}}a T. and {\v{Z}}ivaljevi{\'c}, Rade T.}, TITLE = {Computational topology of equivariant maps from spheres to complements of arrangements}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {361}, YEAR = {2009}, NUMBER = {2}, PAGES = {1007--1038}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {52A37 (55M35 55S35)}, MRNUMBER = {2452832 (2010i:52010)}, MRREVIEWER = {Ion Doru Albu}, DOI = {10.1090/S0002-9947-08-04679-5}, URL = {http://dx.doi.org/10.1090/S0002-9947-08-04679-5}, } @article {Blagojevic-Ziegler(2014), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Ziegler, G{\"u}nter M.}, TITLE = {Convex equipartitions via {E}quivariant {O}bstruction {T}heory}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {200}, YEAR = {2014}, NUMBER = {1}, PAGES = {49--77}, ISSN = {0021-2172}, MRCLASS = {52C17 (52B45)}, MRNUMBER = {3219570}, } @article {Blagojevic-Ziegler(2011), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Ziegler, G{\"u}nter M.}, TITLE = {The ideal-valued index for a dihedral group action, and mass partition by two hyperplanes}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {158}, YEAR = {2011}, NUMBER = {12}, PAGES = {1326--1351}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {52Axx (55N91)}, MRNUMBER = {2812486}, DOI = {10.1016/j.topol.2011.05.008}, URL = {http://dx.doi.org/10.1016/j.topol.2011.05.008}, } @article {Blagojevic-Ziegler(2009), AUTHOR = {Blagojevi{\'c}, Pavle V. M. and Ziegler, G{\"u}nter M.}, TITLE = {Tetrahedra on deformed spheres and integral group cohomology}, JOURNAL = {Electron. J. Combin.}, FJOURNAL = {Electronic Journal of Combinatorics}, VOLUME = {16}, YEAR = {2009}, NUMBER = {2, Special volume in honor of Anders Bjorner}, PAGES = {Research Paper 16, 11}, ISSN = {1077-8926}, MRCLASS = {55M20 (52C99)}, MRNUMBER = {2515779 (2011b:55002)}, URL = {http://www.combinatorics.org/Volume_16/Abstracts/v16i2r16.html}, } @article {Blagojevic-Zivaljevic(2003), AUTHOR = {Blagojevi{\'c}, Pavle and Gruji{\'c}, Vladimir and {\v{Z}}ivaljevi{\'c}, Rade}, TITLE = {Symmetric products of surfaces and the cycle index}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {138}, YEAR = {2003}, PAGES = {61--72}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {05E05 (20N02 52B70)}, MRNUMBER = {2031950 (2004i:05154)}, MRREVIEWER = {Torbj{\"o}rn Tambour}, DOI = {10.1007/BF02783419}, URL = {http://dx.doi.org/10.1007/BF02783419}, } @article {Blanc-Brylinski(1992), AUTHOR = {Blanc, Philippe and Brylinski, Jean-Luc}, TITLE = {Cyclic homology and the {S}elberg principle}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {109}, YEAR = {1992}, NUMBER = {2}, PAGES = {289--330}, ISSN = {0022-1236}, MRCLASS = {22E35 (16E40 19D55 22E50)}, MRNUMBER = {1186324}, MRREVIEWER = {Alain Valette}, DOI = {10.1016/0022-1236(92)90020-J}, URL = {https://doi.org/10.1016/0022-1236(92)90020-J}, } @article {Blanchet-Habegger-Masbaum-Vogel(1992), AUTHOR = {Blanchet, C. and Habegger, N. and Masbaum, G. and Vogel, P.}, TITLE = {Three-manifold invariants derived from the {K}auffman bracket}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {31}, YEAR = {1992}, NUMBER = {4}, PAGES = {685--699}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57M25 (57N10)}, MRNUMBER = {94a:57010}, MRREVIEWER = {Christine Lescop}, } @article {Blanchet-Masbaum(1996), AUTHOR = {Blanchet, C. and Masbaum, G.}, TITLE = {Topological quantum field theories for surfaces with spin structure}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {82}, YEAR = {1996}, NUMBER = {2}, PAGES = {229--267}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {57M25 (16W30 57M30 81R50)}, MRNUMBER = {97e:57005}, MRREVIEWER = {Justin D. Roberts}, } @book {Blatter(1979), AUTHOR = {Blatter, Christian}, TITLE = {Analysis. {I}{I}}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1979}, PAGES = {ix+196}, ISBN = {3-540-09484-9}, MRCLASS = {26-01}, MRNUMBER = {82b:26001b}, } @book {Blatter(1980), AUTHOR = {Blatter, Christian}, TITLE = {Analysis. {I}}, EDITION = {Third}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1980}, PAGES = {xvii+223}, ISBN = {3-540-09483-0}, MRCLASS = {26-01}, MRNUMBER = {82b:26001a}, } @book {Blatter(1981), AUTHOR = {Blatter, Christian}, TITLE = {Analysis. {I}{I}{I}}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1981}, PAGES = {ix+296}, ISBN = {3-540-10892-0}, MRCLASS = {26-01 (42-01)}, MRNUMBER = {83a:26002}, } @article {Blau-Thompson(1993), AUTHOR = {Blau, Matthias and Thompson, George}, TITLE = {${N}=2$ topological gauge theory, the {E}uler characteristic of moduli spaces, and the {C}asson invariant}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {152}, YEAR = {1993}, NUMBER = {1}, PAGES = {41--71}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58D29 (57R20 58D27 58G26 58Z05 81Q60)}, MRNUMBER = {94g:58034}, MRREVIEWER = {Steven Rosenberg}, } @book {Blecher-Merdy(2004), AUTHOR = {Blecher, David P. and Le Merdy, Christian}, TITLE = {Operator algebras and their modules---an operator space approach}, SERIES = {London Mathematical Society Monographs. New Series}, VOLUME = {30}, NOTE = {Oxford Science Publications}, PUBLISHER = {The Clarendon Press Oxford University Press}, ADDRESS = {Oxford}, YEAR = {2004}, PAGES = {x+387}, ISBN = {0-19-852659-8}, MRCLASS = {46L07 (47L30)}, MRNUMBER = {2111973 (2006a:46070)}, MRREVIEWER = {Narutaka Ozawa}, DOI = {10.1093/acprof:oso/9780198526599.001.0001}, URL = {http://dx.doi.org/10.1093/acprof:oso/9780198526599.001.0001}, } @book {Bleecker-Booss-Bavnbeck(2013), AUTHOR = {Bleecker, David D. and Boo{\ss}-Bavnbek, Bernhelm}, TITLE = {Index theory---with applications to mathematics and physics}, PUBLISHER = {International Press}, ADDRESS = {Somerville, MA}, YEAR = {2013}, PAGES = {xxii+769}, ISBN = {978-1-57146-264-0}, MRCLASS = {58-02 (19K56 57R57 58J20)}, MRNUMBER = {3113540}, } @article {Bleiler-Moriah(1988), AUTHOR = {Bleiler, Steven A. and Moriah, Yoav}, TITLE = {Heegaard splittings and branched coverings of ${B}\sp 3$}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {281}, YEAR = {1988}, NUMBER = {4}, PAGES = {531--543}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {57M25 (57N10)}, MRNUMBER = {89k:57006}, MRREVIEWER = {Wolfgang H. Heil}, } @book {Bloch(1997), AUTHOR = {Bloch, Ethan D.}, TITLE = {A first course in geometric topology and differential geometry}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1997}, PAGES = {xiv+421}, ISBN = {0-8176-3840-7}, MRCLASS = {57-01 (53-01)}, MRNUMBER = {99c:57001}, MRREVIEWER = {Ross Geoghegan}, } @article {Bloch(1977), AUTHOR = {Bloch, Spencer}, TITLE = {Algebraic {$K$}-theory and crystalline cohomology}, JOURNAL = {Inst. Hautes \'{E}tudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'{E}tudes Scientifiques. Publications Math\'{e}matiques}, VOLUME = {47}, YEAR = {1977}, PAGES = {187--268 (1978)}, ISSN = {0073-8301}, MRCLASS = {14F30 (14C35 14L05 18F25)}, MRNUMBER = {488288}, URL = {http://www.numdam.org/item?id=PMIHES_1977__47__187_0}, } @article {Bloch-Kriz(1994), AUTHOR = {Bloch, Spencer and K{\v{r}}{\'\i}{\v{z}}, Igor}, TITLE = {Mixed {T}ate motives}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {140}, YEAR = {1994}, NUMBER = {3}, PAGES = {557--605}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {11G09 (14A20 19E99 55P62)}, MRNUMBER = {96c:11062}, MRREVIEWER = {Wayne Raskind}, } @article {Block(1997), AUTHOR = {Block, Jonathan}, TITLE = {Some remarks concerning the {B}aum-{C}onnes conjecture}, JOURNAL = {Comm. Pure Appl. Math.}, FJOURNAL = {Communications on Pure and Applied Mathematics}, VOLUME = {50}, YEAR = {1997}, NUMBER = {9}, PAGES = {813--820}, ISSN = {0010-3640}, CODEN = {CPAMA}, MRCLASS = {46L87}, MRNUMBER = {99f:46103}, MRREVIEWER = {{\'E}ric Leichtnam}, } @article {Block-Getzler(1994), AUTHOR = {Block, Jonathan and Getzler, Ezra}, TITLE = {Equivariant cyclic homology and equivariant differential forms}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {27}, YEAR = {1994}, NUMBER = {4}, PAGES = {493--527}, ISSN = {0012-9593}, CODEN = {ASENAH}, MRCLASS = {19D55 (46L85 55N91 58B30)}, MRNUMBER = {95h:19002}, MRREVIEWER = {Erlend Dahl}, } @article {Block-Getzler-Jones(1995)), AUTHOR = {Block, Jonathan and Getzler, Ezra and Jones, John D. S.}, TITLE = {The cyclic homology of crossed product algebras. {I}{I}. {T}opological algebras}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {466}, YEAR = {1995}, PAGES = {19--25}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {19D55 (55U10)}, MRNUMBER = {96j:19003}, MRREVIEWER = {Philippe Blanc}, } @article {Block-Mathai-Weinberger(1997), AUTHOR = {Block, Jonathan and Mathai, Varghese and Weinberger, Shmuel}, TITLE = {Homotopy invariance of {N}ovikov-{S}hubin invariants and ${L}\sp 2$ {B}etti numbers}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {125}, YEAR = {1997}, NUMBER = {12}, PAGES = {3757--3762}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {58G12 (57R20 58G05)}, MRNUMBER = {98d:58175}, MRREVIEWER = {Patrick T. McDonald}, } @article {Block-Weinberger(2008), AUTHOR = {Block, Jonathan and Weinberger, Shmuel}, TITLE = {On the generalized {N}ielsen realization problem}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {83}, YEAR = {2008}, NUMBER = {1}, PAGES = {21--33}, ISSN = {0010-2571}, MRCLASS = {57N15 (57S17)}, MRNUMBER = {2365406}, MRREVIEWER = {Craig R. Guilbault}, DOI = {10.4171/CMH/116}, URL = {https://doi.org/10.4171/CMH/116}, } @article {Block-Weinberger(2006), AUTHOR = {Block, Jonathan and Weinberger, Shmuel}, TITLE = {Higher {T}odd classes and holomorphic group actions}, JOURNAL = {Pure Appl. Math. Q.}, FJOURNAL = {Pure and Applied Mathematics Quarterly}, VOLUME = {2}, YEAR = {2006}, NUMBER = {4, part 2}, PAGES = {1237--1253}, ISSN = {1558-8599}, MRCLASS = {14C40 (32L10 57R20)}, MRNUMBER = {2282420 (2008c:14016)}, MRREVIEWER = {Shoji Yokura}, } @article {Block-Weinberger(1992), AUTHOR = {Block, Jonathan and Weinberger, Shmuel}, TITLE = {Aperiodic tilings, positive scalar curvature and amenability of spaces}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {5}, YEAR = {1992}, NUMBER = {4}, PAGES = {907--918}, ISSN = {0894-0347}, MRCLASS = {53C23 (52C07 53C21)}, MRNUMBER = {93d:53054}, MRREVIEWER = {Christophe Bavard}, } @article {Blomer-Linnell-Schick(2008), AUTHOR = {Blomer, Inga and Linnell, Peter A. and Schick, Thomas}, TITLE = {Galois cohomology of completed link groups}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {136}, YEAR = {2008}, NUMBER = {10}, PAGES = {3449--3459}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {20E18 (20J06 57M25)}, MRNUMBER = {MR2415028}, } @article {Blumberg(2010), AUTHOR = {Blumberg, Andrew J.}, TITLE = {Topological {H}ochschild homology of {T}hom spectra which are {$E_\infty$} ring spectra}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {3}, YEAR = {2010}, NUMBER = {3}, PAGES = {535--560}, ISSN = {1753-8416}, MRCLASS = {55P43 (18G55 19D55 55N20)}, MRNUMBER = {2684512 (2011h:55017)}, MRREVIEWER = {Birgit Richter}, DOI = {10.1112/jtopol/jtq017}, URL = {http://dx.doi.org/10.1112/jtopol/jtq017}, } @article {Blumberg(2007), AUTHOR = {Blumberg, Andrew J.}, TITLE = {A discrete model of {$S^1$}-homotopy theory}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {210}, YEAR = {2007}, NUMBER = {1}, PAGES = {29--41}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55P91 (18G55)}, MRNUMBER = {2311170 (2008b:55020)}, MRREVIEWER = {Birgit Richter}, DOI = {10.1016/j.jpaa.2006.08.011}, URL = {http://dx.doi.org/10.1016/j.jpaa.2006.08.011}, } @article {Blumberg(2006), AUTHOR = {Blumberg, Andrew J.}, TITLE = {Continuous functors as a model for the equivariant stable homotopy category}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {6}, YEAR = {2006}, PAGES = {2257--2295}, ISSN = {1472-2747}, MRCLASS = {55P42 (55P47 55P91)}, MRNUMBER = {2286026 (2008a:55006)}, DOI = {10.2140/agt.2006.6.2257}, URL = {http://dx.doi.org/10.2140/agt.2006.6.2257}, } @article {Blumberg-Gepner-Tabuada(2014), AUTHOR = {Blumberg, Andrew J. and Gepner, David and Tabuada, Gon{\c{c}}alo}, TITLE = {Uniqueness of the multiplicative cyclotomic trace}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {260}, YEAR = {2014}, PAGES = {191--232}, ISSN = {0001-8708}, MRCLASS = {19Dxx (55N15)}, MRNUMBER = {3209352}, DOI = {10.1016/j.aim.2014.02.004}, URL = {http://dx.doi.org/10.1016/j.aim.2014.02.004}, } @article {Blumberg-Gepner-Tabuada(2013), AUTHOR = {Blumberg, Andrew J. and Gepner, David and Tabuada, Gon{\c{c}}alo}, TITLE = {A universal characterization of higher algebraic {$K$}-theory}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {17}, YEAR = {2013}, NUMBER = {2}, PAGES = {733--838}, ISSN = {1465-3060}, MRCLASS = {19D10 (18D20 19D25 19D55 55N15 55U40)}, MRNUMBER = {3070515}, MRREVIEWER = {Ross Staffeldt}, DOI = {10.2140/gt.2013.17.733}, URL = {http://dx.doi.org/10.2140/gt.2013.17.733}, } @article {Blumberg-Mandell(2012), AUTHOR = {Blumberg, Andrew J. and Mandell, Michael A.}, TITLE = {Localization theorems in topological {H}ochschild homology and topological cyclic homology}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {16}, YEAR = {2012}, NUMBER = {2}, PAGES = {1053--1120}, ISSN = {1465-3060}, MRCLASS = {19D55 (14F43)}, MRNUMBER = {2928988}, MRREVIEWER = {Guillermo Corti{\~n}as}, DOI = {10.2140/gt.2012.16.1053}, URL = {http://dx.doi.org/10.2140/gt.2012.16.1053}, } @article {Blumberg-Mandell(2011), AUTHOR = {Blumberg, Andrew J. and Mandell, Michael A.}, TITLE = {Algebraic {$K$}-theory and abstract homotopy theory}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {226}, YEAR = {2011}, NUMBER = {4}, PAGES = {3760--3812}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {19D99 (55U35)}, MRNUMBER = {2764905 (2012a:19007)}, MRREVIEWER = {Thomas H{\"u}ttemann}, DOI = {10.1016/j.aim.2010.11.002}, URL = {http://dx.doi.org/10.1016/j.aim.2010.11.002}, } @article {Blumberg-Mandell(2008), AUTHOR = {Blumberg, Andrew J. and Mandell, Michael A.}, TITLE = {The localization sequence for the algebraic {$K$}-theory of topological {$K$}-theory}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {200}, YEAR = {2008}, NUMBER = {2}, PAGES = {155--179}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {19D10 (55P43)}, MRNUMBER = {2413133 (2009f:19003)}, MRREVIEWER = {Ian Hambleton}, DOI = {10.1007/s11511-008-0025-4}, URL = {http://dx.doi.org/10.1007/s11511-008-0025-4}, } @article {Blumberg-Riehl(2014), AUTHOR = {Blumberg, Andrew J. and Riehl, Emily}, TITLE = {Homotopical resolutions associated to deformable adjunctions}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {14}, YEAR = {2014}, NUMBER = {5}, PAGES = {3021--3048}, ISSN = {1472-2747}, MRCLASS = {18G55 (18G10 55U35)}, MRNUMBER = {3276853}, DOI = {10.2140/agt.2014.14.3021}, URL = {http://dx.doi.org/10.2140/agt.2014.14.3021}, } @incollection {Boardman(1995), AUTHOR = {Boardman, J. Michael}, TITLE = {Stable operations in generalized cohomology}, BOOKTITLE = {Handbook of algebraic topology}, PAGES = {585--686}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {1995}, MRCLASS = {55S25 (55N20)}, MRNUMBER = {97b:55021}, MRREVIEWER = {Haynes R. Miller}, } @incollection {Boardman-Johnson-Wilson(1995), AUTHOR = {Boardman, J. Michael and Johnson, David Copeland and Wilson, W. Stephen}, TITLE = {Unstable operations in generalized cohomology}, BOOKTITLE = {Handbook of algebraic topology}, PAGES = {687--828}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {1995}, MRCLASS = {55S25 (55N20)}, MRNUMBER = {97b:55022}, MRREVIEWER = {Haynes R. Miller}, } @article {Boardman-Vogt(1968), AUTHOR = {Boardman, J. Michael and Vogt, Rainer M.}, TITLE = {Homotopy-everything ${H}$-spaces}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {74}, YEAR = {1968}, PAGES = {1117--1122}, MRCLASS = {55.42}, MRNUMBER = {38 \#5215}, MRREVIEWER = {R. J. Milgram}, } @book {Boardman-Vogt(1973), AUTHOR = {Boardman, J. M. and Vogt, R. M.}, TITLE = {Homotopy invariant algebraic structures on topological spaces}, SERIES = {Lecture Notes in Mathematics, Vol. 347}, PUBLISHER = {Springer-Verlag, Berlin-New York}, YEAR = {1973}, PAGES = {x+257}, MRCLASS = {55D35}, MRNUMBER = {0420609}, MRREVIEWER = {J. Stasheff}, } @article {Bobinski-Skowronski(1999), AUTHOR = {Bobi{\'n}ski, Grzegorz and Skowro{\'n}ski, Andrzej}, TITLE = {Geometry of directing modules over tame algebras}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {215}, YEAR = {1999}, NUMBER = {2}, PAGES = {603--643}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16G10}, MRNUMBER = {2000f:16017}, MRREVIEWER = {Sheila Brenner}, } @article {Boden-Friedl(2014), AUTHOR = {Boden, Hans U. and Friedl, Stefan}, TITLE = {Metabelian {${\rm SL}(n,\Bbb C)$} representations of knot groups {IV}: twisted {A}lexander polynomials}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {156}, YEAR = {2014}, NUMBER = {1}, PAGES = {81--97}, ISSN = {0305-0041}, MRCLASS = {57Mxx}, MRNUMBER = {3144211}, DOI = {10.1017/S0305004113000510}, URL = {http://dx.doi.org/10.1017/S0305004113000510}, } @Article{Boekstedt-Neeman(1993), Author = {Marcel {B\"okstedt} and Amnon {Neeman}}, Title = {{Homotopy limits in triangulated categories}}, FJournal = {{Compositio Mathematica}}, Journal = {{Compos. Math.}}, ISSN = {0010-437X}, Volume = {86}, Number = {2}, Pages = {209--234}, Year = {1993}, Publisher = {Cambridge University Press, Cambridge; London Mathematical Society, London}, Language = {English}, MSC2010 = {18G10 18G35 18E30 18F20}, Zbl = {0802.18008} } @article {Boedigheimer(1979), AUTHOR = {B{\"o}digheimer, Carl-Friedrich}, TITLE = {Splitting the {K}\"unneth sequence in ${K}$-theory}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {242}, YEAR = {1979}, NUMBER = {2}, PAGES = {159--171}, ISSN = {0025-5831}, CODEN = {MAANA3}, MRCLASS = {55N15 (18G15 46M20)}, MRNUMBER = {80k:55013}, MRREVIEWER = {Jerome Kaminker}, } @article {Boedigheimer(1980), AUTHOR = {B{\"o}digheimer, Carl-Friedrich}, TITLE = {Splitting the {K}\"unneth sequence in ${K}$-theory. {I}{I}}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {251}, YEAR = {1980}, NUMBER = {3}, PAGES = {249--252}, ISSN = {0025-5831}, CODEN = {MAANA3}, MRCLASS = {55N15 (55U25)}, MRNUMBER = {81k:55007}, MRREVIEWER = {Jerome Kaminker}, } @article {Boedigheimer(1983), AUTHOR = {B{\"o}digheimer, Carl-Friedrich}, TITLE = {Remark on the realization of cohomology groups}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {34}, YEAR = {1983}, NUMBER = {133}, PAGES = {1--5}, ISSN = {0033-5606}, CODEN = {QJMAAT}, MRCLASS = {55N05 (55N15)}, MRNUMBER = {84g:55005}, MRREVIEWER = {Jo{\v{z}}e Vrabec}, } @incollection {Boedigheimer(1985), AUTHOR = {B{\"o}digheimer, C.-F.}, TITLE = {Stable splittings of mapping spaces}, BOOKTITLE = {Algebraic topology ({S}eattle, {W}ash., 1985)}, SERIES = {Lecture Notes in Math.}, VOLUME = {1286}, PAGES = {174--187}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1987}, MRCLASS = {55Q05 (55Q10)}, MRNUMBER = {922926 (89c:55011)}, MRREVIEWER = {Donald W. Kahn}, DOI = {10.1007/BFb0078741}, URL = {http://dx.doi.org/10.1007/BFb0078741}, } @incollection {Boedigheimer(1987a), AUTHOR = {B{\"o}digheimer, Carl-Friedrich}, TITLE = {Stable splittings of mapping spaces}, BOOKTITLE = {Algebraic topology (Seattle, Wash., 1985)}, PAGES = {174--187}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1987}, MRCLASS = {55Q05 (55Q10)}, MRNUMBER = {89c:55011}, MRREVIEWER = {Donald W. Kahn}, } @article {Boedigheimer(2006), AUTHOR = {B{\"o}digheimer, C.-F.}, TITLE = {Configuration models for moduli spaces of {R}iemann surfaces with boundary}, JOURNAL = {Abh. Math. Sem. Univ. Hamburg}, FJOURNAL = {Abhandlungen aus dem Mathematischen Seminar der Universit\"at Hamburg}, VOLUME = {76}, YEAR = {2006}, PAGES = {191--233}, ISSN = {0025-5858}, CODEN = {AMHAAJ}, MRCLASS = {32G15 (30F10 30F15 55R35)}, MRNUMBER = {2293442 (2007j:32006)}, MRREVIEWER = {Athanase Papadopoulos}, } @incollection {Boedigheimer(1993a), AUTHOR = {B{\"o}digheimer, Carl-Friedrich}, TITLE = {Interval exchange spaces and moduli spaces}, BOOKTITLE = {Mapping class groups and moduli spaces of Riemann surfaces (G\"ottingen, 1991/Seattle, WA, 1991)}, PAGES = {33--50}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1993}, MRCLASS = {57N05 (28D05 30F99 32G15 58F18)}, MRNUMBER = {94m:57036}, MRREVIEWER = {Lee Mosher}, } @incollection {Boedigheimer-Cohen(1988), AUTHOR = {B{\"o}digheimer, Carl-Friedrich and Cohen, Frederick R.}, TITLE = {Rational cohomology of configuration spaces of surfaces}, BOOKTITLE = {Algebraic topology and transformation groups (G\"ottingen, 1987)}, PAGES = {7--13}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1988}, MRCLASS = {57T99 (55R99 57M99)}, MRNUMBER = {90e:57075}, MRREVIEWER = {N. J. Kuhn}, } @article {Boedigheimer-Cohen-Milgram(1993), AUTHOR = {B{\"o}digheimer, Carl-Friedrich and Cohen, Frederick R. and Milgram, R. James}, TITLE = {Truncated symmetric products and configuration spaces}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {214}, YEAR = {1993}, NUMBER = {2}, PAGES = {179--216}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {55S15 (55P35)}, MRNUMBER = {95a:55043}, MRREVIEWER = {Don Shimamoto}, } @article {Boedigheimer-Cohen-Taylor(1989), AUTHOR = {B{\"o}digheimer, Carl-Friedrich and Cohen, Frederick R. and Taylor, Laurence R.}, TITLE = {On the homology of configuration spaces}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {28}, YEAR = {1989}, NUMBER = {1}, PAGES = {111--123}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57R22 (55P35 55R65)}, MRNUMBER = {90h:57031}, MRREVIEWER = {J. M. Boardman}, } @article {Boedigheimer-Henn(1983), AUTHOR = {B{\"o}digheimer, Carl-Friedrich and Henn, Hans-Werner}, TITLE = {A remark on the size of $\pi \sb{q}({S}\sp{n})$}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {42}, YEAR = {1983}, NUMBER = {1}, PAGES = {79--83}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {55Q40}, MRNUMBER = {85g:55019}, MRREVIEWER = {J. F. Adams}, } @article {Boedigheimer-Madsen(1988), AUTHOR = {B{\"o}digheimer, Carl-Friedrich and Madsen, Ib}, TITLE = {Homotopy quotients of mapping spaces and their stable splitting}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {39}, YEAR = {1988}, NUMBER = {156}, PAGES = {401--409}, ISSN = {0033-5606}, CODEN = {QJMAAT}, MRCLASS = {55P99 (57S99)}, MRNUMBER = {89m:55007}, MRREVIEWER = {Donald M. Davis}, } @article {Boekstedt-Hsiang-Madsen(1993), AUTHOR = {B{\"o}kstedt, Marcel and Hsiang, Wu Chung and Madsen, Ib}, TITLE = {The cyclotomic trace and algebraic ${K}$-theory of spaces}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {111}, YEAR = {1993}, NUMBER = {3}, PAGES = {465--539}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {55P42 (19D55 19L99 55P60)}, MRNUMBER = {94g:55011}, MRREVIEWER = {Roland Schw{\"a}nzl}, } @article {Boekstedt-Madsen(1994), AUTHOR = {B{\"o}kstedt, Marcel and Madsen, Ib}, TITLE = {Topological cyclic homology of the integers}, NOTE = {$K$-theory (Strasbourg, 1992)}, JOURNAL = {Ast\'erisque}, FJOURNAL = {Ast\'erisque}, VOLUME = {226}, YEAR = {1994}, PAGES = {7--8, 57--143}, ISSN = {0303-1179}, MRCLASS = {19D50 (19D55 55P91)}, MRNUMBER = {96d:19004}, MRREVIEWER = {J. P. May}, } @incollection {Boekstedt-Madsen(1995), AUTHOR = {B{\"o}kstedt, Marcel and Madsen, Ib}, TITLE = {Algebraic ${K}$-theory of local number fields: the unramified case}, BOOKTITLE = {Prospects in topology (Princeton, NJ, 1994)}, PAGES = {28--57}, PUBLISHER = {Princeton Univ. Press}, ADDRESS = {Princeton, NJ}, YEAR = {1995}, MRCLASS = {19D50 (11S70 19D10 55P60)}, MRNUMBER = {97e:19004}, MRREVIEWER = {Roland Schw{\"a}nzl}, } @article {Boersema(2007), AUTHOR = {Boersema, Jeffrey L.}, TITLE = {Kaplansky density and {K}adison transitivity theorems for irreducible representations of real {$C^\ast$}-algebras}, JOURNAL = {Acta Math. Sin. (Engl. Ser.)}, FJOURNAL = {Acta Mathematica Sinica (English Series)}, VOLUME = {23}, YEAR = {2007}, NUMBER = {10}, PAGES = {1827--1832}, ISSN = {1439-8516}, MRCLASS = {46L05 (47L30)}, MRNUMBER = {2352297 (2009i:46095)}, MRREVIEWER = {Judith A. Packer}, DOI = {10.1007/s10114-005-0825-9}, URL = {http://dx.doi.org/10.1007/s10114-005-0825-9}, } @article {Boersema(2006), AUTHOR = {Boersema, Jeffrey L.}, TITLE = {The range of united {$K$}-theory}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {235}, YEAR = {2006}, NUMBER = {2}, PAGES = {701--718}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {46L80 (19K35)}, MRNUMBER = {2225467 (2007a:46077)}, MRREVIEWER = {Andreas Thom}, DOI = {10.1016/j.jfa.2005.12.012}, URL = {http://dx.doi.org/10.1016/j.jfa.2005.12.012}, } @article {Boersema(2004), AUTHOR = {Boersema, Jeffrey L.}, TITLE = {Real {$C^*$}-algebras, united {$KK$}-theory, and the universal coefficient theorem}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {33}, YEAR = {2004}, NUMBER = {2}, PAGES = {107--149}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {46L80 (19K35)}, MRNUMBER = {2131747 (2006d:46090)}, MRREVIEWER = {Anton Yu. Savin}, DOI = {10.1007/s10977-004-1961-1}, URL = {http://dx.doi.org/10.1007/s10977-004-1961-1}, } @article {Boersema(2002), AUTHOR = {Boersema, Jeffrey L.}, TITLE = {Real {$C^*$}-algebras, united {$K$}-theory, and the {K}\"unneth formula}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {26}, YEAR = {2002}, NUMBER = {4}, PAGES = {345--402}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {46L05 (19K35 46L80 46M18)}, MRNUMBER = {1935138 (2004b:46072)}, MRREVIEWER = {Judith A. Packer}, DOI = {10.1023/A:1020671031447}, URL = {http://dx.doi.org/10.1023/A:1020671031447}, } @article {Boersema-Ruiz(2011), AUTHOR = {Boersema, Jeffrey L. and Ruiz, Efren}, TITLE = {Stability of real {$C^*$}-algebras}, JOURNAL = {Canad. Math. Bull.}, FJOURNAL = {Canadian Mathematical Bulletin. Bulletin Canadien de Math\'ematiques}, VOLUME = {54}, YEAR = {2011}, NUMBER = {4}, PAGES = {593--606}, ISSN = {0008-4395}, CODEN = {CMBUA3}, MRCLASS = {46L05}, MRNUMBER = {2894510 (2012k:46067)}, MRREVIEWER = {Maryam Amyari}, DOI = {10.4153/CMB-2011-019-0}, URL = {http://dx.doi.org/10.4153/CMB-2011-019-0}, } @article {Boersema-Ruiz-Stacey(2011), AUTHOR = {Boersema, Jeffrey L. and Ruiz, Efren and Stacey, P. J.}, TITLE = {The classification of real purely infinite simple {${\rm C}^*$}-algebras}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, VOLUME = {16}, YEAR = {2011}, PAGES = {619--655}, ISSN = {1431-0635}, MRCLASS = {46L35 (19K56 46L80)}, MRNUMBER = {2837543}, MRREVIEWER = {Hong Liang Yao}, } @article {Boersema-Stacey(205), AUTHOR = {Boersema, Jeffrey L. and Stacey, Peter J.}, TITLE = {Correction to the paper: ``{R}eal structure in purely infinite {$C^\ast$}-algebras'' [{J}. {O}perator {T}heory {\bf 49} (2003), no. 1, 77--84;] by {S}tacey}, JOURNAL = {J. Operator Theory}, FJOURNAL = {Journal of Operator Theory}, VOLUME = {53}, YEAR = {2005}, NUMBER = {2}, PAGES = {441--442}, ISSN = {0379-4024}, MRCLASS = {46L05 (46L35)}, MRNUMBER = {2153158 (2006a:46067)}, } @incollection {Bogley(1993), AUTHOR = {Bogley, William A.}, TITLE = {J. {H}. {C}. {W}hitehead's asphericity question}, BOOKTITLE = {Two-dimensional homotopy and combinatorial group theory}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {197}, PAGES = {309--334}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1993}, MRCLASS = {57M20 (55Q52)}, MRNUMBER = {1279184}, DOI = {10.1017/CBO9780511629358.012}, URL = {http://dx.doi.org/10.1017/CBO9780511629358.012}, } @incollection {Bogley-Dyer(1995), AUTHOR = {Bogley, W. A. and Dyer, M. N.}, TITLE = {A group-theoretic reduction of {J}. {H}. {C}. {W}hitehead's asphericity question}, BOOKTITLE = {Groups---{K}orea '94 ({P}usan)}, PAGES = {15--24}, PUBLISHER = {de Gruyter}, ADDRESS = {Berlin}, YEAR = {1995}, MRCLASS = {57M20 (20F19 57M35)}, MRNUMBER = {1476945 (98f:57005)}, MRREVIEWER = {Stephan Rosebrock}, } @article {Bogley-Pride(1992), AUTHOR = {Bogley, William A. and Pride, Stephen J.}, TITLE = {Aspherical relative presentations}, JOURNAL = {Proc. Edinburgh Math. Soc. (2)}, FJOURNAL = {Proceedings of the Edinburgh Mathematical Society. Series II}, VOLUME = {35}, YEAR = {1992}, NUMBER = {1}, PAGES = {1--39}, ISSN = {0013-0915}, CODEN = {PRMSA3}, MRCLASS = {57M07 (20F32 57M05)}, MRNUMBER = {93d:57004}, MRREVIEWER = {D. J. Collins}, } @incollection {Bogley-Pride(1993), AUTHOR = {Bogley, William A. and Pride, Stephen J.}, TITLE = {Calculating generators of $\Pi\sb 2$}, BOOKTITLE = {Two-dimensional homotopy and combinatorial group theory}, PAGES = {157--188}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1993}, MRCLASS = {57M20 (55Q52)}, MRNUMBER = {1 279 179}, } @article {Bohmann-Gerhardt-Malkiewich-Merling-Zakharevich(2024), AUTHOR = {Bohmann, Anna Marie and Gerhardt, Teena and Malkiewich, Cary and Merling, Mona and Zakharevich, Inna}, TITLE = {A trace map on higher scissors congruence groups}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2024}, Volume = {18}, PAGES = {12683--12710}, ISSN = {1073-7928,1687-0247}, MRCLASS = {19D10 (19D50)}, MRNUMBER = {4798646}, DOI = {10.1093/imrn/rnae153}, URL = {https://doi.org/10.1093/imrn/rnae153}, } @article {Bohr-Hanke-Kotschik(2002), AUTHOR = {Bohr, C. and Hanke, B. and Kotschick, D.}, TITLE = {Cycles, submanifolds, and structures on normal bundles}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {108}, YEAR = {2002}, NUMBER = {4}, PAGES = {483--494}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {57R95 (57R15)}, MRNUMBER = {1923535 (2003f:57068)}, MRREVIEWER = {Alexandru Scorpan}, DOI = {10.1007/s002290200279}, URL = {http://dx.doi.org/10.1007/s002290200279}, } @article {Boileau-Druck-Vogt(2002), AUTHOR = {Boileau, M. and Druck, S. and Vogt, E.}, TITLE = {A vanishing theorem for the {G}romov volume of 3-manifolds with an application to circle foliations}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {322}, YEAR = {2002}, NUMBER = {3}, PAGES = {493--524}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {57M50 (57N10 57R30)}, MRNUMBER = {1 895 704}, } @article {Boileau-Flapan(1995), AUTHOR = {Boileau, Michel and Flapan, Erica}, TITLE = {On $\pi$-hyperbolic knots which are determined by their $2$-fold and $4$-fold cyclic branched coverings}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {61}, YEAR = {1995}, NUMBER = {3}, PAGES = {229--240}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {57M25 (57M12)}, MRNUMBER = {95m:57011}, MRREVIEWER = {Colin C. Adams}, } @article {Boileau-Friedl(2019rigidity), AUTHOR = {Boileau, Michel and Friedl, Stefan}, TITLE = {Grothendieck rigidity of 3-manifold groups}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {13}, YEAR = {2019}, NUMBER = {4}, PAGES = {1133--1150}, ISSN = {1661-7207}, MRCLASS = {57M05 (20E18)}, MRNUMBER = {4033499}, MRREVIEWER = {Thomas Koberda}, DOI = {10.4171/ggd/516}, URL = {https://doi.org/10.4171/ggd/516}, } @article {Boileau-Friedl(2019), AUTHOR = {Boileau, Michel and Friedl, Stefan}, TITLE = {The virtual {T}hurston seminorm of 3-manifolds}, JOURNAL = {Osaka J. Math.}, FJOURNAL = {Osaka Journal of Mathematics}, VOLUME = {56}, YEAR = {2019}, NUMBER = {1}, PAGES = {51--63}, ISSN = {0030-6126}, MRCLASS = {57M27 (57M05 57M10)}, MRNUMBER = {3908776}, URL = {https://projecteuclid.org/euclid.ojm/1547607625}, } @article {Boileau-Friedl(2018), AUTHOR = {Boileau, Michel and Friedl, Stefan}, TITLE = {Epimorphisms of 3-manifold groups}, JOURNAL = {Q. J. Math.}, FJOURNAL = {The Quarterly Journal of Mathematics}, VOLUME = {69}, YEAR = {2018}, NUMBER = {3}, PAGES = {931--942}, ISSN = {0033-5606}, MRCLASS = {57N10 (55P10)}, MRNUMBER = {3859215}, DOI = {10.1093/qmath/hay007}, URL = {https://doi.org/10.1093/qmath/hay007}, } @article {Boileau-Lustig-Moriah(1994a), AUTHOR = {Boileau, Michel and Lustig, Martin and Moriah, Yoav}, TITLE = {Links with super-additive tunnel number}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {115}, YEAR = {1994}, NUMBER = {1}, PAGES = {85--95}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {57M25 (57M05)}, MRNUMBER = {95d:57002}, MRREVIEWER = {N. V. Ivanov}, } @article {Boileau-Wang(2007), AUTHOR = {Boileau, Michel and Wang, Shicheng}, TITLE = {Degree one maps between hyperbolic small 3-manifolds}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {135}, YEAR = {2007}, NUMBER = {12}, PAGES = {4023--4029}, ISSN = {0002-9939}, MRCLASS = {57M50 (57M25 57N10)}, MRNUMBER = {2341954}, MRREVIEWER = {Colin C. Adams}, DOI = {10.1090/S0002-9939-07-09265-9}, URL = {https://doi.org/10.1090/S0002-9939-07-09265-9}, } @article {Boileau-Wang(1996), AUTHOR = {Boileau, Michel and Wang, Shicheng}, TITLE = {Non-zero degree maps and surface bundles over ${S}\sp 1$}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {43}, YEAR = {1996}, NUMBER = {4}, PAGES = {789--806}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57N10 (57M50)}, MRNUMBER = {98g:57023}, } @article {Boltjanski-Ryskov_Saskin(1963), AUTHOR = {Boltjanski{\u\i}, V. G. and Ry{\v{s}}kov, S. S. and {\v{S}}a{\v{s}}kin, Ju. A.}, TITLE = {On {$k$}-regular imbeddings and their application to the theory of approximation of functions}, JOURNAL = {Amer. Math. Soc. Transl. (2)}, FJOURNAL = {American Mathematical Society Translations}, VOLUME = {28}, YEAR = {1963}, PAGES = {211--219}, ISSN = {0065-9290}, MRCLASS = {54.60}, MRNUMBER = {0154031 (27 \#3991)}, } @book {Bombieri(1983), TITLE = {Seminar on minimal submanifolds}, EDITOR = {Bombieri, Enrico}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {1983}, PAGES = {vii+358}, ISBN = {0-691-08324-X; 0-691-08319-3}, MRCLASS = {53-06 (49-06)}, MRNUMBER = {86d:53001}, } @incollection {Block+Weinberger(1997), AUTHOR = {Block, Jonathan and Weinberger, Shmuel}, TITLE = {Large scale homology theories and geometry}, BOOKTITLE = {Geometric topology (Athens, GA, 1993)}, SERIES = {AMS/IP Stud. Adv. Math.}, VOLUME = {2}, PAGES = {522--569}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1997}, MRCLASS = {57M07 (18G60 55N35 58G12)}, MRNUMBER = {MR1470747 (98h:57001)}, MRREVIEWER = {A. A. Ranicki}, } @article {Block+Weinberger(2008), AUTHOR = {Block, Jonathan and Weinberger, Shmuel}, TITLE = {On the generalized {N}ielsen realization problem}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {83}, YEAR = {2008}, NUMBER = {1}, PAGES = {21--33}, ISSN = {0010-2571}, MRCLASS = {57Mxx (57Nxx 57Qxx)}, MRNUMBER = {MR2365406}, } @article {Boltjanskii-Ryskov-Saskin(1963), AUTHOR = {Boltjanski{\u\i}, V. G. and Ry{\v{s}}kov, S. S. and {\v{S}}a{\v{s}}kin, Ju. A.}, TITLE = {On {$k$}-regular imbeddings and their application to the theory of approximation of functions}, JOURNAL = {Amer. Math. Soc. Transl. (2)}, FJOURNAL = {American Mathematical Society Translations}, VOLUME = {28}, YEAR = {1963}, PAGES = {211--219}, ISSN = {0065-9290}, MRCLASS = {54.60}, MRNUMBER = {0154031 (27 \#3991)}, } @phdthesis{Boltner(2007), author = {Christian Boltner}, title = {On the Structure of Equidistant Foliations of $R^n$}, school = {Universitaet Augsburg}, year = {2007}, address = {Universitaetsstr. 22, 86159 Augsburg}, language = {eng}, } @article {Boerkoel-Pinner(2018), AUTHOR = {Boerkoel, Ton and Pinner, Christopher}, TITLE = {Minimal group determinants and the {L}ind--{L}ehmer problem for dihedral groups}, JOURNAL = {Acta Arith.}, FJOURNAL = {Acta Arithmetica}, VOLUME = {186}, YEAR = {2018}, NUMBER = {4}, PAGES = {377--395}, ISSN = {0065-1036}, MRCLASS = {11R06 (11C08 11G50 11R09 15B36 20C05 43A40)}, MRNUMBER = {3879399}, DOI = {10.4064/aa180708-30-8}, URL = {https://doi.org/10.4064/aa180708-30-8}, } @article {Bonahon(1997), AUTHOR = {Bonahon, Francis}, TITLE = {Geodesic laminations with transverse {H}\"older distributions}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {30}, YEAR = {1997}, NUMBER = {2}, PAGES = {205--240}, ISSN = {0012-9593}, CODEN = {ASENAH}, MRCLASS = {57N05 (57R30)}, MRNUMBER = {98b:57027}, MRREVIEWER = {Athanase Papadopoulos}, } @article {Bondal(2004), AUTHOR = {Bondal, A. I.}, TITLE = {A symplectic groupoid of triangular bilinear forms and the braid group}, JOURNAL = {Izv. Ross. Akad. Nauk Ser. Mat.}, FJOURNAL = {Rossi\u\i skaya Akademiya Nauk. Izvestiya. Seriya Matematicheskaya}, VOLUME = {68}, YEAR = {2004}, NUMBER = {4}, PAGES = {19--74}, ISSN = {0373-2436}, MRCLASS = {20L05 (14L35 18E30 58H05)}, MRNUMBER = {MR2084561 (2005h:20127)}, MRREVIEWER = {Dmitriy A. Rumynin}, } @article {Bonk-Kleiner(2005), AUTHOR = {Bonk, Mario and Kleiner, Bruce}, TITLE = {Conformal dimension and {G}romov hyperbolic groups with 2-sphere boundary}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {9}, YEAR = {2005}, PAGES = {219--246 (electronic)}, ISSN = {1465-3060}, MRCLASS = {20F67 (30C65)}, MRNUMBER = {MR2116315 (2005k:20102)}, MRREVIEWER = {John Meier}, } @book {Booss(1977), AUTHOR = {Boo{\ss}-Bavnbek, Bernhelm}, TITLE = {Topologie und {A}nalysis}, NOTE = {Einf\"uhring in die Atiyah-Singer-Indexformel, Hochschultext}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1977}, PAGES = {xiv+352}, ISBN = {3-540-08451-7}, MRCLASS = {58G10}, MRNUMBER = {57 \#17727}, MRREVIEWER = {Harold Donnelly}, } @incollection {Booss-Bavnbeck-Wojciechowski(1993a), AUTHOR = {Boo{\ss}-Bavnbek, Bernhelm and Wojciechowski, Krzysztof P.}, TITLE = {Dirac operators and manifolds with boundary}, BOOKTITLE = {Clifford algebras and their applications in mathematical physics (Deinze, 1993)}, PAGES = {55--66}, PUBLISHER = {Kluwer Acad. Publ.}, ADDRESS = {Dordrecht}, YEAR = {1993}, MRCLASS = {58G20 (58G03 58G25 81Q10)}, MRNUMBER = {94m:58220}, MRREVIEWER = {John Roe}, } @book {Booss-Bavnbeck-Wojciechowski(1993b), AUTHOR = {Boo{\ss}-Bavnbek, Bernhelm and Wojciechowski, Krzysztof P.}, TITLE = {Elliptic boundary problems for {D}irac operators}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1993}, PAGES = {xviii+307}, ISBN = {0-8176-3681-1}, MRCLASS = {58G20 (58G10)}, MRNUMBER = {94h:58168}, MRREVIEWER = {John Roe}, } @article {Booss-Bavnbek-Furutani(1998), AUTHOR = {Boo{\ss}-Bavnbek, Bernhelm and Furutani, Kenro}, TITLE = {The {M}aslov index: a functional analytical definition and the spectral flow formula}, JOURNAL = {Tokyo J. Math.}, FJOURNAL = {Tokyo Journal of Mathematics}, VOLUME = {21}, YEAR = {1998}, NUMBER = {1}, PAGES = {1--34}, ISSN = {0387-3870}, MRCLASS = {58G10 (47B25 58G20)}, MRNUMBER = {99e:58172}, MRREVIEWER = {Liviu I. Nicolaescu}, } @article {Booss-Bavnbek-Morchio-Strocchi-Wojciechowski(1997), AUTHOR = {Boo{\ss}-Bavnbek, Bernhelm and Morchio, Gianni and Strocchi, Franco and Wojciechowski, Krzysztof P.}, TITLE = {Grassmannian and chiral anomaly}, JOURNAL = {J. Geom. Phys.}, FJOURNAL = {Journal of Geometry and Physics}, VOLUME = {22}, YEAR = {1997}, NUMBER = {3}, PAGES = {219--244}, ISSN = {0393-0440}, CODEN = {JGPHE5}, MRCLASS = {58G20 (35Q40 58B25 58G10 81T50)}, MRNUMBER = {98d:58186}, MRREVIEWER = {Tosiaki Kori}, } @article {Booss-Bavnbek-Scott-Wojchiechowski(1998a), AUTHOR = {Booss-Bavnbek, B. and Scott, S. G. and Wojciechowski, K. P.}, TITLE = {The {$\zeta$}-determinant and {$\mathcal C$}-determinant on the {G}rassmannian in dimension one}, JOURNAL = {Lett. Math. Phys.}, FJOURNAL = {Letters in Mathematical Physics. A Journal for the Rapid Dissemination of Short Contributions in the Field of Mathematical Physics}, VOLUME = {45}, YEAR = {1998}, NUMBER = {4}, PAGES = {353--362}, ISSN = {0377-9017}, CODEN = {LMPHDY}, MRCLASS = {58G26}, MRNUMBER = {MR1653440 (99i:58152)}, MRREVIEWER = {J{\"u}rgen Tolksdorf}, } @book {Borceux(1994II), AUTHOR = {Borceux, Francis}, TITLE = {Handbook of categorical algebra. 2}, SERIES = {Encyclopedia of Mathematics and its Applications}, VOLUME = {51}, NOTE = {Categories and structures}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1994}, PAGES = {xviii+443}, ISBN = {0-521-44179-X}, MRCLASS = {18-02 (18Exx)}, MRNUMBER = {1313497 (96g:18001b)}, MRREVIEWER = {Martin Hyland}, } @book {Borceux(1994I), AUTHOR = {Borceux, Francis}, TITLE = {Handbook of categorical algebra. 1}, SERIES = {Encyclopedia of Mathematics and its Applications}, VOLUME = {50}, NOTE = {Basic category theory}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1994}, PAGES = {xvi+345}, ISBN = {0-521-44178-1}, MRCLASS = {18-02 (18Axx)}, MRNUMBER = {1291599 (96g:18001a)}, MRREVIEWER = {Martin Hyland}, } @book {Borel(2001_colIV), AUTHOR = {Borel, Armand}, TITLE = {{\OE}uvres: collected papers. {V}ol. {IV}}, NOTE = {1983--1999}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2001}, PAGES = {x+723}, ISBN = {3-540-67640-6}, MRCLASS = {01A75 (11-03 14-03 17-03 20-03 22-03 32-03)}, MRNUMBER = {MR1829820 (2002d:01024)}, MRREVIEWER = {James E. Humphreys}, } @book {Borel(1983_colIII), AUTHOR = {Borel, Armand}, TITLE = {{\OE}uvres: collected papers. {V}ol. {III}, 1969--1982}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1983}, PAGES = {iv+718 pp. (1 plate)}, ISBN = {3-540-12126-9}, MRCLASS = {01A75 (20Gxx 22Exx)}, MRNUMBER = {MR725854 (85f:01027c)}, MRREVIEWER = {James E. Humphreys}, } @book {Borel(1983_colII), AUTHOR = {Borel, Armand}, TITLE = {{\OE}uvres: collected papers. {V}ol. {II}, 1959--1968}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1983}, PAGES = {iv+790 pp. (1 plate)}, ISBN = {3-540-12126-9}, MRCLASS = {01A75 (20Gxx 22Exx)}, MRNUMBER = {MR725853 (85f:01027b)}, MRREVIEWER = {James E. Humphreys}, } @book {Borel(1983_colI), AUTHOR = {Borel, Armand}, TITLE = {{\OE}uvres: collected papers. {V}ol. {I}, 1948--1958}, NOTE = {1948--1958}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1983}, PAGES = {viii+718 pp. (1 plate)}, ISBN = {3-540-12126-9}, MRCLASS = {01A75 (20Gxx 22Exx)}, MRNUMBER = {MR725852 (85f:01027a)}, MRREVIEWER = {James E. Humphreys}, } @article {Borel(1972), AUTHOR = {Borel, Armand}, TITLE = {Cohomologie r\'eelle stable de groupes {$S$}-arithm\'etiques classiques}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. A-B}, VOLUME = {274}, YEAR = {1972}, PAGES = {A1700--A1702}, MRCLASS = {20G10}, MRNUMBER = {MR0308286 (46 \#7400)}, MRREVIEWER = {M. F. Atiyah}, } @article {Borel(1963), AUTHOR = {Borel, Armand}, TITLE = {Compact {C}lifford-{K}lein forms of symmetric spaces}, JOURNAL = {Topology}, VOLUME = {2}, YEAR = {1963}, PAGES = {111--122}, MRCLASS = {22.70 (53.73)}, MRNUMBER = {26 \#3823}, MRREVIEWER = {Y. Matsushima}, } @book {Borel(1967), AUTHOR = {Borel, Armand}, TITLE = {Topics in the homology theory of fibre bundles}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1967}, PAGES = {95}, MRCLASS = {55.50}, MRNUMBER = {36 \#4559}, MRREVIEWER = {S. Y. Husseini}, } @article {Borel(1974), AUTHOR = {Borel, Armand}, TITLE = {Stable real cohomology of arithmetic groups}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, VOLUME = {7}, YEAR = {1974}, PAGES = {235--272 (1975)}, MRCLASS = {22E40 (20G10)}, MRNUMBER = {52 \#8338}, MRREVIEWER = {Howard Garland}, } @incollection {Borel(1983a), AUTHOR = {Borel, Armand}, TITLE = {${L}\sp{2}$-cohomology and intersection cohomology of certain arithmetic varieties}, BOOKTITLE = {Emmy Noether in Bryn Mawr (Bryn Mawr, Pa., 1982)}, PAGES = {119--131}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1983}, MRCLASS = {32M15 (14F99 22E40 57N65)}, MRNUMBER = {85e:32038}, MRREVIEWER = {I. Dolgachev}, } @article {Borel(1985), AUTHOR = {Borel, Armand}, TITLE = {The ${L}\sp 2$-cohomology of negatively curved {R}iemannian symmetric spaces}, JOURNAL = {Ann. Acad. Sci. Fenn. Ser. A I Math.}, FJOURNAL = {Annales Academiae Scientiarum Fennicae. Series A I. Mathematica}, VOLUME = {10}, YEAR = {1985}, PAGES = {95--105}, ISSN = {0066-1953}, CODEN = {AAFMAT}, MRCLASS = {22E46 (53C35)}, MRNUMBER = {87f:22013}, MRREVIEWER = {Avner Ash}, } @incollection {{Borel(1995), AUTHOR = {Borel, Armand}, TITLE = {Sous-groupes compacts maximaux des groupes de {L}ie}, BOOKTITLE = {S\'{e}minaire {B}ourbaki, {V}ol. 1}, PAGES = {Exp. No. 33, 271--279}, PUBLISHER = {Soc. Math. France, Paris}, YEAR = {1995}, MRCLASS = {22E10 (22E15)}, MRNUMBER = {1605197}, } @book {Borel(1991), AUTHOR = {Borel, Armand}, TITLE = {Linear algebraic groups}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1991}, PAGES = {xii+288}, ISBN = {0-387-97370-2}, MRCLASS = {20-01 (20Gxx)}, MRNUMBER = {92d:20001}, MRREVIEWER = {F. D. Veldkamp}, } @article {Borel-Casselman(1983), AUTHOR = {Borel, Armand and Casselman, William}, TITLE = {${L}\sp{2}$-cohomology of locally symmetric manifolds of finite volume}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {50}, YEAR = {1983}, NUMBER = {3}, PAGES = {625--647}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {22E41 (11F75 22E40 57T15)}, MRNUMBER = {86j:22015}, MRREVIEWER = {Roberto J. Miatello}, } @article {Borel-Casselman(1985), AUTHOR = {Borel, Armand and Casselman, William}, TITLE = {Cohomologie d'intersection et ${L}\sp 2$-cohomologie de vari\'et\'es arithm\'etiques de rang rationnel $2$}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus des S\'eances de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {301}, YEAR = {1985}, NUMBER = {7}, PAGES = {369--373}, ISSN = {0249-6291}, CODEN = {CASMEI}, MRCLASS = {22E41 (11F06 32N15)}, MRNUMBER = {86m:22015}, } @article {Borel-Harish-Chandra(1962), AUTHOR = {Borel, Armand and Harish-Chandra}, TITLE = {Arithmetic subgroups of algebraic groups}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {75}, YEAR = {1962}, PAGES = {485--535}, MRCLASS = {20.65 (14.50)}, MRNUMBER = {26 \#5081}, MRREVIEWER = {P. Cartier}, } @article {Borel-Hirzebruch(1958), AUTHOR = {Borel, Armand and Hirzebruch, Friedrich}, TITLE = {Characteristic classes and homogeneous spaces. {I}}, JOURNAL = {Amer. J. Math.}, VOLUME = {80}, YEAR = {1958}, PAGES = {458--538}, MRCLASS = {55.00 (22.00)}, MRNUMBER = {21 \#1586}, MRREVIEWER = {R. Bott}, } @article {Borel-Hirzebruch(1959), AUTHOR = {Borel, Armand and Hirzebruch, Friedrich}, TITLE = {Characteristic classes and homogeneous spaces. {I}{I}}, JOURNAL = {Amer. J. Math.}, VOLUME = {81}, YEAR = {1959}, PAGES = {315--382}, MRCLASS = {57.00}, MRNUMBER = {22 \#988}, MRREVIEWER = {R. Bott}, } @article {Borel-Hirzebruch(1960), AUTHOR = {Borel, A. and Hirzebruch, F.}, TITLE = {Characteristic classes and homogeneous spaces. {III}}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {82}, YEAR = {1960}, PAGES = {491--504}, ISSN = {0002-9327}, MRCLASS = {57.00}, MRNUMBER = {0120664}, MRREVIEWER = {R. Bott}, } @article {Borel-Serre(1973), AUTHOR = {Borel, A. and Serre, J.-P.}, TITLE = {Corners and arithmetic groups}, NOTE = {Avec un appendice: Arrondissement des vari\'et\'es \`a coins, par A. Douady et L. H\'erault}, JOURNAL = {Comment. Math. Helv.}, VOLUME = {48}, YEAR = {1973}, PAGES = {436--491}, MRCLASS = {22E40}, MRNUMBER = {52 \#8337}, MRREVIEWER = {M. S. Raghunathan}, } @book {Borel-Wallach(1980), AUTHOR = {Borel, Armand and Wallach, Nolan R.}, TITLE = {Continuous cohomology, discrete subgroups, and representations of reductive groups}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1980}, PAGES = {xvii+388}, ISBN = {0-691-08248-0; 0-691-08249-9}, MRCLASS = {22E41 (22E40 22E45 57T15)}, MRNUMBER = {83c:22018}, MRREVIEWER = {Roger Howe}, } @book {Borel-et.al.(1984), TITLE = {Intersection cohomology}, EDITOR = {Borel, Armand and et al.}, NOTE = {Notes on the seminar held at the University of Bern, Bern, 1983, Swiss Seminars}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1984}, PAGES = {x+234}, ISBN = {0-8176-3274-3}, MRCLASS = {32C42 (14F99 32C40 55N35 57N65 58A35)}, MRNUMBER = {88d:32024}, MRREVIEWER = {J. S. Joel}, } @book {Borevich-Shafarevich(1966), AUTHOR = {Borevich, A. I. and Shafarevich, I. R.}, TITLE = {Number theory}, SERIES = {Translated from the Russian by Newcomb Greenleaf. Pure and Applied Mathematics, Vol. 20}, PUBLISHER = {Academic Press}, ADDRESS = {New York}, YEAR = {1966}, PAGES = {x+435}, MRCLASS = {10.00}, MRNUMBER = {0195803 (33 \#4001)}, } @article {Borodzik-Friedl(2014note), AUTHOR = {Borodzik, Maciej and Friedl, Stefan}, TITLE = {A note on a topological approach to the {$\mu$}-constant problem in dimension 2}, JOURNAL = {Rev. Mat. Complut.}, FJOURNAL = {Revista Matem\'atica Complutense}, VOLUME = {27}, YEAR = {2014}, NUMBER = {1}, PAGES = {345--350}, ISSN = {1139-1138}, MRCLASS = {32S15 (57M25 57R65 57R80)}, MRNUMBER = {3149191}, MRREVIEWER = {Eugenii Shustin}, DOI = {10.1007/s13163-013-0122-6}, URL = {http://dx.doi.org/10.1007/s13163-013-0122-6}, } @article {Borodzik-Friedl(2014unknotting), AUTHOR = {Borodzik, Maciej and Friedl, Stefan}, TITLE = {The unknotting number and classical invariants {II}}, JOURNAL = {Glasg. Math. J.}, FJOURNAL = {Glasgow Mathematical Journal}, VOLUME = {56}, YEAR = {2014}, NUMBER = {3}, PAGES = {657--680}, ISSN = {0017-0895}, MRCLASS = {57M27}, MRNUMBER = {3250270}, } @article {Borsuk(1957), AUTHOR = {Borsuk, K.}, TITLE = {On the {$k$}-independent subsets of the {E}uclidean space and of the {H}ilbert space}, JOURNAL = {Bull. Acad. Polon. Sci. Cl. III.}, VOLUME = {5}, YEAR = {1957}, PAGES = {351--356, XXIX}, MRCLASS = {54.0X}, MRNUMBER = {0088710 (19,567d)}, MRREVIEWER = {G. T. Whyburn}, } @book {Borsuk(1967), AUTHOR = {Borsuk, Karol}, TITLE = {Theory of retracts}, SERIES = {Monografie Matematyczne [Mathematical Monographs]}, VOLUME = {Tom 44}, PUBLISHER = {Pa\'{n}stwowe Wydawnictwo Naukowe, Warsaw}, YEAR = {1967}, PAGES = {251}, MRCLASS = {54.60 (55.00)}, MRNUMBER = {216473}, MRREVIEWER = {S.\ -T\ Hu}, } @article {Borwein-Dobrowoloski-Mossinghoff(2007), AUTHOR = {Borwein, Peter and Dobrowolski, Edward and Mossinghoff, Michael J.}, TITLE = {Lehmer's problem for polynomials with odd coefficients}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {166}, YEAR = {2007}, NUMBER = {2}, PAGES = {347--366}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {11R06 (11C08 11R09)}, MRNUMBER = {2373144 (2008j:11153)}, MRREVIEWER = {Art{\=u}ras Dubickas}, DOI = {10.4007/annals.2007.166.347}, URL = {http://dx.doi.org/10.4007/annals.2007.166.347}, } @Book {Bosch(1993), author = {Bosch, S.}, title = {Algebra}, series = {Springer Lehrbuch}, publisher = {Springer}, year = 1993, } @article {Bosch-Luetkebohmert(1993a), AUTHOR = {Bosch, Siegfried and L{\"u}tkebohmert, Werner}, TITLE = {Formal and rigid geometry. {I}. {R}igid spaces}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {295}, YEAR = {1993}, NUMBER = {2}, PAGES = {291--317}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {11G25 (14D15 14G20)}, MRNUMBER = {94a:11090}, MRREVIEWER = {Qing Liu}, } @article {Bosch-Luetkebohmert(1993b), AUTHOR = {Bosch, Siegfried and L{\"u}tkebohmert, Werner}, TITLE = {Formal and rigid geometry. {I}{I}. {F}lattening techniques}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {296}, YEAR = {1993}, NUMBER = {3}, PAGES = {403--429}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {11G25 (14A15 14G20 32P05)}, MRNUMBER = {94e:11070}, } @article {Bosch-Luetkebohmert(1995a), AUTHOR = {Bosch, Siegfried and L{\"u}tkebohmert, Werner and Raynaud, Michel}, TITLE = {Formal and rigid geometry. {I}{V}. {T}he reduced fibre theorem}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {119}, YEAR = {1995}, NUMBER = {2}, PAGES = {361--398}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11G25 (14A15 14G20 32P05)}, MRNUMBER = {97e:11075}, MRREVIEWER = {Reinhold H{\"u}bl}, } @article {Bosch-Luetkebohmert(1995b), AUTHOR = {Bosch, Siegfried and L{\"u}tkebohmert, Werner and Raynaud, Michel}, TITLE = {Formal and rigid geometry. {I}{I}{I}. {T}he relative maximum principle}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {302}, YEAR = {1995}, NUMBER = {1}, PAGES = {1--29}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {11G25 (14A15 14G20 32P05)}, MRNUMBER = {97e:11074}, MRREVIEWER = {Reinhold H{\"u}bl}, } @article {Bost(1990), AUTHOR = {Bost, Jean-Beno\^{\}i t}, TITLE = {Principe d'{O}ka, ${K}$-th\'eorie et syst\`emes dynamiques non commutatifs}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {101}, YEAR = {1990}, NUMBER = {2}, PAGES = {261--333}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {46L87 (19K99 32F20 58B30)}, MRNUMBER = {92j:46126}, MRREVIEWER = {Jonathan M. Rosenberg}, } @incollection {Bott(1997), AUTHOR = {Bott, Raoul}, TITLE = {Configuration spaces and imbedding problems}, BOOKTITLE = {Geometry and physics ({A}arhus, 1995)}, SERIES = {Lecture Notes in Pure and Appl. Math.}, VOLUME = {184}, PAGES = {135--140}, PUBLISHER = {Dekker}, ADDRESS = {New York}, YEAR = {1997}, MRCLASS = {57M25 (58A10)}, MRNUMBER = {1423159 (97k:57009)}, MRREVIEWER = {R{\u{a}}zvan Gelca}, } @article {Bott(1996), AUTHOR = {Bott, Raoul}, TITLE = {Configuration spaces and imbedding invariants}, JOURNAL = {Turkish J. Math.}, FJOURNAL = {Turkish Journal of Mathematics}, VOLUME = {20}, YEAR = {1996}, NUMBER = {1}, PAGES = {1--17}, ISSN = {1300-0098}, MRCLASS = {57M25 (58D99)}, MRNUMBER = {1392659 (97k:57008)}, MRREVIEWER = {Zhenghan Wang}, } @article {Bott(1959), AUTHOR = {Bott, Raoul}, TITLE = {The stable homotopy of the classical groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {70}, YEAR = {1959}, PAGES = {313--337}, ISSN = {0003-486X}, MRCLASS = {57.00}, MRNUMBER = {110104}, DOI = {10.2307/1970106}, URL = {https://doi-org.ezp.lib.unimelb.edu.au/10.2307/1970106}, } @article {Bott(1956), AUTHOR = {Bott, Raoul}, TITLE = {An application of the {M}orse theory to the topology of {L}ie-groups}, JOURNAL = {Bull. Soc. Math. France}, FJOURNAL = {Bulletin de la Soci\'et\'e Math\'ematique de France}, VOLUME = {84}, YEAR = {1956}, PAGES = {251--281}, ISSN = {0037-9484}, MRCLASS = {17.0X}, MRNUMBER = {MR0087035 (19,291a)}, MRREVIEWER = {C. Chevalley}, } @article {Bott-Milnor(1958), AUTHOR = {Bott, R. and Milnor, J.}, TITLE = {On the parallelizability of the spheres}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {64}, YEAR = {1958}, PAGES = {87--89}, ISSN = {0002-9904}, MRCLASS = {55.00}, MRNUMBER = {MR0102804 (21 \#1590)}, MRREVIEWER = {W. S. Massey}, } @article {Bott-Samelson(1958), AUTHOR = {Bott, Raoul and Samelson, Hans}, TITLE = {Applications of the theory of {M}orse to symmetric spaces}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {80}, YEAR = {1958}, PAGES = {964--1029}, ISSN = {0002-9327}, MRCLASS = {55.00 (22.00)}, MRNUMBER = {MR0105694 (21 \#4430)}, MRREVIEWER = {C. T. Yang}, } @article {Bott-Taubes(1989), AUTHOR = {Bott, Raoul and Taubes, Clifford}, TITLE = {On the rigidity theorems of {W}itten}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {2}, YEAR = {1989}, NUMBER = {1}, PAGES = {137--186}, ISSN = {0894-0347}, MRCLASS = {58G10 (57R91)}, MRNUMBER = {89k:58270}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @book {Bott-Tu(1982), AUTHOR = {Bott, Raoul and Tu, Loring W.}, TITLE = {Differential forms in algebraic topology}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1982}, PAGES = {xiv+331}, ISBN = {0-387-90613-4}, MRCLASS = {57R19 (55-02 58-01 58A12)}, MRNUMBER = {83i:57016}, MRREVIEWER = {Hansklaus Rummler}, } @book {Botvinnik(1992), AUTHOR = {Botvinnik, Boris I.}, TITLE = {Manifolds with singularities and the {A}dams-{N}ovikov spectral sequence}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1992}, PAGES = {xvi+181}, ISBN = {0-521-42608-1}, MRCLASS = {55N22 (55T15 57R90)}, MRNUMBER = {93h:55002}, MRREVIEWER = {Donald M. Davis}, } @article {Botvinnik-Gilkey(1995), AUTHOR = {Botvinnik, Boris I. and Gilkey, Peter B.}, TITLE = {The eta invariant and metrics of positive scalar curvature}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {302}, YEAR = {1995}, NUMBER = {3}, PAGES = {507--517}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {58G12 (53C21 53C25 57R15 58D27 58G25)}, MRNUMBER = {96f:58159}, MRREVIEWER = {Jonathan M. Rosenberg}, } @article {Botvinnik-Gilkey-Stolz(1997), AUTHOR = {Botvinnik, Boris I. and Gilkey, Peter B. and Stolz, Stephan}, TITLE = {The {G}romov-{L}awson-{R}osenberg conjecture for groups with periodic cohomology}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {46}, YEAR = {1997}, NUMBER = {3}, PAGES = {374--405}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G12 (53C21 55N15 55N22 57R40 57R50)}, MRNUMBER = {98i:58227}, MRREVIEWER = {Jonathan M. Rosenberg}, } @article {Botvinnik-Ebert-Randal-Williams(2017), AUTHOR = {Botvinnik, Boris and Ebert, Johannes and Randal-Williams, Oscar}, TITLE = {Infinite loop spaces and positive scalar curvature}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {209}, YEAR = {2017}, NUMBER = {3}, PAGES = {749--835}, ISSN = {0020-9910}, MRCLASS = {53C27 (19D06 19K56 55P47 55R35 55S35 57R22 58J20)}, MRNUMBER = {3681394}, MRREVIEWER = {Peter Hochs}, DOI = {10.1007/s00222-017-0719-3}, URL = {https://doi.org/10.1007/s00222-017-0719-3}, } @article {Botvinnik-Hanke-Schick-Walsh(2010), AUTHOR = {Botvinnik, Boris and Hanke, Bernhard and Schick, Thomas and Walsh, Mark}, TITLE = {Homotopy groups of the moduli space of metrics of positive scalar curvature}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {14}, YEAR = {2010}, NUMBER = {4}, PAGES = {2047--2076}, ISSN = {1465-3060}, MRCLASS = {58D27 (53C21 55Q52)}, MRNUMBER = {2680210 (2012a:58020)}, MRREVIEWER = {{\'E}ric Leichtnam}, DOI = {10.2140/gt.2010.14.2047}, URL = {http://dx.doi.org/10.2140/gt.2010.14.2047}, } @article {Botvinnik-Rosenberg(2005), AUTHOR = {Botvinnik, Boris and Rosenberg, Jonathan}, TITLE = {Positive scalar curvature for manifolds with elementary abelian fundamental group}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {133}, YEAR = {2005}, NUMBER = {2}, PAGES = {545--556 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {53C21 (53C20 55N22 55S30 55U25 57R75)}, MRNUMBER = {MR2093079 (2005g:53057)}, MRREVIEWER = {Thomas Schick}, } @article {Boualem(1995), AUTHOR = {Boualem, H.}, TITLE = {Feuilletages riemanniens singuliers transversalement int\'egrables}, JOURNAL = {Compositio Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {95}, YEAR = {1995}, NUMBER = {1}, PAGES = {101--125}, ISSN = {0010-437X}, CODEN = {CMPMAF}, MRCLASS = {53C12 (57R30)}, MRNUMBER = {MR1314698 (96e:53035)}, MRREVIEWER = {Lawrence Conlon}, } @book {Bouc(1997), AUTHOR = {Bouc, Serge}, TITLE = {Green functors and {$G$}-sets}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {1671}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1997}, PAGES = {viii+342}, ISBN = {3-540-63550-5}, MRCLASS = {20C99 (19A22)}, MRNUMBER = {99c:20010}, MRREVIEWER = {Jacques Th{\'e}venaz}, } @incollection {Bouc(1998), AUTHOR = {Bouc, S.}, TITLE = {R\'esolutions de foncteurs de {M}ackey}, BOOKTITLE = {Group representations: cohomology, group actions and topology (Seattle, WA, 1996)}, SERIES = {Proc. Sympos. Pure Math.}, VOLUME = {63}, PAGES = {31--83}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1998}, MRCLASS = {20C20 (19A22)}, MRNUMBER = {99b:20015}, MRREVIEWER = {Jacques Th{\'e}venaz}, } @article {Bouc(1999a), AUTHOR = {Bouc, Serge}, TITLE = {Sur le centre des alg\`ebres de groupe en caract\'eristique {$p$}}, JOURNAL = {Exposition. Math.}, FJOURNAL = {Expositiones Mathematicae. International Journal}, VOLUME = {17}, YEAR = {1999}, NUMBER = {4}, PAGES = {375--383}, ISSN = {0723-0869}, MRCLASS = {20C05}, MRNUMBER = {1 734 256}, } @article {Bouc(1999b), AUTHOR = {Bouc, Serge}, TITLE = {Le complexe de cha\^\i nes d'un {$G$}-complexe simplicial acyclique}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {220}, YEAR = {1999}, NUMBER = {2}, PAGES = {415--436}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {18G30 (20J05)}, MRNUMBER = {2000k:18009}, MRREVIEWER = {Graham J. Ellis}, } @incollection {Bouc(2000), AUTHOR = {Bouc, Serge}, TITLE = {Burnside rings}, BOOKTITLE = {Handbook of algebra, Vol. 2}, PAGES = {739--804}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {2000}, MRCLASS = {19A22 (20C15 20G20)}, MRNUMBER = {MR1759611 (2001m:19001)}, MRREVIEWER = {Robert Boltje}, } @incollection {Bouc(2000a), AUTHOR = {Bouc, Serge}, TITLE = {Burnside rings}, BOOKTITLE = {Handbook of algebra, Vol. 2}, PAGES = {739--804}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {2000}, MRCLASS = {19A22 (20C15 20G20)}, MRNUMBER = {2001m:19001}, MRREVIEWER = {Robert Boltje}, } @article {Bouc(2000b), AUTHOR = {Bouc, Serge}, TITLE = {Polynomial ideals and classes of finite groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {229}, YEAR = {2000}, NUMBER = {1}, PAGES = {153--174}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {13F20 (20D25)}, MRNUMBER = {2001j:13020}, MRREVIEWER = {James B. Coykendall}, } @article {Bouc(2000c), AUTHOR = {Bouc, S.}, TITLE = {Tensor induction of relative syzygies}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {523}, YEAR = {2000}, PAGES = {113--171}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {20C20 (20D15)}, MRNUMBER = {2001g:20011}, MRREVIEWER = {J. L. Alperin}, } @article {Bouc(2000d), AUTHOR = {Bouc, Serge}, TITLE = {Non-additive exact functors and tensor induction for {M}ackey functors}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {144}, YEAR = {2000}, NUMBER = {683}, PAGES = {viii+74}, ISSN = {0065-9266}, CODEN = {MAMCAU}, MRCLASS = {19A22 (18A22 20J05 20J06 55M35 55N91)}, MRNUMBER = {2000i:19002}, MRREVIEWER = {L. Gaunce Lewis, Jr.}, } @article {Bouc(2001), AUTHOR = {Bouc, Serge}, TITLE = {A remark on a theorem of {R}itter and {S}egal}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {4}, YEAR = {2001}, NUMBER = {1}, PAGES = {11--18}, ISSN = {1433-5883}, CODEN = {JGTHFQ}, MRCLASS = {20C05}, MRNUMBER = {2001k:20004}, MRREVIEWER = {I. M. Isaacs}, } @article {Bouc(2002), AUTHOR = {Bouc, Serge}, TITLE = {Green functors, crossed {$G$}-monoids, and {H}ochschild constructions}, JOURNAL = {AMA Algebra Montp. Announc.}, FJOURNAL = {AMA. Algebra Montpellier Announcements}, YEAR = {2002}, PAGES = {Paper 1, 7 pp. (electronic)}, MRCLASS = {19A22 (20J06)}, MRNUMBER = {2003e:19001}, MRREVIEWER = {Robert Boltje}, } @article {Bouc(2003), AUTHOR = {Bouc, Serge}, TITLE = {Hochschild constructions for {G}reen functors}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {31}, YEAR = {2003}, NUMBER = {1}, PAGES = {403--436}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {16E40 (19A22)}, MRNUMBER = {1 969 231}, } @article {Bouc-Thevenaz(2000), AUTHOR = {Bouc, Serge and Th{\'e}venaz, Jacques}, TITLE = {The group of endo-permutation modules}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {139}, YEAR = {2000}, NUMBER = {2}, PAGES = {275--349}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20C20 (20C10 20J15)}, MRNUMBER = {2001i:20023}, MRREVIEWER = {Jon F. Carlson}, } @article {Boudon(1995), AUTHOR = {Bourdon, Marc}, TITLE = {Structure conforme au bord et flot g\'eod\'esique d'un {${\rm CAT}(-1)$}-espace}, JOURNAL = {Enseign. Math. (2)}, FJOURNAL = {L'Enseignement Math\'ematique. Revue Internationale. IIe S\'erie}, VOLUME = {41}, YEAR = {1995}, NUMBER = {1-2}, PAGES = {63--102}, ISSN = {0013-8584}, CODEN = {ENMAAR}, MRCLASS = {58F17 (20F05 20F32 57S30)}, MRNUMBER = {MR1341941 (96f:58120)}, MRREVIEWER = {Michel Coornaert}, } @article {Bouldin(1981), AUTHOR = {Bouldin, Richard}, TITLE = {The essential minimum modulus}, JOURNAL = {Indiana Univ. Math. J.}, FJOURNAL = {Indiana University Mathematics Journal}, VOLUME = {30}, YEAR = {1981}, NUMBER = {4}, PAGES = {513--517}, ISSN = {0022-2518}, CODEN = {IUMJAB}, MRCLASS = {47A05 (47A53)}, MRNUMBER = {82i:47001}, MRREVIEWER = {Eric Nordgren}, } @book {Bourbaki(1972), AUTHOR = {Bourbaki, Nicolas}, TITLE = {Elements of mathematics. {C}ommutative algebra}, NOTE = {Translated from the French}, PUBLISHER = {Hermann}, ADDRESS = {Paris}, YEAR = {1972}, PAGES = {xxiv+625}, MRCLASS = {13-XX}, MRNUMBER = {50 \#12997}, } @book {Bourbaki(1989), AUTHOR = {Bourbaki, Nicolas}, TITLE = {Commutative algebra. {C}hapters 1--7}, NOTE = {Translated from the French, Reprint of the 1972 edition}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1989}, PAGES = {xxiv+625}, ISBN = {3-540-19371-5}, MRCLASS = {13-XX (00A05)}, MRNUMBER = {90a:13001}, } @article {Bourguignon-Karcher(1978), AUTHOR = {Bourguignon, Jean-Pierre and Karcher, Hermann}, TITLE = {Curvature operators: pinching estimates and geometric examples}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, VOLUME = {11}, YEAR = {1978}, NUMBER = {1}, PAGES = {71--92}, MRCLASS = {53C20 (58G99)}, MRNUMBER = {58 \#12829}, MRREVIEWER = {D. G. Ebin}, } @article {Bourguignon-Polombo(1981), AUTHOR = {Bourguignon, Jean-Pierre and Polombo, Albert}, TITLE = {Int\'egrands des nombres caract\'eristiques et courbure: rien ne va plus d\`es la dimension $6$}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {16}, YEAR = {1981}, NUMBER = {4}, PAGES = {537--550 (1982)}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C20 (57R20)}, MRNUMBER = {83m:53054}, MRREVIEWER = {D. Lehmann}, } @article {Bousfield(2008), AUTHOR = {Bousfield, A. K.}, TITLE = {Kunneth theorems and unstable operations in 2-adic {$KO$}-cohomology}, JOURNAL = {J. K-Theory}, FJOURNAL = {Journal of K-Theory. K-Theory and its Applications in Algebra, Geometry, Analysis \& Topology}, VOLUME = {1}, YEAR = {2008}, NUMBER = {3}, PAGES = {395--430}, ISSN = {1865-2433}, MRCLASS = {55N15 (55S25 55U25)}, MRNUMBER = {MR2433276}, } @article {Bousfield(2007), AUTHOR = {Bousfield, A. K.}, TITLE = {On the 2-adic {$K$}-localizations of {$H$}-spaces}, JOURNAL = {Homology, Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {9}, YEAR = {2007}, NUMBER = {1}, PAGES = {331--366 (electronic)}, ISSN = {1532-0073}, MRCLASS = {55N15 (55P60 55Q51 55S25)}, MRNUMBER = {MR2299803 (2007m:55005)}, MRREVIEWER = {Richard John Steiner}, } @article {Bousfield(2005), AUTHOR = {Bousfield, A. K.}, TITLE = {On the 2-primary {$v\sb 1$}-periodic homotopy groups of spaces}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {44}, YEAR = {2005}, NUMBER = {2}, PAGES = {381--413}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55Q51 (55N15 55P60 55S25 55T20)}, MRNUMBER = {MR2114954 (2005j:55018)}, MRREVIEWER = {Mark J. Behrens}, } @article {Bousfield(2003), AUTHOR = {Bousfield, A. K.}, TITLE = {Cosimplicial resolutions and homotopy spectral sequences in model categories}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {7}, YEAR = {2003}, PAGES = {1001--1053 (electronic)}, ISSN = {1465-3060}, MRCLASS = {55U35 (18G55 55P60 55T15)}, MRNUMBER = {MR2026537 (2004j:55015)}, MRREVIEWER = {Paul G. Goerss}, } @article {Bousfield(2001), AUTHOR = {Bousfield, A. K.}, TITLE = {On the telescopic homotopy theory of spaces}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {353}, YEAR = {2001}, NUMBER = {6}, PAGES = {2391--2426 (electronic)}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {55P60 (55N20 55P42 55P65 55U35)}, MRNUMBER = {MR1814075 (2001k:55030)}, MRREVIEWER = {Edgar H. Brown, Jr.}, } @article {Bousfield(1999), AUTHOR = {Bousfield, A. K.}, TITLE = {The {$K$}-theory localizations and {$v\sb 1$}-periodic homotopy groups of {$H$}-spaces}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {38}, YEAR = {1999}, NUMBER = {6}, PAGES = {1239--1264}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P60 (55P45 55Q51)}, MRNUMBER = {MR1690156 (2000d:55022)}, } @incollection {Bousfield(1998), AUTHOR = {Bousfield, A. K.}, TITLE = {On {$K(n)$}-equivalences of spaces}, BOOKTITLE = {Homotopy invariant algebraic structures ({B}altimore, {MD}, 1998)}, SERIES = {Contemp. Math.}, VOLUME = {239}, PAGES = {85--89}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1999}, MRCLASS = {55N20 (55N15 55P60)}, MRNUMBER = {MR1718077 (2001k:55013)}, MRREVIEWER = {Carles Casacuberta}, } @article {Bousfield(1997), AUTHOR = {Bousfield, A. K.}, TITLE = {Homotopical localizations of spaces}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {119}, YEAR = {1997}, NUMBER = {6}, PAGES = {1321--1354}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {55P60}, MRNUMBER = {MR1481817 (98m:55009)}, MRREVIEWER = {Dirk Scevenels}, } @article {Bousfield(1996adiclambdarings), AUTHOR = {Bousfield, A. K.}, TITLE = {On {$p$}-adic {$\lambda$}-rings and the {$K$}-theory of {$H$}-spaces}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {223}, YEAR = {1996}, NUMBER = {3}, PAGES = {483--519}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {55S25 (16W30 55N15)}, MRNUMBER = {MR1417857 (97i:55033)}, MRREVIEWER = {Paul G. Goerss}, } @article {Bousfield(1996loop), AUTHOR = {Bousfield, A. K.}, TITLE = {On {$\lambda$}-rings and the {$K$}-theory of infinite loop spaces}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {10}, YEAR = {1996}, NUMBER = {1}, PAGES = {1--30}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {55N15 (19L20 55P47 55S25)}, MRNUMBER = {MR1373816 (98a:55006)}, MRREVIEWER = {Robert D. Thompson}, } @incollection {Bousfield(1996localization), AUTHOR = {Bousfield, A. K.}, TITLE = {Unstable localization and periodicity}, BOOKTITLE = {Algebraic topology: new trends in localization and periodicity ({S}ant {F}eliu de {G}u\'\i xols, 1994)}, SERIES = {Progr. Math.}, VOLUME = {136}, PAGES = {33--50}, PUBLISHER = {Birkh\"auser}, ADDRESS = {Basel}, YEAR = {1996}, MRCLASS = {55P60 (55Q05)}, MRNUMBER = {MR1397720 (98c:55014)}, MRREVIEWER = {N. J. Kuhn}, } @article {Bousfield(1994), AUTHOR = {Bousfield, A. K.}, TITLE = {Localization and periodicity in unstable homotopy theory}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {7}, YEAR = {1994}, NUMBER = {4}, PAGES = {831--873}, ISSN = {0894-0347}, MRCLASS = {55P60 (55N15 55N20 55Q05 55U10)}, MRNUMBER = {95c:55010}, MRREVIEWER = {N. J. Kuhn}, } @article {Bousfield(1990), AUTHOR = {Bousfield, A. K.}, TITLE = {A classification of {$K$}-local spectra}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {66}, YEAR = {1990}, NUMBER = {2}, PAGES = {121--163}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55N15 (19L99 55P42)}, MRNUMBER = {1075335 (92d:55003)}, MRREVIEWER = {Andrei V. Pazhitnov}, DOI = {10.1016/0022-4049(90)90082-S}, URL = {http://dx.doi.org/10.1016/0022-4049(90)90082-S}, } @article {Bousfield(1974), AUTHOR = {Bousfield, A. K.}, TITLE = {Types of acyclicity}, JOURNAL = {J. Pure Appl. Algebra}, VOLUME = {4}, YEAR = {1974}, PAGES = {293--298}, MRCLASS = {55B35}, MRNUMBER = {51 \#4220}, MRREVIEWER = {W. M. Singer}, } @incollection {Bousfield-Friedlander(1978), AUTHOR = {Bousfield, A. K. and Friedlander, E. M.}, TITLE = {Homotopy theory of {$\Gamma $}-spaces, spectra, and bisimplicial sets}, BOOKTITLE = {Geometric applications of homotopy theory (Proc. Conf., Evanston, Ill., 1977), II}, SERIES = {Lecture Notes in Math.}, VOLUME = {658}, PAGES = {80--130}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1978}, MRCLASS = {55P65 (55P42)}, MRNUMBER = {80e:55021}, MRREVIEWER = {D. W. Anderson}, } @book {Bousfield-Kan(1972), AUTHOR = {Bousfield, A. K. and Kan, D. M.}, TITLE = {Homotopy limits, completions and localizations}, NOTE = {Lecture Notes in Mathematics, Vol. 304}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1972}, PAGES = {v+348}, MRCLASS = {55J05}, MRNUMBER = {51 \#1825}, MRREVIEWER = {Harold Hastings}, } @incollection {Bowditch(1991), AUTHOR = {Bowditch, B. H.}, TITLE = {Notes on {G}romov's hyperbolicity criterion for path-metric spaces}, BOOKTITLE = {Group theory from a geometrical viewpoint (Trieste, 1990)}, PAGES = {64--167}, PUBLISHER = {World Sci. Publishing}, ADDRESS = {River Edge, NJ}, YEAR = {1991}, MRCLASS = {57M07 (53C23)}, MRNUMBER = {93h:57002}, MRREVIEWER = {Tadeusz Januszkiewicz}, } @article {Bowditch(1998cut), AUTHOR = {Bowditch, Brian H.}, TITLE = {Cut points and canonical splittings of hyperbolic groups}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {180}, YEAR = {1998}, NUMBER = {2}, PAGES = {145--186}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {20F32 (20E06 20E08 57M07)}, MRNUMBER = {MR1638764 (99g:20069)}, MRREVIEWER = {Eric M. Freden}, } @incollection {Bowditch(1998boundaries), AUTHOR = {Bowditch, B. H.}, TITLE = {Boundaries of strongly accessible hyperbolic groups}, BOOKTITLE = {The {E}pstein birthday schrift}, SERIES = {Geom. Topol. Monogr.}, VOLUME = {1}, PAGES = {51--97}, PUBLISHER = {Geom. Topol. Publ., Coventry}, YEAR = {1998}, MRCLASS = {20F67 (20E08 57M07)}, MRNUMBER = {1668331}, MRREVIEWER = {John Meier}, DOI = {10.2140/gtm.1998.1.51}, URL = {http://dx.doi.org/10.2140/gtm.1998.1.51}, } @article {Bowditch(1998characterization), AUTHOR = {Bowditch, Brian H.}, TITLE = {A topological characterisation of hyperbolic groups}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {11}, YEAR = {1998}, NUMBER = {3}, PAGES = {643--667}, ISSN = {0894-0347}, MRCLASS = {20F32 (53C23 54H15 57S30)}, MRNUMBER = {1602069}, MRREVIEWER = {Jane Gilman}, DOI = {10.1090/S0894-0347-98-00264-1}, URL = {http://dx.doi.org/10.1090/S0894-0347-98-00264-1}, } @article {Bowditch(1999), AUTHOR = {Bowditch, B. H.}, TITLE = {Boundaries of geometrically finite groups}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {230}, YEAR = {1999}, NUMBER = {3}, PAGES = {509--527}, ISSN = {0025-5874}, MRCLASS = {20F65 (57M07)}, MRNUMBER = {1680044}, MRREVIEWER = {Athanase Papadopoulos}, DOI = {10.1007/PL00004703}, URL = {http://dx.doi.org/10.1007/PL00004703}, } @article {Bowditch(2004), AUTHOR = {Bowditch, Brian H.}, TITLE = {Planar groups and the {S}eifert conjecture}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {576}, YEAR = {2004}, PAGES = {11--62}, ISSN = {0075-4102}, MRCLASS = {57P10 (20F65 57M05)}, MRNUMBER = {2099199}, MRREVIEWER = {Sylvain Maillot}, DOI = {10.1515/crll.2004.084}, URL = {http://dx.doi.org/10.1515/crll.2004.084}, } @article {Bowditch(2012), AUTHOR = {Bowditch, B. H.}, TITLE = {Relatively hyperbolic groups}, JOURNAL = {Internat. J. Algebra Comput.}, FJOURNAL = {International Journal of Algebra and Computation}, VOLUME = {22}, YEAR = {2012}, NUMBER = {3}, PAGES = {1250016, 66}, ISSN = {0218-1967}, MRCLASS = {20F67 (20F65)}, MRNUMBER = {2922380}, MRREVIEWER = {R{\'e}mi Bernard Coulon}, DOI = {10.1142/S0218196712500166}, URL = {http://dx.doi.org/10.1142/S0218196712500166}, } @article {Bowditch-Maclachlan-Reid(1995)(1991), AUTHOR = {Bowditch, B. H. and Maclachlan, C. and Reid, A. W.}, TITLE = {Arithmetic hyperbolic surface bundles}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {302}, YEAR = {1995}, NUMBER = {1}, PAGES = {31--60}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {57M50}, MRNUMBER = {96a:57032}, MRREVIEWER = {Colin C. Adams}, } @incollection {Boyd(2002Mahler), AUTHOR = {Boyd, David W.}, TITLE = {Mahler's measure and invariants of hyperbolic manifolds}, BOOKTITLE = {Number theory for the millennium, {I} ({U}rbana, {IL}, 2000)}, PAGES = {127--143}, PUBLISHER = {A K Peters}, ADDRESS = {Natick, MA}, YEAR = {2002}, MRCLASS = {11G50 (57M50)}, MRNUMBER = {1956222 (2004a:11054)}, MRREVIEWER = {Colin C. Adams}, } @article {Boyd-Rodrigues-Villegas(2002), AUTHOR = {Boyd, David W. and Rodriguez-Villegas, Fernando}, TITLE = {Mahler's measure and the dilogarithm. {I}}, JOURNAL = {Canad. J. Math.}, FJOURNAL = {Canadian Journal of Mathematics. Journal Canadien de Math\'ematiques}, VOLUME = {54}, YEAR = {2002}, NUMBER = {3}, PAGES = {468--492}, ISSN = {0008-414X}, CODEN = {CJMAAB}, MRCLASS = {11G55 (11R09 11R42 19F27)}, MRNUMBER = {1900760 (2003d:11095)}, MRREVIEWER = {Jan Nekov{\'a}{\v{r}}}, DOI = {10.4153/CJM-2002-016-9}, URL = {http://dx.doi.org/10.4153/CJM-2002-016-9}, } @article {Boyd(2002problem), AUTHOR = {Boyd, David W.}, TITLE = {On a problem of {B}yrnes concerning polynomials with restricted coefficients. {II}}, JOURNAL = {Math. Comp.}, FJOURNAL = {Mathematics of Computation}, VOLUME = {71}, YEAR = {2002}, NUMBER = {239}, PAGES = {1205--1217}, ISSN = {0025-5718}, CODEN = {MCMPAF}, MRCLASS = {11C08 (12D10 94A99)}, MRNUMBER = {1898751 (2003d:11035)}, MRREVIEWER = {Maurice Mignotte}, DOI = {10.1090/S0025-5718-01-01360-6}, URL = {http://dx.doi.org/10.1090/S0025-5718-01-01360-6}, } @incollection {Boyd(1999), AUTHOR = {Boyd, David W.}, TITLE = {Mahler's measure and special values of {$L$}-functions---some conjectures}, BOOKTITLE = {Number theory in progress, {V}ol. 1 ({Z}akopane-{K}o\'scielisko, 1997)}, PAGES = {27--34}, PUBLISHER = {de Gruyter}, ADDRESS = {Berlin}, YEAR = {1999}, MRCLASS = {11R06 (11M20)}, MRNUMBER = {1689496 (2000f:11139)}, MRREVIEWER = {Art{\=u}ras Dubickas}, } @article {Boyd(1998l-functions), AUTHOR = {Boyd, David W.}, TITLE = {Mahler's measure and special values of {$L$}-functions}, JOURNAL = {Experiment. Math.}, FJOURNAL = {Experimental Mathematics}, VOLUME = {7}, YEAR = {1998}, NUMBER = {1}, PAGES = {37--82}, ISSN = {1058-6458}, MRCLASS = {11G40 (11R06 11Y35)}, MRNUMBER = {1618282 (99d:11070)}, MRREVIEWER = {Jan Nekov{\'a}{\v{r}}}, URL = {http://projecteuclid.org/getRecord?id=euclid.em/1047674271}, } @article {Boyd(1998approximation), AUTHOR = {Boyd, David W.}, TITLE = {Uniform approximation to {M}ahler's measure in several variables}, JOURNAL = {Canad. Math. Bull.}, FJOURNAL = {Canadian Mathematical Bulletin. Bulletin Canadien de Math\'ematiques}, VOLUME = {41}, YEAR = {1998}, NUMBER = {1}, PAGES = {125--128}, ISSN = {0008-4395}, CODEN = {CMBUA3}, MRCLASS = {11R09 (11C08)}, MRNUMBER = {1618904 (99e:11134)}, MRREVIEWER = {Christopher Smyth}, DOI = {10.4153/CMB-1998-019-6}, URL = {http://dx.doi.org/10.4153/CMB-1998-019-6}, } @incollection {Boyd(1997Salem), AUTHOR = {Boyd, David W.}, TITLE = {The beta expansion for {S}alem numbers}, BOOKTITLE = {Organic mathematics ({B}urnaby, {BC}, 1995)}, SERIES = {CMS Conf. Proc.}, VOLUME = {20}, PAGES = {117--131}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1997}, MRCLASS = {11R06 (11K16)}, MRNUMBER = {1483916 (98k:11146)}, MRREVIEWER = {Christopher Smyth}, } @article {Boyd(1997Byrnes), AUTHOR = {Boyd, David W.}, TITLE = {On a problem of {B}yrnes concerning polynomials with restricted coefficients}, JOURNAL = {Math. Comp.}, FJOURNAL = {Mathematics of Computation}, VOLUME = {66}, YEAR = {1997}, NUMBER = {220}, PAGES = {1697--1703}, ISSN = {0025-5718}, CODEN = {MCMPAF}, MRCLASS = {11C08 (11Y99 12D10 94A99)}, MRNUMBER = {1433263 (98a:11033)}, MRREVIEWER = {Maurice Mignotte}, DOI = {10.1090/S0025-5718-97-00892-2}, URL = {http://dx.doi.org/10.1090/S0025-5718-97-00892-2}, } @article {Boyd(1996Salem), AUTHOR = {Boyd, David W.}, TITLE = {On the beta expansion for {S}alem numbers of degree {$6$}}, JOURNAL = {Math. Comp.}, FJOURNAL = {Mathematics of Computation}, VOLUME = {65}, YEAR = {1996}, NUMBER = {214}, PAGES = {861--875, $S$29--$S$31}, ISSN = {0025-5718}, CODEN = {MCMPAF}, MRCLASS = {11K16 (11R06)}, MRNUMBER = {1333306 (96g:11091)}, MRREVIEWER = {Christopher Smyth}, DOI = {10.1090/S0025-5718-96-00700-4}, URL = {http://dx.doi.org/10.1090/S0025-5718-96-00700-4}, } @article {Boyd(1996Pisot), AUTHOR = {Boyd, David W.}, TITLE = {On beta expansions for {P}isot numbers}, JOURNAL = {Math. Comp.}, FJOURNAL = {Mathematics of Computation}, VOLUME = {65}, YEAR = {1996}, NUMBER = {214}, PAGES = {841--860}, ISSN = {0025-5718}, CODEN = {MCMPAF}, MRCLASS = {11K16 (11R06)}, MRNUMBER = {1325863 (96g:11090)}, MRREVIEWER = {Daniel Berend}, DOI = {10.1090/S0025-5718-96-00693-X}, URL = {http://dx.doi.org/10.1090/S0025-5718-96-00693-X}, } @article {Boyd(1995), AUTHOR = {Bertin, M.-J. and Boyd, David W.}, TITLE = {A characterization of two related classes of {S}alem numbers}, JOURNAL = {J. Number Theory}, FJOURNAL = {Journal of Number Theory}, VOLUME = {50}, YEAR = {1995}, NUMBER = {2}, PAGES = {309--317}, ISSN = {0022-314X}, CODEN = {JNUTA9}, MRCLASS = {11R06}, MRNUMBER = {1316825 (96b:11139)}, MRREVIEWER = {Christopher Smyth}, DOI = {10.1006/jnth.1995.1024}, URL = {http://dx.doi.org/10.1006/jnth.1995.1024}, } @article {Boyd(1994sharp), AUTHOR = {Boyd, David W.}, TITLE = {Sharp inequalities for the product of polynomials}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {26}, YEAR = {1994}, NUMBER = {5}, PAGES = {449--454}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {30C10 (11C08)}, MRNUMBER = {1308361 (95m:30008)}, MRREVIEWER = {Thomas McCoy}, DOI = {10.1112/blms/26.5.449}, URL = {http://dx.doi.org/10.1112/blms/26.5.449}, } @article {Boyd(1994irreducible), AUTHOR = {Boyd, David W.}, TITLE = {Irreducible polynomials with many roots of maximal modulus}, JOURNAL = {Acta Arith.}, FJOURNAL = {Acta Arithmetica}, VOLUME = {68}, YEAR = {1994}, NUMBER = {1}, PAGES = {85--88}, ISSN = {0065-1036}, CODEN = {AARIA9}, MRCLASS = {11R09 (11C08 11R04)}, MRNUMBER = {1302509 (95i:11119)}, MRREVIEWER = {Christopher Smyth}, } @incollection {Boyd(1994Large), AUTHOR = {Boyd, David W.}, TITLE = {Large factors of small polynomials}, BOOKTITLE = {The {R}ademacher legacy to mathematics ({U}niversity {P}ark, {PA}, 1992)}, SERIES = {Contemp. Math.}, VOLUME = {166}, PAGES = {301--308}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1994}, MRCLASS = {11C08 (12D05 30C10)}, MRNUMBER = {1284070 (95e:11034)}, MRREVIEWER = {Maurice Mignotte}, DOI = {10.1090/conm/166/01625}, URL = {http://dx.doi.org/10.1090/conm/166/01625}, } @incollection {Boyd(1993), AUTHOR = {Boyd, David W.}, TITLE = {Linear recurrence relations for some generalized {P}isot sequences}, BOOKTITLE = {Advances in number theory ({K}ingston, {ON}, 1991)}, SERIES = {Oxford Sci. Publ.}, PAGES = {333--340}, PUBLISHER = {Oxford Univ. Press}, ADDRESS = {New York}, YEAR = {1993}, MRCLASS = {11B37 (11R06 11Y55)}, MRNUMBER = {1368431 (96i:11017)}, MRREVIEWER = {Jeffrey O. Shallit}, } @incollection {Boyd(1986), AUTHOR = {Boyd, David W.}, TITLE = {Inverse problems for {M}ahler's measure}, BOOKTITLE = {Diophantine analysis ({K}ensington, 1985)}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {109}, PAGES = {147--158}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1986}, MRCLASS = {11K60 (11R04)}, MRNUMBER = {874125 (88b:11051)}, MRREVIEWER = {Marthe Grandet}, } @article {Boyd(1981speculations), AUTHOR = {Boyd, David W.}, TITLE = {Speculations concerning the range of {M}ahler's measure}, JOURNAL = {Canad. Math. Bull.}, FJOURNAL = {Canadian Mathematical Bulletin}, VOLUME = {24}, YEAR = {1981}, NUMBER = {4}, PAGES = {453--469}, ISSN = {0008-4395}, CODEN = {CMBUA3}, MRCLASS = {12A15}, MRNUMBER = {644535 (83h:12002)}, MRREVIEWER = {Marie-Jos{\'e} Bertin}, DOI = {10.4153/CMB-1981-069-5}, URL = {http://dx.doi.org/10.4153/CMB-1981-069-5}, } @article {Boyd(1981Kronecker), AUTHOR = {Boyd, David W.}, TITLE = {Kronecker's theorem and {L}ehmer's problem for polynomials in several variables}, JOURNAL = {J. Number Theory}, FJOURNAL = {Journal of Number Theory}, VOLUME = {13}, YEAR = {1981}, NUMBER = {1}, PAGES = {116--121}, ISSN = {0022-314X}, CODEN = {JNUTA9}, MRCLASS = {10F40 (12A20)}, MRNUMBER = {602452 (82e:10066)}, MRREVIEWER = {Christopher Smyth}, DOI = {10.1016/0022-314X(81)90033-0}, URL = {http://dx.doi.org/10.1016/0022-314X(81)90033-0}, } @article {Boyd(1980), AUTHOR = {Boyd, David W.}, TITLE = {Reciprocal polynomials having small measure}, JOURNAL = {Math. Comp.}, FJOURNAL = {Mathematics of Computation}, VOLUME = {35}, YEAR = {1980}, NUMBER = {152}, PAGES = {1361--1377}, ISSN = {0025-5718}, CODEN = {MCMPAF}, MRCLASS = {30C15 (12-04 26C05 65D20)}, MRNUMBER = {583514 (82a:30005)}, MRREVIEWER = {M. Marden}, DOI = {10.2307/2006402}, URL = {http://dx.doi.org/10.2307/2006402}, } @article {Boyd(1977), AUTHOR = {Boyd, David W.}, TITLE = {Small {S}alem numbers}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {44}, YEAR = {1977}, NUMBER = {2}, PAGES = {315--328}, ISSN = {0012-7094}, MRCLASS = {12A15}, MRNUMBER = {0453692 (56 \#11952)}, MRREVIEWER = {D. G. Cantor}, } @article {Boyd-Keswani-Raeburn(1993), AUTHOR = {Boyd, Sarah and Keswani, Navin and Raeburn, Iain}, TITLE = {Faithful representations of crossed products by endomorphisms}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {118}, YEAR = {1993}, NUMBER = {2}, PAGES = {427--436}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {46L55}, MRNUMBER = {93g:46066}, MRREVIEWER = {John Quigg}, } @article {Boyd-Mossinghoff(2005), AUTHOR = {Boyd, David W. and Mossinghoff, Michael J.}, TITLE = {Small limit points of {M}ahler's measure}, JOURNAL = {Experiment. Math.}, FJOURNAL = {Experimental Mathematics}, VOLUME = {14}, YEAR = {2005}, NUMBER = {4}, PAGES = {403--414}, ISSN = {1058-6458}, MRCLASS = {11R09 (11C08 11Y35)}, MRNUMBER = {2193803 (2006g:11216)}, MRREVIEWER = {Art{\=u}ras Dubickas}, URL = {http://projecteuclid.org/getRecord?id=euclid.em/1136926971}, } @incollection {Boyd-Parry(1990), AUTHOR = {Boyd, David W. and Parry, Walter}, TITLE = {Limit points of the {S}alem numbers}, BOOKTITLE = {Number theory ({B}anff, {AB}, 1988)}, PAGES = {27--35}, PUBLISHER = {de Gruyter}, ADDRESS = {Berlin}, YEAR = {1990}, MRCLASS = {11R06}, MRNUMBER = {1106648 (92i:11114)}, MRREVIEWER = {Christopher Smyth}, } @article {Boyer-Gordon_Zhang(2014), AUTHOR = {Boyer, Steven and Gordon, Cameron McA. and Zhang, Xingru}, TITLE = {Dehn fillings of knot manifolds containing essential once-punctured tori}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {366}, YEAR = {2014}, NUMBER = {1}, PAGES = {341--393}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57-XX}, MRNUMBER = {3118399}, DOI = {10.1090/S0002-9947-2013-05837-0}, URL = {http://dx.doi.org/10.1090/S0002-9947-2013-05837-0}, } @article {Boyer-Gordon_Zhang(2012), AUTHOR = {Boyer, Steven and Gordon, Cameron McA. and Zhang, Xingru}, TITLE = {Characteristic submanifold theory and toroidal {D}ehn filling}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {230}, YEAR = {2012}, NUMBER = {4-6}, PAGES = {1673--1737}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {57M50 (57M25)}, MRNUMBER = {2927352}, MRREVIEWER = {Bruno P. Zimmermann}, DOI = {10.1016/j.aim.2012.03.029}, URL = {http://dx.doi.org/10.1016/j.aim.2012.03.029}, } @article {Boyer-Gordon_Zhang(2009), AUTHOR = {Boyer, Steven and Gordon, Cameron McA. and Zhang, Xingru}, TITLE = {Reducible and finite {D}ehn fillings}, JOURNAL = {J. Lond. Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {79}, YEAR = {2009}, NUMBER = {1}, PAGES = {72--84}, ISSN = {0024-6107}, MRCLASS = {57M50}, MRNUMBER = {2472134 (2009i:57036)}, MRREVIEWER = {Bruno Zimmermann}, DOI = {10.1112/jlms/jdn063}, URL = {http://dx.doi.org/10.1112/jlms/jdn063}, } @article {Boyer-Gordon_Zhang(2001), AUTHOR = {Boyer, S. and Gordon, C. McA. and Zhang, X.}, TITLE = {Dehn fillings of large hyperbolic 3-manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {58}, YEAR = {2001}, NUMBER = {2}, PAGES = {263--308}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57M50}, MRNUMBER = {1913944 (2003j:57025)}, MRREVIEWER = {Mario Eudave Mu{\~n}oz}, URL = {http://projecteuclid.org/getRecord?id=euclid.jdg/1090348327}, } @article {Boyer-Hurtubise-Mann-Milgram(1993), AUTHOR = {Boyer, C. P. and Hurtubise, J. C. and Mann, B. M. and Milgram, R. J.}, TITLE = {The topology of instanton moduli spaces. {I}. {T}he {A}tiyah-{J}ones conjecture}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {137}, YEAR = {1993}, NUMBER = {3}, PAGES = {561--609}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {55P35 (14D20 32G13 58D27)}, MRNUMBER = {94h:55010}, MRREVIEWER = {Martin A. Guest}, } @article {Boyer-Zhang(1994), AUTHOR = {Boyer, S. and Zhang, X.}, TITLE = {Exceptional surgery on knots}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {31}, YEAR = {1994}, NUMBER = {2}, PAGES = {197--203}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {57N10 (57M25)}, MRNUMBER = {95f:57035}, MRREVIEWER = {Sergej V. Matveev}, } @article {Brady+Crisp(2007), AUTHOR = {Brady, Noel and Crisp, John}, TITLE = {{$\rm CAT(0)$} and {$\rm CAT(-1)$} dimensions of torsion free hyperbolic groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {82}, YEAR = {2007}, NUMBER = {1}, PAGES = {61--85}, ISSN = {0010-2571}, MRCLASS = {57Mxx (53Cxx)}, MRNUMBER = {MR2296058}, } @article {Brady-Leary-Nucinkis(2001), AUTHOR = {Brady, Noel and Leary, Ian J. and Nucinkis, Brita E. A.}, TITLE = {On algebraic and geometric dimensions for groups with torsion}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {64}, YEAR = {2001}, NUMBER = {2}, PAGES = {489--500}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {57M20 (20J05 55N25)}, MRNUMBER = {2002h:57007}, MRREVIEWER = {Nobuaki Yagita}, } @book {Brandenburg(1980), AUTHOR = {Brandenburg, Joseph Edward}, TITLE = {T{HE} {WHITEHEAD} {CONJECTURE} {AND} {ASPHERICAL}, {COCKROFT} {AND} {MINIMAL} {COMPLEXES}}, NOTE = {Thesis (Ph.D.)--University of Oregon}, PUBLISHER = {ProQuest LLC, Ann Arbor, MI}, YEAR = {1980}, PAGES = {90}, MRCLASS = {Thesis}, MRNUMBER = {2630929}, URL = {http://gateway.proquest.com/openurl?url_ver=Z39.88-2004&rft_val_fmt=info:ofi/fmt:kev:mtx:dissertation&res_dat=xri:pqdiss&rft_dat=xri:pqdiss:8101811}, } @article {Brandenburg-Dyer(1981), AUTHOR = {Brandenburg, Joe and Dyer, Micheal}, TITLE = {On {J}. {H}. {C}. {W}hitehead's aspherical question. {I}}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {56}, YEAR = {1981}, NUMBER = {3}, PAGES = {431--446}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57M20}, MRNUMBER = {639360 (83d:57002)}, MRREVIEWER = {Johannes Huebschmann}, DOI = {10.1007/BF02566221}, URL = {http://dx.doi.org/10.1007/BF02566221}, } @incollection {Brandenburg-Dyer-Strebel(1983), AUTHOR = {Brandenburg, Joe and Dyer, Micheal and Strebel, Ralph}, TITLE = {On {J}. {H}. {C}. {W}hitehead's aspherical question. {II}}, BOOKTITLE = {Low-dimensional topology ({S}an {F}rancisco, {C}alif., 1981)}, SERIES = {Contemp. Math.}, VOLUME = {20}, PAGES = {65--78}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1983}, MRCLASS = {57M20}, MRNUMBER = {718134 (85g:57002)}, MRREVIEWER = {Johannes Huebschmann}, DOI = {10.1090/conm/020/718134}, URL = {http://dx.doi.org/10.1090/conm/020/718134}, } @Article {Branson-Gilkey(1990), AUTHOR = {Branson, Thomas P. and Gilkey, Peter B.}, TITLE = {The asymptotics of the {L}aplacian on a manifold with boundary}, JOURNAL = {Comm. Partial Differential Equations}, FJOURNAL = {Communications in Partial Differential Equations}, VOLUME = {15}, YEAR = {1990}, NUMBER = {2}, PAGES = {245--272}, ISSN = {0360-5302}, CODEN = {CPDIDZ}, MRCLASS = {58G11 (35P20)}, MRNUMBER = {90m:58201}, MRREVIEWER = {Steven Rosenberg}, } @article {Branson-Gilkey(1994), AUTHOR = {Branson, Thomas P. and Gilkey, Peter B.}, TITLE = {The functional determinant of a four-dimensional boundary value problem}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {344}, YEAR = {1994}, NUMBER = {2}, PAGES = {479--531}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {58G26 (58G20)}, MRNUMBER = {94k:58155}, MRREVIEWER = {Paul C. Yang}, } @incollection {Branson-Gilkey-Oersted-Pierzchalski(1992a), AUTHOR = {Branson, Thomas P. and Gilkey, Peter B. and {\O}rsted, Bent and Pierzchalski, Antoni}, TITLE = {Heat equation asymptotics of a generalized {A}hlfors {L}aplacian on a manifold with boundary}, BOOKTITLE = {Operator calculus and spectral theory (Lambrecht, 1991)}, PAGES = {1--13}, PUBLISHER = {Birkh\"auser}, ADDRESS = {Basel}, YEAR = {1992}, MRCLASS = {58G11}, MRNUMBER = {94i:58192}, MRREVIEWER = {Friedbert Pr{\"u}fer}, } @article {Brasselet-Schuermann-Yokura(2006b), AUTHOR = {Brasselet, Jean-Paul and Sch{\"u}rmann, J{\"o}rg and Yokura, Shoji}, TITLE = {Classes de {H}irzebruch et classes de {C}hern motiviques}, JOURNAL = {C. R. Acad. Sci. Paris}, FJOURNAL = {Comptes Rendus Mathematiques}, VOLUME = {342}, YEAR = {2006}, NUMBER = {5}, PAGES = {325--328}, } @article {Brasselet-Schuermann-Yokura(2007a), AUTHOR = {Brasselet, Jean-Paul and Sch{\"u}rmann, J{\"o}rg and Yokura, Shoji}, TITLE = {On the uniqueness of bivariant {C}hern class and bivariant {R}iemann-{R}och transformations}, JOURNAL = {Adv. in Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {210}, YEAR = {2007}, NUMBER = {2}, PAGES = {797--812}, } @article {Brasselet-Schuermann-Yokura(2007b), AUTHOR = {Brasselet, Jean-Paul and Sch{\"u}rmann, J{\"o}rg and Yokura, Shoji}, TITLE = {On {G}rothendieck transformations in {F}ulton-{M}ac{P}herson's bivariant theory}, JOURNAL = {J. of Pure and Applied Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {211}, YEAR = {2007}, NUMBER = {3}, PAGES = {665--684}, } @article {Bratelli-Elliott-Kishimoto(1986), AUTHOR = {Bratteli, Ola and Elliott, George A. and Kishimoto, Akitaka}, TITLE = {The temperature state space of a {$C^\ast$}-dynamical system. {II}}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {123}, YEAR = {1986}, NUMBER = {2}, PAGES = {205--263}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {46L55 (22D25 82A15)}, MRNUMBER = {835762 (87j:46123)}, MRREVIEWER = {H. Araki}, DOI = {10.2307/1971271}, URL = {http://dx.doi.org/10.2307/1971271}, } @article {Bratteli-Elliott-Evans-Kishimoto(1991), AUTHOR = {Bratteli, Ola and Elliott, George A. and Evans, David E. and Kishimoto, Akitaka}, TITLE = {Noncommutative spheres. {I}}, JOURNAL = {Internat. J. Math.}, FJOURNAL = {International Journal of Mathematics}, VOLUME = {2}, YEAR = {1991}, NUMBER = {2}, PAGES = {139--166}, ISSN = {0129-167X}, MRCLASS = {58B30 (19B99 46L87)}, MRNUMBER = {92d:58008}, MRREVIEWER = {Palle E. T. Jorgensen}, } @article {Bratteli-Elliott-Evans-Kishimoto(1992), AUTHOR = {Bratteli, Ola and Elliott, George A. and Evans, David E. and Kishimoto, Akitaka}, TITLE = {Noncommutative spheres. {II}. {R}ational rotations}, JOURNAL = {J. Operator Theory}, FJOURNAL = {Journal of Operator Theory}, VOLUME = {27}, YEAR = {1992}, NUMBER = {1}, PAGES = {53--85}, ISSN = {0379-4024}, MRCLASS = {46L87 (17B37 46L35 46L55 58B30)}, MRNUMBER = {94j:46068}, MRREVIEWER = {Palle E. T. Jorgensen}, } @article {Bratteli-Kishimoto(1992), AUTHOR = {Bratteli, Ola and Kishimoto, Akitaka}, TITLE = {Noncommutative spheres. {III}. {I}rrational rotations}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {147}, YEAR = {1992}, NUMBER = {3}, PAGES = {605--624}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58B30 (19K14 46L87)}, MRNUMBER = {93g:58008}, MRREVIEWER = {Palle E. T. Jorgensen}, } @book {Bratteli-Robinson(1979), AUTHOR = {Bratteli, Ola and Robinson, Derek W.}, TITLE = {Operator algebras and quantum statistical mechanics. {V}ol. 1}, NOTE = {$C\sp{\ast} $- and $W\sp{\ast} $-algebras, algebras, symmetry groups, decomposition of states, Texts and Monographs in Physics}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1979}, PAGES = {xii+500}, ISBN = {0-387-09187-4}, MRCLASS = {46Lxx (81D99 81E05 82A15)}, MRNUMBER = {81a:46070}, MRREVIEWER = {H. Araki}, } @article {Bravermann(1996), AUTHOR = {Braverman, M.}, TITLE = {Witten deformation of analytic torsion and the spectral sequence of a filtration}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {6}, YEAR = {1996}, NUMBER = {1}, PAGES = {28--50}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G26}, MRNUMBER = {97d:58202}, MRREVIEWER = {Friedbert Pr{\"u}fer}, } @article {Braverman(1998), AUTHOR = {Braverman, Maxim}, TITLE = {On self-adjointness of a {S}chr\"odinger operator on differential forms}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {126}, YEAR = {1998}, NUMBER = {2}, PAGES = {617--623}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {58G03 (35J10 35P05)}, MRNUMBER = {98g:58163}, MRREVIEWER = {Friedbert Pr{\"u}fer}, } @article {Braverman(1999), AUTHOR = {Braverman, Maxim}, TITLE = {Holomorphic {M}orse inequalities and symplectic reduction}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {38}, YEAR = {1999}, NUMBER = {1}, PAGES = {71--78}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {58G10 (32L10 58F06)}, MRNUMBER = {99h:58178}, MRREVIEWER = {Kenji Tsuboi}, } @article {Braverman-Farber(1995b), AUTHOR = {Braverman, Maxim and Farber, Michael}, TITLE = {The {N}ovikov-{B}ott inequalities}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {321}, YEAR = {1995}, NUMBER = {7}, PAGES = {897--902}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {58G05 (58A10 58E05 58G25)}, MRNUMBER = {96i:58165}, MRREVIEWER = {Kefeng Liu}, } @article {Braverman-Farber(1996), AUTHOR = {Braverman, Maxim and Farber, Michael}, TITLE = {Novikov inequalities with symmetry}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {323}, YEAR = {1996}, NUMBER = {7}, PAGES = {793--798}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {57R70 (57R91 57S15)}, MRNUMBER = {97h:57056}, MRREVIEWER = {J. S. Joel}, } @article {Braverman-Farber(1997a), AUTHOR = {Braverman, Maxim and Farber, Michael}, TITLE = {Novikov type inequalities for differential forms with non-isolated zeros}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {122}, YEAR = {1997}, NUMBER = {2}, PAGES = {357--375}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {58G05 (58E05 58G25 58G26)}, MRNUMBER = {99b:58220}, MRREVIEWER = {Patrick T. McDonald}, } @article {Braverman-Farber(1997b), AUTHOR = {Braverman, Maxim and Farber, Michael}, TITLE = {Equivariant {N}ovikov inequalities}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {12}, YEAR = {1997}, NUMBER = {4}, PAGES = {293--318}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {57R70 (57R91 57S15)}, MRNUMBER = {98m:57043}, MRREVIEWER = {Serge L. Tabachnikov}, } @article {Braverman-Kappeler(2008), AUTHOR = {Braverman, Maxim and Kappeler, Thomas}, TITLE = {Refined analytic torsion}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {78}, YEAR = {2008}, NUMBER = {2}, PAGES = {193--267}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58J52 (58J28)}, MRNUMBER = {2394022 (2009a:58041)}, MRREVIEWER = {Stefan Haller}, URL = {http://projecteuclid.org/euclid.jdg/1203000267}, } @article {Braverman-Kazhdan(2016), AUTHOR = {Braverman, Alexander and Kazhdan, David}, TITLE = {Bernstein components via the {B}ernstein center}, JOURNAL = {Selecta Math. (N.S.)}, FJOURNAL = {Selecta Mathematica. New Series}, VOLUME = {22}, YEAR = {2016}, NUMBER = {4}, PAGES = {2313--2323}, ISSN = {1022-1824}, MRCLASS = {22E35 (20G25 22E50)}, MRNUMBER = {3573959}, DOI = {10.1007/s00029-016-0277-3}, URL = {https://doi.org/10.1007/s00029-016-0277-3}, } @book {Bredon(1967a), AUTHOR = {Bredon, Glen E.}, TITLE = {Equivariant cohomology theories}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1967}, PAGES = {vi+64 pp. (not consecutively paged)}, MRCLASS = {55.40 (22.00)}, MRNUMBER = {35 \#4914}, MRREVIEWER = {N. Stein}, } @book {Bredon(1967b), AUTHOR = {Bredon, Glen E.}, TITLE = {Sheaf theory}, PUBLISHER = {McGraw-Hill Book Co.}, ADDRESS = {New York}, YEAR = {1967}, PAGES = {xi+272}, MRCLASS = {55.32 (18.00)}, MRNUMBER = {36 \#4552}, MRREVIEWER = {J. W. Gray}, } @incollection {Bredon(1968), AUTHOR = {Bredon, Glen E.}, TITLE = {Cohomological aspects of transformation groups}, BOOKTITLE = {Proc. {C}onf. on {T}ransformation {G}roups ({N}ew {O}rleans, {L}a., 1967)}, PAGES = {245--280}, PUBLISHER = {Springer}, ADDRESS = {New York}, YEAR = {1968}, MRCLASS = {55.36 (22.00)}, MRNUMBER = {0244990 (39 \#6303)}, MRREVIEWER = {P. S. Mostert}, } @book {Bredon(1972), AUTHOR = {Bredon, Glen E.}, TITLE = {Introduction to compact transformation groups}, NOTE = {Pure and Applied Mathematics, Vol. 46}, PUBLISHER = {Academic Press}, ADDRESS = {New York}, YEAR = {1972}, PAGES = {xiii+459}, MRCLASS = {57E15}, MRNUMBER = {54 \#1265}, MRREVIEWER = {P. Y. Wang}, } @book {Bredon(1997), AUTHOR = {Bredon, Glen E.}, TITLE = {Sheaf theory}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1997}, PAGES = {xii+502}, ISBN = {0-387-94905-4}, MRCLASS = {55N30 (18F20 54B40 55-02)}, MRNUMBER = {98g:55005}, } @book {Bredon(1997a), AUTHOR = {Bredon, Glen E.}, TITLE = {Topology and geometry}, NOTE = {Corrected third printing of the 1993 original}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1997}, PAGES = {xiv+557}, ISBN = {0-387-97926-3}, MRCLASS = {55-01 (54-01 57-01)}, MRNUMBER = {2000b:55001}, } @article {Brendle-Schoen(2009), AUTHOR = {Brendle, Simon and Schoen, Richard}, TITLE = {Manifolds with {$1/4$}-pinched curvature are space forms}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {22}, YEAR = {2009}, NUMBER = {1}, PAGES = {287--307}, ISSN = {0894-0347}, MRCLASS = {53C20 (53C44)}, MRNUMBER = {2449060}, MRREVIEWER = {Fr\'{e}d\'{e}ric Robert}, DOI = {10.1090/S0894-0347-08-00613-9}, URL = {https://doi.org/10.1090/S0894-0347-08-00613-9}, } @article {Breuillard-Gelander(2008), AUTHOR = {Breuillard, E. and Gelander, T.}, TITLE = {Uniform independence in linear groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {173}, YEAR = {2008}, NUMBER = {2}, PAGES = {225--263}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20G30 (20F16 20F65 20G25 22E40)}, MRNUMBER = {2415307 (2009j:20068)}, MRREVIEWER = {Herbert Abels}, DOI = {10.1007/s00222-007-0101-y}, URL = {http://dx.doi.org/10.1007/s00222-007-0101-y}, } @article {Breuillard-Gelander(2007), AUTHOR = {Breuillard, E. and Gelander, T.}, TITLE = {A topological {T}its alternative}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {166}, YEAR = {2007}, NUMBER = {2}, PAGES = {427--474}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {20G25 (22E35 37C85 43A07 57R30)}, MRNUMBER = {2373146 (2009a:20077)}, MRREVIEWER = {Herbert Abels}, DOI = {10.4007/annals.2007.166.427}, URL = {http://dx.doi.org/10.4007/annals.2007.166.427}, } @article {Breuillard-Gelander(2005), AUTHOR = {Breuillard, Emmanuel and Gelander, Tsachik}, TITLE = {Cheeger constant and algebraic entropy of linear groups}, JOURNAL = {Int. Math. Res. Not.}, FJOURNAL = {International Mathematics Research Notices}, YEAR = {2005}, VOLUME = {56}, PAGES = {3511--3523}, ISSN = {1073-7928}, MRCLASS = {20F65 (20G30)}, MRNUMBER = {2200587 (2006m:20061)}, MRREVIEWER = {Ralf Gramlich}, DOI = {10.1155/IMRN.2005.3511}, URL = {http://dx.doi.org/10.1155/IMRN.2005.3511}, } @article {Breuillard-Gelander(2003), AUTHOR = {Breuillard, E. and Gelander, T.}, TITLE = {On dense free subgroups of {L}ie groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {261}, YEAR = {2003}, NUMBER = {2}, PAGES = {448--467}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {22E15}, MRNUMBER = {1966638 (2004h:22005)}, MRREVIEWER = {Alexander Lubotzky}, DOI = {10.1016/S0021-8693(02)00675-0}, URL = {http://dx.doi.org/10.1016/S0021-8693(02)00675-0}, } @article {Breuillard-Gelander-Souto-Storm(2006), AUTHOR = {Breuillard, Emmanuel and Gelander, Tsachik and Souto, Juan and Storm, Peter}, TITLE = {Dense embeddings of surface groups}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {10}, YEAR = {2006}, PAGES = {1373--1389}, ISSN = {1465-3060}, MRCLASS = {22E40 (20H10 22E15)}, MRNUMBER = {2255501 (2008b:22007)}, MRREVIEWER = {Jean-Fran{\c{c}}ois Lafont}, DOI = {10.2140/gt.2006.10.1373}, URL = {http://dx.doi.org/10.2140/gt.2006.10.1373}, } @article {Brick(1993), AUTHOR = {Brick, Stephen G.}, TITLE = {Quasi-isometries and ends of groups}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {86}, YEAR = {1993}, NUMBER = {1}, PAGES = {23--33}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20F32 (57M07)}, MRNUMBER = {MR1213151 (94b:20043)}, MRREVIEWER = {Michael L. Mihalik}, } @article {Brick-Mihalik(1994), AUTHOR = {Brick, S. G. and Mihalik, M. L.}, TITLE = {Group extensions are quasi-simply-filtrated}, JOURNAL = {Bull. Austral. Math. Soc.}, FJOURNAL = {Bulletin of the Australian Mathematical Society}, VOLUME = {50}, YEAR = {1994}, NUMBER = {1}, PAGES = {21--27}, ISSN = {0004-9727}, CODEN = {ALNBAB}, MRCLASS = {20F32 (20E22)}, MRNUMBER = {95d:20064}, MRREVIEWER = {John Meier}, } @incollection {Bridson(2014), AUTHOR = {Bridson, Martin R.}, TITLE = {Cube complexes, subgroups of mapping class groups, and nilpotent genus}, BOOKTITLE = {Geometric group theory}, SERIES = {IAS/Park City Math. Ser.}, VOLUME = {21}, PAGES = {379--399}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2014}, MRCLASS = {20F65 (20F10 57M60)}, MRNUMBER = {3329733}, MRREVIEWER = {Sebastian Wolfgang Hensel}, } @article {Bridson(2013), AUTHOR = {Bridson, Martin R.}, TITLE = {On the subgroups of right-angled {A}rtin groups and mapping class groups}, JOURNAL = {Math. Res. Lett.}, FJOURNAL = {Mathematical Research Letters}, VOLUME = {20}, YEAR = {2013}, NUMBER = {2}, PAGES = {203--212}, ISSN = {1073-2780}, MRCLASS = {20F65 (20F10 53C24 57S25)}, MRNUMBER = {3151642}, MRREVIEWER = {Martin Edjvet}, DOI = {10.4310/MRL.2013.v20.n2.a1}, URL = {http://dx.doi.org/10.4310/MRL.2013.v20.n2.a1}, } @article {Bridson(2012), AUTHOR = {Bridson, Martin R.}, TITLE = {On the dimension of {CAT}(0) spaces where mapping class groups act}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {673}, YEAR = {2012}, PAGES = {55--68}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {53C23 (20F67)}, MRNUMBER = {2999128}, MRREVIEWER = {Sylvain Maillot}, } @article {Bridson(2011rhombic), AUTHOR = {Bridson, Martin R.}, TITLE = {The rhombic dodecahedron and semisimple actions of {${\rm Aut}(F_n)$} on {${\rm CAT}(0)$} spaces}, JOURNAL = {Fund. Math.}, FJOURNAL = {Fundamenta Mathematicae}, VOLUME = {214}, YEAR = {2011}, NUMBER = {1}, PAGES = {13--25}, ISSN = {0016-2736}, MRCLASS = {20F65 (20E36)}, MRNUMBER = {2845631 (2012h:20092)}, MRREVIEWER = {Thomas Koberda}, DOI = {10.4064/fm214-1-2}, URL = {http://dx.doi.org/10.4064/fm214-1-2}, } @article {Bridson(2011decision), AUTHOR = {Bridson, Martin R.}, TITLE = {Decision problems and profinite completions of groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {326}, YEAR = {2011}, PAGES = {59--73}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20E18 (20F10)}, MRNUMBER = {2746052 (2012f:20086)}, DOI = {10.1016/j.jalgebra.2010.06.019}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2010.06.019}, } @article {Bridson(2010Schur), AUTHOR = {Bridson, Martin R.}, TITLE = {The {S}chur multiplier, profinite completions and decidability}, JOURNAL = {Bull. Lond. Math. Soc.}, FJOURNAL = {Bulletin of the London Mathematical Society}, VOLUME = {42}, YEAR = {2010}, NUMBER = {3}, PAGES = {412--416}, ISSN = {0024-6093}, MRCLASS = {20E18 (20F10)}, MRNUMBER = {2651935 (2011h:20053)}, MRREVIEWER = {Fausto De Mari}, DOI = {10.1112/blms/bdp133}, URL = {http://dx.doi.org/10.1112/blms/bdp133}, } @incollection {Bridson(2010semisimple), AUTHOR = {Bridson, Martin R.}, TITLE = {Semisimple actions of mapping class groups on {${\rm CAT}(0)$} spaces}, BOOKTITLE = {Geometry of {R}iemann surfaces}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {368}, PAGES = {1--14}, PUBLISHER = {Cambridge Univ. Press, Cambridge}, YEAR = {2010}, MRCLASS = {30F35 (20F65 30F60)}, MRNUMBER = {2665003 (2011i:30041)}, MRREVIEWER = {Anders Karlsson}, } @article {Bridson(2009), AUTHOR = {Bridson, Martin R.}, TITLE = {Direct factors of profinite completions and decidability}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {12}, YEAR = {2009}, NUMBER = {1}, PAGES = {151--156}, ISSN = {1433-5883}, CODEN = {JGTHFQ}, MRCLASS = {20E26 (20E18)}, MRNUMBER = {2488145 (2010c:20037)}, MRREVIEWER = {Thomas Weigel}, DOI = {10.1515/JGT.2008.067}, URL = {http://dx.doi.org/10.1515/JGT.2008.067}, } @incollection {Bridson(2008), AUTHOR = {Bridson, Martin R.}, TITLE = {A condition that prevents groups from acting nontrivially on trees}, BOOKTITLE = {The {Z}ieschang {G}edenkschrift}, SERIES = {Geom. Topol. Monogr.}, VOLUME = {14}, PAGES = {129--133}, PUBLISHER = {Geom. Topol. Publ., Coventry}, YEAR = {2008}, MRCLASS = {20E08 (20F65 57M07)}, MRNUMBER = {2484701 (2010a:20055)}, MRREVIEWER = {Gilbert Levitt}, DOI = {10.2140/gtm.2008.14.129}, URL = {http://dx.doi.org/10.2140/gtm.2008.14.129}, } @incollection {Bridson(2006ICM), AUTHOR = {Bridson, Martin R.}, TITLE = {Non-positive curvature and complexity for finitely presented groups}, BOOKTITLE = {International Congress of Mathematicians. Vol. II}, PAGES = {961--987}, PUBLISHER = {Eur. Math. Soc., Z\"urich}, YEAR = {2006}, MRCLASS = {20F65 (20F67)}, MRNUMBER = {MR2275631}, } @article {Bridson(2005), AUTHOR = {Bridson, Martin R.}, TITLE = {On the growth of groups and automorphisms}, JOURNAL = {Internat. J. Algebra Comput.}, FJOURNAL = {International Journal of Algebra and Computation}, VOLUME = {15}, YEAR = {2005}, NUMBER = {5-6}, PAGES = {869--874}, ISSN = {0218-1967}, MRCLASS = {20F05 (20E06 20F69)}, MRNUMBER = {2197810 (2007f:20061)}, DOI = {10.1142/S021819670500258X}, URL = {http://dx.doi.org/10.1142/S021819670500258X}, } @incollection {Bridson(2002), AUTHOR = {Bridson, Martin R.}, TITLE = {The geometry of the word problem}, BOOKTITLE = {Invitations to geometry and topology}, SERIES = {Oxf. Grad. Texts Math.}, VOLUME = {7}, PAGES = {29--91}, PUBLISHER = {Oxford Univ. Press, Oxford}, YEAR = {2002}, MRCLASS = {20F65 (20F10 49J05 57M07)}, MRNUMBER = {1967746 (2004g:20056)}, MRREVIEWER = {Ross Geoghegan}, } @article {Bridson(2000), AUTHOR = {Bridson, Martin R.}, TITLE = {Finiteness properties for subgroups of {${\rm GL}(n,\bold Z)$}}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {317}, YEAR = {2000}, NUMBER = {4}, PAGES = {629--633}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {20H25 (20C12)}, MRNUMBER = {1777113 (2001f:20112)}, MRREVIEWER = {Andy R. Magid}, DOI = {10.1007/PL00004417}, URL = {http://dx.doi.org/10.1007/PL00004417}, } @incollection {Bridson(1999), AUTHOR = {Bridson, Martin R.}, TITLE = {Non-positive curvature in group theory}, BOOKTITLE = {Groups {S}t. {A}ndrews 1997 in {B}ath, {I}}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {260}, PAGES = {124--175}, PUBLISHER = {Cambridge Univ. Press, Cambridge}, YEAR = {1999}, MRCLASS = {20F67 (20F55 53C23 53C45 57M07 57M20 57N10)}, MRNUMBER = {1676614 (2000h:20082)}, MRREVIEWER = {Athanase Papadopoulos}, DOI = {10.1007/978-3-662-12494-9}, URL = {http://dx.doi.org/10.1007/978-3-662-12494-9}, } @article {Bridson(1995), AUTHOR = {Bridson, Martin R.}, TITLE = {Optimal isoperimetric inequalities for abelian-by-free groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {34}, YEAR = {1995}, NUMBER = {3}, PAGES = {547--564}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {20F32 (20F10 57M07)}, MRNUMBER = {96h:20070}, MRREVIEWER = {Susan Hermiller}, } @article {Bridson-Burillo-Elder-Sunic(2012), AUTHOR = {Bridson, Martin R. and Burillo, Jos{\'e} and Elder, Murray and {\v{S}}uni{\'c}, Zoran}, TITLE = {On groups whose geodesic growth is polynomial}, JOURNAL = {Internat. J. Algebra Comput.}, FJOURNAL = {International Journal of Algebra and Computation}, VOLUME = {22}, YEAR = {2012}, NUMBER = {5}, PAGES = {1250048, 13}, ISSN = {0218-1967}, MRCLASS = {20F65}, MRNUMBER = {2949213}, MRREVIEWER = {Delaram Kahrobaei}, DOI = {10.1142/S0218196712500488}, URL = {http://dx.doi.org/10.1142/S0218196712500488}, } @article {Bridson-Conder-Reid(2016), AUTHOR = {Bridson, M. R. and Conder, M. D. E. and Reid, A. W.}, TITLE = {Determining {F}uchsian groups by their finite quotients}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {214}, YEAR = {2016}, NUMBER = {1}, PAGES = {1--41}, ISSN = {0021-2172}, MRCLASS = {20E26 (20E18 20F36 20F67 20H10 20J06 22E40 57M07)}, MRNUMBER = {3540604}, MRREVIEWER = {Matthew Stover}, DOI = {10.1007/s11856-016-1341-6}, URL = {https://doi.org/10.1007/s11856-016-1341-6}, } @article {Bridson-delaHarpe(2004), AUTHOR = {Bridson, Martin R. and de la Harpe, Pierre}, TITLE = {Mapping class groups and outer automorphism groups of free groups are {$C^*$}-simple}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {212}, YEAR = {2004}, NUMBER = {1}, PAGES = {195--205}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {46L55 (20F28)}, MRNUMBER = {2065242 (2005d:46142)}, MRREVIEWER = {Paul Jolissaint}, DOI = {10.1016/S0022-1236(03)00216-7}, URL = {http://dx.doi.org/10.1016/S0022-1236(03)00216-7}, } @article {Bridson-delaHarpe-Kleptsyn(2009), AUTHOR = {Bridson, Martin R. and de la Harpe, Pierre and Kleptsyn, Victor}, TITLE = {The {C}habauty space of closed subgroups of the three-dimensional {H}eisenberg group}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {240}, YEAR = {2009}, NUMBER = {1}, PAGES = {1--48}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {22D05 (22E25 22E40)}, MRNUMBER = {2485473 (2010a:22005)}, MRREVIEWER = {Alain Valette}, DOI = {10.2140/pjm.2009.240.1}, URL = {http://dx.doi.org/10.2140/pjm.2009.240.1}, } @article {Bridson-Gersten(1996), AUTHOR = {Bridson, M. R. and Gersten, S. M.}, TITLE = {The optimal isoperimetric inequality for torus bundles over the circle}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {47}, YEAR = {1996}, NUMBER = {185}, PAGES = {1--23}, ISSN = {0033-5606}, CODEN = {QJMAAT}, MRCLASS = {20F06 (20F16 57M07)}, MRNUMBER = {MR1380947 (97c:20047)}, MRREVIEWER = {Fr{\'e}d{\'e}ric Paulin}, } @article {Bridson-Groves(2010), AUTHOR = {Bridson, Martin R. and Groves, Daniel}, TITLE = {The quadratic isoperimetric inequality for mapping tori of free group automorphisms}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {203}, YEAR = {2010}, NUMBER = {955}, PAGES = {xii+152}, ISSN = {0065-9266}, CODEN = {MAMCAU}, ISBN = {978-0-8218-4631-5}, MRCLASS = {20F65 (20E36 20F06 57M07)}, MRNUMBER = {2590896 (2011g:20058)}, MRREVIEWER = {Ian M. Chiswell}, DOI = {10.1090/S0065-9266-09-00578-X}, URL = {http://dx.doi.org/10.1090/S0065-9266-09-00578-X}, } @article {Bridson-Groves-Hillman-Martin(2010), AUTHOR = {Bridson, Martin R. and Groves, Daniel and Hillman, Jonathan A. and Martin, Gaven J.}, TITLE = {Cofinitely {H}opfian groups, open mappings and knot complements}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {4}, YEAR = {2010}, NUMBER = {4}, PAGES = {693--707}, ISSN = {1661-7207}, MRCLASS = {20F65 (20E26 20F67 57M25)}, MRNUMBER = {2727659 (2011j:20103)}, MRREVIEWER = {Stephan Rosebrock}, DOI = {10.4171/GGD/101}, URL = {http://dx.doi.org/10.4171/GGD/101}, } @article {Bridson-Grunewald(2004), AUTHOR = {Bridson, Martin R. and Grunewald, Fritz J.}, TITLE = {Grothendieck's problems concerning profinite completions and representations of groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {160}, YEAR = {2004}, NUMBER = {1}, PAGES = {359--373}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {20E18 (20E26)}, MRNUMBER = {2119723 (2005k:20069)}, MRREVIEWER = {Jan-Christoph Schlage-Puchta}, DOI = {10.4007/annals.2004.160.359}, URL = {http://dx.doi.org/10.4007/annals.2004.160.359}, } @article {Bridson-Grunewald-Vogtmann(2014), AUTHOR = {Bridson, Martin R. and Grunewald, Fritz and Vogtmann, Karen}, TITLE = {Actions of arithmetic groups on homology spheres and acyclic homology manifolds}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {276}, YEAR = {2014}, NUMBER = {1-2}, PAGES = {387--395}, ISSN = {0025-5874}, MRCLASS = {57S25 (20F65 20G30)}, MRNUMBER = {3150210}, MRREVIEWER = {Bruno P. Zimmermann}, DOI = {10.1007/s00209-013-1205-2}, URL = {http://dx.doi.org/10.1007/s00209-013-1205-2}, } @book {Bridson-Haefliger(1999), AUTHOR = {Bridson, Martin R. and Haefliger, Andr{\'e}}, TITLE = {Metric spaces of non-positive curvature}, PUBLISHER = {Springer-Verlag}, NOTE = {Die Grundlehren der mathematischen Wissenschaften, Band 319}, ADDRESS = {Berlin}, YEAR = {1999}, PAGES = {xxii+643}, ISBN = {3-540-64324-9}, MRCLASS = {53C23 (20F65 53C70 57M07)}, MRNUMBER = {2000k:53038}, MRREVIEWER = {Athanase Papadopoulos}, } @article {Bridson-Howie(2013), AUTHOR = {Bridson, Martin R. and Howie, James and Miller, III, Charles F. and Short, Hamish}, TITLE = {On the finite presentation of subdirect products and the nature of residually free groups}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {135}, YEAR = {2013}, NUMBER = {4}, PAGES = {891--933}, ISSN = {0002-9327}, MRCLASS = {20E26}, MRNUMBER = {3086064}, MRREVIEWER = {Martin Edjvet}, DOI = {10.1353/ajm.2013.0036}, URL = {http://dx.doi.org/10.1353/ajm.2013.0036}, } @article {Bridson-Howie(2009), AUTHOR = {Bridson, Martin R. and Howie, James and Miller, III, Charles F. and Short, Hamish}, TITLE = {Subgroups of direct products of limit groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {170}, YEAR = {2009}, NUMBER = {3}, PAGES = {1447--1467}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {20F65 (20J05)}, MRNUMBER = {2600879 (2011h:20082)}, DOI = {10.4007/annals.2009.170.1447}, URL = {http://dx.doi.org/10.4007/annals.2009.170.1447}, } @article {Bridson-Howie(2007limit), AUTHOR = {Bridson, Martin R. and Howie, James}, TITLE = {Subgroups of direct products of two limit groups}, JOURNAL = {Math. Res. Lett.}, FJOURNAL = {Mathematical Research Letters}, VOLUME = {14}, YEAR = {2007}, NUMBER = {4}, PAGES = {547--558}, ISSN = {1073-2780}, MRCLASS = {20F65 (20E08 20F67)}, MRNUMBER = {2335982 (2008g:20092)}, MRREVIEWER = {Matt T. Clay}, DOI = {10.4310/MRL.2007.v14.n4.a1}, URL = {http://dx.doi.org/10.4310/MRL.2007.v14.n4.a1}, } @article {Bridson-Howie(2007free), AUTHOR = {Bridson, Martin R. and Howie, James}, TITLE = {Subgroups of direct products of elementarily free groups}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {17}, YEAR = {2007}, NUMBER = {2}, PAGES = {385--403}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {20F65 (20E08)}, MRNUMBER = {2322489 (2008f:20098)}, MRREVIEWER = {Piotr W. Nowak}, DOI = {10.1007/s00039-007-0600-4}, URL = {http://dx.doi.org/10.1007/s00039-007-0600-4}, } @article {Bridson-Howie(2007normalizers), AUTHOR = {Bridson, Martin R. and Howie, James}, TITLE = {Normalisers in limit groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {337}, YEAR = {2007}, NUMBER = {2}, PAGES = {385--394}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {20F65 (20E08 20F67)}, MRNUMBER = {2262789 (2007i:20067)}, MRREVIEWER = {Matt T. Clay}, DOI = {10.1007/s00208-006-0039-1}, URL = {http://dx.doi.org/10.1007/s00208-006-0039-1}, } @article {Bridson-Howie-Miller_short(2002), AUTHOR = {Bridson, Martin R. and Howie, James and Miller, III, Charles F. and Short, Hamish}, TITLE = {The subgroups of direct products of surface groups}, NOTE = {Dedicated to John Stallings on the occasion of his 65th birthday}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {92}, YEAR = {2002}, PAGES = {95--103}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20E07 (20F34 20J05 57M05)}, MRNUMBER = {1934013 (2004b:20038)}, MRREVIEWER = {Stephen J. Pride}, DOI = {10.1023/A:1019611419598}, URL = {http://dx.doi.org/10.1023/A:1019611419598}, } @article {Bridson-Kochloukova(2015), AUTHOR = {Bridson, Martin R. and Kochloukova, Dessislava H.}, TITLE = {The virtual first {B}etti number of soluble groups}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {274}, YEAR = {2015}, NUMBER = {2}, PAGES = {497--510}, ISSN = {0030-8730}, MRCLASS = {20Fxx (20J06)}, MRNUMBER = {3332913}, DOI = {10.2140/pjm.2015.274.497}, URL = {http://dx.doi.org/10.2140/pjm.2015.274.497}, } @article {Bridson-Kochloukova(2017), AUTHOR = {Bridson, Martin R. and Kochloukova, Dessislava H.}, TITLE = {Volume gradients and homology in towers of residually-free groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {367}, YEAR = {2017}, NUMBER = {3-4}, PAGES = {1007--1045}, ISSN = {0025-5831,1432-1807}, MRCLASS = {20J06 (20E07 20E08 20E26 55R35)}, MRNUMBER = {3623217}, MRREVIEWER = {Nansen\ Petrosyan}, DOI = {10.1007/s00208-016-1387-0}, URL = {https://doi.org/10.1007/s00208-016-1387-0}, } @article {Bridson-Kropholler(2015), AUTHOR = {Bridson, Martin R. and Kropholler, Peter H.}, TITLE = {Dimension of elementary amenable groups}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {699}, YEAR = {2015}, PAGES = {217--243}, ISSN = {0075-4102}, MRCLASS = {20J05 (20F19 43A45)}, MRNUMBER = {3305926}, MRREVIEWER = {D. F. Holt}, DOI = {10.1515/crelle-2013-0012}, URL = {http://dx.doi.org/10.1515/crelle-2013-0012}, } @article {Bridson-McReynolds-Reid-Spliler(2020), AUTHOR = {Bridson, M. R. and McReynolds, D. B. and Reid, A. W. and Spitler, R.}, TITLE = {Absolute profinite rigidity and hyperbolic geometry}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {192}, YEAR = {2020}, NUMBER = {3}, PAGES = {679--719}, ISSN = {0003-486X}, MRCLASS = {57M50 (11F06 20E18 20H10)}, MRNUMBER = {4172619}, DOI = {10.4007/annals.2020.192.3.1}, URL = {https://doi.org/10.4007/annals.2020.192.3.1}, } @article {Bridson-Miller(2009), AUTHOR = {Bridson, Martin R. and Miller, III, Charles F.}, TITLE = {Structure and finiteness properties of subdirect products of groups}, JOURNAL = {Proc. Lond. Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {98}, YEAR = {2009}, NUMBER = {3}, PAGES = {631--651}, ISSN = {0024-6115}, MRCLASS = {20F05 (20E06 20E07 20F10 20J05)}, MRNUMBER = {2500867 (2010g:20049)}, MRREVIEWER = {Ian M. Chiswell}, DOI = {10.1112/plms/pdn039}, URL = {http://dx.doi.org/10.1112/plms/pdn039}, } @article {Bridson-Miller(2004), AUTHOR = {Bridson, Martin R. and Miller, III, Charles F.}, TITLE = {Recognition of subgroups of direct products of hyperbolic groups}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {132}, YEAR = {2004}, NUMBER = {1}, PAGES = {59--65 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {20F10 (20F67)}, MRNUMBER = {MR2021248 (2004j:20068)}, MRREVIEWER = {Michel Coornaert}, } @article {Bridson-Reed(2015), AUTHOR = {Bridson, Martin R. and Reid, Alan W.}, TITLE = {Nilpotent completions of groups, {G}rothendieck pairs, and four problems of {B}aumslag}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2015}, NUMBER = {8}, PAGES = {2111--2140}, ISSN = {1073-7928}, MRCLASS = {20Fxx}, MRNUMBER = {3344664}, DOI = {10.1093/imrn/rnt353}, URL = {http://dx.doi.org/10.1093/imrn/rnt353}, } @article {Bridson-Reeves(2011), AUTHOR = {Bridson, Martin R. and Reeves, Lawrence}, TITLE = {On the algorithmic construction of classifying spaces and the isomorphism problem for biautomatic groups}, JOURNAL = {Sci. China Math.}, FJOURNAL = {Science China. Mathematics}, VOLUME = {54}, YEAR = {2011}, NUMBER = {8}, PAGES = {1533--1545}, ISSN = {1674-7283}, MRCLASS = {20F65 (20F67 57M07)}, MRNUMBER = {2824957 (2012h:20093)}, MRREVIEWER = {Vassilis Metaftsis}, DOI = {10.1007/s11425-011-4212-y}, URL = {http://dx.doi.org/10.1007/s11425-011-4212-y}, } @article {Bridon-Reed-Wilton(2017), AUTHOR = {Bridson, Martin R. and Reid, Alan W. and Wilton, Henry}, TITLE = {Profinite rigidity and surface bundles over the circle}, JOURNAL = {Bull. Lond. Math. Soc.}, FJOURNAL = {Bulletin of the London Mathematical Society}, VOLUME = {49}, YEAR = {2017}, NUMBER = {5}, PAGES = {831--841}, ISSN = {0024-6093}, MRCLASS = {57M27 (20E18 20E26)}, MRNUMBER = {3742450}, MRREVIEWER = {Steffen Kionke}, DOI = {10.1112/blms.12076}, URL = {https://doi.org/10.1112/blms.12076}, } @article {Bridson-Riley(2009), AUTHOR = {Bridson, Martin and Riley, Timothy}, TITLE = {Extrinsic versus intrinsic diameter for {R}iemannian filling-discs and van {K}ampen diagrams}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {82}, YEAR = {2009}, NUMBER = {1}, PAGES = {115--154}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57M07 (20F65)}, MRNUMBER = {2504772 (2010f:57002)}, MRREVIEWER = {Darryl McCullough}, URL = {http://projecteuclid.org/euclid.jdg/1242134370}, } @article {Bridson-Riley(2007), AUTHOR = {Bridson, Martin R. and Riley, Tim R.}, TITLE = {Free and fragmenting filling length}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {307}, YEAR = {2007}, NUMBER = {1}, PAGES = {171--190}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20F65 (20F06 57M07)}, MRNUMBER = {2278048 (2007i:20066)}, MRREVIEWER = {Darryl McCullough}, DOI = {10.1016/j.jalgebra.2006.05.030}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2006.05.030}, } @article {Bridson-Segal(2011), AUTHOR = {Bridson, Martin and Segal, Dan}, TITLE = {Special issue on the occasion of {F}ritz {G}runewald's 60th birthday}, NOTE = {Special issue edited by Bridson and Segal with the cooperation of Alex Lubotzky and Peter Sarnak}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {5}, YEAR = {2011}, NUMBER = {2}, PAGES = {207--211}, ISSN = {1661-7207}, MRCLASS = {01A70}, MRNUMBER = {2782169}, } @article{Bridson-Short(2016), AUTHOR = {Bridson, Martin R. and Short, Hamish}, TITLE = {Inversion is possible in groups with no periodic automorphisms}, JOURNAL = {Proc. Edinb. Math. Soc. (2)}, FJOURNAL = {Proceedings of the Edinburgh Mathematical Society. Series II}, VOLUME = {59}, YEAR = {2016}, NUMBER = {1}, PAGES = {11--16}, ISSN = {0013-0915}, MRCLASS = {20F28 (20F67)}, MRNUMBER = {3439120}, DOI = {10.1017/S0013091514000388}, URL = {http://dx.doi.org/10.1017/S0013091514000388}, } @article {Bridson-Tweedale(2014), AUTHOR = {Bridson, Martin R. and Tweedale, Michael}, TITLE = {Constructing presentations of subgroups of right-angled {A}rtin groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {169}, YEAR = {2014}, PAGES = {1--14}, ISSN = {0046-5755}, MRCLASS = {20F05 (20F65 57M07)}, MRNUMBER = {3175232}, MRREVIEWER = {Vassilis Metaftsis}, DOI = {10.1007/s10711-013-9838-1}, URL = {http://dx.doi.org/10.1007/s10711-013-9838-1}, } @article {Bridson-Tweedale(2007), AUTHOR = {Bridson, Martin R. and Tweedale, Michael}, TITLE = {Deficiency and abelianized deficiency of some virtually free groups}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {143}, YEAR = {2007}, NUMBER = {2}, PAGES = {257--264}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {20E06 (57M07)}, MRNUMBER = {2364648 (2008k:20049)}, MRREVIEWER = {Martin Edjvet}, DOI = {10.1017/S030500410700045X}, URL = {http://dx.doi.org/10.1017/S030500410700045X}, } @article {Bridson-Tweedale-Wilton(2007), AUTHOR = {Bridson, Martin R. and Tweedale, Michael and Wilton, Henry}, TITLE = {Limit groups, positive-genus towers and measure-equivalence}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {27}, YEAR = {2007}, NUMBER = {3}, PAGES = {703--712}, ISSN = {0143-3857}, MRCLASS = {37A05 (20E05 57M07)}, MRNUMBER = {2322174 (2008f:37004)}, MRREVIEWER = {Anders Karlsson}, DOI = {10.1017/S0143385706001039}, URL = {http://dx.doi.org/10.1017/S0143385706001039}, } @article {Bridson-Vogtmann(2012Dehn), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {The {D}ehn functions of {$Out(F_n)$} and {$Aut(F_n)$}}, JOURNAL = {Ann. Inst. Fourier (Grenoble)}, FJOURNAL = {Universit\'e de Grenoble. Annales de l'Institut Fourier}, VOLUME = {62}, YEAR = {2012}, NUMBER = {5}, PAGES = {1811--1817}, ISSN = {0373-0956}, MRCLASS = {20F65 (20F28 53C24 57S25)}, MRNUMBER = {3025154}, DOI = {10.5802/aif.2736}, URL = {http://dx.doi.org/10.5802/aif.2736}, } @article {Bridson-Vogtmann(2012abelian), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {Abelian covers of graphs and maps between outer automorphism groups of free groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {353}, YEAR = {2012}, NUMBER = {4}, PAGES = {1069--1102}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {20F65 (20F28)}, MRNUMBER = {2944024}, MRREVIEWER = {Fran{\c{c}}ois Dahmani}, DOI = {10.1007/s00208-011-0710-z}, URL = {http://dx.doi.org/10.1007/s00208-011-0710-z}, } @article {Bridson-Vogtmann(2011), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {Actions of automorphism groups of free groups on homology spheres and acyclic manifolds}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {86}, YEAR = {2011}, NUMBER = {1}, PAGES = {73--90}, ISSN = {0010-2571}, MRCLASS = {20F65 (20F28 53C24 57S25)}, MRNUMBER = {2745276 (2011j:20104)}, DOI = {10.4171/CMH/218}, URL = {http://dx.doi.org/10.4171/CMH/218}, } @incollection {Bridson-Vogtmann(2006), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {Automorphism groups of free groups, surface groups and free abelian groups}, BOOKTITLE = {Problems on mapping class groups and related topics}, SERIES = {Proc. Sympos. Pure Math.}, VOLUME = {74}, PAGES = {301--316}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2006}, MRCLASS = {20F65 (20F28 57M07)}, MRNUMBER = {2264548 (2008g:20091)}, DOI = {10.1090/pspum/074/2264548}, URL = {http://dx.doi.org/10.1090/pspum/074/2264548}, } @article {Bridson-Vogtmann(2003), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {Homomorphisms from automorphism groups of free groups}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {35}, YEAR = {2003}, NUMBER = {6}, PAGES = {785--792}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {20F28 (20E05 20F65)}, MRNUMBER = {2000025 (2004f:20066)}, MRREVIEWER = {S. Andreadakis}, DOI = {10.1112/S0024609303002248}, URL = {http://dx.doi.org/10.1112/S0024609303002248}, } @article {Bridson-Vogtmann(2001), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {The symmetries of outer space}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {106}, YEAR = {2001}, NUMBER = {2}, PAGES = {391--409}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {20F65 (20E05 20F28 57M07)}, MRNUMBER = {2001k:20084}, MRREVIEWER = {S. Andreadakis}, } @article {Bridson-Vogtmann(2000), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {Automorphisms of automorphism groups of free groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {229}, YEAR = {2000}, NUMBER = {2}, PAGES = {785--792}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20F28 (20E05)}, MRNUMBER = {1769698 (2001g:20041)}, MRREVIEWER = {Katalin A. Bencsath}, DOI = {10.1006/jabr.2000.8327}, URL = {http://dx.doi.org/10.1006/jabr.2000.8327}, } @article {Bridson-Vogtmann(1995a), AUTHOR = {Bridson, Martin R. and Vogtmann, Karen}, TITLE = {On the geometry of the automorphism group of a free group}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {27}, YEAR = {1995}, NUMBER = {6}, PAGES = {544--552}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {20F28 (20F10 20F32 57M07)}, MRNUMBER = {96j:20050}, MRREVIEWER = {Michel Coornaert}, } @article {Bridson-Wade(2011), AUTHOR = {Bridson, Martin R. and Wade, Richard D.}, TITLE = {Actions of higher-rank lattices on free groups}, JOURNAL = {Compos. Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {147}, YEAR = {2011}, NUMBER = {5}, PAGES = {1573--1580}, ISSN = {0010-437X}, MRCLASS = {20E36 (22E40)}, MRNUMBER = {2834733 (2012j:20092)}, MRREVIEWER = {Fran{\c{c}}ois Dahmani}, DOI = {10.1112/S0010437X11005598}, URL = {http://dx.doi.org/10.1112/S0010437X11005598}, } @article {Bridson-Wilton(2015), AUTHOR = {Bridson, Martin R. and Wilton, Henry}, TITLE = {The triviality problem for profinite completions}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {202}, YEAR = {2015}, NUMBER = {2}, PAGES = {839--874}, ISSN = {0020-9910}, MRCLASS = {20F10 (20E18 20F65 20F67 57M07)}, MRNUMBER = {3418245}, DOI = {10.1007/s00222-015-0578-8}, URL = {http://dx.doi.org/10.1007/s00222-015-0578-8}, } @article {Bridson-Wilton(2014), AUTHOR = {Bridson, Martin R. and Wilton, Henry}, TITLE = {The isomorphism problem for profinite completions of finitely presented, residually finite groups}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {8}, YEAR = {2014}, NUMBER = {3}, PAGES = {733--745}, ISSN = {1661-7207}, MRCLASS = {20E18 (20E26 20F10 57M07)}, MRNUMBER = {3267521}, MRREVIEWER = {Egle Bettio}, DOI = {10.4171/GGD/245}, URL = {http://dx.doi.org/10.4171/GGD/245}, } @article {Bridson-Wilton(2011), AUTHOR = {Bridson, Martin R. and Wilton, Henry}, TITLE = {On the difficulty of presenting finitely presentable groups}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {5}, YEAR = {2011}, NUMBER = {2}, PAGES = {301--325}, ISSN = {1661-7207}, MRCLASS = {20F05 (20F10 20F65 20F67)}, MRNUMBER = {2782175 (2012c:20085)}, MRREVIEWER = {Fran{\c{c}}ois Dahmani}, DOI = {10.4171/GGD/129}, URL = {http://dx.doi.org/10.4171/GGD/129}, } @article {Bridson-Wilton(2008), AUTHOR = {Bridson, Martin R. and Wilton, Henry}, TITLE = {Subgroup separability in residually free groups}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {260}, YEAR = {2008}, NUMBER = {1}, PAGES = {25--30}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {20E26}, MRNUMBER = {2413340 (2010c:20036)}, DOI = {10.1007/s00209-007-0256-7}, URL = {http://dx.doi.org/10.1007/s00209-007-0256-7}, } @article {Bridson-Wise(2001), AUTHOR = {Bridson, Martin R. and Wise, Daniel T.}, TITLE = {Malnormality is undecidable in hyperbolic groups}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {124}, YEAR = {2001}, PAGES = {313--316}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {20F67 (03D35)}, MRNUMBER = {1856523 (2002h:20062)}, DOI = {10.1007/BF02772626}, URL = {http://dx.doi.org/10.1007/BF02772626}, } @article {Bridson-Wise(1999), AUTHOR = {Bridson, Martin R. and Wise, Daniel T.}, TITLE = {{$\scr V\scr H$} complexes, towers and subgroups of {$F\times F$}}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {126}, YEAR = {1999}, NUMBER = {3}, PAGES = {481--497}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {20F05}, MRNUMBER = {1684244 (2000c:20050)}, MRREVIEWER = {Eric Lewis Swenson}, DOI = {10.1017/S0305004199003503}, URL = {http://dx.doi.org/10.1017/S0305004199003503}, } @article {Brieskorn(1966), AUTHOR = {Brieskorn, Egbert}, TITLE = {Beispiele zur {D}ifferentialtopologie von {S}ingularit\"aten}, JOURNAL = {Invent. Math.}, VOLUME = {2}, YEAR = {1966}, PAGES = {1--14}, MRCLASS = {57.10 (14.18)}, MRNUMBER = {34 \#6788}, MRREVIEWER = {F. Hirzebruch}, } @article {Brieskorn(1971), AUTHOR = {Brieskorn, E.}, TITLE = {Die {F}undamentalgruppe des {R}aumes der regul\"aren {O}rbits einer endlichen komplexen {S}piegelungsgruppe}, JOURNAL = {Invent. Math.}, VOLUME = {12}, YEAR = {1971}, PAGES = {57--61}, MRCLASS = {55A05}, MRNUMBER = {45 \#2692}, MRREVIEWER = {L. Neuwirth}, } @article {Brin(1996), AUTHOR = {Brin, Matthew G.}, TITLE = {The chameleon groups of {R}ichard {J}. {T}hompson: automorphisms and dynamics}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {84}, YEAR = {1996}, PAGES = {5--33 (1997)}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {57M07 (20F38)}, MRNUMBER = {99e:57003}, MRREVIEWER = {Darryl McCullough}, } @article {Brin-Squier(1985), AUTHOR = {Brin, Matthew G. and Squier, Craig C.}, TITLE = {Groups of piecewise linear homeomorphisms of the real line}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {79}, YEAR = {1985}, NUMBER = {3}, PAGES = {485--498}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57S05 (20F32 57S25)}, MRNUMBER = {86h:57033}, MRREVIEWER = {Bruno Zimmermann}, } @article {Brock-Dunfield(2015), AUTHOR = {Brock, Jeffrey F. and Dunfield, Nathan M.}, TITLE = {Injectivity radii of hyperbolic integer homology 3-spheres}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {19}, YEAR = {2015}, NUMBER = {1}, PAGES = {497--523}, ISSN = {1465-3060}, MRCLASS = {57M50 (30F40)}, MRNUMBER = {3318758}, MRREVIEWER = {Hongbin Sun}, DOI = {10.2140/gt.2015.19.497}, URL = {https://doi.org/10.2140/gt.2015.19.497}, } @article {Brodzki-Guentner-Higson(2019), AUTHOR = {Brodzki, J. and Guentner, E. and Higson, N.}, TITLE = {A differential complex for {CAT}(0) cubical spaces}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {347}, YEAR = {2019}, PAGES = {1054--1111}, ISSN = {0001-8708}, MRCLASS = {46L07 (20E08 20F65)}, MRNUMBER = {3923391}, DOI = {10.1016/j.aim.2019.03.009}, URL = {https://doi.org/10.1016/j.aim.2019.03.009}, } @article {Brodzki-Guentner-Higson-Nishikawa(2021), AUTHOR = {Brodzki, Jacek and Guentner, Erik and Higson, Nigel and Nishikawa, Shintaro}, TITLE = {On the {B}aum-{C}onnes conjecture for groups acting on {${\rm CAT}(0)$}-cubical spaces}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2021}, VOLUME = {5}, PAGES = {3698--3728}, ISSN = {1073-7928,1687-0247}, MRCLASS = {57S20 (19K35 22F05)}, MRNUMBER = {4227583}, MRREVIEWER = {Ralf\ Meyer}, DOI = {10.1093/imrn/rnaa059}, URL = {https://doi.org/10.1093/imrn/rnaa059}, } @article {Brodzki-Plymen(1999), AUTHOR = {Brodzki, Jacek and Plymen, Roger}, TITLE = {Periodic cyclic homology of certain nuclear algebras}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {329}, YEAR = {1999}, NUMBER = {8}, PAGES = {671--676}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {46Mxx (46Hxx)}, MRNUMBER = {1 724 090}, } @incollection {Broecker(1991), AUTHOR = {Br{\"o}cker, Ludwig}, TITLE = {Families of semialgebraic sets and limits}, BOOKTITLE = {Real algebraic geometry (Rennes, 1991)}, PAGES = {145--162}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1992}, MRCLASS = {14P10 (12J15 12J20)}, MRNUMBER = {94i:14058}, MRREVIEWER = {Murray Marshall}, } @incollection {Broecker(1994), AUTHOR = {Br{\"o}cker, Ludwig}, TITLE = {On the reduction of semialgebraic sets by real valuations}, BOOKTITLE = {Recent advances in real algebraic geometry and quadratic forms (Berkeley, CA, 1990/1991; San Francisco, CA, 1991)}, PAGES = {75--95}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1994}, MRCLASS = {14P10 (14P05 14P25)}, MRNUMBER = {95f:14099}, MRREVIEWER = {Niels Schwartz}, } @article {Broecker(1995), AUTHOR = {Br{\"o}cker, L.}, TITLE = {Semialgebraische {G}eometrie}, JOURNAL = {Jahresber. Deutsch. Math.-Verein.}, FJOURNAL = {Jahresbericht der Deutschen Mathematiker-Vereinigung}, VOLUME = {97}, YEAR = {1995}, NUMBER = {4}, PAGES = {130--156}, ISSN = {0012-0456}, CODEN = {JDMVA7}, MRCLASS = {14P10}, MRNUMBER = {1 367 214}, } @book {Broecker-Dieck(1970), AUTHOR = {Br{\"o}cker, Theodor and tom Dieck, Tammo}, TITLE = {Kobordismentheorie}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1970}, PAGES = {xvi+191}, MRCLASS = {57.10 (55.00)}, MRNUMBER = {43 \#1202}, MRREVIEWER = {P. S. Landweber}, } @book {Broecker-Dieck(1985), AUTHOR = {Br{\"o}cker, Theodor and tom Dieck, Tammo}, TITLE = {Representations of compact {L}ie groups}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1985}, PAGES = {x+313}, ISBN = {0-387-13678-9}, MRCLASS = {22E45 (57-01)}, MRNUMBER = {86i:22023}, MRREVIEWER = {R. Schultz}, } @book {Broecker-Jaenich(1973), AUTHOR = {Br{\"o}cker, Theodor and J{\"a}nich, Klaus}, TITLE = {Einf\"uhrung in die {D}ifferentialtopologie}, NOTE = {Heidelberger Taschenb\"ucher, Band 143}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1973}, PAGES = {v+168}, MRCLASS = {58-01}, MRNUMBER = {50 \#11307}, MRREVIEWER = {M. L. Gromov}, } @book {Broecker-Jaenich(1982), AUTHOR = {Br{\"o}cker, Theodor and J{\"a}nich, Klaus}, TITLE = {Introduction to differential topology}, NOTE = {Translated from the German by C. B. Thomas and M. J. Thomas}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1982}, PAGES = {vii+160}, ISBN = {0-521-24135-9; 0-521-28470-8}, MRCLASS = {58-01 (57Rxx)}, MRNUMBER = {674117 (83i:58001)}, } @article {Broecker-Kuppe-Scheufler(1997), AUTHOR = {Br{\"o}cker, L. and Kuppe, M. and Scheufler, W.}, TITLE = {Inner metric properties of $2$-dimensional semi-algebraic sets}, NOTE = {Real algebraic and analytic geometry (Segovia, 1995)}, JOURNAL = {Rev. Mat. Univ. Complut. Madrid}, FJOURNAL = {Revista Matem\'atica de la Universidad Complutense de Madrid}, VOLUME = {10}, YEAR = {1997}, NUMBER = {Special Issue, suppl.}, PAGES = {51--78}, ISSN = {0214-3577}, MRCLASS = {53C45 (14P10)}, MRNUMBER = {98m:53084}, MRREVIEWER = {Akhil Ranjan}, } @article {Broise(1967), AUTHOR = {Broise, Michel}, TITLE = {Commutateurs dans le groupe unitaire d'un facteur}, JOURNAL = {J. Math. Pures Appl. (9)}, VOLUME = {46}, YEAR = {1967}, PAGES = {299--312}, MRCLASS = {46.65 (47.00)}, MRNUMBER = {36 \#6947}, MRREVIEWER = {C. R. Putnam}, } @book {Bronstein-Semendjajew(1996), TITLE = {Teubner-{T}aschenbuch der {M}athematik}, EDITOR = {Zeidler, E.}, NOTE = {Founded by I. N. Bronstein [I. N. Bronshte\u\i n] and K. A. Semendjajew [K. A. Semendyaev], Continued by G. Grosche, V. Ziegler and D. Ziegler, Present edition edited by E. Zeidler, With contributions by W. Hackbusch, H. R. Schwarz and Zeidler}, PUBLISHER = {B. G. Teubner}, ADDRESS = {Stuttgart}, YEAR = {1996}, PAGES = {xxvi+1298}, ISBN = {3-8154-2001-6}, MRCLASS = {00A20 (00A22)}, MRNUMBER = {98a:00002}, } @Article{Brookman-Davis-Khan(2007), Author = {Brookman, Jeremy and Davis, James F. and Khan, Qayum}, Title = {Manifolds homotopy equivalent to {{\(P^{n} \# P^{n}\)}}}, FJournal = {Mathematische Annalen}, Journal = {Math. Ann.}, ISSN = {0025-5831}, Volume = {338}, Number = {4}, Pages = {947--962}, Year = {2007}, Language = {English}, DOI = {10.1007/s00208-007-0099-x}, Keywords = {57N15,57N13}, zbMATH = {5199456}, Zbl = {1129.57029} } @article {Brooks(1981), AUTHOR = {Brooks, Robert}, TITLE = {The fundamental group and the spectrum of the {L}aplacian}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {56}, YEAR = {1981}, NUMBER = {4}, PAGES = {581--598}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {58G30 (22E99 53C20 57M05 58G25)}, MRNUMBER = {84j:58131}, } @book {Broto-Casacuberta-Mislin(1996), TITLE = {Algebraic topology: new trends in localization and periodicity}, EDITOR = {Broto, Carles and Casacuberta, Carles and Mislin, Guido}, NOTE = {Papers from the Barcelona Conference (BCAT) held in Sant Feliu de Gu\'\i xols, June 1--7, 1994}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1996}, PAGES = {xii+400}, ISBN = {3-7643-5333-3}, MRCLASS = {55-06}, MRNUMBER = {97a:55001}, } @article {Browder(1961), AUTHOR = {Browder, William}, TITLE = {Torsion in ${H}$-spaces}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {74}, YEAR = {1961}, PAGES = {24--51}, MRCLASS = {55.30 (55.99)}, MRNUMBER = {23 \#A2201}, MRREVIEWER = {W. S. Massey}, } @Misc{Browder(1962), Author = {W. {Browder}}, Title = {{Homotopy type of differentiable manifolds}}, Year = {1962}, Language = {English}, HowPublished = {{Colloq. algebr. Topology, Aarhus 1962, 42-46 (1962).}}, Zbl = {0144.22701} } @incollection {Browder(1965), AUTHOR = {Browder, William}, TITLE = {On the action of {$\Theta ^{n}\,(\partial \pi )$}}, BOOKTITLE = {Differential and {C}ombinatorial {T}opology ({A} {S}ymposium in {H}onor of {M}arston {M}orse)}, PAGES = {23--36}, PUBLISHER = {Princeton Univ. Press, Princeton, N.J.}, YEAR = {1965}, MRCLASS = {57.20}, MRNUMBER = {0179799}, MRREVIEWER = {E. H. Brown}, } @article {Browder(1966), AUTHOR = {Browder, William}, TITLE = {Manifolds with $\pi \sb{1}={Z}$}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {72}, YEAR = {1966}, PAGES = {238--244}, MRCLASS = {57.10}, MRNUMBER = {32 \#8350}, MRREVIEWER = {E. H. Brown}, } @article {Browder(1969), AUTHOR = {Browder, William}, TITLE = {The {K}ervaire invariant of framed manifolds and its generalization}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {90}, YEAR = {1969}, PAGES = {157--186}, MRCLASS = {57.10}, MRNUMBER = {40 \#4963}, MRREVIEWER = {Edgar H. Brown, Jr.}, } @book {Browder(1972), AUTHOR = {Browder, William}, TITLE = {Surgery on simply-connected manifolds}, NOTE = {Ergebnisse der Mathematik und ihrer Grenzgebiete, Band 65}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1972}, PAGES = {ix+132}, MRCLASS = {57D65}, MRNUMBER = {50 \#11272}, MRREVIEWER = {P. J. Kahn}, } @article {Browder(1983), AUTHOR = {Browder, William}, TITLE = {Cohomology and group actions}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {71}, YEAR = {1983}, NUMBER = {3}, PAGES = {599--607}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57S17 (57S25)}, MRNUMBER = {85m:57022a}, MRREVIEWER = {Gunnar Carlsson}, } @book {Browder(1987), TITLE = {Algebraic topology and algebraic ${K}$-theory}, BOOKTITLE = {Proceedings of the conference dedicated to John C. Moore on his sixtieth birthday, held at Princeton University, Princeton, N.J., October 24--28, 1983}, EDITOR = {Browder, William}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {1987}, PAGES = {x+564}, ISBN = {0-691-08415-7; 0-691-08426-2}, MRCLASS = {55-06 (18F25 19-06)}, MRNUMBER = {88g:55002}, } @incollection {Browder(1995), AUTHOR = {Browder, William}, TITLE = {Homotopy type of differentiable manifolds}, BOOKTITLE = {Novikov conjectures, index theorems and rigidity, Vol.\ 1 (Oberwolfach, 1993)}, PAGES = {97--100}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1995}, MRCLASS = {57R65 (57R55)}, MRNUMBER = {97d:57044}, MRREVIEWER = {Terry Lawson}, } @Article{Browder-Hirsch(1966), Author = {W. {Browder} and M. W. {Hirsch}}, Title = {{Surgery on piecewise linear manifolds and applications}}, FJournal = {{Bulletin of the American Mathematical Society}}, Journal = {{Bull. Am. Math. Soc.}}, ISSN = {0002-9904; 1936-881X/e}, Volume = {72}, Pages = {959--964}, Year = {1966}, Publisher = {American Mathematical Society (AMS), Providence, RI}, Language = {English}, Zbl = {0149.20603} } @incollection {Browder-Hsiang(1978), AUTHOR = {Browder, W. and Hsiang, W. C.}, TITLE = {Some problems on homotopy theory manifolds and transformation groups}, BOOKTITLE = {Algebraic and geometric topology ({P}roc. {S}ympos. {P}ure {M}ath., {S}tanford {U}niv., {S}tanford, {C}alif., 1976), {P}art 2}, SERIES = {Proc. Sympos. Pure Math., XXXII}, PAGES = {251--267}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1978}, MRCLASS = {55-02}, MRNUMBER = {MR520546 (80e:55001)}, MRREVIEWER = {R. E. Stong}, } @article {Browder-Hsiang(1981), AUTHOR = {Browder, William and Hsiang, Wu Chung}, TITLE = {${G}$-actions and the fundamental group}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {65}, YEAR = {1981/82}, NUMBER = {3}, PAGES = {411--424}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57S15 (57S25)}, MRNUMBER = {83d:57026}, MRREVIEWER = {H.-T. Ku}, } @article {Browder-Levine(1966), AUTHOR = {Browder, W. and Levine, J.}, TITLE = {Fibering manifolds over a circle}, JOURNAL = {Comment. Math. Helv.}, VOLUME = {40}, YEAR = {1966}, PAGES = {153--160}, MRCLASS = {57.20}, MRNUMBER = {MR0195104 (33 \#3309)}, MRREVIEWER = {R. H. Rosen}, } @Article{Browder-Petrie-Wall(1971), Author = {Browder, W. and Petrie, T. and Wall, C. T. C.}, Title = {The classification of free actions of cyclic groups of odd order on homotopy spheres}, FJournal = {Bulletin of the American Mathematical Society}, Journal = {Bull. Am. Math. Soc.}, ISSN = {0002-9904}, Volume = {77}, Pages = {455--459}, Year = {1971}, Language = {English}, DOI = {10.1090/S0002-9904-1971-12736-2}, Keywords = {57R60,57S25}, zbMATH = {3340091}, Zbl = {0214.22601} } @incollection {Browder-Quinn(1975), AUTHOR = {Browder, William and Quinn, Frank}, TITLE = {A surgery theory for ${G}$-manifolds and stratified sets}, BOOKTITLE = {Manifolds---Tokyo 1973 (Proc. Internat. Conf., Tokyo, 1973)}, PAGES = {27--36}, PUBLISHER = {Univ. Tokyo Press}, ADDRESS = {Tokyo}, YEAR = {1975}, MRCLASS = {57D65}, MRNUMBER = {51 \#11543}, MRREVIEWER = {Edgar H. Brown, Jr.}, } @article {Brown(1962emb), AUTHOR = {Brown, Morton}, TITLE = {Locally flat imbeddings of topological manifolds}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {75}, YEAR = {1962}, PAGES = {331--341}, ISSN = {0003-486X}, MRCLASS = {54.78}, MRNUMBER = {0133812}, MRREVIEWER = {E. Michael}, } @article {Brown(1962), AUTHOR = {Brown, Jr., Edgar H.}, TITLE = {Cohomology theories}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {75}, YEAR = {1962}, PAGES = {467--484}, MRCLASS = {55.30}, MRNUMBER = {25 \#1551}, MRREVIEWER = {S.-T. Hu}, } @article {Brown(1963), AUTHOR = {Brown, Jr., Edgar H.}, TITLE = {Correction to ``{C}ohomology theories''}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {78}, YEAR = {1963}, PAGES = {201}, MRCLASS = {55.30}, MRNUMBER = {27 \#749}, MRREVIEWER = {S.-T. Hu}, } @article {Brown(1965), AUTHOR = {Brown, Jr., Edgar H.}, TITLE = {Abstract homotopy theory}, JOURNAL = {Trans. Amer. Math. Soc.}, VOLUME = {119}, YEAR = {1965}, PAGES = {79--85}, MRCLASS = {55.40 (55.30)}, MRNUMBER = {32 \#452}, MRREVIEWER = {P. J. Hilton}, } @book {Brown(1968), AUTHOR = {Brown, Ronald}, TITLE = {Elements of modern topology}, PUBLISHER = {McGraw-Hill Book Co.}, ADDRESS = {New York}, YEAR = {1968}, PAGES = {xvi+351}, MRCLASS = {55.40 (54.00)}, MRNUMBER = {37 \#3563}, MRREVIEWER = {R. E. Mosher}, } @incollection {Brown(1970), AUTHOR = {Brown, Jr., Edgar H.}, TITLE = {The {K}ervaire invariant of a manifold}, BOOKTITLE = {Algebraic topology (Proc. Sympos. Pure Math., Vol. XXII, Univ. Wisconsin, Madison, Wis., 1970)}, PAGES = {65--71}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R. I.}, YEAR = {1971}, MRCLASS = {57D65}, MRNUMBER = {48 \#1249}, MRREVIEWER = {M. L. Curtis}, } @book {Brown(1971), AUTHOR = {Brown, Robert F.}, TITLE = {The {L}efschetz fixed point theorem}, PUBLISHER = {Scott, Foresman and Co., Glenview, Ill.-London}, YEAR = {1971}, PAGES = {vi+186}, MRCLASS = {55.36}, MRNUMBER = {44 \#1023}, MRREVIEWER = {E. Fadell}, } @article {Brown(1972), AUTHOR = {Brown, Jr., Edgar H.}, TITLE = {Generalizations of the {K}ervaire invariant}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {95}, YEAR = {1972}, PAGES = {368--383}, MRCLASS = {57A70}, MRNUMBER = {45 \#2719}, MRREVIEWER = {M. L. Curtis}, } @article {Brown(1974), AUTHOR = {Brown, Kenneth S.}, TITLE = {Abstract homotopy theory and generalized sheaf cohomology}, JOURNAL = {Trans. Amer. Math. Soc.}, VOLUME = {186}, YEAR = {1974}, PAGES = {419--458}, MRCLASS = {55B30 (18H99)}, MRNUMBER = {49 \#6220}, MRREVIEWER = {A. Dold}, } @article {Brown(1975), AUTHOR = {Brown, Kenneth S.}, TITLE = {Homological criteria for finiteness}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {50}, YEAR = {1975}, PAGES = {129--135}, ISSN = {0010-2571}, MRCLASS = {18G05 (55D15)}, MRNUMBER = {MR0376820 (51 \#12995)}, MRREVIEWER = {L. Ribes}, } @InProceedings{Brown(1979), author = {Brown, K.S.}, title = {Groups of virtually finite dimension}, booktitle = {Proceedings {\em ``Homological group theory''}, editor: Wall, C.T.C., LMS Lecture Notes Series 36}, pages = {27--70}, publisher = {Cambridge University Press}, year = {1979}, } @book {Brown(1982), AUTHOR = {Brown, Kenneth S.}, TITLE = {Cohomology of groups}, SERIES = {Graduate Texts in Mathematics}, VOLUME = {87}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1982}, PAGES = {x+306}, ISBN = {0-387-90688-6}, MRCLASS = {20-02 (18-01 20F32 20J05 55-01)}, MRNUMBER = {83k:20002}, MRREVIEWER = {Ross Staffeldt}, } @book {Brown(1993), AUTHOR = {Brown, Robert F.}, TITLE = {A topological introduction to nonlinear analysis}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1993}, PAGES = {x+146}, ISBN = {0-8176-3706-0}, MRCLASS = {47H15 (34B15 47H11 47N20 55M20 58C30)}, MRNUMBER = {94j:47093}, MRREVIEWER = {Jacobo Pejsachowicz}, } @article {Brown(1994), AUTHOR = {Brown, K. A. and Lorenz, M.}, TITLE = {Grothendieck groups of invariant rings and of group rings}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {166}, YEAR = {1994}, NUMBER = {3}, PAGES = {423--454}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16E20 (16W20 19A49)}, MRNUMBER = {95f:16003}, MRREVIEWER = {Reinhard C. Laubenbacher}, } @book {Brown(1994a), AUTHOR = {Brown, Kenneth S.}, TITLE = {Cohomology of groups}, NOTE = {Corrected reprint of the 1982 original}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1994}, PAGES = {x+306}, ISBN = {0-387-90688-6}, MRCLASS = {20J05 (20-02)}, MRNUMBER = {96a:20072}, } @book {Brown(1998), AUTHOR = {Brown, Kenneth S.}, TITLE = {Buildings}, NOTE = {Reprint of the 1989 original}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1998}, PAGES = {viii+215}, ISBN = {0-387-98624-3}, MRCLASS = {20E42}, MRNUMBER = {99d:20042}, } @article {Brown-Dykema-Jung(2008), AUTHOR = {Brown, Nathanial P. and Dykema, Kenneth J. and Jung, Kenley}, TITLE = {Free entropy dimension in amalgamated free products}, NOTE = {With an appendix by Wolfgang L{\"u}ck}, JOURNAL = {Proc. Lond. Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {97}, YEAR = {2008}, NUMBER = {2}, PAGES = {339--367}, ISSN = {0024-6115}, MRCLASS = {46L54 (46L53)}, MRNUMBER = {MR2439665}, } @article {Brown-Geoghegan(1984), AUTHOR = {Brown, Kenneth S. and Geoghegan, Ross}, TITLE = {An infinite-dimensional torsion-free ${\rm {F}{P}}\sb{\infty }$ group}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {77}, YEAR = {1984}, NUMBER = {2}, PAGES = {367--381}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20J05 (55P99)}, MRNUMBER = {85m:20073}, MRREVIEWER = {G. Peter Scott}, } @article {Brown-Geoghegan(1985), AUTHOR = {Brown, Kenneth S. and Geoghegan, Ross}, TITLE = {Cohomology with free coefficients of the fundamental group of a graph of groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {60}, YEAR = {1985}, NUMBER = {1}, PAGES = {31--45}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {20J05 (20F32 55N35)}, MRNUMBER = {87b:20066}, MRREVIEWER = {Johannes Huebschmann}, } @article {Brown-Gordon-Stroppel(2008), AUTHOR = {Brown, K. A. and Gordon, I. G. and Stroppel, C. H.}, TITLE = {Cherednik, {H}ecke and quantum algebras as free {F}robenius and {C}alabi-{Y}au extensions}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {319}, YEAR = {2008}, NUMBER = {3}, PAGES = {1007--1034}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16S99 (17B37 20C08 20G42)}, MRNUMBER = {2379091 (2009c:16093)}, MRREVIEWER = {Maurizio Martino}, DOI = {10.1016/j.jalgebra.2007.10.026}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2007.10.026}, } @incollection {Brown-Lorenz(1992), AUTHOR = {Brown, K. A. and Lorenz, M.}, TITLE = {Colimits of functors, and {G}rothendieck groups of infinite group algebras}, BOOKTITLE = {Abelian groups and noncommutative rings}, PAGES = {89--109}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1992}, MRCLASS = {16E20 (16S34 19A31 20C07)}, MRNUMBER = {93h:16009}, MRREVIEWER = {Reinhard C. Laubenbacher}, } @incollection {Brown-Lorenz(1995), AUTHOR = {Brown, Kenneth A. and Lorenz, Martin}, TITLE = {Grothendieck groups and higher class groups of commutative invariants}, BOOKTITLE = {Second International Conference on Algebra (Barnaul, 1991)}, PAGES = {59--74}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1995}, MRCLASS = {16E20 (13A50 16W20 19A49)}, MRNUMBER = {96f:16010}, MRREVIEWER = {Timothy J. Hodges}, } @article {Brown-Lorenz(1996), AUTHOR = {Brown, Kenneth A. and Lorenz, Martin}, TITLE = {Grothendieck groups of invariant rings: linear actions of finite groups}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {221}, YEAR = {1996}, NUMBER = {1}, PAGES = {113--137}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {19A49 (13A50 13D15)}, MRNUMBER = {96m:19005}, MRREVIEWER = {M. E. Keating}, } @article {Brueck-Kielak_Wu(2021), AUTHOR = {Br\"{u}ck, Benjamin and Kielak, Dawid and Wu, Xiaolei}, TITLE = {The {F}arrell-{J}ones conjecture for normally poly-free groups}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {149}, YEAR = {2021}, NUMBER = {6}, PAGES = {2349--2356}, ISSN = {0002-9939,1088-6826}, MRCLASS = {18F25 (19A31 19B28 20E22 20F24)}, MRNUMBER = {4246787}, MRREVIEWER = {Luis\ Jorge\ S\'{a}nchez Salda\~{n}a}, DOI = {10.1090/proc/15357}, URL = {https://doi.org/10.1090/proc/15357}, } @Book {Bruedern(1995), author = {Bruedern, J.}, title = {Einf\"uhrung in die analytische Zahlentheorie}, publisher = {Springer}, year = 1995, } @article {Bruening(1988), AUTHOR = {Br{\"u}ning, Jochen}, TITLE = {Heat kernel asymptotics for operator valued {S}turm-{L}iouville equations}, JOURNAL = {Analysis}, FJOURNAL = {Analysis. International Mathematical Journal of Analysis and its Applications}, VOLUME = {8}, YEAR = {1988}, NUMBER = {1-2}, PAGES = {73--93}, ISSN = {0174-4747}, MRCLASS = {35C20 (34G10 35B40 35J99 35P99)}, MRNUMBER = {89j:35037}, MRREVIEWER = {Wei Tao Zhang}, } @article {Bruening(1990), AUTHOR = {Br{\"u}ning, Jochen}, TITLE = {${L}\sp 2$-index theorems on certain complete manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {32}, YEAR = {1990}, NUMBER = {2}, PAGES = {491--532}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G10}, MRNUMBER = {91h:58103}, MRREVIEWER = {John Roe}, } @article {Bruening(1992), AUTHOR = {Br{\"u}ning, Jochen}, TITLE = {On ${L}\sp 2$-index theorems for complete manifolds of rank-one-type}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {66}, YEAR = {1992}, NUMBER = {2}, PAGES = {257--309}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {58G10}, MRNUMBER = {93i:58145}, MRREVIEWER = {John Roe}, } @article {Bruening-Lesch(1992), AUTHOR = {Br{\"u}ning, J. and Lesch, M.}, TITLE = {Hilbert complexes}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {108}, YEAR = {1992}, NUMBER = {1}, PAGES = {88--132}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G05 (46M20 47A53 58A12 58G20)}, MRNUMBER = {93k:58208}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article {Bruening-Lesch(1993), AUTHOR = {Br{\"u}ning, J. and Lesch, M.}, TITLE = {K\"ahler-{H}odge theory for conformal complex cones}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {3}, YEAR = {1993}, NUMBER = {5}, PAGES = {439--473}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G05 (47A53 53C55 58A14 58G20)}, MRNUMBER = {94i:58189}, MRREVIEWER = {Nicolae Anghel}, } @article {Bruening-Seeley(1988), AUTHOR = {Br{\"u}ning, Jochen and Seeley, Robert}, TITLE = {An index theorem for first order regular singular operators}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {110}, YEAR = {1988}, NUMBER = {4}, PAGES = {659--714}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {58G10 (47F05)}, MRNUMBER = {89k:58271}, MRREVIEWER = {Elmar Schrohe}, } @article {Bruhat-Tits(1984), AUTHOR = {Bruhat, F. and Tits, J.}, TITLE = {Groupes r\'eductifs sur un corps local. {II}. {S}ch\'emas en groupes. {E}xistence d'une donn\'ee radicielle valu\'ee}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, Volume = {60}, YEAR = {1984}, PAGES = {197--376}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {20G25 (14L15)}, MRNUMBER = {756316 (86c:20042)}, MRREVIEWER = {James E. Humphreys}, URL = {http://www.numdam.org/item?id=PMIHES_1984__60__5_0}, } @article {Bruhat-Tits(1972), AUTHOR = {Bruhat, F. and Tits, J.}, TITLE = {Groupes r\'eductifs sur un corps local}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, Volume = {41}, YEAR = {1972}, PAGES = {5--251}, ISSN = {0073-8301}, MRCLASS = {20G25 (22E20)}, MRNUMBER = {0327923 (48 \#6265)}, MRREVIEWER = {M. Krusemeyer}, } @incollection {Bruhat-Tits(1971), AUTHOR = {Bruhat, Fran{\c{c}}ois}, TITLE = {Groupes alg\'ebriques semi-simples sur un corps local}, BOOKTITLE = {Actes du {C}ongr\`es {I}nternational des {M}ath\'ematiciens ({N}ice, 1970),{T}ome 2}, PAGES = {285--290}, PUBLISHER = {Gauthier-Villars, Paris}, YEAR = {1971}, MRCLASS = {20G25}, MRNUMBER = {0424962 (54 \#12920)}, MRREVIEWER = {S. I. Gelfand}, } @incollection {Bruhat-Tits(1967), AUTHOR = {Bruhat, F. and Tits, J.}, TITLE = {Groupes alg\'ebriques simples sur un corps local}, BOOKTITLE = {Proc. {C}onf. {L}ocal {F}ields ({D}riebergen, 1966)}, PAGES = {23--36}, PUBLISHER = {Springer, Berlin}, YEAR = {1967}, MRCLASS = {22.20 (14.00)}, MRNUMBER = {0230838 (37 \#6396)}, MRREVIEWER = {A. Borel}, } @Article {Brumer(1966), AUTHOR = {Brumer, Armand}, TITLE = {Pseudocompact algebras, profinite groups and class formations}, JOURNAL = {J. Algebra}, VOLUME = {4}, YEAR = {1966}, PAGES = {442--470}, MRCLASS = {18.20}, MRNUMBER = {34 \#2650}, MRREVIEWER = {H. Bass}, } @article {Brumer(1967), AUTHOR = {Brumer, Armand}, TITLE = {On the units of algebraic number fields}, JOURNAL = {Mathematika}, FJOURNAL = {Mathematika. A Journal of Pure and Applied Mathematics}, VOLUME = {14}, YEAR = {1967}, PAGES = {121--124}, ISSN = {0025-5793}, MRCLASS = {10.65}, MRNUMBER = {0220694 (36 \#3746)}, MRREVIEWER = {D. J. Lewis}, } @Article{Brumfiel(1968), author = {Brumfiel, G.W.}, title = {{On the homotopy groups of $BPL$ and $PL/O$}}, journal = {Annals of Mathematics}, volume = 22, pages = {73--79}, year = 1968, } @Unpublished{Brumfiel(1968actions), author = {Brumfiel, G.}, title = {Differentiable {$S^1$}- Actions on Homotopy Spheres}, note = {mimeographed. University of California, Berkeley}, year = {1968}, } @Article{Brumfiel(1969), author = {Brumfiel, G.W.}, title = {{On the homotopy groups of $BPL$ and $PL/O$, II}}, journal = {Topology}, volume = 8, pages = {305--311}, year = 1969, } @Article{Brumfiel(1970), author = {Brumfiel, G.W.}, title = {{On the homotopy groups of $BPL$ and $PL/O$, III}}, journal = {Michigan Math. J.}, volume = 17, pages = {217--224}, year = 1969, } @incollection {Brumfiel(1971), AUTHOR = {Brumfiel, Gregory W.}, TITLE = {Homotopy equivalences of almost smooth manifolds}, BOOKTITLE = {Algebraic topology (Proc. Sympos. Pure Math., Vol. XXII, Univ. Wisconsin, Madison, Wis., 1970)}, PAGES = {73--79}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence R.I.}, YEAR = {1971}, MRCLASS = {57D90}, MRNUMBER = {47 \#7762}, MRREVIEWER = {R. K. Lashof}, } @article {Brundan-Stroppel(2010), AUTHOR = {Brundan, Jonathan and Stroppel, Catharina}, TITLE = {Highest weight categories arising from {K}hovanov's diagram algebra. {II}. {K}oszulity}, JOURNAL = {Transform. Groups}, FJOURNAL = {Transformation Groups}, VOLUME = {15}, YEAR = {2010}, NUMBER = {1}, PAGES = {1--45}, ISSN = {1083-4362}, MRCLASS = {17B10 (16S37)}, MRNUMBER = {2600694 (2011b:17014)}, MRREVIEWER = {Volodymyr Mazorchuk}, DOI = {10.1007/s00031-010-9079-4}, URL = {http://dx.doi.org/10.1007/s00031-010-9079-4}, } @article {Bruner-Greenlees(2003), AUTHOR = {Bruner, R. R. and Greenlees, J. P. C.}, TITLE = {The connective {$K$}-theory of finite groups}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {165}, YEAR = {2003}, NUMBER = {785}, PAGES = {viii+127}, ISSN = {0065-9266}, CODEN = {MAMCAU}, MRCLASS = {19L41 (19L47 20J05 55N91 55U25)}, MRNUMBER = {MR1997161 (2004e:19003)}, MRREVIEWER = {Donald M. Davis}, } @article {Brunnbauer(2008), AUTHOR = {Brunnbauer, Michael}, TITLE = {Homological invariance for asymptotic invariants and systolic inequalities}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {18}, YEAR = {2008}, NUMBER = {4}, PAGES = {1087--1117}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {53C23 (53C20 57R19)}, MRNUMBER = {MR2465685}, MRREVIEWER = {Mikhail G. Katz}, } @book {Bruns-Herzog(1993), AUTHOR = {Bruns, Winfried and Herzog, J{\"u}rgen}, TITLE = {Cohen-{M}acaulay rings}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1993}, PAGES = {xii+403}, ISBN = {0-521-41068-1}, MRCLASS = {13H10 (13-02)}, MRNUMBER = {95h:13020}, MRREVIEWER = {Matthew Miller}, } @article {Bryant-Ferry-Mio-Weinberger(1993), AUTHOR = {Bryant, J. and Ferry, S. and Mio, W. and Weinberger, S.}, TITLE = {Topology of homology manifolds}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {28}, YEAR = {1993}, NUMBER = {2}, PAGES = {324--328}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {57P10 (57N15 57P05 57R67)}, MRNUMBER = {93h:57034}, MRREVIEWER = {A. A. Ranicki}, } @article {Bryant-Ferry-Mio-Weinberger(1996), AUTHOR = {Bryant, J. and Ferry, S. and Mio, W. and Weinberger, S.}, TITLE = {Topology of homology manifolds}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {143}, YEAR = {1996}, NUMBER = {3}, PAGES = {435--467}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57P99}, MRNUMBER = {MR1394965 (97b:57017)}, MRREVIEWER = {A. A. Ranicki}, } @article {Bryant-Ferry-Mio-Weinberger(2007), AUTHOR = {Bryant, J. and Ferry, S. and Mio, W. and Weinberger, S.}, TITLE = {Desingularizing homology manifolds}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {11}, YEAR = {2007}, PAGES = {1289--1314}, MRCLASS = {57N15}, MRNUMBER = {MR2326946}, } @article {Bryant-Ferry-Mio-Weinberger-Erratum(2024), AUTHOR = {Bryant, J. and Ferry, S. and Mio, W. and Weinberger, S.}, TITLE = {Erratum to Topology of homology manifolds}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {143}, YEAR = {2024}, NUMBER = {3}, PAGES = {435--467}, ISSN = {0003-486X,1939-8980}, MRCLASS = {57P99}, MRNUMBER = {1394965}, MRREVIEWER = {A.\ A.\ Ranicki}, DOI = {10.2307/2118532}, } @article {Brylinski(1987), AUTHOR = {Brylinski, Jean-Luc}, TITLE = {Cyclic homology and equivariant theories}, JOURNAL = {Ann. Inst. Fourier (Grenoble)}, FJOURNAL = {Universit\'e de Grenoble. Annales de l'Institut Fourier}, VOLUME = {37}, YEAR = {1987}, NUMBER = {4}, PAGES = {15--28}, ISSN = {0373-0956}, CODEN = {AIFUA7}, MRCLASS = {55N91 (17B56 19L47 46L80 58G12)}, MRNUMBER = {89j:55008}, MRREVIEWER = {Claude Schochet}, } @article {Brylinski(1990), AUTHOR = {Brylinski, Jean-Luc}, TITLE = {Representations of loop groups, {D}irac operators on loop space, and modular forms}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {29}, YEAR = {1990}, NUMBER = {4}, PAGES = {461--480}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {58G10 (11F11 22E67 57R20 58G12)}, MRNUMBER = {91j:58151}, MRREVIEWER = {P. S. Landweber}, } @book {Brylinski(1993), AUTHOR = {Brylinski, Jean-Luc}, TITLE = {Loop spaces, characteristic classes and geometric quantization}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1993}, PAGES = {xvi+300}, ISBN = {0-8176-3644-7}, MRCLASS = {57Rxx (18G50 55P35 58F06)}, MRNUMBER = {94b:57030}, MRREVIEWER = {Daniel S. Freed}, } @article {Bucher-Gelander(2011), AUTHOR = {Bucher, Michelle and Gelander, Tsachik}, TITLE = {The generalized {C}hern conjecture for manifolds that are locally a product of surfaces}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {228}, YEAR = {2011}, NUMBER = {3}, PAGES = {1503--1542}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {53C23 (53C35 57R22)}, MRNUMBER = {2824562}, MRREVIEWER = {Thilo Kuessner}, DOI = {10.1016/j.aim.2011.06.022}, URL = {http://dx.doi.org/10.1016/j.aim.2011.06.022}, } @article {Bucher-Karlsson(2008), AUTHOR = {Bucher-Karlsson, Michelle}, TITLE = {The simplicial volume of closed manifolds covered by {$\Bbb H\sp 2\times\Bbb H\sp 2$}}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {1}, YEAR = {2008}, NUMBER = {3}, PAGES = {584--602}, ISSN = {1753-8416}, MRCLASS = {55N10 (20J06)}, MRNUMBER = {MR2417444}, } @book {Buchsbaum(1983), AUTHOR = {Buchsbaum, David A.}, TITLE = {Generic free resolutions and {S}chur complexes}, SERIES = {Brandeis Lecture Notes}, VOLUME = {3}, NOTE = {Notes by Giandomenico Boffi}, PUBLISHER = {Brandeis University}, ADDRESS = {Waltham, MA}, YEAR = {1983}, PAGES = {ii+160}, MRCLASS = {13D25 (18G10)}, MRNUMBER = {741331 (86c:13016)}, MRREVIEWER = {A. Kh. Kushkule{\u\i}}, } @article {Bullett-MacDonald(1982), AUTHOR = {Bullett, S. R. and Macdonald, I. G.}, TITLE = {On the {A}dem relations}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {21}, YEAR = {1982}, NUMBER = {3}, PAGES = {329--332}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55S05 (55S10)}, MRNUMBER = {83h:55035}, MRREVIEWER = {Frederick Cohen}, } @article {Bumagina(2004), AUTHOR = {Bumagina, Inna}, TITLE = {The {H}opf property for subgroups of hyperbolic groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {106}, YEAR = {2004}, PAGES = {211--230}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F67 (57M07)}, MRNUMBER = {MR2079844 (2005e:20061)}, MRREVIEWER = {Gilbert Levitt}, } @incollection {Bumagina(2005), AUTHOR = {Bumagin, Inna}, TITLE = {On definitions of relatively hyperbolic groups}, BOOKTITLE = {Geometric methods in group theory}, SERIES = {Contemp. Math.}, VOLUME = {372}, PAGES = {189--196}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2005}, MRCLASS = {20F67 (20F65)}, MRNUMBER = {2139687 (2006c:20087)}, MRREVIEWER = {Eric M. Freden}, DOI = {10.1090/conm/372/06884}, URL = {http://dx.doi.org/10.1090/conm/372/06884}, } @article {Bunke(1992a), AUTHOR = {Bunke, Ulrich}, TITLE = {Relative index theory}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {105}, YEAR = {1992}, NUMBER = {1}, PAGES = {63--76}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G10 (47A40 47N99)}, MRNUMBER = {93e:58175}, MRREVIEWER = {John Roe}, } @article {Bunke(1995a), AUTHOR = {Bunke, Ulrich}, TITLE = {On the gluing problem for the $\eta$-invariant}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {41}, YEAR = {1995}, NUMBER = {2}, PAGES = {397--448}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G10 (57R57)}, MRNUMBER = {96c:58163}, MRREVIEWER = {Paul A. Kirk}, } @article {Bunke(1995b), AUTHOR = {Bunke, Ulrich}, TITLE = {A ${K}$-theoretic relative index theorem and {C}allias-type {D}irac operators}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {303}, YEAR = {1995}, NUMBER = {2}, PAGES = {241--279}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {58G12 (19K56 53C21)}, MRNUMBER = {96e:58148}, MRREVIEWER = {John Roe}, } @article {Bunke(1999equivtors), AUTHOR = {Bunke, U.}, TITLE = {Equivariant torsion and ${G}$-{C}{W}-complexes}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {9}, YEAR = {1999}, NUMBER = {1}, PAGES = {67--89}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {57Q10 (55T10 57Q91 58J52)}, MRNUMBER = {2000a:57059}, MRREVIEWER = {Thomas Schick}, } @article {Bunke(2000), AUTHOR = {Bunke, Ulrich}, TITLE = {Equivariant higher analytic torsion and equivariant {E}uler characteristic}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {122}, YEAR = {2000}, NUMBER = {2}, PAGES = {377--401}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {58J52 (58J35 58J70)}, MRNUMBER = {2001b:58052}, MRREVIEWER = {Thomas Schick}, } @article {Bunke-Cisinski(2020), AUTHOR = {Bunke, Ulrich and Cisinski, Denis-Charles}, TITLE = {A universal coarse {$K$}-theory}, JOURNAL = {New York J. Math.}, FJOURNAL = {New York Journal of Mathematics}, VOLUME = {26}, YEAR = {2020}, PAGES = {1--27}, MRCLASS = {19D99 (18E30)}, MRNUMBER = {4047397}, } @article {Bunke-Kasprowski-Winges(2021(split), AUTHOR = {Bunke, Ulrich and Kasprowski, Daniel and Winges, Christoph}, TITLE = {Split injectivity of {$A$}-theoretic assembly maps}, JOURNAL = {Int. Math. Res. Not. IMRN}, FJOURNAL = {International Mathematics Research Notices. IMRN}, YEAR = {2021}, VOLUME = {2}, PAGES = {885--947}, ISSN = {1073-7928}, MRCLASS = {19D10 (18N99 19E20)}, MRNUMBER = {4201957}, MRREVIEWER = {Charles Weibel}, DOI = {10.1093/imrn/rnz209}, URL = {https://doi.org/10.1093/imrn/rnz209}, } @article {Bunke-Engel-Kasprowski-Winges(2020(Injectivity), AUTHOR = {Bunke, Ulrich and Engel, Alexander and Kasprowski, Daniel and Winges, Christoph}, TITLE = {Injectivity results for coarse homology theories}, JOURNAL = {Proc. Lond. Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {121}, YEAR = {2020}, NUMBER = {6}, PAGES = {1619--1684}, ISSN = {0024-6115}, MRCLASS = {18G90 (18F20 19D50 20F65 20F69)}, MRNUMBER = {4144372}, DOI = {10.1112/plms.12380}, URL = {https://doi.org/10.1112/plms.12380}, } @article {Bunke-Engel-Kasprowski-Winges(2020(Transfer), AUTHOR = {Bunke, Ulrich and Engel, Alexander and Kasprowski, Daniel and Winges, Christoph}, TITLE = {Transfers in coarse homology}, JOURNAL = {M\"{u}nster J. Math.}, FJOURNAL = {M\"{u}nster Journal of Mathematics}, VOLUME = {13}, YEAR = {2020}, NUMBER = {2}, PAGES = {353--424}, ISSN = {1867-5778}, MRCLASS = {20J05 (18F99 19E99 55N15)}, MRNUMBER = {4130687}, } @article {Bunke-Engel-Kasprowski-Winges(2020(Homotopy), AUTHOR = {Bunke, Ulrich and Engel, Alexander and Kasprowski, Daniel and Winges, Christoph}, TITLE = {Homotopy theory with marked additive categories}, JOURNAL = {Theory Appl. Categ.}, FJOURNAL = {Theory and Applications of Categories}, VOLUME = {35}, YEAR = {2020}, PAGES = {Paper No. 13, 371--416}, MRCLASS = {18E05 (18N40)}, MRNUMBER = {4087665}, } @incollection {Bunke-Engel-Kasprowski-Winges(2020Equivariant), AUTHOR = {Bunke, Ulrich and Engel, Alexander and Kasprowski, Daniel and Winges, Christoph}, TITLE = {Equivariant coarse homotopy theory and coarse algebraic {K}-homology}, BOOKTITLE = {{$K$}-theory in algebra, analysis and topology}, SERIES = {Contemp. Math.}, VOLUME = {749}, PAGES = {13--104}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2020}, MRCLASS = {18F25}, MRNUMBER = {4087635}, DOI = {10.1090/conm/749/15068}, URL = {https://doi.org/10.1090/conm/749/15068}, } @article {Bunke-Engel-Kasprowski-Winges(2019), AUTHOR = {Bunke, Ulrich and Engel, Alexander and Kasprowski, Daniel and Winges, Christoph}, TITLE = {Coarse homology theories and finite decomposition complexity}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {19}, YEAR = {2019}, NUMBER = {6}, PAGES = {3033--3074}, ISSN = {1472-2747}, MRCLASS = {20F69 (18G60 19D99 20F65 20J15)}, MRNUMBER = {4023335}, DOI = {10.2140/agt.2019.19.3033}, URL = {https://doi.org/10.2140/agt.2019.19.3033}, } @incollection {Bunke-Joachim-Stolz(2003), AUTHOR = {Bunke, Ulrich and Joachim, Michael and Stolz, Stephan}, TITLE = {Classifying spaces and spectra representing the {$K$}-theory of a graded {$C\sp *$}-algebra}, BOOKTITLE = {High-dimensional manifold topology}, PAGES = {80--102}, PUBLISHER = {World Sci. Publ., River Edge, NJ}, YEAR = {2003}, MRCLASS = {19K35 (46L80 55N15 55P43)}, MRNUMBER = {MR2048716 (2005d:19006)}, MRREVIEWER = {Jonathan M. Rosenberg}, } @article {Bunke-Kreck-Schick(2010), AUTHOR = {Bunke, Ulrich and Kreck, Matthias and Schick, Thomas}, TITLE = {A geometric description of differential cohomology}, JOURNAL = {Ann. Math. Blaise Pascal}, FJOURNAL = {Annales Math\'ematiques Blaise Pascal}, VOLUME = {17}, YEAR = {2010}, NUMBER = {1}, PAGES = {1--16}, ISSN = {1259-1734}, MRCLASS = {55N20 (57R19)}, MRNUMBER = {2674652}, URL = {http://ambp.cedram.org/item?id=AMBP_2010__17_1_1_0}, } @article {Bunke-Olbrich(1994e), AUTHOR = {Bunke, Ulrich and Olbrich, Martin}, TITLE = {The wave kernel for the {L}aplacian on the classical locally symmetric spaces of rank one, theta functions, trace formulas and the {S}elberg zeta function}, NOTE = {With an appendix by Andreas Juhl}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {12}, YEAR = {1994}, NUMBER = {4}, PAGES = {357--405}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {58G26 (11F72 22E40 58G25)}, MRNUMBER = {95g:58253}, MRREVIEWER = {Christian Grosche}, } @article {Bunke-Olbrich(1995), AUTHOR = {Bunke, Ulrich and Olbrich, Martin}, TITLE = {Gamma-cohomology and the {S}elberg zeta function}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {467}, YEAR = {1995}, PAGES = {199--219}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {11F72 (11F75 22E46)}, MRNUMBER = {96h:11042}, MRREVIEWER = {Shin-ya Koyama}, } @book {Bunke-Olbrich(1995a), AUTHOR = {Bunke, Ulrich and Olbrich, Martin}, TITLE = {Selberg zeta and theta functions}, NOTE = {A differential operator approach}, PUBLISHER = {Akademie-Verlag}, ADDRESS = {Berlin}, YEAR = {1995}, PAGES = {168}, ISBN = {3-05-501690-4}, MRCLASS = {11M36 (11F72 58F20 58G26)}, MRNUMBER = {97c:11088}, MRREVIEWER = {Yiannis Petridis}, } @article {Bunke-Olbrich(1997), AUTHOR = {Bunke, Ulrich and Olbrich, Martin}, TITLE = {Fuchsian groups of the second kind and representations carried by the limit set}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {127}, YEAR = {1997}, NUMBER = {1}, PAGES = {127--154}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11F72 (20H10)}, MRNUMBER = {98e:11065}, MRREVIEWER = {Shin-ya Koyama}, } @article {Bunke-Olbrich(1997a), AUTHOR = {Bunke, Ulrich and Olbrich, Martin}, TITLE = {Cohomological properties of the canonical globalizations of {H}arish-{C}handra modules. {C}onsequences of theorems of {K}ashiwara-{S}chmid, {C}asselman, and {S}chneider-{S}tuhler}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {15}, YEAR = {1997}, NUMBER = {5}, PAGES = {401--418}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {22E46 (22E41 22E50)}, MRNUMBER = {99b:22025}, MRREVIEWER = {William M. McGovern}, } @article {Bunke-Olbrich(1999), AUTHOR = {Bunke, Ulrich and Olbrich, Martin}, TITLE = {Group cohomology and the singularities of the {S}elberg zeta function associated to a {K}leinian group}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {149}, YEAR = {1999}, NUMBER = {2}, PAGES = {627--689}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {11M36 (11F72 22E40 43A85)}, MRNUMBER = {2000f:11110}, MRREVIEWER = {Shin-ya Koyama}, } @book {Burago-Burago-Ivanov(2001), AUTHOR = {Burago, Dmitri and Burago, Yuri and Ivanov, Sergei}, TITLE = {A course in metric geometry}, SERIES = {Graduate Studies in Mathematics}, VOLUME = {33}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {2001}, PAGES = {xiv+415}, ISBN = {0-8218-2129-6}, MRCLASS = {53C23}, MRNUMBER = {MR1835418 (2002e:53053)}, MRREVIEWER = {Mario Bonk}, } @article {Burago-Gromov-Perelman(1992), AUTHOR = {Burago, Yu. and Gromov, M. and Perel{\cprime}man, G.}, TITLE = {A. {D}. {A}leksandrov spaces with curvatures bounded below}, JOURNAL = {Uspekhi Mat. Nauk}, FJOURNAL = {Rossi\u\i skaya Akademiya Nauk. Moskovskoe Matematicheskoe Obshchestvo. Uspekhi Matematicheskikh Nauk}, VOLUME = {47}, YEAR = {1992}, NUMBER = {2(284)}, PAGES = {3--51, 222}, ISSN = {0042-1316}, MRCLASS = {53C21 (53C23)}, MRNUMBER = {93m:53035}, MRREVIEWER = {Tadeusz Januszkiewicz}, NOTE = {English translation in \emph{Russian Math. Surveys} 47 (1992), no.~2, 1--58}, } @article {Burde(1990), AUTHOR = {Burde, Gerhard}, TITLE = {${\rm {S}{U}}(2)$-representation spaces for two-bridge knot groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {288}, YEAR = {1990}, NUMBER = {1}, PAGES = {103--119}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {57M25 (20C99 20F34)}, MRNUMBER = {92c:57004}, MRREVIEWER = {Erica Flapan}, } @book {Burde-Zieschang(1985), AUTHOR = {Burde, Gerhard and Zieschang, Heiner}, TITLE = {Knots}, PUBLISHER = {Walter de Gruyter \& Co.}, ADDRESS = {Berlin}, YEAR = {1985}, PAGES = {xii+399}, ISBN = {3-11-008675-1}, MRCLASS = {57M25 (57-02)}, MRNUMBER = {87b:57004}, MRREVIEWER = {J. A. Hillman}, } @book {Burde-Zieschang(2003), AUTHOR = {Burde, Gerhard and Zieschang, Heiner}, TITLE = {Knots}, SERIES = {de Gruyter Studies in Mathematics}, VOLUME = {5}, EDITION = {Second}, PUBLISHER = {Walter de Gruyter \& Co.}, ADDRESS = {Berlin}, YEAR = {2003}, PAGES = {xii+559}, ISBN = {3-11-017005-1}, MRCLASS = {57M25 (57-02)}, MRNUMBER = {1959408 (2003m:57005)}, } @article {Burger+Monod(2002), AUTHOR = {Burger, M. and Monod, N.}, TITLE = {Continuous bounded cohomology and applications to rigidity theory}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {12}, YEAR = {2002}, NUMBER = {2}, PAGES = {219--280}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {53C24 (22E41 46H25 46M20)}, MRNUMBER = {MR1911660 (2003d:53065a)}, MRREVIEWER = {David Michael Fisher}, } @article {Burger-Canary(1994), AUTHOR = {Burger, Marc and Canary, Richard D.}, TITLE = {A lower bound on $\lambda\sb 0$ for geometrically finite hyperbolic $n$-manifolds}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {454}, YEAR = {1994}, PAGES = {37--57}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {58G25 (30F40 57M50)}, MRNUMBER = {95h:58138}, MRREVIEWER = {Colin C. Adams}, } @article {Burger-Monod(1999a), AUTHOR = {Burger, M. and Monod, N.}, TITLE = {Bounded cohomology of lattices in higher rank {L}ie groups}, JOURNAL = {J. Eur. Math. Soc. (JEMS)}, FJOURNAL = {Journal of the European Mathematical Society (JEMS)}, VOLUME = {1}, YEAR = {1999}, NUMBER = {2}, PAGES = {199--235}, ISSN = {1435-9855}, MRCLASS = {57T10 (20J06 55N35)}, MRNUMBER = {2000g:57058a}, } @article {Burger-Monod(1999b), AUTHOR = {Burger, M. and Monod, N.}, TITLE = {Erratum: ``{B}ounded cohomology of lattices in higher rank {L}ie groups''}, JOURNAL = {J. Eur. Math. Soc. (JEMS)}, FJOURNAL = {Journal of the European Mathematical Society (JEMS)}, VOLUME = {1}, YEAR = {1999}, NUMBER = {3}, PAGES = {338}, ISSN = {1435-9855}, MRCLASS = {57T10 (20J06 55N35)}, MRNUMBER = {2000g:57058b}, } @article {Burger-Mozes(2000), AUTHOR = {Burger, Marc and Mozes, Shahar}, TITLE = {Lattices in product of trees}, JOURNAL = {Inst. Hautes \'{E}tudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'{E}tudes Scientifiques. Publications Math\'{e}matiques}, VOLUME = {92}, YEAR = {2000}, PAGES = {151--194 (2001)}, ISSN = {0073-8301}, MRCLASS = {20E08 (22E40)}, MRNUMBER = {1839489}, MRREVIEWER = {Alexander Lubotzky}, URL = {http://www.numdam.org/item?id=PMIHES_2000__92__151_0}, } @article {Burger-Mozes(1997), AUTHOR = {Burger, Marc and Mozes, Shahar}, TITLE = {Finitely presented simple groups and products of trees}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {324}, YEAR = {1997}, NUMBER = {7}, PAGES = {747--752}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {20E08 (20E32)}, MRNUMBER = {98g:20041}, MRREVIEWER = {Olympia Talelli}, } @Article {Burger-Mozes(1994), author = {Burger, M. and Mozes, S.}, title = {Finitely presented simple groups and products of trees}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, volume = 454, pages = {37--57}, year = 1994, } @article {Burger-Valette(1998), AUTHOR = {Burger, Marc and Valette, Alain}, TITLE = {Idempotents in complex group rings: theorems of {Z}alesskii and {B}ass revisited}, JOURNAL = {J. Lie Theory}, FJOURNAL = {Journal of Lie Theory}, VOLUME = {8}, YEAR = {1998}, NUMBER = {2}, PAGES = {219--228}, ISSN = {0949-5932}, MRCLASS = {16S34}, MRNUMBER = {99j:16016}, MRREVIEWER = {E. Formanek}, } @incollection {Burger+Monod(2002SL2Z), AUTHOR = {Burger, Marc and Monod, Nicolas}, TITLE = {On and around the bounded cohomology of {${\rm SL}\sb 2$}}, BOOKTITLE = {Rigidity in dynamics and geometry (Cambridge, 2000)}, PAGES = {19--37}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2002}, MRCLASS = {22E41}, MRNUMBER = {MR1919394 (2003i:22015)}, } @article {Burger+Monod(2002_rigidity), AUTHOR = {Burger, M. and Monod, N.}, TITLE = {Continuous bounded cohomology and applications to rigidity theory}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {12}, YEAR = {2002}, NUMBER = {2}, PAGES = {219--280}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {53C24 (22E41 46H25 46M20)}, MRNUMBER = {MR1911660 (2003d:53065a)}, MRREVIEWER = {David Michael Fisher}, } @article {Burger+Iozzi+Monod(2005), AUTHOR = {Burger, Marc and Iozzi, Alessandra and Monod, Nicolas}, TITLE = {Equivariant embeddings of trees into hyperbolic spaces}, JOURNAL = {Int. Math. Res. Not.}, FJOURNAL = {International Mathematics Research Notices}, YEAR = {2005}, VOLUME = {22}, PAGES = {1331--1369}, ISSN = {1073-7928}, MRCLASS = {20E08 (20F65 57M07)}, MRNUMBER = {MR2152540 (2006m:20036)}, } @inproceedings {Burghelea(1997), AUTHOR = {Burghelea, Dan}, TITLE = {Lectures on {W}itten-{H}elffer-{S}j\"ostrand theory}, BOOKTITLE = {Proceedings of the {T}hird {I}nternational {W}orkshop on {D}ifferential {G}eometry and its {A}pplications and the {F}irst {G}erman-{R}omanian {S}eminar on {G}eometry ({S}ibiu, 1997)}, JOURNAL = {Gen. Math.}, FJOURNAL = {General Mathematics}, VOLUME = {5}, YEAR = {1997}, PAGES = {85--99}, ISSN = {1221-5023}, MRCLASS = {58J10 (58A12 58E05 58J52)}, MRNUMBER = {1723597 (2000h:58040)}, MRREVIEWER = {Leonid Friedlander}, } @article {Burghelea(1985), AUTHOR = {Burghelea, Dan}, TITLE = {The cyclic homology of the group rings}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {60}, YEAR = {1985}, NUMBER = {3}, PAGES = {354--365}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {18F25 (19D55)}, MRNUMBER = {88e:18007}, MRREVIEWER = {Claude Schochet}, } @article {Burghelea-Fiedorowics(1986), AUTHOR = {Burghelea, D. and Fiedorowicz, Z.}, TITLE = {Cyclic homology and algebraic ${K}$-theory of spaces. {I}{I}}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {25}, YEAR = {1986}, NUMBER = {3}, PAGES = {303--317}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {18F25 (18G50 19D10 19D55)}, MRNUMBER = {88i:18009b}, MRREVIEWER = {Claude Schochet}, } @article {Burghelea-Friedlander-Kappeler(1992c), AUTHOR = {Burghelea, D. and Friedlander, L. and Kappeler, T.}, TITLE = {Meyer-{V}ietoris type formula for determinants of elliptic differential operators}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {107}, YEAR = {1992}, NUMBER = {1}, PAGES = {34--65}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G26 (35S15 58G20)}, MRNUMBER = {93f:58242}, MRREVIEWER = {Steven Rosenberg}, } @article {Burghelea-Friedlander-Kappeler(1994), AUTHOR = {Burghelea, Dan and Kappeler, Thomas and McDonald, Patrick and Friedlander, Leonid}, TITLE = {On the functional logdet and related flows on the space of closed embedded curves on ${S}\sp 2$}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {120}, YEAR = {1994}, NUMBER = {2}, PAGES = {440--466}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G26 (58E10)}, MRNUMBER = {95j:58174}, MRREVIEWER = {Friedbert Pr{\"u}fer}, } @article {Burghelea-Friedlander-Kappeler(1996c), AUTHOR = {Burghelea, D. and Friedlander, L. and Kappeler, T.}, TITLE = {Asymptotic expansion of the {W}itten deformation of the analytic torsion}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {137}, YEAR = {1996}, NUMBER = {2}, PAGES = {320--363}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G26 (58G18)}, MRNUMBER = {97b:58147}, MRREVIEWER = {Steven Rosenberg}, } @incollection {Burghelea-Friedlander-Kappeler(1998), AUTHOR = {Burghelea, Dan and Friedlander, Leonid and Kappeler, Thomas}, TITLE = {Witten deformation of the analytic torsion and the {R}eidemeister torsion}, BOOKTITLE = {Voronezh Winter Mathematical Schools}, PAGES = {23--39}, NOTE = {Trans. Ser. 2 184 (1998)}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1998}, MRCLASS = {58J52 (57Q10 58J37)}, MRNUMBER = {2001c:58031}, MRREVIEWER = {Igor Prokhorenkov}, } @article {Burghelea-Friedlander-Kappeler(1999a), AUTHOR = {Burghelea, Dan and Friedlander, Leonid and Kappeler, Thomas}, TITLE = {Torsions for manifolds with boundary and glueing formulas}, JOURNAL = {Math. Nachr.}, FJOURNAL = {Mathematische Nachrichten}, VOLUME = {208}, YEAR = {1999}, PAGES = {31--91}, ISSN = {0025-584X}, MRCLASS = {58J52}, MRNUMBER = {2000m:58053}, MRREVIEWER = {Thomas Schick}, } @incollection {Burghelea-Friedlander-Kappeler(1999b), AUTHOR = {Burghelea, D. and Friedlander, L. and Kappeler, T.}, TITLE = {Relative torsion for homotopy triangulations}, BOOKTITLE = {Tel Aviv Topology Conference: Rothenberg Festschrift (1998)}, PAGES = {37--57}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1999}, MRCLASS = {58J52 (46L99 57Q10)}, MRNUMBER = {2000i:58058}, MRREVIEWER = {Joan Porti}, } @article {Burghelea-Friedlander-Kappeler(2001), AUTHOR = {Burghelea, Dan and Friedlander, Leonid and Kappeler, Thomas}, TITLE = {Relative torsion}, JOURNAL = {Commun. Contemp. Math.}, FJOURNAL = {Communications in Contemporary Mathematics}, VOLUME = {3}, YEAR = {2001}, NUMBER = {1}, PAGES = {15--85}, ISSN = {0219-1997}, MRCLASS = {58J52}, MRNUMBER = {1 820 014}, } @article {Burghelea-Friedlander-Kappeler-McDonald(1996a), AUTHOR = {Burghelea, D. and Friedlander, L. and Kappeler, T. and McDonald, P.}, TITLE = {Analytic and {R}eidemeister torsion for representations in finite type {H}ilbert modules}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {6}, YEAR = {1996}, NUMBER = {5}, PAGES = {751--859}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G26 (46L05 57Q10 58G12)}, MRNUMBER = {97i:58177}, MRREVIEWER = {Alan L. Carey}, } @article {Burghelea-Haller(2010), AUTHOR = {Burghelea, Dan and Haller, Stefan}, TITLE = {Complex valued {R}ay-{S}inger torsion {II}}, JOURNAL = {Math. Nachr.}, FJOURNAL = {Mathematische Nachrichten}, VOLUME = {283}, YEAR = {2010}, NUMBER = {10}, PAGES = {1372--1402}, ISSN = {0025-584X}, MRCLASS = {58J52}, MRNUMBER = {2744135 (2011j:58057)}, MRREVIEWER = {Rung-Tzung Huang}, DOI = {10.1002/mana.200910122}, URL = {http://dx.doi.org/10.1002/mana.200910122}, } @incollection {Burghelea-Haller(2008function), AUTHOR = {Burghelea, Dan and Haller, Stefan}, TITLE = {Torsion, as a function on the space of representations}, BOOKTITLE = {{$C^\ast$}-algebras and elliptic theory {II}}, SERIES = {Trends Math.}, PAGES = {41--66}, PUBLISHER = {Birkh\"auser, Basel}, YEAR = {2008}, MRCLASS = {58J52 (57R20)}, MRNUMBER = {2408135 (2009i:58045)}, MRREVIEWER = {Rung-Tzung Huang}, DOI = {10.1007/978-3-7643-8604-7_2}, URL = {http://dx.doi.org/10.1007/978-3-7643-8604-7_2}, } @article {Burghelea-Haller(2008dynamics), AUTHOR = {Burghelea, Dan and Haller, Stefan}, TITLE = {Dynamics, {L}aplace transform and spectral geometry}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {1}, YEAR = {2008}, NUMBER = {1}, PAGES = {115--151}, ISSN = {1753-8416}, MRCLASS = {58J52 (57R20 57R70 58J50)}, MRNUMBER = {2365654 (2008m:58074)}, MRREVIEWER = {Michael S. Farber}, DOI = {10.1112/jtopol/jtm005}, URL = {http://dx.doi.org/10.1112/jtopol/jtm005}, } @article {Burghelea-Haller(2007), AUTHOR = {Burghelea, Dan and Haller, Stefan}, TITLE = {Complex-valued {R}ay-{S}inger torsion}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {248}, YEAR = {2007}, NUMBER = {1}, PAGES = {27--78}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58J52}, MRNUMBER = {2329682 (2008b:58035)}, MRREVIEWER = {Thomas Schick}, DOI = {10.1016/j.jfa.2007.03.027}, URL = {http://dx.doi.org/10.1016/j.jfa.2007.03.027}, } @incollection {Burghelea-Haller(2006Riemannian), AUTHOR = {Burghelea, Dan and Haller, Stefan}, TITLE = {A {R}iemannian invariant, {E}uler structures and some topological applications}, BOOKTITLE = {{$C^\ast$}-algebras and elliptic theory}, SERIES = {Trends Math.}, PAGES = {37--60}, PUBLISHER = {Birkh\"auser, Basel}, YEAR = {2006}, MRCLASS = {58J52 (58J28)}, MRNUMBER = {2276914 (2007g:58033)}, MRREVIEWER = {Thomas Schick}, DOI = {10.1007/978-3-7643-7687-1_3}, URL = {http://dx.doi.org/10.1007/978-3-7643-7687-1_3}, } @article {Burghelea-Haller(2006Turaev), AUTHOR = {Burghelea, Dan and Haller, Stefan}, TITLE = {Euler structures, the variety of representations and the {M}ilnor-{T}uraev torsion}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {10}, YEAR = {2006}, PAGES = {1185--1238}, ISSN = {1465-3060}, MRCLASS = {58J52 (57Q10 58J28)}, MRNUMBER = {2255496 (2007i:58043)}, MRREVIEWER = {Dave Auckly}, DOI = {10.2140/gt.2006.10.1185}, URL = {http://dx.doi.org/10.2140/gt.2006.10.1185}, } @incollection {Burghelea-Haller(2001), AUTHOR = {Burghelea, Dan and Haller, Stefan}, TITLE = {On the topology and analysis of a closed one form. {I} ({N}ovikov's theory revisited)}, BOOKTITLE = {Essays on geometry and related topics, {V}ol. 1, 2}, SERIES = {Monogr. Enseign. Math.}, VOLUME = {38}, PAGES = {133--175}, PUBLISHER = {Enseignement Math., Geneva}, YEAR = {2001}, MRCLASS = {58J10 (57R70 58J50)}, MRNUMBER = {1929325 (2003h:58030)}, MRREVIEWER = {Michael S. Farber}, } @article {Burghelea-Lashof(1982), AUTHOR = {Burghelea, D. and Lashof, R.}, TITLE = {Geometric transfer and the homotopy type of the automorphism groups of a manifold}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {269}, YEAR = {1982}, NUMBER = {1}, PAGES = {1--38}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57R65 (20F38 55R10 58D05)}, MRNUMBER = {MR637027 (83c:57016)}, MRREVIEWER = {J. M. Boardman}, DOI = {10.2307/1998592}, URL = {http://dx.doi.org/10.2307/1998592}, } @article {Burghelea-Lashof(1977), AUTHOR = {Burghelea, D. and Lashof, R.}, TITLE = {Stability of concordances and the suspension homomorphism}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {105}, YEAR = {1977}, NUMBER = {3}, PAGES = {449--472}, MRCLASS = {57E05 (57A35 58D10)}, MRNUMBER = {55 \#11280}, MRREVIEWER = {Allen E. Hatcher}, } @article {Burghelea-Lashof(1974), AUTHOR = {Burghelea, Dan and Lashof, Richard}, TITLE = {The homotopy type of the space of diffeomorphisms. {I}, {II}}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {196}, YEAR = {1974}, PAGES = {1--36; ibid. 196\ (1974), 37--50}, ISSN = {0002-9947}, MRCLASS = {57E05 (58D05)}, MRNUMBER = {MR0356103 (50 \#8574)}, MRREVIEWER = {Edgar H. Brown}, } @book {Burghelea-Lashof-Rothenberg(1975), AUTHOR = {Burghelea, Dan and Lashof, Richard and Rothenberg, Melvin}, TITLE = {Groups of automorphisms of manifolds}, SERIES = {Lecture Notes in Mathematics, Vol. 473}, NOTE = {With an appendix (``The topological category'') by E. Pedersen}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1975}, PAGES = {vii+156}, MRCLASS = {57E05 (58D10)}, MRNUMBER = {MR0380841 (52 \#1738)}, MRREVIEWER = {E. C. Turner}, } @article {Burgos-Freixas-Litcanu-Ruazvan(2014), AUTHOR = {Burgos Gil, Jos{\'e} Ignacio and Freixas i Montplet, Gerard and Li{\c{t}}canu, R{\u{a}}zvan}, TITLE = {Generalized holomorphic analytic torsion}, JOURNAL = {J. Eur. Math. Soc. (JEMS)}, FJOURNAL = {Journal of the European Mathematical Society (JEMS)}, VOLUME = {16}, YEAR = {2014}, NUMBER = {3}, PAGES = {463--535}, ISSN = {1435-9855}, MRCLASS = {58J52 (19L10)}, MRNUMBER = {3165730}, MRREVIEWER = {Damian R{\"o}ssler}, DOI = {10.4171/JEMS/438}, URL = {http://dx.doi.org/10.4171/JEMS/438}, } @incollection {Burns-Mazzeo(1996), AUTHOR = {Burns, Dan and Mazzeo, Rafe}, TITLE = {On the geometry of cusps for ${\rm {S}{U}}(n,1)$}, BOOKTITLE = {Manifolds and geometry (Pisa, 1993)}, PAGES = {112--131}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1996}, MRCLASS = {32C18 (32H20 53C56)}, MRNUMBER = {98b:32008}, MRREVIEWER = {Kimio Miyajima}, } @book {Busemann(1955), AUTHOR = {Busemann, Herbert}, TITLE = {The geometry of geodesics}, PUBLISHER = {Academic Press Inc.}, ADDRESS = {New York, N. Y.}, YEAR = {1955}, PAGES = {x+422}, MRCLASS = {53.0X}, MRNUMBER = {17,779a}, MRREVIEWER = {L. W. Green}, } @book {Buser(1992), AUTHOR = {Buser, Peter}, TITLE = {Geometry and spectra of compact {R}iemann surfaces}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1992}, PAGES = {xiv+454}, ISBN = {0-8176-3406-1}, MRCLASS = {58G25 (30F99)}, MRNUMBER = {93g:58149}, MRREVIEWER = {Robert Brooks}, } @book {Buser-Karcher(1981), AUTHOR = {Buser, Peter and Karcher, Hermann}, TITLE = {Gromov's almost flat manifolds}, PUBLISHER = {Soci\'et\'e Math\'ematique de France}, ADDRESS = {Paris}, YEAR = {1981}, PAGES = {148}, MRCLASS = {53C30 (57R15)}, MRNUMBER = {83m:53070}, MRREVIEWER = {K. Grove}, } @book {Bushnell-Henniart(2006), AUTHOR = {Bushnell, Colin J. and Henniart, Guy}, TITLE = {The local {L}anglands conjecture for {$\rm GL(2)$}}, SERIES = {Grundlehren der Mathematischen Wissenschaften [Fundamental Principles of Mathematical Sciences]}, VOLUME = {335}, PUBLISHER = {Springer-Verlag, Berlin}, YEAR = {2006}, PAGES = {xii+347}, ISBN = {978-3-540-31486-8; 3-540-31486-5}, MRCLASS = {22E50 (11-02 11S37 22-02)}, MRNUMBER = {2234120}, MRREVIEWER = {Alexandru Ioan Badulescu}, DOI = {10.1007/3-540-31511-X}, URL = {http://dx.doi.org/10.1007/3-540-31511-X}, } @article {Bushnell-Kuzko(2001), AUTHOR = {Bushnell, Colin J. and Kutzko, Philip C.}, TITLE = {Types in reductive {$p$}-adic groups: the {H}ecke algebra of a cover}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {129}, YEAR = {2001}, NUMBER = {2}, PAGES = {601--607}, ISSN = {0002-9939}, MRCLASS = {22E50}, MRNUMBER = {1712937}, DOI = {10.1090/S0002-9939-00-05665-3}, URL = {http://dx.doi.org/10.1090/S0002-9939-00-05665-3}, } @article {Bushnell-Kutzko(1998smooth_reps), AUTHOR = {Bushnell, Colin J. and Kutzko, Philip C.}, TITLE = {Smooth representations of reductive {$p$}-adic groups: structure theory via types}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {77}, YEAR = {1998}, NUMBER = {3}, PAGES = {582--634}, ISSN = {0024-6115}, MRCLASS = {22E50 (22E35)}, MRNUMBER = {1643417}, MRREVIEWER = {David Goldberg}, DOI = {10.1112/S0024611598000574}, URL = {https://doi.org/10.1112/S0024611598000574}, } @article {Buss-Echterhoff-Willet(2018), AUTHOR = {Buss, Alcides and Echterhoff, Siegfried and Willett, Rufus}, TITLE = {Exotic crossed products and the {B}aum-{C}onnes conjecture}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"{u}r die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {740}, YEAR = {2018}, PAGES = {111--159}, ISSN = {0075-4102}, MRCLASS = {46L55 (19K35 46L40)}, MRNUMBER = {3824785}, MRREVIEWER = {Jonathan M. Rosenberg}, DOI = {10.1515/crelle-2015-0061}, URL = {https://doi.org/10.1515/crelle-2015-0061}, } @article {Bustamante-Farrell(2016), AUTHOR = {Bustamante, Mauricio and Farrell, F. Thomas and Jiang, Yi}, TITLE = {Rigidity and characteristic classes of smooth bundles with nonpositively curved fibers}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {9}, YEAR = {2016}, NUMBER = {3}, PAGES = {934--956}, ISSN = {1753-8416}, MRCLASS = {57R20 (53C24 57R22 58D17)}, MRNUMBER = {3551844}, MRREVIEWER = {Nick Salter}, DOI = {10.1112/jtopol/jtw015}, URL = {http://dx.doi.org/10.1112/jtopol/jtw015}, } @article {Buttig(1988), AUTHOR = {Buttig, Ingolf}, TITLE = {Spectral approximation by ${L}\sb 2$ discretization of the {L}aplace operator on manifolds of bounded geometry}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {6}, YEAR = {1988}, NUMBER = {1}, PAGES = {55--107}, ISSN = {0232-704X}, CODEN = {ANAGDV}, MRCLASS = {58G25}, MRNUMBER = {89m:58204}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @article {Button(2007), AUTHOR = {Button, Jack O.}, TITLE = {Mapping tori with first {B}etti number at least two}, JOURNAL = {J. Math. Soc. Japan}, FJOURNAL = {Journal of the Mathematical Society of Japan}, VOLUME = {59}, YEAR = {2007}, NUMBER = {2}, PAGES = {351--370}, ISSN = {0025-5645}, MRCLASS = {57M05 (20F65 57N10)}, MRNUMBER = {2325689}, MRREVIEWER = {Richard Weidmann}, URL = {http://projecteuclid.org/euclid.jmsj/1191247591}, } @article {Butz-Moerdijk(1999), AUTHOR = {Butz, Carsten and Moerdijk, Ieke}, TITLE = {Topological representation of sheaf cohomology of sites}, JOURNAL = {Compositio Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {118}, YEAR = {1999}, NUMBER = {2}, PAGES = {217--233}, ISSN = {0010-437X}, CODEN = {CMPMAF}, MRCLASS = {14F20 (18F10)}, MRNUMBER = {2000g:14027}, MRREVIEWER = {Paul Arne {\O}stv{\ae}r}, } @article {Buzzard-Calegari(2006), AUTHOR = {Buzzard, Kevin and Calegari, Frank}, TITLE = {The 2-adic eigencurve is proper}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, YEAR = {2006}, VOLUME = {Extra Vol.}, PAGES = {211--232 (electronic)}, ISSN = {1431-0635}, MRCLASS = {11F33 (11F85)}, MRNUMBER = {MR2290588 (2007j:11055)}, MRREVIEWER = {Thomas A. Weston}, } @incollection {Cahn-Gilkey-Wolf(1976), AUTHOR = {Cahn, Robert S. and Gilkey, Peter B. and Wolf, Joseph A.}, TITLE = {Heat equation, proportionality principle, and volume of fundamental domains}, BOOKTITLE = {Differential geometry and relativity}, PAGES = {43--54. Mathematical Phys. and Appl. Math., Vol. 3}, PUBLISHER = {Reidel}, ADDRESS = {Dordrecht}, YEAR = {1976}, MRCLASS = {58G05 (32N05 53C35)}, MRNUMBER = {55 \#9170}, MRREVIEWER = {Harold Donnelly}, } @article {Calegari(2009commutator), AUTHOR = {Calegari, Danny}, TITLE = {Stable commutator length is rational in free groups}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {22}, YEAR = {2009}, NUMBER = {4}, PAGES = {941--961}, ISSN = {0894-0347}, MRCLASS = {57M07 (20F65 20J05)}, MRNUMBER = {MR2525776}, DOI = {10.1090/S0894-0347-09-00634-1}, URL = {http://dx.doi.org/10.1090/S0894-0347-09-00634-1}, } @book {Calegari(2009book), AUTHOR = {Calegari, Danny}, TITLE = {scl}, SERIES = {MSJ Memoirs}, VOLUME = {20}, PUBLISHER = {Mathematical Society of Japan}, ADDRESS = {Tokyo}, YEAR = {2009}, PAGES = {xii+209}, ISBN = {978-4-931469-53-2}, MRCLASS = {57M07 (20F65 20F67 20Jxx 37Exx 37Jxx)}, MRNUMBER = {MR2527432}, } @article {Calegari(2009faces), AUTHOR = {Calegari, Danny}, TITLE = {Faces of the scl norm ball}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {13}, YEAR = {2009}, NUMBER = {3}, PAGES = {1313--1336}, ISSN = {1465-3060}, MRCLASS = {20F65 (55Nxx 57Mxx)}, MRNUMBER = {MR2496047}, DOI = {10.2140/gt.2009.13.1313}, URL = {http://dx.doi.org/10.2140/gt.2009.13.1313}, } @article {Calegari-Emerton(2011), AUTHOR = {Calegari, Frank and Emerton, Matthew}, TITLE = {Mod-{$p$} cohomology growth in {$p$}-adic analytic towers of 3-manifolds}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {5}, YEAR = {2011}, NUMBER = {2}, PAGES = {355--366}, ISSN = {1661-7207}, MRCLASS = {22E40 (57M50 57N10)}, MRNUMBER = {2782177 (2012b:22010)}, MRREVIEWER = {John G. Ratcliffe}, DOI = {10.4171/GGD/131}, URL = {http://dx.doi.org/10.4171/GGD/131}, } @article {Calegari-Emerton(2009bounds), AUTHOR = {Calegari, Frank and Emerton, Matthew}, TITLE = {Bounds for multiplicities of unitary representations of cohomological type in spaces of cusp forms}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {170}, YEAR = {2009}, NUMBER = {3}, PAGES = {1437--1446}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {22E55 (11F70 11F75)}, MRNUMBER = {2600878 (2011c:22032)}, MRREVIEWER = {Neven Grbac}, DOI = {10.4007/annals.2009.170.1437}, URL = {http://dx.doi.org/10.4007/annals.2009.170.1437}, } @article {Calegari-Mazur(2009), AUTHOR = {Calegari, Frank and Mazur, Barry}, TITLE = {Nearly ordinary {G}alois deformations over arbitrary number fields}, JOURNAL = {J. Inst. Math. Jussieu}, FJOURNAL = {Journal of the Institute of Mathematics of Jussieu. JIMJ. Journal de l'Institut de Math\'ematiques de Jussieu}, VOLUME = {8}, YEAR = {2009}, NUMBER = {1}, PAGES = {99--177}, ISSN = {1474-7480}, MRCLASS = {11F80 (11F75)}, MRNUMBER = {MR2461903 (2009i:11070)}, MRREVIEWER = {Lei Yang}, DOI = {10.1017/S1474748008000327}, URL = {http://dx.doi.org/10.1017/S1474748008000327}, } @article {Calegari-Emerton(2009curves), AUTHOR = {Calegari, Frank and Emerton, Matthew}, TITLE = {Elliptic curves of odd modular degree}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {169}, YEAR = {2009}, PAGES = {417--444}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {11G05 (14G25 14H52)}, MRNUMBER = {MR2460912}, DOI = {10.1007/s11856-009-0017-x}, URL = {http://dx.doi.org/10.1007/s11856-009-0017-x}, } @article {Calegari-Zhunag(2008), AUTHOR = {Calegari, Danny and Zhuang, Dongping}, TITLE = {Large scale geometry of commutator subgroups}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {8}, YEAR = {2008}, NUMBER = {4}, PAGES = {2131--2146}, ISSN = {1472-2747}, MRCLASS = {20F65 (57M07)}, MRNUMBER = {MR2460882 (2009k:20095)}, MRREVIEWER = {Bernhard Kr{\"o}n}, DOI = {10.2140/agt.2008.8.2131}, URL = {http://dx.doi.org/10.2140/agt.2008.8.2131}, } @article {Calegari(2008whatis), AUTHOR = {Calegari, Danny}, TITLE = {What is{$\ldots$} stable commutator length?}, JOURNAL = {Notices Amer. Math. Soc.}, FJOURNAL = {Notices of the American Mathematical Society}, VOLUME = {55}, YEAR = {2008}, NUMBER = {9}, PAGES = {1100--1101}, ISSN = {0002-9920}, CODEN = {AMNOAN}, MRCLASS = {57M99 (20F12 57R58)}, MRNUMBER = {MR2451345}, } @article {Calegari(2008interval), AUTHOR = {Calegari, Danny}, TITLE = {Nonsmoothable, locally indicable group actions on the interval}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {8}, YEAR = {2008}, NUMBER = {1}, PAGES = {609--613}, ISSN = {1472-2747}, MRCLASS = {37E05 (37C85 54H20)}, MRNUMBER = {MR2443241 (2009m:37109)}, MRREVIEWER = {Habib Marzougui}, DOI = {10.2140/agt.2008.8.609}, URL = {http://dx.doi.org/10.2140/agt.2008.8.609}, } @article {Calegari(2008surface), AUTHOR = {Calegari, Danny}, TITLE = {Surface subgroups from homology}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {12}, YEAR = {2008}, NUMBER = {4}, PAGES = {1995--2007}, ISSN = {1465-3060}, MRCLASS = {20F67 (20F34 20F65 57M07)}, MRNUMBER = {MR2431013 (2009d:20104)}, MRREVIEWER = {Stephen P. Humphries}, DOI = {10.2140/gt.2008.12.1995}, URL = {http://dx.doi.org/10.2140/gt.2008.12.1995}, } @article {Calegari(2008length), AUTHOR = {Calegari, Danny}, TITLE = {Length and stable length}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {18}, YEAR = {2008}, NUMBER = {1}, PAGES = {50--76}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {57M50 (20F99 57M07)}, MRNUMBER = {MR2399095 (2009m:57032)}, DOI = {10.1007/s00039-008-0656-9}, URL = {http://dx.doi.org/10.1007/s00039-008-0656-9}, } @article {Calegari(2008lengthsurface), AUTHOR = {Calegari, Danny}, TITLE = {Word length in surface groups with characteristic generating sets}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {136}, YEAR = {2008}, NUMBER = {7}, PAGES = {2631--2637}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57M07}, MRNUMBER = {MR2390536 (2008m:57001)}, MRREVIEWER = {Vassilis Metaftsis}, DOI = {10.1090/S0002-9939-08-09443-4}, URL = {http://dx.doi.org/10.1090/S0002-9939-08-09443-4}, } @article {Calegari(2008Coleman), AUTHOR = {Calegari, Frank}, TITLE = {The {C}oleman-{M}azur eigencurve is proper at integral weights}, JOURNAL = {Algebra Number Theory}, FJOURNAL = {Algebra \& Number Theory}, VOLUME = {2}, YEAR = {2008}, NUMBER = {2}, PAGES = {209--215}, ISSN = {1937-0652}, MRCLASS = {11F85 (11F11)}, MRNUMBER = {MR2377369 (2008m:11111)}, MRREVIEWER = {M. S. Mahadeva Naika}, DOI = {10.2140/ant.2008.2.209}, URL = {http://dx.doi.org/10.2140/ant.2008.2.209}, } @article {Cairns(1944), AUTHOR = {Cairns, Stewart S.}, TITLE = {Introduction of a {R}iemannian geometry on a triangulable 4-manifold}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {45}, YEAR = {1944}, PAGES = {218--219}, ISSN = {0003-486X}, MRCLASS = {56.0X}, MRNUMBER = {10272}, MRREVIEWER = {S.\ Chern}, DOI = {10.2307/1969264}, URL = {https://doi.org/10.2307/1969264}, } @article {Calegari(2007sepctral), AUTHOR = {Calegari, P. C. and Baz{\'a}n, F. S. V.}, TITLE = {Spectral analysis of a pseudospectral method for wave propagation under transparent boundary conditions}, JOURNAL = {TEMA Tend. Mat. Apl. Comput.}, FJOURNAL = {TEMA. Tend\^encias em Matem\'atica Aplicada e Computacional}, VOLUME = {8}, YEAR = {2007}, NUMBER = {2}, PAGES = {201--210}, ISSN = {1677-1966}, MRCLASS = {35L05 (35L15 35P05 65M70)}, MRNUMBER = {MR2372630}, } @article {Calegari(2007commutator), AUTHOR = {Calegari, Danny}, TITLE = {Stable commutator length in subgroups of {${\rm PL}^+(I)$}}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {232}, YEAR = {2007}, NUMBER = {2}, PAGES = {257--262}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {20F12 (20J05)}, MRNUMBER = {MR2366352 (2008m:20058)}, MRREVIEWER = {I. B. S. Passi}, DOI = {10.2140/pjm.2007.232.257}, URL = {http://dx.doi.org/10.2140/pjm.2007.232.257}, } @book {Calegari(2007foliations), AUTHOR = {Calegari, Danny}, TITLE = {Foliations and the geometry of 3-manifolds}, SERIES = {Oxford Mathematical Monographs}, PUBLISHER = {Oxford University Press}, ADDRESS = {Oxford}, YEAR = {2007}, PAGES = {xiv+363}, ISBN = {978-0-19-857008-0}, MRCLASS = {57R30 (37C85 57M50 57N10)}, MRNUMBER = {MR2327361 (2008k:57048)}, MRREVIEWER = {Thilo Kuessner}, } @article {Calegari(2007denominators), AUTHOR = {Calegari, Danny}, TITLE = {Denominator bounds in {T}hompson-like groups and flows}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {1}, YEAR = {2007}, NUMBER = {2}, PAGES = {101--109}, ISSN = {1661-7207}, MRCLASS = {37E45 (37E10 54H20)}, MRNUMBER = {MR2319453 (2008d:37069)}, MRREVIEWER = {Evgeny Zhuzhoma}, DOI = {10.4171/GGD/6}, URL = {http://dx.doi.org/10.4171/GGD/6}, } @article {Calegari(2006circles), AUTHOR = {Calegari, Danny}, TITLE = {Universal circles for quasigeodesic flows}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {10}, YEAR = {2006}, PAGES = {2271--2298 (electronic)}, ISSN = {1465-3060}, MRCLASS = {53C23 (37D40 57M50 57R30)}, MRNUMBER = {MR2284058 (2008m:53094)}, MRREVIEWER = {Thierry Barbot}, DOI = {10.2140/gt.2006.10.2271}, URL = {http://dx.doi.org/10.2140/gt.2006.10.2271}, } @article {Calegari(2006laminations), AUTHOR = {Calegari, Danny}, TITLE = {Promoting essential laminations}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {166}, YEAR = {2006}, NUMBER = {3}, PAGES = {583--643}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57M50 (37C85 57R30)}, MRNUMBER = {MR2257392 (2008c:57029)}, MRREVIEWER = {Richard J. Brown}, DOI = {10.1007/s00222-006-0004-3}, URL = {http://dx.doi.org/10.1007/s00222-006-0004-3}, } @article {Calegari-Dunfield(2006HNN), AUTHOR = {Calegari, Danny and Dunfield, Nathan M.}, TITLE = {An ascending {HNN} extension of a free group inside {${\rm SL}_2\Bbb C$}}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {134}, YEAR = {2006}, NUMBER = {11}, PAGES = {3131--3136 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {20E06 (57M07)}, MRNUMBER = {MR2231894 (2007f:20046)}, MRREVIEWER = {Martin Edjvet}, DOI = {10.1090/S0002-9939-06-08398-5}, URL = {http://dx.doi.org/10.1090/S0002-9939-06-08398-5}, } @article {Calmes-Dotto-Harpaz-Hebestreit-Land-Moi-Nardin-Nikolaus-Steimle(2023foundations), AUTHOR = {Calm\`es, Baptiste and Dotto, Emanuele and Harpaz, Yonatan and Hebestreit, Fabian and Land, Markus and Moi, Kristian and Nardin, Denis and Nikolaus, Thomas and Steimle, Wolfgang}, TITLE = {Hermitian {K}-theory for stable {$\infty$}-categories {I}: {F}oundations}, JOURNAL = {Selecta Math. (N.S.)}, FJOURNAL = {Selecta Mathematica. New Series}, VOLUME = {29}, YEAR = {2023}, } @article {Calmes-Hornbostel(2009), AUTHOR = {Calm{\`e}s, Baptiste and Hornbostel, Jens}, TITLE = {Tensor-triangulated categories and dualities}, JOURNAL = {Theory Appl. Categ.}, FJOURNAL = {Theory and Applications of Categories}, VOLUME = {22}, YEAR = {2009}, PAGES = {No. 6, 136--200}, ISSN = {1201-561X}, MRCLASS = {18D10}, MRNUMBER = {MR2520968}, } @incollection {Cameron(1995), AUTHOR = {Cameron, Peter J.}, TITLE = {Permutation groups}, BOOKTITLE = {Handbook of combinatorics, Vol.\ 1,\ 2}, PAGES = {611--645}, PUBLISHER = {Elsevier}, ADDRESS = {Amsterdam}, YEAR = {1995}, MRCLASS = {20B05 (20B07 20B25 20E32)}, MRNUMBER = {97e:20002}, MRREVIEWER = {Cheryl E. Praeger}, } @article {Campana(1981), AUTHOR = {Campana, F.}, TITLE = {Cor\'eduction alg\'ebrique d'un espace analytique faiblement k\"ahl\'erien compact}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {63}, YEAR = {1981}, NUMBER = {2}, PAGES = {187--223}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {32J20}, MRNUMBER = {84e:32028}, MRREVIEWER = {Gerd Fischer}, } @article {Campana(1985a), AUTHOR = {Campana, F.}, TITLE = {R\'eduction d'{A}lban\`ese d'un morphisme propre et faiblement k\"ahl\'erien. {I}}, JOURNAL = {Compositio Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {54}, YEAR = {1985}, NUMBER = {3}, PAGES = {373--398}, ISSN = {0010-437X}, CODEN = {CMPMAF}, MRCLASS = {32L99 (32H35 32J99 53C55)}, MRNUMBER = {87h:32058}, MRREVIEWER = {H. Kerner}, } @article {Campana(1985b), AUTHOR = {Campana, F.}, TITLE = {R\'eduction d'{A}lban\`ese d'un morphisme propre et faiblement k\"ahl\'erien. {I}{I}. {G}roupes d'automorphismes relatifs}, JOURNAL = {Compositio Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {54}, YEAR = {1985}, NUMBER = {3}, PAGES = {399--416}, ISSN = {0010-437X}, CODEN = {CMPMAF}, MRCLASS = {32L99 (32H35 32J99 53C55)}, MRNUMBER = {87h:32059}, MRREVIEWER = {H. Kerner}, } @article {Campana(1992), AUTHOR = {Campana, F.}, TITLE = {Connexit\'e rationnelle des vari\'et\'es de {F}ano}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {25}, YEAR = {1992}, NUMBER = {5}, PAGES = {539--545}, ISSN = {0012-9593}, CODEN = {ASENAH}, MRCLASS = {14J45}, MRNUMBER = {93k:14050}, MRREVIEWER = {Luciana Picco Botta}, } @article {Campana(1995), AUTHOR = {Campana, F.}, TITLE = {Fundamental group and positivity of cotangent bundles of compact {K}\"ahler manifolds}, JOURNAL = {J. Algebraic Geom.}, FJOURNAL = {Journal of Algebraic Geometry}, VOLUME = {4}, YEAR = {1995}, NUMBER = {3}, PAGES = {487--502}, ISSN = {1056-3911}, MRCLASS = {32J27 (14J15)}, MRNUMBER = {96f:32054}, MRREVIEWER = {Yoichi Miyaoka}, } @article{Canary(1993), AUTHOR = {Canary, Richard D.}, TITLE = {Ends of hyperbolic $3$-manifolds}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {6}, YEAR = {1993}, NUMBER = {1}, PAGES = {1--35}, ISSN = {0894-0347}, MRCLASS = {57M50 (30F40)}, MRNUMBER = {93e:57019}, MRREVIEWER = {Colin C. Adams}, } @inproceedings{Canary(1994), AUTHOR = {Canary, Richard D.}, TITLE = {Covering theorems for hyperbolic $3$-manifolds}, BOOKTITLE = {Low-dimensional topology (Knoxville, TN, 1992)}, PAGES = {21--30}, PUBLISHER = {Internat. Press}, ADDRESS = {Cambridge, MA}, YEAR = {1994}, MRCLASS = {57M50 (30F40 57N10)}, MRNUMBER = {95m:57024}, MRREVIEWER = {Alan W. Reid}, } @article {Canary-Minsky(1996), AUTHOR = {Canary, Richard D. and Minsky, Yair N.}, TITLE = {On limits of tame hyperbolic $3$-manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {43}, YEAR = {1996}, NUMBER = {1}, PAGES = {1--41}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57M50 (30F40 57N10)}, MRNUMBER = {98f:57021}, MRREVIEWER = {Ken-ichi Ohshika}, } @article {Cannon(1984), AUTHOR = {Cannon, James W.}, TITLE = {The combinatorial structure of cocompact discrete hyperbolic groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {16}, YEAR = {1984}, NUMBER = {2}, PAGES = {123--148}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F10 (05C25 22E40 57M05)}, MRNUMBER = {86j:20032}, MRREVIEWER = {William Harvey}, } @incollection {Cannon(1991), AUTHOR = {Cannon, James W.}, TITLE = {The theory of negatively curved spaces and groups}, BOOKTITLE = {Ergodic theory, symbolic dynamics, and hyperbolic spaces (Trieste, 1989)}, SERIES = {Oxford Sci. Publ.}, PAGES = {315--369}, PUBLISHER = {Oxford Univ. Press}, ADDRESS = {New York}, YEAR = {1991}, MRCLASS = {57S30 (20F32 53C23 57M07)}, MRNUMBER = {MR1130181}, } @article {Cannon-Cooper(1992), AUTHOR = {Cannon, J. W. and Cooper, Daryl}, TITLE = {A characterization of cocompact hyperbolic and finite-volume hyperbolic groups in dimension three}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {330}, YEAR = {1992}, NUMBER = {1}, PAGES = {419--431}, ISSN = {0002-9947}, MRCLASS = {22E40 (30F40 53C70 57M15)}, MRNUMBER = {1036000}, MRREVIEWER = {Fr\'ed\'eric Paulin}, DOI = {10.2307/2154172}, URL = {http://dx.doi.org/10.2307/2154172}, } @article {Cannon-Floyd-Parry(1996), AUTHOR = {Cannon, J. W. and Floyd, W. J. and Parry, W. R.}, TITLE = {Introductory notes on {R}ichard {T}hompson's groups}, JOURNAL = {Enseign. Math. (2)}, FJOURNAL = {L'Enseignement Math\'ematique. Revue Internationale. IIe S\'erie}, VOLUME = {42}, YEAR = {1996}, NUMBER = {3-4}, PAGES = {215--256}, ISSN = {0013-8584}, CODEN = {ENMAAR}, MRCLASS = {20F32 (57M07)}, MRNUMBER = {98g:20058}, MRREVIEWER = {Michael L. Mihalik}, } @article {Cannon-Swenson(1998), AUTHOR = {Cannon, J. W. and Swenson, E. L.}, TITLE = {Recognizing constant curvature discrete groups in dimension {$3$}}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {350}, YEAR = {1998}, NUMBER = {2}, PAGES = {809--849}, ISSN = {0002-9947}, MRCLASS = {57M50 (20F32 30F40 57N10)}, MRNUMBER = {1458317}, MRREVIEWER = {Michel Coornaert}, DOI = {10.1090/S0002-9947-98-02107-2}, URL = {http://dx.doi.org/10.1090/S0002-9947-98-02107-2}, } @incollection {Cannon(2002), AUTHOR = {Cannon, J. W.}, TITLE = {Geometric group theory}, BOOKTITLE = {Handbook of geometric topology}, PAGES = {261--305}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {2002}, MRCLASS = {20F65 (20-02 20F67 57M07 57M50)}, MRNUMBER = {MR1886672 (2003d:20053)}, MRREVIEWER = {Michel Coornaert}, } @article {Cao-Chow(1999), AUTHOR = {Cao, Huai-Dong and Chow, Bennett}, TITLE = {Recent developments on the {R}icci flow}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {36}, YEAR = {1999}, NUMBER = {1}, PAGES = {59--74}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {53C21 (58G11)}, MRNUMBER = {99j:53044}, MRREVIEWER = {Man Chun Leung}, } @article {Cao-Xavier(2001), AUTHOR = {Cao, Jianguo and Xavier, Frederico}, TITLE = {K\"ahler parabolicity and the {E}uler number of compact manifolds of non-positive sectional curvature}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {319}, YEAR = {2001}, NUMBER = {3}, PAGES = {483--491}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {53Cxx (32Qxx)}, MRNUMBER = {1 819 879}, } @article {Cappell(1973), AUTHOR = {Cappell, Sylvain E.}, TITLE = {Splitting obstructions for {H}ermitian forms and manifolds with ${Z}\sb{2}\subset \pi \sb{1}$}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {79}, YEAR = {1973}, PAGES = {909--913}, MRCLASS = {57D65 (57A35)}, MRNUMBER = {49 \#3987}, MRREVIEWER = {Ronnie Lee}, } @incollection {Cappell(1973a), AUTHOR = {Cappell, Sylvain E.}, TITLE = {Mayer-{V}ietoris sequences in hermitian {$K$}-theory}, BOOKTITLE = {Algebraic K-theory, III: Hermitian K-theory and geometric applications (Proc. Conf., Battelle Memorial Inst., Seattle, Wash., 1972)}, PAGES = {478--512. Lecture Notes in Math., Vol. 343}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1973}, MRCLASS = {57D65 (18F25 20E30)}, MRNUMBER = {50 \#11273}, MRREVIEWER = {R. Schultz}, } @article {Cappell(1974a), AUTHOR = {Cappell, Sylvain E.}, TITLE = {On connected sums of manifolds}, JOURNAL = {Topology}, VOLUME = {13}, YEAR = {1974}, PAGES = {395--400}, MRCLASS = {57C10 (57D65)}, MRNUMBER = {50 \#11252}, MRREVIEWER = {K. W. Kwun}, } @article {Cappell(1974b), AUTHOR = {Cappell, Sylvain E.}, TITLE = {Manifolds with fundamental group a generalized free product. {I}}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {80}, YEAR = {1974}, PAGES = {1193--1198}, MRCLASS = {57D65 (57A35 57C35 57D40 57D80)}, MRNUMBER = {50 \#8562}, MRREVIEWER = {R. K. Lashof}, } @article {Cappell(1974c), AUTHOR = {Cappell, Sylvain E.}, TITLE = {Unitary nilpotent groups and {H}ermitian ${K}$-theory. {I}}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {80}, YEAR = {1974}, PAGES = {1117--1122}, MRCLASS = {57D65 (16A54 18F25)}, MRNUMBER = {50 \#11274}, MRREVIEWER = {R. Schultz}, } @article {Cappell(1976a), AUTHOR = {Cappell, Sylvain E.}, TITLE = {A splitting theorem for manifolds}, JOURNAL = {Invent. Math.}, VOLUME = {33}, YEAR = {1976}, NUMBER = {2}, PAGES = {69--170}, MRCLASS = {57D65}, MRNUMBER = {55 \#11274}, MRREVIEWER = {Edgar H. Brown, Jr.}, } @article {Cappell(1976b), AUTHOR = {Cappell, Sylvain E.}, TITLE = {On homotopy invariance of higher signatures}, JOURNAL = {Invent. Math.}, VOLUME = {33}, YEAR = {1976}, NUMBER = {2}, PAGES = {171--179}, MRCLASS = {57D20}, MRNUMBER = {55 \#11264}, MRREVIEWER = {Edgar H. Brown, Jr.}, } @article {Cappell-Lubotzky-Weinberger(2018), AUTHOR = {Cappell, Sylvain and Lubotzky, Alexander and Weinberger, Shmuel}, TITLE = {A trichotomy theorem for transformation groups of locally symmetric manifolds and topological rigidity}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {327}, YEAR = {2018}, PAGES = {25--46}, ISSN = {0001-8708}, MRCLASS = {57S30 (22E40 22F30 53C35 57S17 57S20)}, MRNUMBER = {3761989}, MRREVIEWER = {Rainer L\"{o}wen}, DOI = {10.1016/j.aim.2017.06.010}, URL = {https://doi.org/10.1016/j.aim.2017.06.010}, } @article {Cappell-Miller(2010), AUTHOR = {Cappell, Sylvain E. and Miller, Edward Y.}, TITLE = {Complex-valued analytic torsion for flat bundles and for holomorphic bundles with {$(1,1)$} connections}, JOURNAL = {Comm. Pure Appl. Math.}, FJOURNAL = {Communications on Pure and Applied Mathematics}, VOLUME = {63}, YEAR = {2010}, NUMBER = {2}, PAGES = {133--202}, ISSN = {0010-3640}, CODEN = {CPAMA}, MRCLASS = {58J52 (32L05)}, MRNUMBER = {2588459 (2011a:58061)}, MRREVIEWER = {Paul A. Kirk}, DOI = {10.1002/cpa.20307}, URL = {http://dx.doi.org/10.1002/cpa.20307}, } @book {Cappell-Ranicki-Rosenberg(2000), TITLE = {Surveys on surgery theory. {V}ol. 1}, EDITOR = {Cappell, Sylvain and Ranicki, Andrew and Rosenberg, Jonathan}, NOTE = {Papers dedicated to C. T. C. Wall}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {2000}, PAGES = {viii+439}, ISBN = {0-691-04937-8; 0-691-04938-6}, MRCLASS = {57-06 (57R99)}, MRNUMBER = {2000k:57004}, } @book {Cappell-Ranicki-Rosenberg(2001), TITLE = {Surveys on surgery theory. {V}ol. 2}, EDITOR = {Cappell, Sylvain and Ranicki, Andrew and Rosenberg, Jonathan}, NOTE = {Papers dedicated to C. T. C. Wall}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {2001}, PAGES = {viii+436}, ISBN = {0-691-08814-4; 0-691-08815-2}, MRCLASS = {57-06 (00B30 19J25 57R65)}, MRNUMBER = {2001i:57001}, } @article {Cappell-Shaneson(1971), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {On four dimensional surgery and applications}, JOURNAL = {Comment. Math. Helv.}, VOLUME = {46}, YEAR = {1971}, PAGES = {500--528}, MRCLASS = {57D65}, MRNUMBER = {46 \#905}, MRREVIEWER = {J. Milnor}, } @article {Cappell-Shaneson(1974), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {The codimension two placement problem and homology equivalent manifolds}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {99}, YEAR = {1974}, PAGES = {277--348}, ISSN = {0003-486X}, MRCLASS = {57D40}, MRNUMBER = {339216}, MRREVIEWER = {J. P. Levine}, DOI = {10.2307/1970901}, URL = {https://doi.org/10.2307/1970901}, } @article {Cappell-Shaneson(1976), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Some new four-manifolds}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {104}, YEAR = {1976}, NUMBER = {1}, PAGES = {61--72}, MRCLASS = {57D65 (57E25)}, MRNUMBER = {54 \#6167}, MRREVIEWER = {Allan Edmonds}, } @article {Cappell-Shaneson(1981), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Nonlinear similarity}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {113}, YEAR = {1981}, NUMBER = {2}, PAGES = {315--355}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57S99 (57R67 58F10 58F19)}, MRNUMBER = {83h:57060}, MRREVIEWER = {Frank Quinn}, } @article {Cappell-Shaneson(1985), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {On $4$-dimensional $s$-cobordisms}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {22}, YEAR = {1985}, NUMBER = {1}, PAGES = {97--115}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57R80 (57N70)}, MRNUMBER = {87j:57021}, MRREVIEWER = {J. H. Rubinstein}, } @incollection {Cappell-Shaneson(1985torsion), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Torsion in {$L$}-groups}, BOOKTITLE = {Algebraic and geometric topology ({N}ew {B}runswick, {N}.{J}., 1983)}, SERIES = {Lecture Notes in Math.}, VOLUME = {1126}, PAGES = {22--50}, PUBLISHER = {Springer, Berlin}, YEAR = {1985}, MRCLASS = {57R67 (18F25 19G24)}, MRNUMBER = {802784}, MRREVIEWER = {Christopher W. Stark}, DOI = {10.1007/BFb0074437}, URL = {https://doi.org/10.1007/BFb0074437}, } @article {Cappell-Shaneson(1991a), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Singular spaces, characteristic classes, and intersection homology}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {134}, YEAR = {1991}, NUMBER = {2}, PAGES = {325--374}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57N80 (14B05 55N33)}, MRNUMBER = {92m:57026}, MRREVIEWER = {A. A. Ranicki}, } @article {Cappell-Shaneson(1991b), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Stratifiable maps and topological invariants}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {4}, YEAR = {1991}, NUMBER = {3}, PAGES = {521--551}, ISSN = {0894-0347}, MRCLASS = {57R45 (55P10 57N80)}, MRNUMBER = {92d:57024}, MRREVIEWER = {A. A. Ranicki}, } @article {Cappell-Shaneson(1994), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Genera of algebraic varieties and counting of lattice points}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {30}, YEAR = {1994}, NUMBER = {1}, PAGES = {62--69}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {14F45 (11P21 14M25 32S60)}, MRNUMBER = {94f:14018}, MRREVIEWER = {A. Hirschowitz}, } @article {Cappell-Shaneson(1995), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L.}, TITLE = {Euler-{M}aclaurin expansions for lattices above dimension one}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {321}, YEAR = {1995}, NUMBER = {7}, PAGES = {885--890}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {52B20 (11P21 14M25)}, MRNUMBER = {96i:52012}, } @article {Cappell-Shaneson-Steinberger-West(1989), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L. and Steinberger, Mark and West, James E.}, TITLE = {Nonlinear similarity begins in dimension six}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {111}, YEAR = {1989}, NUMBER = {5}, PAGES = {717--752}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {57S17 (19M05 57S25)}, MRNUMBER = {1020826 (91e:57065)}, MRREVIEWER = {Ian Hambleton}, DOI = {10.2307/2374878}, URL = {http://dx.doi.org/10.2307/2374878}, } @article {Cappell-Shaneson-Steinberger-Weinberger-West(1990), AUTHOR = {Cappell, Sylvain E. and Shaneson, Julius L. and Steinberger, Mark and Weinberger, Shmuel and West, James E.}, TITLE = {The classification of nonlinear similarities over ${Z}\sb {2\sp r}$}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {22}, YEAR = {1990}, NUMBER = {1}, PAGES = {51--57}, ISSN = {0273-0979}, CODEN = {BAMOAD}, MRCLASS = {57S17 (57S25)}, MRNUMBER = {90e:57070}, MRREVIEWER = {Katsuo Kawakubo}, } @article {Cappell-Weinberger(1985), AUTHOR = {Cappell, Sylvain and Weinberger, Shmuel}, TITLE = {Parallelizability of finite ${H}$-spaces}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {60}, YEAR = {1985}, NUMBER = {4}, PAGES = {628--629}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {55P45}, MRNUMBER = {87c:55007}, MRREVIEWER = {R. E. Stong}, } @article {Cappell-Weinberger(1987), AUTHOR = {Cappell, Sylvain and Weinberger, Shmuel}, TITLE = {Homology propagation of group actions}, JOURNAL = {Comm. Pure Appl. Math.}, FJOURNAL = {Communications on Pure and Applied Mathematics}, VOLUME = {40}, YEAR = {1987}, NUMBER = {6}, PAGES = {723--744}, ISSN = {0010-3640}, CODEN = {CPAMA}, MRCLASS = {57S17 (57R65 57R67)}, MRNUMBER = {88m:57048}, MRREVIEWER = {Amir H. Assadi}, } @article {Cappell-Weinberger(1988), AUTHOR = {Cappell, Sylvain and Weinberger, Shmuel}, TITLE = {Which ${H}$-spaces are manifolds? {I}}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {27}, YEAR = {1988}, NUMBER = {4}, PAGES = {377--386}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57R67 (19M05 55P45 57-02)}, MRNUMBER = {89k:57066}, MRREVIEWER = {A. A. Ranicki}, } @incollection{Cappell-Weinberger(2001), AUTHOR = {Cappell, Sylvain and Weinberger, Shmuel}, TITLE = {Surgery theoretic methods in group actions}, BOOKTITLE = {Surveys on surgery theory, {V}ol. 2}, SERIES = {Ann. of Math. Stud.}, VOLUME = {149}, PAGES = {285--317}, PUBLISHER = {Princeton Univ. Press, Princeton, NJ}, YEAR = {2001}, ISBN = {0-691-08814-4; 0-691-08815-2}, MRCLASS = {57R65 (57S17)}, MRNUMBER = {1818776}, } @article{Cappell-Weinberger-Yan(2013), author = {Cappell, Sylvain E. and Weinberger, Shmuel and Yan, Min}, title = {Closed aspherical manifolds with center}, Journal = {Journal of Topology}, Volume = {6}, Pages = {1009-1018}, year = 2014, } @article {Caprace-Marquis(2022), AUTHOR = {Caprace, Pierre-Emmanuel and Marquis, Timoth\'{e}e and Reid, Colin D.}, TITLE = {Locally normal subgroups and ends of locally compact {K}ac-{M}oody groups}, JOURNAL = {M\"{u}nster J. Math.}, FJOURNAL = {M\"{u}nster Journal of Mathematics}, VOLUME = {15}, YEAR = {2022}, NUMBER = {2}, PAGES = {473--498}, ISSN = {1867-5778}, MRCLASS = {20G44 (20E42 22D05)}, MRNUMBER = {4541291}, } @article{Caprace-Marquis(2013), AUTHOR = {Caprace, Pierre-Emmanuel and Marquis, Timoth\'{e}e}, TITLE = {Open subgroups of locally compact {K}ac-{M}oody groups}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {274}, YEAR = {2013}, NUMBER = {1-2}, PAGES = {291--313}, ISSN = {0025-5874}, MRCLASS = {20E42 (20F55)}, MRNUMBER = {3054330}, MRREVIEWER = {Jean L\'{e}cureux}, DOI = {10.1007/s00209-012-1070-4}, URL = {https://doi.org/10.1007/s00209-012-1070-4}, } @incollection {Caraiani-Fintzen-Varma(2016), AUTHOR = {Caraiani, Ana and Eischen, Ellen and Fintzen, Jessica and Mantovan, Elena and Varma, Ila}, TITLE = {{$p$}-adic {$q$}-expansion principles on unitary {S}himura varieties}, BOOKTITLE = {Directions in number theory}, SERIES = {Assoc. Women Math. Ser.}, VOLUME = {3}, PAGES = {197--243}, PUBLISHER = {Springer, [Cham]}, YEAR = {2016}, MRCLASS = {11F85}, MRNUMBER = {3596581}, MRREVIEWER = {U. K. Anandavardhanan}, DOI = {10.1007/978-3-319-30976-7\_7}, URL = {https://doi.org/10.1007/978-3-319-30976-7_7}, } @article {Caraiani-Scholze(2017), AUTHOR = {Caraiani, Ana and Scholze, Peter}, TITLE = {On the generic part of the cohomology of compact unitary {S}himura varieties}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {186}, YEAR = {2017}, NUMBER = {3}, PAGES = {649--766}, ISSN = {0003-486X}, MRCLASS = {11F75 (11G18 11R23 14G35)}, MRNUMBER = {3702677}, MRREVIEWER = {Nguy\cftil{e}n Qu\^{o}c Th\'{a}ng}, DOI = {10.4007/annals.2017.186.3.1}, URL = {https://doi.org/10.4007/annals.2017.186.3.1}, } @article {Cardenas-Pedersen(1997), AUTHOR = {C{\'a}rdenas, M. and Pedersen, E. K.}, TITLE = {On the {K}aroubi filtration of a category}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {12}, YEAR = {1997}, NUMBER = {2}, PAGES = {165--191}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {18F25 (19D10)}, MRNUMBER = {98g:18012}, MRREVIEWER = {Frank Neumann}, } @article{Carey-Coulhon-Mathai-Philips(1998), AUTHOR = {Carey, Alan L. and Coulhon, Thierry and Mathai, Varghese and Phillips, John}, TITLE = {Von {N}eumann spectra near the spectral gap}, JOURNAL = {Bull. Sci. Math.}, FJOURNAL = {Bulletin des Sciences Math\'ematiques}, VOLUME = {122}, YEAR = {1998}, NUMBER = {3}, PAGES = {203--242}, ISSN = {0007-4497}, CODEN = {BSMQA9}, MRCLASS = {58G26 (58G11 58G25)}, MRNUMBER = {99g:58128}, MRREVIEWER = {Patrick T. McDonald}, } @article{Carey-Farber-Mathai(1997), AUTHOR = {Carey, Alan L. and Farber, Michael and Mathai, Varghese}, TITLE = {Determinant lines, von {N}eumann algebras and ${L}\sp 2$ torsion}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {484}, YEAR = {1997}, PAGES = {153--181}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {58G26 (46H25 46L10 46L85)}, MRNUMBER = {98c:58175}, MRREVIEWER = {Patrick T. McDonald}, } @article{Carey-Hannabuss-Mathai-McCann(1998), AUTHOR = {Carey, A. L. and Hannabuss, K. C. and Mathai, V. and McCann, P.}, TITLE = {Quantum {H}all effect on the hyperbolic plane}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {190}, YEAR = {1998}, NUMBER = {3}, PAGES = {629--673}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G12 (19K35 19K56 46L60 81V70)}, MRNUMBER = {99f:58195}, MRREVIEWER = {Albert Jeu-Liang Sheu}, } @Article{Carey-Mathai(1990), author = {Carey, A.L. and Mathai, V.}, title = {$L^2$-acyclicity and $L^2$-torsion invariants}, journal = {Contemporary Mathematics}, volume = 105, pages = {141--155}, year = 1990, } @article{Carey-Mathai(1992), AUTHOR = {Carey, Alan L. and Mathai, Varghese}, TITLE = {${L}\sp 2$-torsion invariants}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {110}, YEAR = {1992}, NUMBER = {2}, PAGES = {377--409}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G26 (46L10 57Q10)}, MRNUMBER = {94a:58211}, MRREVIEWER = {Steven Rosenberg}, } @article{Carlson-Henn(1995), AUTHOR = {Carlson, Jon F. and Henn, Hans-Werner}, TITLE = {Depth and the cohomology of wreath products}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {87}, YEAR = {1995}, NUMBER = {2}, PAGES = {145--151}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {20J05 (20E22)}, MRNUMBER = {96f:20079}, MRREVIEWER = {Veena Sharma}, } @article{Carlsson(1981), AUTHOR = {Carlsson, Gunnar}, TITLE = {A counterexample to a conjecture of {S}teenrod}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {64}, YEAR = {1981}, NUMBER = {1}, PAGES = {171--174}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57S17 (20C07)}, MRNUMBER = {82j:57036}, MRREVIEWER = {J. F. Adams}, } @article{Carlsson(1983), AUTHOR = {Carlsson, Gunnar}, TITLE = {G. {B}. {S}egal's {B}urnside ring conjecture for $({\mathbf {Z}}/2)\sp{k}$}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {22}, YEAR = {1983}, NUMBER = {1}, PAGES = {83--103}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P42 (55T15)}, MRNUMBER = {84a:55007}, MRREVIEWER = {J. F. Adams}, } @article{Carlsson(1984), AUTHOR = {Carlsson, Gunnar}, TITLE = {Equivariant stable homotopy and {S}egal's {B}urnside ring conjecture}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {120}, YEAR = {1984}, NUMBER = {2}, PAGES = {189--224}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57S17 (55P91)}, MRNUMBER = {86f:57036}, MRREVIEWER = {J. P. May}, } @inproceedings {Carlsson(1987a), AUTHOR = {Carlsson, Gunnar}, TITLE = {Segal's {B}urnside ring conjecture and related problems in topology}, BOOKTITLE = {Proceedings of the International Congress of Mathematicians, Vol. 1, 2 (Berkeley, Calif., 1986)}, PAGES = {574--579}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1987}, MRCLASS = {55N91 (18F25 19D99 55P99)}, MRNUMBER = {MR934258 (89g:55010)}, MRREVIEWER = {J. F. Adams}, } @incollection {Carlsson(1987b), AUTHOR = {Carlsson, Gunnar}, TITLE = {Segal's {B}urnside ring conjecture and the homotopy limit problem}, BOOKTITLE = {Homotopy theory (Durham, 1985)}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {117}, PAGES = {6--34}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1987}, MRCLASS = {55P91 (55P42)}, MRNUMBER = {MR932258 (89g:55020)}, MRREVIEWER = {Haynes R. Miller}, } @article{Carlsson(1992a), AUTHOR = {Carlsson, Gunnar}, TITLE = {A survey of equivariant stable homotopy theory}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {31}, YEAR = {1992}, NUMBER = {1}, PAGES = {1--27}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55N91 (55P42 55P91)}, MRNUMBER = {93d:55009}, MRREVIEWER = {J. P. C. Greenlees}, } @incollection {Carlsson(1992b), AUTHOR = {Carlsson, Gunnar}, TITLE = {Bounded ${K}$-theory and the assembly map in algebraic ${K}$-theory}, BOOKTITLE = {Novikov conjectures, index theorems and rigidity, Vol.\ 2 (Oberwolfach, 1993)}, PAGES = {5--127}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1995}, MRCLASS = {19D50 (55R40)}, MRNUMBER = {97c:19002}, MRREVIEWER = {A. A. Ranicki}, } @Article{Carlsson(1995), author = {Carlsson, G.}, title = {On the algebraic ${K}$-theory of infinite product categories}, journal = {K-theory}, volume = 9, pages = {305--322}, year = 1995, } @article {Carlsson(2001Problemsession), AUTHOR = {Carlsson, Gunnar}, TITLE = {Problem session}, NOTE = {Equivariant stable homotopy theory and related areas (Stanford, CA, 2000)}, JOURNAL = {Homology Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {3}, YEAR = {2001}, NUMBER = {2}, PAGES = {vii--xv (electronic)}, ISSN = {1512-0139}, MRCLASS = {55-02 (18-02 57-02)}, MRNUMBER = {MR1856027}, } @proceedings {Carlsson(2001equivariantstablehomotopy), TITLE = {Equivariant stable homotopy theory and related areas}, BOOKTITLE = {Proceedings of the workshop held at Stanford University, Stanford, CA, August 23--27, 2000}, EDITOR = {Carlsson, Gunnar}, NOTE = {Homology Homotopy Appl. {\bf 3} (2001), no. 2}, PUBLISHER = {Homology, Homotopy and Applications, Tbilisi}, YEAR = {2001}, PAGES = {i--xvi and 225--451 (electronic)}, ISSN = {1512-0139}, MRCLASS = {55-06}, MRNUMBER = {MR1848189}, } @incollection {Carlsson(2002), AUTHOR = {Carlsson, Gunnar}, TITLE = {Recent developments in algebraic {$K$}-theory}, BOOKTITLE = {Current developments in mathematics, 2001}, PAGES = {1--40}, PUBLISHER = {Int. Press, Somerville, MA}, YEAR = {2002}, MRCLASS = {19-02 (19D06 19D50)}, MRNUMBER = {MR1971376 (2005a:19001)}, MRREVIEWER = {Jerry Lodder}, } @proceedings {Carlsson(2003), TITLE = {Algebraic topological methods in computer science}, BOOKTITLE = {Proceedings of the workshop held at Stanford University, Stanford, CA, July 30--August 3, 2001}, EDITOR = {Carlsson, Gunnar}, NOTE = {Homology Homotopy Appl. {\bf 5} (2003), no. 2}, PUBLISHER = {Homology, Homotopy and Applications, Tbilisi}, YEAR = {2003}, PAGES = {i--vi and 1--280 (electronic)}, ISSN = {1512-0139}, MRCLASS = {55-06 (68-06 68Q85)}, MRNUMBER = {MR1994937}, } @incollection {Carlsson(2005), AUTHOR = {Carlsson, Gunnar}, TITLE = {Deloopings in algebraic {$K$}-theory}, BOOKTITLE = {Handbook of $K$-theory. Vol. 1, 2}, PAGES = {3--37}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2005}, MRCLASS = {19Dxx (55P48)}, MRNUMBER = {MR2181819}, } @article {Carlson(2008), AUTHOR = {Carlsson, Gunnar}, TITLE = {Derived completions in stable homotopy theory}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {212}, YEAR = {2008}, NUMBER = {3}, PAGES = {550--577}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55P43 (13J10 55P60)}, MRNUMBER = {MR2365333}, } @article {Carlsson+Carlsson+deSilva(2006), AUTHOR = {Carlsson, Erik and Carlsson, Gunnar and de Silva, Vin}, TITLE = {An algebraic topological method for feature identification}, JOURNAL = {Internat. J. Comput. Geom. Appl.}, FJOURNAL = {International Journal of Computational Geometry \& Applications}, VOLUME = {16}, YEAR = {2006}, NUMBER = {4}, PAGES = {291--314}, ISSN = {0218-1959}, MRCLASS = {52B55 (68T45 68U05)}, MRNUMBER = {MR2250511 (2007c:52015)}, } @book{Carlsson-Cohen-Hsiang-Jones(1994), TITLE = {Algebraic topology and its applications}, EDITOR = {Carlsson, G. E. and Cohen, R. L. and Hsiang, W. C. and Jones, J. D. S.}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1994}, PAGES = {viii+267}, ISBN = {0-387-94098-7}, MRCLASS = {55-06 (57-06)}, MRNUMBER = {95b:55001}, MRREVIEWER = {A. A. Ranicki}, } @article {Carlsson+deSilva(2004), AUTHOR = {Carlsson, Gunnar and de Silva, Vin}, TITLE = {A geometric framework for sparse matrix problems}, JOURNAL = {Adv. in Appl. Math.}, FJOURNAL = {Advances in Applied Mathematics}, VOLUME = {33}, YEAR = {2004}, NUMBER = {1}, PAGES = {1--25}, ISSN = {0196-8858}, MRCLASS = {65F50 (55T05)}, MRNUMBER = {MR2064354 (2005b:65050)}, } @article {Carlsson+Goldfarb(2004Novikov), AUTHOR = {Carlsson, Gunnar and Goldfarb, Boris}, TITLE = {The integral {$K$}-theoretic {N}ovikov conjecture for groups with finite asymptotic dimension}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {157}, YEAR = {2004}, NUMBER = {2}, PAGES = {405--418}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {19G24 (19L47 20F65 57R67 57S30)}, MRNUMBER = {MR2076928 (2005g:19007)}, MRREVIEWER = {Tsuyoshi Kato}, } @article {Carlsson+Goldfarb(2004coherence), AUTHOR = {Carlsson, Gunnar and Goldfarb, Boris}, TITLE = {On homological coherence of discrete groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {276}, YEAR = {2004}, NUMBER = {2}, PAGES = {502--514}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20J05 (19D50 20F69 22E25)}, MRNUMBER = {MR2058455 (2005a:20078)}, MRREVIEWER = {Alexander N. Dranishnikov}, } @article {Carlsson-Goldfarb(2011), AUTHOR = {Carlsson, Gunnar and Goldfarb, Boris}, TITLE = {Controlled algebraic {$G$}-theory, {I}}, JOURNAL = {J. Homotopy Relat. Struct.}, FJOURNAL = {Journal of Homotopy and Related Structures}, VOLUME = {6}, YEAR = {2011}, NUMBER = {1}, PAGES = {119--159}, MRCLASS = {19D35 (18E10 18E30 18E35)}, MRNUMBER = {2818704 (2012h:19007)}, MRREVIEWER = {Stanis{\l}aw Betley}, } @incollection{Carlsson-Milgram(1995), AUTHOR = {Carlsson, Gunnar and Milgram, R. James}, TITLE = {Stable homotopy and iterated loop spaces}, BOOKTITLE = {Handbook of algebraic topology}, PAGES = {505--583}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {1995}, MRCLASS = {55P35 (55P42)}, MRNUMBER = {97j:55007}, MRREVIEWER = {Lionel Schwartz}, } @article{Carlsson-Pedersen(1995a), AUTHOR = {Carlsson, Gunnar and Pedersen, Erik Kj{\ae}r}, TITLE = {Controlled algebra and the {N}ovikov conjectures for ${K}$- and ${L}$-theory}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {34}, YEAR = {1995}, NUMBER = {3}, PAGES = {731--758}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {19D10 (19G24 55R40)}, MRNUMBER = {96f:19006}, MRREVIEWER = {A. A. Ranicki}, } @article {Carlsson-Pedersen(1998Cech), AUTHOR = {Carlsson, Gunnar and Pedersen, Erik Kj{\ae}r}, TITLE = {\v {C}ech homology and the {N}ovikov conjectures for {$K$}- and {$L$}-theory}, JOURNAL = {Math. Scand.}, FJOURNAL = {Mathematica Scandinavica}, VOLUME = {82}, YEAR = {1998}, NUMBER = {1}, PAGES = {5--47}, ISSN = {0025-5521}, CODEN = {MTSCAN}, MRCLASS = {55N05 (18F25 19G24 55N40)}, MRNUMBER = {1634649 (99e:55004)}, MRREVIEWER = {A. A. Ranicki}, } @article {Carlsson-Pedersen-Vogell(1998), AUTHOR = {Carlsson, Gunnar and Pedersen, Erik Kj{\ae}r and Vogell, Wolrad}, TITLE = {Continuously controlled algebraic {$K$}-theory of spaces and the {N}ovikov conjecture}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {310}, YEAR = {1998}, NUMBER = {1}, PAGES = {169--182}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {19D10 (55N20 57R67)}, MRNUMBER = {98k:19001}, MRREVIEWER = {Masayuki Yamasaki}, } @article {Carlsson+Zomorodian(2005), AUTHOR = {Zomorodian, Afra and Carlsson, Gunnar}, TITLE = {Computing persistent homology}, JOURNAL = {Discrete Comput. Geom.}, FJOURNAL = {Discrete \& Computational Geometry. An International Journal of Mathematics and Computer Science}, VOLUME = {33}, YEAR = {2005}, NUMBER = {2}, PAGES = {249--274}, ISSN = {0179-5376}, CODEN = {DCGEER}, MRCLASS = {55N99 (55-04 55U10)}, MRNUMBER = {MR2121296 (2005j:55004)}, MRREVIEWER = {Donald M. Davis}, } @article {Carrizosa(2009), AUTHOR = {Carrizosa, Mar{\'{\i}}a}, TITLE = {Survey on {L}ehmer problems}, JOURNAL = {S\~ao Paulo J. Math. Sci.}, FJOURNAL = {S\~ao Paulo Journal of Mathematical Sciences}, VOLUME = {3}, YEAR = {2009}, NUMBER = {2}, PAGES = {317--327}, ISSN = {1982-6907}, MRCLASS = {11G50 (11G05 11G10)}, MRNUMBER = {2604658 (2011c:11103)}, } @article {Carron(1998), AUTHOR = {Carron, Gilles}, TITLE = {Une suite exacte en ${L}\sp 2$-cohomologie}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {95}, YEAR = {1998}, NUMBER = {2}, PAGES = {343--372}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {58G05 (53C21 58A14)}, MRNUMBER = {99g:58115}, MRREVIEWER = {Thomas Schick}, } @book{Cartan-Eilenberg(1956), AUTHOR = {Cartan, Henri and Eilenberg, Samuel}, TITLE = {Homological algebra}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, N. J.}, YEAR = {1956}, PAGES = {xv+390}, MRCLASS = {09.0X}, MRNUMBER = {17,1040e}, MRREVIEWER = {G. Hochschild}, } @article{Carter(1980), AUTHOR = {Carter, David W.}, TITLE = {Lower ${K}$-theory of finite groups}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {8}, YEAR = {1980}, NUMBER = {20}, PAGES = {1927--1937}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {16A54}, MRNUMBER = {81m:16027}, MRREVIEWER = {I. Reiner}, } @article {Carter(1980b), AUTHOR = {Carter, David W.}, TITLE = {Localization in lower algebraic {$K$}-theory}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {8}, YEAR = {1980}, NUMBER = {7}, PAGES = {603--622}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {18F25}, MRNUMBER = {81c:18017}, MRREVIEWER = {Howard Lyn Hiller}, } @book {Carter-Segal-McDonald(1995), AUTHOR = {Carter, Roger and Segal, Graeme and Macdonald, Ian}, TITLE = {Lectures on {L}ie groups and {L}ie algebras}, NOTE = {With a foreword by Martin Taylor}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1995}, PAGES = {vii+190}, ISBN = {0-521-49579-2; 0-521-49922-4}, MRCLASS = {17Bxx (20Gxx 22-02 22Exx)}, MRNUMBER = {97f:17002}, MRREVIEWER = {Hartmut Schlosser}, } @inproceedings {Cartier(1979), AUTHOR = {Cartier, P.}, TITLE = {Representations of {$p$}-adic groups: a survey}, BOOKTITLE = {Automorphic forms, representations and {$L$}-functions ({P}roc. {S}ympos. {P}ure {M}ath., {O}regon {S}tate {U}niv., {C}orvallis, {O}re., 1977), {P}art 1}, SERIES = {Proc. Sympos. Pure Math., XXXIII}, PAGES = {111--155}, PUBLISHER = {Amer. Math. Soc., Providence, R.I.}, YEAR = {1979}, MRCLASS = {22E50}, MRNUMBER = {546593}, MRREVIEWER = {Allan J. Silberger}, } @article {Cartier(1993a), AUTHOR = {Cartier, Pierre}, TITLE = {Construction combinatoire des invariants de {V}assiliev-{K}ontsevich des n\oe uds}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {316}, YEAR = {1993}, NUMBER = {11}, PAGES = {1205--1210}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {57M25 (18D10)}, MRNUMBER = {94c:57004}, MRREVIEWER = {J. S. Birman}, } @incollection {Casacuberta(1994), AUTHOR = {Casacuberta, Carles}, TITLE = {Recent advances in unstable localization}, BOOKTITLE = {The Hilton Symposium 1993 (Montreal, PQ)}, PAGES = {1--22}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1994}, MRCLASS = {55P60 (18A40)}, MRNUMBER = {95e:55014}, MRREVIEWER = {Donald M. Davis}, } @article {Casian-Stanton(1999), AUTHOR = {Casian, Luis and Stanton, Robert J.}, TITLE = {Schubert cells and representation theory}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {137}, YEAR = {1999}, NUMBER = {3}, PAGES = {461--539}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {14M15 (22E47)}, MRNUMBER = {2001e:14049}, } @article {Cashen-Levitt(2016), AUTHOR = {Cashen, Christopher H. and Levitt, Gilbert}, TITLE = {Mapping tori of free group automorphisms, and the {B}ieri-{N}eumann-{S}trebel invariant of graphs of groups}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {19}, YEAR = {2016}, NUMBER = {2}, PAGES = {191--216}, ISSN = {1433-5883}, MRCLASS = {20E06 (20E05 20E36 20J05)}, MRNUMBER = {3466593}, MRREVIEWER = {Witold Tomaszewski}, URL = {https://doi.org/10.1515/jgth-2015-0038}, } @InCollection{Casson(1996), Author = {Casson, A. J.}, Title = {Generalisations and applications of block bundles}, BookTitle = {The Hauptvermutung book. A collection of papers on the topology of manifolds}, ISBN = {0-7923-4174-0}, Pages = {33--67}, Year = {1996}, Publisher = {Dordrecht: Kluwer Academic Publishers}, Language = {English}, Keywords = {57Q25,57Q50}, zbMATH = {957296}, Zbl = {0871.57022} } @incollection {Casselman(1987), AUTHOR = {Casselman, W.}, TITLE = {Introduction to the ${L}\sp 2$-cohomology of arithmetic quotients of bounded symmetric domains}, BOOKTITLE = {Complex analytic singularities}, PAGES = {69--93}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {1987}, MRCLASS = {22E41 (14C17 32C36 32C42 55N45)}, MRNUMBER = {88i:22026}, MRREVIEWER = {K. F. Lai}, } @book{Casson-Bleiler(1988), AUTHOR = {Casson, Andrew J. and Bleiler, Steven A.}, TITLE = {Automorphisms of surfaces after {N}ielsen and {T}hurston}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1988}, PAGES = {iv+105}, ISBN = {0-521-34203-1}, MRCLASS = {57N05 (32G15 57R30 58F15)}, MRNUMBER = {89k:57025}, MRREVIEWER = {William Dunbar}, } @article {Casson-Gottlieb(1977), AUTHOR = {Casson, Andrew and Gottlieb, Daniel Henry}, TITLE = {Fibrations with compact fibres}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {99}, YEAR = {1977}, NUMBER = {1}, PAGES = {159--189}, ISSN = {0002-9327}, MRCLASS = {55F99}, MRNUMBER = {0436144}, MRREVIEWER = {David Handel}, } @incollection {Casson-Gordan(1978), AUTHOR = {Casson, A. J. and Gordon, C. McA.}, TITLE = {On slice knots in dimension three}, BOOKTITLE = {Algebraic and geometric topology (Proc. Sympos. Pure Math., Stanford Univ., Stanford, Calif., 1976), Part 2}, PAGES = {39--53}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1978}, MRCLASS = {57M25}, MRNUMBER = {81g:57003}, } @article{Casson-Jungreis(1994), AUTHOR = {Casson, Andrew and Jungreis, Douglas}, TITLE = {Convergence groups and {S}eifert fibered $3$-manifolds}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {118}, YEAR = {1994}, NUMBER = {3}, PAGES = {441--456}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57M50 (57M60 57N10)}, MRNUMBER = {96f:57011}, MRREVIEWER = {G. Peter Scott}, } @article {Cassou-Nogues(1973), AUTHOR = {Cassou-Nogu{\`e}s, Philippe}, TITLE = {Classes d'id\'eaux de l'alg\`ebre d'un groupe ab\'elien}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. A-B}, VOLUME = {276}, YEAR = {1973}, PAGES = {A973--A975}, MRCLASS = {20C05}, MRNUMBER = {MR0320126 (47 \#8667)}, MRREVIEWER = {H. W. Brinkmann}, } @article {Castellano-Corob-Cook(2020), AUTHOR = {Castellano, I. and Corob Cook, G.}, TITLE = {Finiteness properties of totally disconnected locally compact groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {543}, YEAR = {2020}, PAGES = {54--97}, ISSN = {0021-8693}, MRCLASS = {20F05 (18A30 20E18 20E22 20J05 22D05)}, MRNUMBER = {4019790}, MRREVIEWER = {Francesco G. Russo}, DOI = {10.1016/j.jalgebra.2019.09.017}, URL = {https://doi.org/10.1016/j.jalgebra.2019.09.017}, } @article{Cavicchioli-Hegenbarth-Repovs(1998), AUTHOR = {Cavicchioli, Alberto and Hegenbarth, Friedrich and Repov{\v{s}}, Du{\v{s}}an}, TITLE = {On four-manifolds fibering over surfaces}, JOURNAL = {Tsukuba J. Math.}, FJOURNAL = {Tsukuba Journal of Mathematics}, VOLUME = {22}, YEAR = {1998}, NUMBER = {2}, PAGES = {333--342}, ISSN = {0387-4982}, MRCLASS = {57N13 (57R40 57R67)}, MRNUMBER = {2000a:57048}, MRREVIEWER = {Ricardo F. Vila Freyer}, } @article {Cavicchioli-Hegenbarth-Repovs(1997), AUTHOR = {Cavicchioli, Alberto and Hegenbarth, Friedrich and Repov\v{s}, Du\v{s}an}, TITLE = {Four-manifolds with surface fundamental groups}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {349}, YEAR = {1997}, NUMBER = {10}, PAGES = {4007--4019}, ISSN = {0002-9947}, MRCLASS = {57N13 (57N65 57Q10 57R67)}, MRNUMBER = {1376542}, MRREVIEWER = {Masayuki Yamasaki}, DOI = {10.1090/S0002-9947-97-01751-0}, URL = {https://doi.org/10.1090/S0002-9947-97-01751-0}, } @article {Cavicchioli-Hegenbarth-Repovs(1995), AUTHOR = {Cavicchioli, Alberto and Hegenbarth, Friedrich and Repov\v{s}, Du\v{s}an}, TITLE = {On the stable classification of certain {$4$}-manifolds}, JOURNAL = {Bull. Austral. Math. Soc.}, FJOURNAL = {Bulletin of the Australian Mathematical Society}, VOLUME = {52}, YEAR = {1995}, NUMBER = {3}, PAGES = {385--398}, ISSN = {0004-9727}, MRCLASS = {57N13}, MRNUMBER = {1358695}, MRREVIEWER = {Jonathan A. Hillman}, DOI = {10.1017/S000497270001488X}, URL = {https://doi.org/10.1017/S000497270001488X}, } @article {Cavicchioli-Muranov-Repovs(1998), AUTHOR = {Cavicchioli, Alberto and Muranov, Yurij V. and Repov{\v{s}}, Du{\v{s}}an}, TITLE = {Spectral sequences in ${K}$-theory for a twisted quadratic extension}, JOURNAL = {Yokohama Math. J.}, FJOURNAL = {Yokohama Mathematical Journal}, VOLUME = {46}, YEAR = {1998}, NUMBER = {1}, PAGES = {1--13}, ISSN = {0044-0523}, MRCLASS = {19J25 (57R67)}, MRNUMBER = {99k:19003}, MRREVIEWER = {A. A. Ranicki}, } @Article{Cavicchioli-Repovs-Skopenkov(2000), AUTHOR = {Cavicchioli, A. and Repov{\v{s}}, D. and Skopenkov, A. B.}, TITLE = {An extension of the {B}olsinov-{F}omenko theorem on orbital classification of integrable {H}amiltonian systems}, JOURNAL = {Rocky Mountain J. Math.}, FJOURNAL = {The Rocky Mountain Journal of Mathematics}, VOLUME = {30}, YEAR = {2000}, NUMBER = {2}, PAGES = {447--476}, ISSN = {0035-7596}, CODEN = {RMJMAE}, MRCLASS = {37J35 (37C15 53D05)}, MRNUMBER = {2001g:37095}, MRREVIEWER = {Vladimir S. Matveev}, } @article {Cavicchioli-Muranov-Spaggoari(2006), AUTHOR = {Cavicchioli, Alberto and Muranov, Yurij V. and Spaggiari, Fulvia}, TITLE = {Mixed structures on a manifold with boundary}, JOURNAL = {Glasg. Math. J.}, FJOURNAL = {Glasgow Mathematical Journal}, VOLUME = {48}, YEAR = {2006}, NUMBER = {1}, PAGES = {125--143}, ISSN = {0017-0895}, MRCLASS = {57R67 (57Q10)}, MRNUMBER = {2224934}, DOI = {10.1017/S0017089505002934}, URL = {https://doi.org/10.1017/S0017089505002934}, } @article {Cecil-Chi-Jensen(2007), AUTHOR = {Cecil, Thomas E. and Chi, Quo-Shin and Jensen, Gary R.}, TITLE = {Isoparametric hypersurfaces with four principal curvatures}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {166}, YEAR = {2007}, NUMBER = {1}, PAGES = {1--76}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {53C42}, MRNUMBER = {MR2342690 (2008m:53150)}, MRREVIEWER = {Luiz A. M. Sousa, Jr.}, } @incollection {Cerf(1981), AUTHOR = {Cerf, Jean}, TITLE = {{$1$}-formes ferm\'ees non singuli\`eres sur les vari\'et\'es compactes de dimension {$3$}}, BOOKTITLE = {Bourbaki {S}eminar, {V}ol. 1980/81}, SERIES = {Lecture Notes in Math.}, VOLUME = {901}, PAGES = {205--219}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1981}, MRCLASS = {57R52 (57N10 58A10 58F18)}, MRNUMBER = {MR647498 (84i:57025)}, } @article {Cerf(1970stratification), AUTHOR = {Cerf, Jean}, TITLE = {La stratification naturelle des espaces de fonctions diff\'erentiables r\'eelles et le th\'eor\`eme de la pseudo-isotopie}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {39}, YEAR = {1970}, PAGES = {5--173}, ISSN = {0073-8301}, MRCLASS = {58D99 (57D35)}, MRNUMBER = {MR0292089 (45 \#1176)}, MRREVIEWER = {J. Milnor}, } @incollection {Cerf(1970simply), AUTHOR = {Cerf, Jean}, TITLE = {The pseudo-isotopy theorem for simply connected differentiable manifolds}, BOOKTITLE = {Manifolds--{A}msterdam 1970 ({P}roc. {N}uffic {S}ummer {S}chool)}, PAGES = {76--82}, PUBLISHER = {Lecture Notes in Mathematics, Vol. 197. Springer, Berlin}, YEAR = {1970}, MRCLASS = {57.47}, MRNUMBER = {MR0290404 (44 \#7585)}, MRREVIEWER = {S. Y. Husseini}, } @incollection {Cerf(1968pseudo), AUTHOR = {Cerf, Jean}, TITLE = {Isotopie et pseudo-isotopie}, BOOKTITLE = {Proc. {I}nternat. {C}ongr. {M}ath. ({M}oscow, 1966)}, PAGES = {429--437}, PUBLISHER = {Izdat. ``Mir'', Moscow}, YEAR = {1968}, MRCLASS = {57.20}, MRNUMBER = {MR0234478 (38 \#2795)}, MRREVIEWER = {W. A. LaBach}, } @book {Cerf(1968spheres), AUTHOR = {Cerf, Jean}, TITLE = {Sur les diff\'{e}omorphismes de la sph\`ere de dimension trois {$(\Gamma \sb{4}=0)$}}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {No. 53}, PUBLISHER = {Springer-Verlag, Berlin-New York}, YEAR = {1968}, PAGES = {xii+133}, MRCLASS = {57.31}, MRNUMBER = {229250}, MRREVIEWER = {N.\ Kuiper}, } @article {Cerf(1961), AUTHOR = {Cerf, Jean}, TITLE = {Topologie de certains espaces de plongements}, JOURNAL = {Bull. Soc. Math. France}, FJOURNAL = {Bulletin de la Soci\'{e}t\'{e} Math\'{e}matique de France}, VOLUME = {89}, YEAR = {1961}, PAGES = {227--380}, ISSN = {0037-9484}, MRCLASS = {57.20 (57.50)}, MRNUMBER = {140120}, MRREVIEWER = {R. S. Palais}, URL = {http://www.numdam.org/item?id=BSMF_1961__89__227_0}, } @article {Cha(2003), AUTHOR = {Cha, Jae Choon}, TITLE = {Fibred knots and twisted {A}lexander invariants}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {355}, YEAR = {2003}, NUMBER = {10}, PAGES = {4187--4200 (electronic)}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57M25}, MRNUMBER = {1990582 (2004e:57008)}, MRREVIEWER = {Peiyi Zhao}, DOI = {10.1090/S0002-9947-03-03348-8}, URL = {http://dx.doi.org/10.1090/S0002-9947-03-03348-8}, } @article{Cha-Friedl(2013), AUTHOR = {Cha, Jae Choon and Friedl, Stefan}, TITLE = {Twisted torsion invariants and link concordance}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {25}, YEAR = {2013}, NUMBER = {3}, PAGES = {471--504}, ISSN = {0933-7741}, CODEN = {FOMAEF}, MRCLASS = {57M25 (57M27 57N70)}, MRNUMBER = {3062861}, } @article {Cha-Friedl-Funke(2017), AUTHOR = {Cha, Jae Choon and Friedl, Stefan and Funke, Florian}, TITLE = {The {G}rothendieck group of polytopes and norms}, JOURNAL = {M\"unster J. Math.}, FJOURNAL = {M\"unster Journal of Mathematics}, VOLUME = {10}, YEAR = {2017}, NUMBER = {1}, PAGES = {75--81}, ISSN = {1867-5778}, MRCLASS = {52B11 (18F30)}, MRNUMBER = {3624102}, } @article {Cha-Friedl-Powell(2014), AUTHOR = {Cha, Jae Choon and Friedl, Stefan and Powell, Mark}, TITLE = {Concordance of links with identical {A}lexander invariants}, JOURNAL = {Bull. Lond. Math. Soc.}, FJOURNAL = {Bulletin of the London Mathematical Society}, VOLUME = {46}, YEAR = {2014}, NUMBER = {3}, PAGES = {629--642}, ISSN = {0024-6093}, MRCLASS = {57M25}, MRNUMBER = {3210718}, } @article {Chabert-Echterhoff-Nest(2003), AUTHOR = {Chabert, J{\'e}r{\^o}me and Echterhoff, Siegfried and Nest, Ryszard}, TITLE = {The {C}onnes-{K}asparov conjecture for almost connected groups and for linear {$p$}-adic groups}, JOURNAL = {Publ. Math. Inst. Hautes \'Etudes Sci.}, FJOURNAL = {Publications Math\'ematiques. Institut de Hautes \'Etudes Scientifiques}, VOLUME = {97}, YEAR = {2003}, PAGES = {239--278}, ISSN = {0073-8301}, MRCLASS = {19K35 (20D25)}, MRNUMBER = {2010742 (2004j:19004)}, MRREVIEWER = {Jean-Louis Tu}, DOI = {10.1007/s10240-003-0014-2}, URL = {http://dx.doi.org/10.1007/s10240-003-0014-2}, } @article {Chabert-Echterhoff(2001a), AUTHOR = {Chabert, J{\'e}r\^{o}me and Echterhoff, Siegfried}, TITLE = {Twisted equivariant ${K}{K}$-theory and the {B}aum-{C}onnes conjecture for group extensions}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {23}, YEAR = {2001}, NUMBER = {2}, PAGES = {157--200}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19K35 (46L80 46L87)}, MRNUMBER = {1 857 079}, } @article {Chabert-Echterhoff(2001b), AUTHOR = {Chabert, J{\'e}r\^{o}me and Echterhoff, Siegfried}, TITLE = {Permanence properties of the {B}aum-{C}onnes conjecture}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, VOLUME = {6}, YEAR = {2001}, PAGES = {127--183 (electronic)}, ISSN = {1431-0643}, MRCLASS = {46L80 (19K99)}, MRNUMBER = {2002h:46117}, MRREVIEWER = {{\'E}ric Leichtnam}, } @article {Chabert-Echterhoff-Meyer(2001), AUTHOR = {Chabert, J{\'e}r\^{o}me and Echterhoff, Siegfried and Meyer, Ralf}, TITLE = {Deux remarques sur l'application de {B}aum-{C}onnes}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {332}, YEAR = {2001}, NUMBER = {7}, PAGES = {607--610}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {19K35}, MRNUMBER = {1 841 893}, MRREVIEWER = {Erik K. Pedersen}, } @article {Champetier+Guirardel(2005), AUTHOR = {Champetier, Christophe and Guirardel, Vincent}, TITLE = {Limit groups as limits of free groups}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {146}, YEAR = {2005}, PAGES = {1--75}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {20E06 (03C45 20E05 20E26 57M07)}, MRNUMBER = {MR2151593 (2006d:20045)}, MRREVIEWER = {Yves de Cornulier}, } @article {Chang(2004), AUTHOR = {Chang, Stanley}, TITLE = {On conjectures of {M}athai and {B}orel}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {106}, YEAR = {2004}, PAGES = {161--167}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {57R67 (55N22 58J22)}, MRNUMBER = {MR2079840 (2005g:57058)}, MRREVIEWER = {Wies{\l}aw J. Ol{\polhk{e}}dzki}, } @article {Chang-Ferry-Yu(2008), AUTHOR = {Chang, Stanley S. and Ferry, Steven and Yu, Guoliang}, TITLE = {Bounded rigidity of manifolds and asymptotic dimension growth}, JOURNAL = {J. K-Theory}, FJOURNAL = {Journal of K-Theory. K-Theory and its Applications in Algebra, Geometry, Analysis \& Topology}, VOLUME = {1}, YEAR = {2008}, NUMBER = {1}, PAGES = {129--144}, ISSN = {1865-2433}, MRCLASS = {53C24 (57R19 57R67)}, MRNUMBER = {MR2424569 (2009g:53059)}, MRREVIEWER = {Boris Goldfarb}, DOI = {10.1017/is007011012jkt008}, URL = {http://dx.doi.org/10.1017/is007011012jkt008}, } @article {Chang-Weinberger(2003b), AUTHOR = {Chang, Stanley and Weinberger, Shmuel}, TITLE = {On invariants of {H}irzebruch and {C}heeger-{G}romov}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {7}, YEAR = {2003}, PAGES = {311--319 (electronic)}, ISSN = {1465-3060}, MRCLASS = {57R67 (46L80 58J20 58J28)}, MRNUMBER = {2004c:57052}, MRREVIEWER = {Thomas Schick}, } @book {Chang-Weinberger(2021), AUTHOR = {Chang, Stanley and Weinberger, Shmuel}, TITLE = {A course on surgery theory}, SERIES = {Annals of Mathematics Studies}, VOLUME = {211}, PUBLISHER = {Princeton University Press, Princeton, NJ}, YEAR = {2021}, PAGES = {430}, ISBN = {978-0-691-20035-4; 978-0-691-16048-1; 978-0-691-16049-8}, MRCLASS = {57R65 (19G24 19Lxx 57-02 57R67)}, MRNUMBER = {4207574}, } @article{Chapman(1973), AUTHOR = {Chapman, T. A.}, TITLE = {Compact {H}ilbert cube manifolds and the invariance of {W}hitehead torsion}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {79}, YEAR = {1973}, PAGES = {52--56}, MRCLASS = {57A20 (57C10)}, MRNUMBER = {49 \#11518}, MRREVIEWER = {N. Desolneux Moulis}, } @article{Chapman(1974), AUTHOR = {Chapman, T. A.}, TITLE = {Topological invariance of {W}hitehead torsion}, JOURNAL = {Amer. J. Math.}, VOLUME = {96}, YEAR = {1974}, PAGES = {488--497}, MRCLASS = {57C10}, MRNUMBER = {52 \#11931}, MRREVIEWER = {K. W. Kwun}, } @article {Chapman(1979), AUTHOR = {Chapman, T. A.}, TITLE = {Homotopy conditions which detect simple homotopy equivalences}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {80}, YEAR = {1979}, NUMBER = {1}, PAGES = {13--46}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {57Q10}, MRNUMBER = {534693 (81f:57011)}, MRREVIEWER = {Martin Scharlemann}, URL = {http://projecteuclid.org/getRecord?id=euclid.pjm/1102785949}, } @article {Chapman(1980), AUTHOR = {Chapman, T. A.}, TITLE = {Approximation results in {H}ilbert cube manifolds}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {262}, YEAR = {1980}, NUMBER = {2}, PAGES = {303--334}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57N20 (55R05)}, MRNUMBER = {586720 (82g:57006)}, MRREVIEWER = {R. R. Summerhill}, DOI = {10.2307/1999831}, URL = {http://dx.doi.org/10.2307/1999831}, } @article {Chapman(1981), AUTHOR = {Chapman, T. A.}, TITLE = {Approximation results in topological manifolds}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {34}, YEAR = {1981}, NUMBER = {251}, PAGES = {iii+64}, ISSN = {0065-9266}, CODEN = {MAMCAU}, MRCLASS = {57N15 (55R65 57N20)}, MRNUMBER = {634341 (83i:57005)}, MRREVIEWER = {A. A. Ranicki}, } @book{Chapman(1983), AUTHOR = {Chapman, T. A.}, TITLE = {Controlled simple homotopy theory and applications}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1983}, PAGES = {i+94}, ISBN = {3-540-12338-5}, MRCLASS = {57Q10 (57R80)}, MRNUMBER = {85d:57016}, MRREVIEWER = {Frank Quinn}, } @article{Chapman-Ferry(1979), AUTHOR = {Chapman, T. A. and Ferry, S. C.}, TITLE = {Approximating homotopy equivalences by homeomorphisms}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {101}, YEAR = {1979}, NUMBER = {3}, PAGES = {583--607}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {57N15}, MRNUMBER = {81f:57007b}, MRREVIEWER = {Martin Scharlemann}, } @article{Chapman-Ferry(1983), AUTHOR = {Chapman, T. A. and Ferry, S. C.}, TITLE = {Constructing approximate fibrations}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {276}, YEAR = {1983}, NUMBER = {2}, PAGES = {757--774}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {55R65 (57N15 57N30)}, MRNUMBER = {85b:55026}, MRREVIEWER = {L. S. Husch}, } @book {Chapman-Glaz(2013), TITLE = {Non-{N}oetherian commutative ring theory}, SERIES = {Mathematics and its Applications}, VOLUME = {520}, EDITOR = {Chapman, Scott T. and Glaz, Sarah}, PUBLISHER = {Kluwer Academic Publishers, Dordrecht}, YEAR = {2000}, PAGES = {x+479}, ISBN = {0-7923-6492-9}, MRCLASS = {13-06}, MRNUMBER = {1858154 (2002c:13002)}, DOI = {10.1007/978-1-4757-3180-4}, URL = {http://dx.doi.org/10.1007/978-1-4757-3180-4}, } @book{Chari-Pressley(1995), AUTHOR = {Chari, Vyjayanthi and Pressley, Andrew}, TITLE = {A guide to quantum groups}, NOTE = {Corrected reprint of the 1994 original}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1995}, PAGES = {xvi+651}, ISBN = {0-521-55884-0}, MRCLASS = {17B37 (16W30 81R50)}, MRNUMBER = {96h:17014}, } @article{Charlap(1965), AUTHOR = {Charlap, Leonard S.}, TITLE = {Compact flat riemannian manifolds. {I}}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {81}, YEAR = {1965}, PAGES = {15--30}, MRCLASS = {53.72 (53.66)}, MRNUMBER = {30 \#543}, MRREVIEWER = {L. Auslander}, } @article{Charlap-Vasquez(1965), AUTHOR = {Charlap, L. S. and Vasquez, A. T.}, TITLE = {Compact flat {R}iemannian manifolds. {I}{I}. {T}he cohomology of ${Z}\sb{p}$-manifolds}, JOURNAL = {Amer. J. Math.}, VOLUME = {87}, YEAR = {1965}, PAGES = {551--563}, MRCLASS = {57.45 (53.72)}, MRNUMBER = {32 \#6491}, MRREVIEWER = {L. Auslander}, } @article{Charlap-Vasquez(1966), AUTHOR = {Charlap, L. S. and Vasquez, A. T.}, TITLE = {The cohomology of group extensions}, JOURNAL = {Trans. Amer. Math. Soc.}, VOLUME = {124}, YEAR = {1966}, PAGES = {24--40}, MRCLASS = {20.48 (18.00)}, MRNUMBER = {35 \#5514}, MRREVIEWER = {L. Auslander}, } @article{Charlap-Vasquez(1969), AUTHOR = {Charlap, L. S. and Vasquez, A. T.}, TITLE = {Characteristic classes for modules over groups. {I}}, JOURNAL = {Trans. Amer. Math. Soc.}, VOLUME = {137}, YEAR = {1969}, PAGES = {533--549}, MRCLASS = {20.50}, MRNUMBER = {42 \#3181}, MRREVIEWER = {J. A. Schafer}, } @article {Charney(2007), AUTHOR = {Charney, Ruth}, TITLE = {An introduction to right-angled {A}rtin groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {125}, YEAR = {2007}, PAGES = {141--158}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F36 (20F65)}, MRNUMBER = {2322545 (2008f:20076)}, MRREVIEWER = {Noelle C. Antony}, DOI = {10.1007/s10711-007-9148-6}, URL = {http://dx.doi.org/10.1007/s10711-007-9148-6}, } @article {Charney(1992), AUTHOR = {Charney, Ruth}, TITLE = {Artin groups of finite type are biautomatic}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {292}, YEAR = {1992}, NUMBER = {4}, PAGES = {671--683}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {20F36 (20F10)}, MRNUMBER = {1157320 (93c:20067)}, MRREVIEWER = {D. F. Holt}, DOI = {10.1007/BF01444642}, URL = {http://dx.doi.org/10.1007/BF01444642}, } @incollection {Charney(1982), AUTHOR = {Charney, Ruth}, TITLE = {{$K$}-theory of ideals}, BOOKTITLE = {Current trends in algebraic topology, {P}art 1 ({L}ondon, {O}nt., 1981)}, SERIES = {CMS Conf. Proc.}, VOLUME = {2}, PAGES = {3--18}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1982}, MRCLASS = {18F25 (16A54)}, MRNUMBER = {686107 (84f:18017)}, } @article {Charney-Crisp(2007), AUTHOR = {Charney, Ruth and Crisp, John}, TITLE = {Relative hyperbolicity and {A}rtin groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {129}, YEAR = {2007}, PAGES = {1--13}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F36 (20F67)}, MRNUMBER = {2353977 (2008m:20065)}, MRREVIEWER = {Ilya Kapovich}, DOI = {10.1007/s10711-007-9178-0}, URL = {http://dx.doi.org/10.1007/s10711-007-9178-0}, } @article{Charney-Davis(1995), AUTHOR = {Charney, Ruth M. and Davis, Michael W.}, TITLE = {Strict hyperbolization}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {34}, YEAR = {1995}, NUMBER = {2}, PAGES = {329--350}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57Q05 (53C23)}, MRNUMBER = {95m:57034}, MRREVIEWER = {Colin C. Adams}, } @article {Charney-Davis(2000), AUTHOR = {Charney, Ruth and Davis, Michael}, TITLE = {When is a {C}oxeter system determined by its {C}oxeter group?}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {61}, YEAR = {2000}, NUMBER = {2}, PAGES = {441--461}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {20F55 (57M07 57M60 57P10)}, MRNUMBER = {MR1760693 (2001i:20078)}, MRREVIEWER = {Stephen P. Humphries}, } @incollection {Charney-Davis(1995Artin), AUTHOR = {Charney, Ruth and Davis, Michael W.}, TITLE = {Finite {$K(\pi, 1)$}s for {A}rtin groups}, BOOKTITLE = {Prospects in topology ({P}rinceton, {NJ}, 1994)}, SERIES = {Ann. of Math. Stud.}, VOLUME = {138}, PAGES = {110--124}, PUBLISHER = {Princeton Univ. Press, Princeton, NJ}, YEAR = {1995}, MRCLASS = {57M07 (20F36 55P20)}, MRNUMBER = {1368655 (97a:57001)}, MRREVIEWER = {Darryl McCullough}, } @article {Charney-Davis(1995Euler), AUTHOR = {Charney, Ruth and Davis, Michael}, TITLE = {The {E}uler characteristic of a nonpositively curved, piecewise {E}uclidean manifold}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {171}, YEAR = {1995}, NUMBER = {1}, PAGES = {117--137}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {53C23 (57M50 57Q05)}, MRNUMBER = {1362980 (96k:53066)}, MRREVIEWER = {Athanase Papadopoulos}, URL = {http://projecteuclid.org/euclid.pjm/1102370321}, } @article {Charney-Davis(1995problem), AUTHOR = {Charney, Ruth and Davis, Michael W.}, TITLE = {The {$K(\pi,1)$}-problem for hyperplane complements associated to infinite reflection groups}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {8}, YEAR = {1995}, NUMBER = {3}, PAGES = {597--627}, ISSN = {0894-0347}, MRCLASS = {52B30 (20F55 55P20)}, MRNUMBER = {1303028 (95i:52011)}, MRREVIEWER = {Hiroaki Terao}, DOI = {10.2307/2152924}, URL = {http://dx.doi.org/10.2307/2152924}, } @article {Charney-Davis-Mussong(1997), AUTHOR = {Charney, R. and Davis, M. and Moussong, G.}, TITLE = {Nonpositively curved, piecewise {E}uclidean structures on hyperbolic manifolds}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {Michigan Mathematical Journal}, VOLUME = {44}, YEAR = {1997}, NUMBER = {1}, PAGES = {201--208}, ISSN = {0026-2285}, MRCLASS = {53C23}, MRNUMBER = {1439678 (98b:53034)}, MRREVIEWER = {Athanase Papadopoulos}, DOI = {10.1307/mmj/1029005630}, URL = {http://dx.doi.org/10.1307/mmj/1029005630}, } @article {Charney-Farber(2012), AUTHOR = {Charney, Ruth and Farber, Michael}, TITLE = {Random groups arising as graph products}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {12}, YEAR = {2012}, NUMBER = {2}, PAGES = {979--995}, ISSN = {1472-2747}, MRCLASS = {20F67 (20P05 57M07)}, MRNUMBER = {2928902}, MRREVIEWER = {Goulnara N. Arzhantseva}, DOI = {10.2140/agt.2012.12.979}, URL = {http://dx.doi.org/10.2140/agt.2012.12.979}, } @article {Charney-Lytchak(2001), AUTHOR = {Charney, Ruth and Lytchak, Alexander}, TITLE = {Metric characterizations of spherical and {E}uclidean buildings}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {5}, YEAR = {2001}, PAGES = {521--550 (electronic)}, ISSN = {1465-3060}, MRCLASS = {51E24 (20E42 20F65)}, MRNUMBER = {MR1833752 (2002h:51008)}, MRREVIEWER = {Linus K. H. Kramer}, } @article {Charney-Peifer(2003), AUTHOR = {Charney, Ruth and Peifer, David}, TITLE = {The {$K(\pi,1)$}-conjecture for the affine braid groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {78}, YEAR = {2003}, NUMBER = {3}, PAGES = {584--600}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {20F36 (52C35 55R80 57M07)}, MRNUMBER = {1998395 (2004f:20067)}, MRREVIEWER = {Athanase Papadopoulos}, DOI = {10.1007/s00014-003-0764-y}, URL = {http://dx.doi.org/10.1007/s00014-003-0764-y}, } @article {Charney-Sultan(2015), AUTHOR = {Charney, Ruth and Sultan, Harold}, TITLE = {Contracting boundaries of {$\rm CAT(0)$} spaces}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {8}, YEAR = {2015}, NUMBER = {1}, PAGES = {93--117}, ISSN = {1753-8416}, MRCLASS = {20F65}, MRNUMBER = {3339446}, URL = {http://doi.org/10.1112/jtopol/jtu017}, } @incollection {Charney-Vogtmann(2011), AUTHOR = {Charney, Ruth and Vogtmann, Karen}, TITLE = {Subgroups and quotients of automorphism groups of {RAAG}s}, BOOKTITLE = {Low-dimensional and symplectic topology}, SERIES = {Proc. Sympos. Pure Math.}, VOLUME = {82}, PAGES = {9--27}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2011}, MRCLASS = {20F36}, MRNUMBER = {2768650}, DOI = {10.1090/pspum/082/2768650}, URL = {http://dx.doi.org/10.1090/pspum/082/2768650}, } @article {Charney-Vogtmann(2009), AUTHOR = {Charney, Ruth and Vogtmann, Karen}, TITLE = {Finiteness properties of automorphism groups of right-angled {A}rtin groups}, JOURNAL = {Bull. Lond. Math. Soc.}, FJOURNAL = {Bulletin of the London Mathematical Society}, VOLUME = {41}, YEAR = {2009}, NUMBER = {1}, PAGES = {94--102}, ISSN = {0024-6093}, MRCLASS = {20F36}, MRNUMBER = {2481994 (2010a:20084)}, MRREVIEWER = {Volker Gebhardt}, DOI = {10.1112/blms/bdn108}, URL = {http://dx.doi.org/10.1112/blms/bdn108}, } @incollection {Chatterji(2017), AUTHOR = {Chatterji, Indira}, TITLE = {Introduction to the rapid decay property}, BOOKTITLE = {Around {L}anglands correspondences}, SERIES = {Contemp. Math.}, VOLUME = {691}, PAGES = {53--72}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2017}, MRCLASS = {20-02 (20F65 22D40)}, MRNUMBER = {3666050}, DOI = {10.1090/conm/691/13893}, URL = {https://doi.org/10.1090/conm/691/13893}, } @incollection {Chatterji-Mislin(2009), AUTHOR = {Chatterji, Indira and Mislin, Guido}, TITLE = {Hattori-{S}tallings trace and {E}uler characteristics for groups}, BOOKTITLE = {Geometric and cohomological methods in group theory}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {358}, PAGES = {256--271}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {2009}, MRCLASS = {20J05 (19A31 20F65)}, MRNUMBER = {2605179 (2011c:20104)}, MRREVIEWER = {Peter A. Linnell}, } @article {Chatterji-Ruane(2005), AUTHOR = {Chatterji, I. and Ruane, K.}, TITLE = {Some geometric groups with rapid decay}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {15}, YEAR = {2005}, NUMBER = {2}, PAGES = {311--339}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {20F65 (20F67 22E40)}, MRNUMBER = {2153902 (2006d:20070)}, MRREVIEWER = {Tullio G. Ceccherini-Silberstein}, DOI = {10.1007/s00039-005-0508-9}, URL = {http://dx.doi.org/10.1007/s00039-005-0508-9}, } @book{Chavel(1993), AUTHOR = {Chavel, Isaac}, TITLE = {Riemannian geometry---a modern introduction}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1993}, PAGES = {xii+386}, ISBN = {0-521-43201-4; 0-521-48578-9}, MRCLASS = {53-02 (53Cxx)}, MRNUMBER = {95j:53001}, MRREVIEWER = {Carolyn Gordon}, } @article{Chavel-Dodziuk(1994), AUTHOR = {Chavel, I. and Dodziuk, J.}, TITLE = {The spectrum of degenerating hyperbolic $3$-manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {39}, YEAR = {1994}, NUMBER = {1}, PAGES = {123--137}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G25 (57M50 57N10)}, MRNUMBER = {95e:58175}, MRREVIEWER = {Robert Brooks}, } @Book{Chavel-Farkas(1985), author = {Chavel, I. and Farkas, H.}, title = {Rauch Memorial Volume}, publisher = {Springer}, year = 1985, } @article{Chayet-Lohoue(1997), AUTHOR = {Chayet, Maurice and Lohoue, No{\"e}l}, TITLE = {Sur la cohomologie ${L}\sp p$ des vari\'et\'es}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {324}, YEAR = {1997}, NUMBER = {2}, PAGES = {211--213}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {58A14 (22E45 53C20)}, MRNUMBER = {98b:58008}, MRREVIEWER = {J. S. Joel}, } @article {Chazarain(1974), AUTHOR = {Chazarain, J.}, TITLE = {Formule de {P}oisson pour les vari\'et\'es riemanniennes}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {24}, YEAR = {1974}, PAGES = {65--82}, ISSN = {0020-9910}, MRCLASS = {58G15 (35P05 58E10)}, MRNUMBER = {MR0343320 (49 \#8062)}, MRREVIEWER = {R. S. Palais}, } @article{Cheeger(1970), AUTHOR = {Cheeger, Jeff}, TITLE = {Finiteness theorems for {R}iemannian manifolds}, JOURNAL = {Amer. J. Math.}, VOLUME = {92}, YEAR = {1970}, PAGES = {61--74}, MRCLASS = {57.10}, MRNUMBER = {41 \#7697}, MRREVIEWER = {M. Klingmann}, } @article{Cheeger(1979), AUTHOR = {Cheeger, Jeff}, TITLE = {Analytic torsion and the heat equation}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {109}, YEAR = {1979}, NUMBER = {2}, PAGES = {259--322}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {58G10}, MRNUMBER = {80j:58065a}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @incollection {Cheeger(1980), AUTHOR = {Cheeger, Jeff}, TITLE = {On the {H}odge theory of {R}iemannian pseudomanifolds}, BOOKTITLE = {Geometry of the Laplace operator (Proc. Sympos. Pure Math., Univ. Hawaii, Honolulu, Hawaii, 1979)}, PAGES = {91--146}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1980}, MRCLASS = {58G05 (58A14 58G10 58G11)}, MRNUMBER = {83a:58081}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @article{Cheeger(1983), AUTHOR = {Cheeger, Jeff}, TITLE = {Spectral geometry of singular {R}iemannian spaces}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {18}, YEAR = {1983}, NUMBER = {4}, PAGES = {575--657 (1984)}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G25 (57R20 58G11)}, MRNUMBER = {85d:58083}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @article{Cheeger(1987), AUTHOR = {Cheeger, Jeff}, TITLE = {$\eta$-invariants, the adiabatic approximation and conical singularities. {I}. {T}he adiabatic approximation}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {26}, YEAR = {1987}, NUMBER = {1}, PAGES = {175--221}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G11 (58G30)}, MRNUMBER = {89c:58123}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article {Cheeger-Colding(1996), AUTHOR = {Cheeger, Jeff and Colding, Tobias H.}, TITLE = {Lower bounds on {R}icci curvature and the almost rigidity of warped products}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {144}, YEAR = {1996}, NUMBER = {1}, PAGES = {189--237}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {53C21 (53C20 53C23)}, MRNUMBER = {MR1405949 (97h:53038)}, MRREVIEWER = {Joseph E. Borzellino}, } @article {Cheeger-Colding(1997), AUTHOR = {Cheeger, Jeff and Colding, Tobias H.}, TITLE = {On the structure of spaces with {R}icci curvature bounded below. {I}}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {46}, YEAR = {1997}, NUMBER = {3}, PAGES = {406--480}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C21 (53C20)}, MRNUMBER = {MR1484888 (98k:53044)}, MRREVIEWER = {William P. Minicozzi, II}, } @article {Cheeger-Colding(2000), AUTHOR = {Cheeger, Jeff and Colding, Tobias H.}, TITLE = {On the structure of spaces with {R}icci curvature bounded below. {II}}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {54}, YEAR = {2000}, NUMBER = {1}, PAGES = {13--35}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C21 (49Q15 53C20 53C23)}, MRNUMBER = {MR1815410 (2003a:53043)}, MRREVIEWER = {Man Chun Leung}, } @article {Cheeger-Colding(2000a), AUTHOR = {Cheeger, Jeff and Colding, Tobias H.}, TITLE = {On the structure of spaces with {R}icci curvature bounded below. {III}}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {54}, YEAR = {2000}, NUMBER = {1}, PAGES = {37--74}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C21 (49Q15 53C20 53C23)}, MRNUMBER = {MR1815411 (2003a:53044)}, MRREVIEWER = {Man Chun Leung}, } @book {Cheeger-Ebin(1975), AUTHOR = {Cheeger, Jeff and Ebin, David G.}, TITLE = {Comparison theorems in {R}iemannian geometry}, NOTE = {North-Holland Mathematical Library, Vol. 9}, PUBLISHER = {North-Holland Publishing Co.}, ADDRESS = {Amsterdam}, YEAR = {1975}, PAGES = {viii+174}, MRCLASS = {53C20 (58E10)}, MRNUMBER = {56 \#16538}, MRREVIEWER = {N. J. Hicks}, } @article {Cheeger-Fukaya-Gromov(1992), AUTHOR = {Cheeger, Jeff and Fukaya, Kenji and Gromov, Mikhael}, TITLE = {Nilpotent structures and invariant metrics on collapsed manifolds}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {5}, YEAR = {1992}, NUMBER = {2}, PAGES = {327--372}, ISSN = {0894-0347}, MRCLASS = {53C23 (53C20)}, MRNUMBER = {MR1126118 (93a:53036)}, MRREVIEWER = {Viktor Schroeder}, } @incollection {Cheeger-Goresky-McPherson(1982), AUTHOR = {Cheeger, Jeff and Goresky, Mark and MacPherson, Robert}, TITLE = {${L}\sp{2}$-cohomology and intersection homology of singular algebraic varieties}, BOOKTITLE = {Seminar on Differential Geometry}, PAGES = {303--340}, PUBLISHER = {Princeton Univ. Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1982}, MRCLASS = {58A14 (32J25 55N35 58A35)}, MRNUMBER = {84f:58005}, MRREVIEWER = {Steven M. Zucker}, } @article{Cheeger-Gromoll(1971), AUTHOR = {Cheeger, Jeff and Gromoll, Detlef}, TITLE = {The splitting theorem for manifolds of nonnegative {R}icci curvature}, JOURNAL = {J. Differential Geometry}, VOLUME = {6}, YEAR = {1971/72}, PAGES = {119--128}, MRCLASS = {53C20}, MRNUMBER = {46 \#2597}, MRREVIEWER = {J. R. Vanstone}, } @article{Cheeger-Gromoll(1972), AUTHOR = {Cheeger, Jeff and Gromoll, Detlef}, TITLE = {On the structure of complete manifolds of nonnegative curvature}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {96}, YEAR = {1972}, PAGES = {413--443}, MRCLASS = {53C20}, MRNUMBER = {46 \#8121}, MRREVIEWER = {J. A. Wolf}, } @article{Cheeger-Gromov(1985), AUTHOR = {Cheeger, Jeff and Gromov, Mikhael}, TITLE = {Bounds on the von {N}eumann dimension of ${L}\sp 2$-cohomology and the {G}auss-{B}onnet theorem for open manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {21}, YEAR = {1985}, NUMBER = {1}, PAGES = {1--34}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G12 (53C20)}, MRNUMBER = {87d:58136}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @incollection{Cheeger-Gromov(1985a), AUTHOR = {Cheeger, Jeff and Gromov, Mikhael}, TITLE = {On the characteristic numbers of complete manifolds of bounded curvature and finite volume}, BOOKTITLE = {Differential geometry and complex analysis}, PAGES = {115--154}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1985}, MRCLASS = {58G10 (53C20 58G11)}, MRNUMBER = {86h:58131}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @article{Cheeger-Gromov(1986), AUTHOR = {Cheeger, Jeff and Gromov, Mikhael}, TITLE = {${L}\sb 2$-Cohomology and group cohomology}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {25}, YEAR = {1986}, NUMBER = {2}, PAGES = {189--215}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {58G12 (20J05 22E41 53C20 58A14)}, MRNUMBER = {87i:58161}, MRREVIEWER = {Avner Ash}, } @article{Cheeger-Gromov(1986a), AUTHOR = {Cheeger, Jeff and Gromov, Mikhael}, TITLE = {Collapsing {R}iemannian manifolds while keeping their curvature bounded. {I}}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {23}, YEAR = {1986}, NUMBER = {3}, PAGES = {309--346}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C20 (53C21 58G99)}, MRNUMBER = {87k:53087}, MRREVIEWER = {Karsten Grove}, } @article {Cheeger-Gromov(1990), AUTHOR = {Cheeger, Jeff and Gromov, Mikhael}, TITLE = {Collapsing {R}iemannian manifolds while keeping their curvature bounded. {II}}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {32}, YEAR = {1990}, NUMBER = {1}, PAGES = {269--298}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C23}, MRNUMBER = {MR1064875 (92a:53066)}, MRREVIEWER = {Jyh-Yang Wu}, } @article{Cheeger-Gromov-Taylor(1982), AUTHOR = {Cheeger, Jeff and Gromov, Mikhail and Taylor, Michael}, TITLE = {Finite propagation speed, kernel estimates for functions of the {L}aplace operator, and the geometry of complete {R}iemannian manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {17}, YEAR = {1982}, NUMBER = {1}, PAGES = {15--53}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58G30 (53C21)}, MRNUMBER = {84b:58109}, MRREVIEWER = {Helga Baum}, } @article{Cheeger-Mueller-Schrader(1984), AUTHOR = {Cheeger, Jeff and M{\"u}ller, Werner and Schrader, Robert}, TITLE = {On the curvature of piecewise flat spaces}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {92}, YEAR = {1984}, NUMBER = {3}, PAGES = {405--454}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {53C20 (53C80 83C45)}, MRNUMBER = {85m:53037}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @article {Chen-Fox-Lyndon(1958), AUTHOR = {Chen, K.-T. and Fox, R. H. and Lyndon, R. C.}, TITLE = {Free differential calculus. {I}{V}. {T}he quotient groups of the lower central series}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {68}, YEAR = {1958}, PAGES = {81--95}, MRCLASS = {20.00}, MRNUMBER = {21 \#1330}, MRREVIEWER = {R. H. Bruck}, } @incollection {Chen-Ruan(2002), AUTHOR = {Chen, Weimin and Ruan, Yongbin}, TITLE = {Orbifold {G}romov-{W}itten theory}, BOOKTITLE = {Orbifolds in mathematics and physics (Madison, WI, 2001)}, SERIES = {Contemp. Math.}, VOLUME = {310}, PAGES = {25--85}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2002}, MRCLASS = {53D45 (14N35)}, MRNUMBER = {1 950 941}, } @article {Cheng(1998), AUTHOR = {Cheng, Xu}, TITLE = {Yamabe invariant for complete manifold with nonpositive scalar curvature}, JOURNAL = {Chinese Sci. Bull.}, FJOURNAL = {Chinese Science Bulletin}, VOLUME = {43}, YEAR = {1998}, NUMBER = {21}, PAGES = {1790--1793}, ISSN = {1001-6538}, MRCLASS = {53C21 (53C20)}, MRNUMBER = {99m:53075}, MRREVIEWER = {Thalia D. Jeffres}, } @article {Chen-Wang-Yu(2013), AUTHOR = {Chen, Xiaoman and Wang, Qin and Yu, Guoliang}, TITLE = {The maximal coarse {B}aum-{C}onnes conjecture for spaces which admit a fibred coarse embedding into {H}ilbert space}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {249}, YEAR = {2013}, PAGES = {88--130}, ISSN = {0001-8708}, MRCLASS = {46L80 (19Kxx 47L15)}, MRNUMBER = {3116568}, MRREVIEWER = {Ralf Meyer}, DOI = {10.1016/j.aim.2013.09.003}, URL = {http://dx.doi.org/10.1016/j.aim.2013.09.003}, } @book {Cherix-Cowling-Jolissaint-Julg-Valette(2001), AUTHOR = {Cherix, Pierre-Alain and Cowling, Michael and Jolissaint, Paul and Julg, Pierre and Valette, Alain}, TITLE = {Groups with the {H}aagerup property}, SERIES = {Progress in Mathematics}, VOLUME = {197}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {2001}, PAGES = {viii+126}, ISBN = {3-7643-6598-6}, MRCLASS = {22D10 (22-02 22D25 22E30 43A07 46Lxx)}, MRNUMBER = {2002h:22007}, MRREVIEWER = {Tullio G. Ceccherini-Silberstein}, } @article{Chern(1955), AUTHOR = {Chern, Shiing-shen}, TITLE = {On curvature and characteristic classes of a {R}iemann manifold}, JOURNAL = {Abh. Math. Sem. Univ. Hamburg}, VOLUME = {20}, YEAR = {1955}, PAGES = {117--126}, MRCLASS = {53.1X}, MRNUMBER = {17,783e}, MRREVIEWER = {W. M. Boothby}, } @Book {Chern(1968), AUTHOR = {Chern, S. S.}, TITLE = {Minimal submanifolds in a {R}iemannian manifold}, PUBLISHER = {Univ. of Kansas Lawrence}, ADDRESS = {Kan.}, YEAR = {1968}, PAGES = {iii+58}, MRCLASS = {53.04}, MRNUMBER = {40 \#1899}, MRREVIEWER = {B. Smyth}, } @article{Chern-Hirzebruch-Serre(1957), AUTHOR = {Chern, S. S. and Hirzebruch, F. and Serre, J.-P.}, TITLE = {On the index of a fibered manifold}, JOURNAL = {Proc. Amer. Math. Soc.}, VOLUME = {8}, YEAR = {1957}, PAGES = {587--596}, MRCLASS = {55.0X}, MRNUMBER = {19,441c}, MRREVIEWER = {M. F. Atiyah}, } @article{Chern-Simons(1974), AUTHOR = {Chern, Shiing Shen and Simons, James}, TITLE = {Characteristic forms and geometric invariants}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {99}, YEAR = {1974}, PAGES = {48--69}, MRCLASS = {57D20}, MRNUMBER = {50 \#5811}, MRREVIEWER = {R. L. Bishop}, } @article{Chernoff(1973), AUTHOR = {Chernoff, Paul R.}, TITLE = {Essential self-adjointness of powers of generators of hyperbolic equations}, JOURNAL = {J. Functional Analysis}, VOLUME = {12}, YEAR = {1973}, PAGES = {401--414}, MRCLASS = {35G10 (47F05)}, MRNUMBER = {51 \#6119}, MRREVIEWER = {Michael E. Taylor}, } @article {Chisholm(1979), AUTHOR = {Chisholm, Michael E.}, TITLE = {{$k$}-regular mappings of {$2^{n}$}-dimensional {E}uclidean space}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {74}, YEAR = {1979}, NUMBER = {1}, PAGES = {187--190}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {55S99 (41A50)}, MRNUMBER = {521896 (82h:55022)}, DOI = {10.2307/2042128}, URL = {http://dx.doi.org/10.2307/2042128}, } @article {Christensen-Hovey(2002), AUTHOR = {Christensen, J. Daniel and Hovey, Mark}, TITLE = {Quillen model structures for relative homological algebra}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {133}, YEAR = {2002}, NUMBER = {2}, PAGES = {261--293}, ISSN = {0305-0041}, MRCLASS = {18G25 (18A05 18E30 55U15)}, MRNUMBER = {1912401}, MRREVIEWER = {Andrew Borisovich Ver\"{e}vkin}, DOI = {10.1017/S0305004102006126}, URL = {https://doi.org/10.1017/S0305004102006126}, } @Article{Cho-Masuda(2000), AUTHOR = {Cho, Jin-Hwan and Masuda, Mikiya}, TITLE = {Equivariant ${K}$-groups of spheres with involutions}, JOURNAL = {J. Korean Math. Soc.}, FJOURNAL = {Journal of the Korean Mathematical Society}, VOLUME = {37}, YEAR = {2000}, NUMBER = {4}, PAGES = {645--655}, ISSN = {0304-9914}, CODEN = {JKMSDG}, MRCLASS = {19L47 (55N15 55N25 55N91)}, MRNUMBER = {2001e:19008}, MRREVIEWER = {Nicolae Cristian Costinescu}, } @article {Chodosh-Li-Liokumovich(2023), AUTHOR = {Chodosh, Otis and Li, Chao and Liokumovich, Yevgeny}, TITLE = {Classifying sufficiently connected {PSC} manifolds in 4 and 5 dimensions}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {27}, YEAR = {2023}, NUMBER = {4}, PAGES = {1635--1655}, ISSN = {1465-3060,1364-0380}, MRCLASS = {53C21 (57N65)}, MRNUMBER = {4602422}, DOI = {10.2140/gt.2023.27.1635}, URL = {https://doi.org/10.2140/gt.2023.27.1635}, } @article {Christ(2002), AUTHOR = {Christ, Ulrich}, TITLE = {Homogeneity of equifocal submanifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {62}, YEAR = {2002}, NUMBER = {1}, PAGES = {1--15}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {53C30 (53C35 53C40)}, MRNUMBER = {MR1987374 (2004h:53075)}, MRREVIEWER = {Andreas M. Kollross}, } @book {Chung(1997), AUTHOR = {Chung, Fan R. K.}, TITLE = {Spectral graph theory}, SERIES = {CBMS Regional Conference Series in Mathematics}, VOLUME = {92}, PUBLISHER = {Published for the Conference Board of the Mathematical Sciences, Washington, DC}, YEAR = {1997}, PAGES = {xii+207}, ISBN = {0-8218-0315-8}, MRCLASS = {58G99 (05C50 35P05 46N20 47N20)}, MRNUMBER = {1421568 (97k:58183)}, MRREVIEWER = {Robert Brooks}, } @article {Chung-Thom(2015), AUTHOR = {Chung, Nhan-Phu and Thom, Andreas}, TITLE = {Some remarks on the entropy for algebraic actions of amenable groups}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {367}, YEAR = {2015}, NUMBER = {12}, PAGES = {8579--8595}, ISSN = {0002-9947}, MRCLASS = {22D45 (37B40 94A17)}, MRNUMBER = {3403066}, MRREVIEWER = {Thomas Ward}, DOI = {10.1090/S0002-9947-2014-06348-4}, URL = {http://dx.doi.org/10.1090/S0002-9947-2014-06348-4}, } @article {Church(2012), AUTHOR = {Church, Thomas}, TITLE = {Homological stability for configuration spaces of manifolds}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {188}, YEAR = {2012}, NUMBER = {2}, PAGES = {465--504}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {55R80}, MRNUMBER = {2909770}, MRREVIEWER = {Donald W. Kahn}, DOI = {10.1007/s00222-011-0353-4}, URL = {http://dx.doi.org/10.1007/s00222-011-0353-4}, } @article {Church-Farb(2012), AUTHOR = {Church, Thomas and Farb, Benson}, TITLE = {Parameterized {A}bel-{J}acobi maps and abelian cycles in the {T}orelli group}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {5}, YEAR = {2012}, NUMBER = {1}, PAGES = {15--38}, ISSN = {1753-8416}, MRCLASS = {57Mxx (20F38)}, MRNUMBER = {2897048}, DOI = {10.1112/jtopol/jtr026}, URL = {http://dx.doi.org/10.1112/jtopol/jtr026}, } @article {Church-Farb(2010reps), AUTHOR = {Church, Thomas and Farb, Benson}, TITLE = {Infinite generation of the kernels of the {M}agnus and {B}urau representations}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {10}, YEAR = {2010}, NUMBER = {2}, PAGES = {837--851}, ISSN = {1472-2747}, MRCLASS = {20F36 (20F34 57M07)}, MRNUMBER = {2629766 (2011f:20084)}, MRREVIEWER = {Juan Gonz{\'a}lez-Meneses}, DOI = {10.2140/agt.2010.10.837}, URL = {http://dx.doi.org/10.2140/agt.2010.10.837}, } @article {Church-Pixton(2011), AUTHOR = {Church, Thomas and Pixton, Aaron}, TITLE = {Separating twists and the {M}agnus representation of the {T}orelli group}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {155}, YEAR = {2011}, PAGES = {177--190}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {57M07 (20F38)}, MRNUMBER = {2863900 (2012j:57002)}, MRREVIEWER = {Andrew Putman}, DOI = {10.1007/s10711-011-9584-1}, URL = {http://dx.doi.org/10.1007/s10711-011-9584-1}, } @book {Cisinki(2011), AUTHOR = {Cisinski, Denis-Charles}, TITLE = {Higher categories and homotopical algebra}, SERIES = {Cambridge Studies in Advanced Mathematics}, VOLUME = {180}, PUBLISHER = {Cambridge University Press, Cambridge}, YEAR = {2019}, PAGES = {xviii+430}, ISBN = {978-1-108-47320-0}, MRCLASS = {18-02 (18D05 18F20 18G55 55U10 55U35)}, MRNUMBER = {3931682}, MRREVIEWER = {Charles\ Rezk}, DOI = {10.1017/9781108588737}, URL = {https://doi.org/10.1017/9781108588737}, } @article {Cisinki(2010inv), AUTHOR = {Cisinski, Denis-Charles}, TITLE = {Invariance de la {$K$}-th\'eorie par \'equivalences d\'eriv\'ees}, JOURNAL = {J. K-Theory}, FJOURNAL = {Journal of K-Theory. K-Theory and its Applications in Algebra, Geometry, Analysis \& Topology}, VOLUME = {6}, YEAR = {2010}, NUMBER = {3}, PAGES = {505--546}, ISSN = {1865-2433}, MRCLASS = {19D10 (18G55 55U35)}, MRNUMBER = {2746284 (2012h:19006)}, MRREVIEWER = {Philippe Gaucher}, DOI = {10.1017/is009010008jkt094}, URL = {http://dx.doi.org/10.1017/is009010008jkt094}, } @article {Cisinki(2010cat_der), AUTHOR = {Cisinski, Denis-Charles}, TITLE = {Cat\'egories d\'erivables}, JOURNAL = {Bull. Soc. Math. France}, FJOURNAL = {Bulletin de la Soci\'et\'e Math\'ematique de France}, VOLUME = {138}, YEAR = {2010}, NUMBER = {3}, PAGES = {317--393}, ISSN = {0037-9484}, CODEN = {BSMFAA}, MRCLASS = {18G10 (18G55 55U35 55U40)}, MRNUMBER = {2729017 (2012b:18019)}, MRREVIEWER = {Timothy Porter}, } @article {Cisinki(2009), AUTHOR = {Cisinski, Denis-Charles}, TITLE = {Locally constant functors}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {147}, YEAR = {2009}, NUMBER = {3}, PAGES = {593--614}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {18A25 (18G55 55U35)}, MRNUMBER = {2557145 (2010k:18001)}, MRREVIEWER = {Philippe Gaucher}, DOI = {10.1017/S030500410900262X}, URL = {http://dx.doi.org/10.1017/S030500410900262X}, } @article {Cisinki(2008), AUTHOR = {Cisinski, Denis-Charles}, TITLE = {Propri\'et\'es universelles et extensions de {K}an d\'eriv\'ees}, JOURNAL = {Theory Appl. Categ.}, FJOURNAL = {Theory and Applications of Categories}, VOLUME = {20}, YEAR = {2008}, PAGES = {No. 17, 605--649}, ISSN = {1201-561X}, MRCLASS = {55U40 (18A40 18G50 18G55 55U35)}, MRNUMBER = {2534209 (2010j:55021)}, MRREVIEWER = {Viorel Mihai Gontineac}, } @article {Cisinki-Deglise(2009), AUTHOR = {Cisinski, Denis-Charles and D{\'e}glise, Fr{\'e}d{\'e}ric}, TITLE = {Local and stable homological algebra in {G}rothendieck abelian categories}, JOURNAL = {Homology, Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {11}, YEAR = {2009}, NUMBER = {1}, PAGES = {219--260}, ISSN = {1532-0073}, MRCLASS = {18G55 (14F42 18E15 18G35)}, MRNUMBER = {2529161 (2010h:18025)}, MRREVIEWER = {Annette Huber}, URL = {http://projecteuclid.org/getRecord?id=euclid.hha/1251832567}, } @article {Cisinki-Matsiniotis(2011), AUTHOR = {Cisinski, Denis-Charles and Maltsiniotis, Georges}, TITLE = {La cat\'egorie {$\Theta$} de {J}oyal est une cat\'egorie test}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {215}, YEAR = {2011}, NUMBER = {5}, PAGES = {962--982}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {18E35 (18F20 55P15 55U10 55U40)}, MRNUMBER = {2747231 (2012a:18027)}, MRREVIEWER = {Geoffrey M. L. Powell}, DOI = {10.1016/j.jpaa.2010.07.003}, URL = {http://dx.doi.org/10.1016/j.jpaa.2010.07.003}, } @article {Cisinski-Moerdijk(2011), AUTHOR = {Cisinski, Denis-Charles and Moerdijk, Ieke}, TITLE = {Dendroidal sets as models for homotopy operads}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {4}, YEAR = {2011}, NUMBER = {2}, PAGES = {257--299}, ISSN = {1753-8416}, MRCLASS = {55P48 (18D10 18G30 18G55 55U10 55U40)}, MRNUMBER = {2805991 (2012e:55013)}, MRREVIEWER = {Julia Bergner}, DOI = {10.1112/jtopol/jtq039}, URL = {http://dx.doi.org/10.1112/jtopol/jtq039}, } @article {Cisinki-Neeman(2008), AUTHOR = {Cisinski, Denis-Charles and Neeman, Amnon}, TITLE = {Additivity for derivator {$K$}-theory}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {217}, YEAR = {2008}, NUMBER = {4}, PAGES = {1381--1475}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {19D06 (18E30 19D10 55P42)}, MRNUMBER = {2382732 (2009a:19003)}, MRREVIEWER = {Giordano Favi}, DOI = {10.1016/j.aim.2007.10.003}, URL = {http://dx.doi.org/10.1016/j.aim.2007.10.003}, } @article {Cisinski-Tabuada(2011), AUTHOR = {Cisinski, Denis-Charles and Tabuada, Gon{\c{c}}alo}, TITLE = {Non-connective {$K$}-theory via universal invariants}, JOURNAL = {Compos. Math.}, FJOURNAL = {Compositio Mathematica}, VOLUME = {147}, YEAR = {2011}, NUMBER = {4}, PAGES = {1281--1320}, ISSN = {0010-437X}, MRCLASS = {19D35 (18G55 19D55)}, MRNUMBER = {2822869 (2012f:19005)}, MRREVIEWER = {Philippe Gaucher}, DOI = {10.1112/S0010437X11005380}, URL = {http://dx.doi.org/10.1112/S0010437X11005380}, } @article{Clair(1999), AUTHOR = {Clair, Bryan}, TITLE = {Residual amenability and the approximation of ${L}\sp 2$-invariants}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {The Michigan Mathematical Journal}, VOLUME = {46}, YEAR = {1999}, NUMBER = {2}, PAGES = {331--346}, ISSN = {0026-2285}, MRCLASS = {58J52 (57Q10)}, MRNUMBER = {2001b:58053}, MRREVIEWER = {A. R. Shastri}, } @article {Clair-Whyte(2003), AUTHOR = {Clair, Bryan and Whyte, Kevin}, TITLE = {Growth of {B}etti numbers}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {42}, YEAR = {2003}, NUMBER = {5}, PAGES = {1125--1142}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {58J52 (57Q10 58J22)}, MRNUMBER = {1978050 (2004e:58057)}, MRREVIEWER = {Michael S. Farber}, DOI = {10.1016/S0040-9383(02)00046-0}, URL = {http://dx.doi.org/10.1016/S0040-9383(02)00046-0}, } @article {Clapp(1981), AUTHOR = {Clapp, M{\'o}nica}, TITLE = {Duality and transfer for parametrized spectra}, JOURNAL = {Arch. Math. (Basel)}, FJOURNAL = {Archiv der Mathematik. Archives of Mathematics. Archives Math\'ematiques}, VOLUME = {37}, YEAR = {1981}, NUMBER = {5}, PAGES = {462--472}, ISSN = {0003-889X}, CODEN = {ACVMAL}, MRCLASS = {55P25}, MRNUMBER = {643290}, MRREVIEWER = {J. M. Boardman}, DOI = {10.1007/BF01234383}, URL = {http://dx.doi.org/10.1007/BF01234383}, } @article {Clapp-Puppe(1984), AUTHOR = {Clapp, M{\'o}nica and Puppe, Dieter}, TITLE = {The homotopy category of parametrized spectra}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {45}, YEAR = {1984}, NUMBER = {3}, PAGES = {219--247}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {55P42 (55R65)}, MRNUMBER = {MR734840 (85c:55007)}, MRREVIEWER = {Richard John Steiner}, } @article{Clapp-Puppe(1986), AUTHOR = {Clapp, M{\'o}nica and Puppe, Dieter}, TITLE = {Invariants of the {L}usternik-{S}chnirelmann type and the topology of critical sets}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {298}, YEAR = {1986}, NUMBER = {2}, PAGES = {603--620}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {55M30 (55P50)}, MRNUMBER = {88d:55004}, MRREVIEWER = {E. Fadell}, } @article{Clapp-Puppe(1990), AUTHOR = {Clapp, M{\'o}nica and Puppe, Dieter}, TITLE = {The generalized {L}usternik-{S}chnirelmann category of a product space}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {321}, YEAR = {1990}, NUMBER = {2}, PAGES = {525--532}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {55P50}, MRNUMBER = {91a:55012}, MRREVIEWER = {Yves F{\'e}lix}, } @incollection {Claudi(1988), AUTHOR = {Busqu{\'e}, Claudi}, TITLE = {Directly finite {$\aleph\sb 0$}-complete regular rings are unit-regular}, BOOKTITLE = {Ring theory (Granada, 1986)}, SERIES = {Lecture Notes in Math.}, VOLUME = {1328}, PAGES = {38--49}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1988}, MRCLASS = {16A30}, MRNUMBER = {MR959742 (89k:16021)}, } @article {Clausen-Mathew-Naumann-Noel(2024), AUTHOR = {Clausen, Dustin and Mathew, Akhil and Naumann, Niko and Noel, Justin}, TITLE = {Descent and vanishing in chromatic algebraic {$K$}-theory via group actions}, JOURNAL = {Ann. Sci. \'Ec. Norm. Sup\'er. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {57}, YEAR = {2024}, NUMBER = {4}, PAGES = {1135--1190}, ISSN = {0012-9593,1873-2151}, MRCLASS = {18N60 (19D10 19L47)}, MRNUMBER = {4773302}, } @article {Clay(2017free), AUTHOR = {Clay, Matt}, TITLE = {{$\ell^2$}-torsion of free-by-cyclic groups}, JOURNAL = {Q. J. Math.}, FJOURNAL = {The Quarterly Journal of Mathematics}, VOLUME = {68}, YEAR = {2017}, NUMBER = {2}, PAGES = {617--634}, ISSN = {0033-5606}, MRCLASS = {20J05 (57M07)}, MRNUMBER = {3667215}, URL = {https://doi.org/10.1093/qmath/haw057}, } @article {Clay(2017homology), AUTHOR = {Clay, Matt}, TITLE = {{$\ell^2$}-homology of the free group}, JOURNAL = {Expo. Math.}, FJOURNAL = {Expositiones Mathematicae}, VOLUME = {35}, YEAR = {2017}, NUMBER = {2}, PAGES = {133--148}, ISSN = {0723-0869}, MRCLASS = {20J06 (20E05 55N35)}, MRNUMBER = {3654071}, URL = {https://doi.org/10.1016/j.exmath.2016.09.001}, } @article{Cliff(1980), AUTHOR = {Cliff, Gerald H.}, TITLE = {Zero divisors and idempotents in group rings}, JOURNAL = {Canad. J. Math.}, FJOURNAL = {Canadian Journal of Mathematics. Journal Canadien de Math\'ematiques}, VOLUME = {32}, YEAR = {1980}, NUMBER = {3}, PAGES = {596--602}, ISSN = {0008-414X}, CODEN = {CJMAAB}, MRCLASS = {16A26 (20C07)}, MRNUMBER = {81k:16011}, MRREVIEWER = {E. Formanek}, } @article{Cliff-Weiss(1988), AUTHOR = {Cliff, Gerald and Weiss, Alfred}, TITLE = {Moody's induction theorem}, JOURNAL = {Illinois J. Math.}, FJOURNAL = {Illinois Journal of Mathematics}, VOLUME = {32}, YEAR = {1988}, NUMBER = {3}, PAGES = {489--500}, ISSN = {0019-2082}, CODEN = {IJMTAW}, MRCLASS = {16A27 (19A31 20C07)}, MRNUMBER = {89h:16009}, MRREVIEWER = {Donald S. Passman}, } @article {Coates-Lichtenbaum(1973), AUTHOR = {Coates, J. and Lichtenbaum, S.}, TITLE = {On {$l$}-adic zeta functions}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {98}, YEAR = {1973}, PAGES = {498--550}, ISSN = {0003-486X}, MRCLASS = {12A70}, MRNUMBER = {MR0330107 (48 \#8445)}, MRREVIEWER = {T. Kubota}, } @article{Cochran(1984), AUTHOR = {Cochran, T.}, TITLE = {$4$-manifolds which embed in ${\mathbf{R}}\sp{6}$ but not in ${\mathbf{R}}\sp{5}$, and {S}eifert manifolds for fibered knots}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {77}, YEAR = {1984}, NUMBER = {1}, PAGES = {173--184}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57R40 (57N13)}, MRNUMBER = {86a:57024}, MRREVIEWER = {Cameron McA. Gordon}, } @article {Cochran(2004), AUTHOR = {Cochran, Tim D.}, TITLE = {Noncommutative knot theory}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {4}, YEAR = {2004}, PAGES = {347--398}, ISSN = {1472-2747}, MRCLASS = {57M27 (20F14)}, MRNUMBER = {MR2077670 (2005k:57023)}, MRREVIEWER = {Martin Scharlemann}, } @article {Cochran-Friedl-Teichner(2009), AUTHOR = {Cochran, Tim and Friedl, Stefan and Teichner, Peter}, TITLE = {New constructions of slice links}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {84}, YEAR = {2009}, NUMBER = {3}, PAGES = {617--638}, ISSN = {0010-2571}, MRCLASS = {57M25}, MRNUMBER = {2507256 (2011a:57011)}, MRREVIEWER = {Daniel Silver}, DOI = {10.4171/CMH/175}, URL = {http://dx.doi.org/10.4171/CMH/175}, } @article{Cochran-Habegger(1990), AUTHOR = {Cochran, Tim D. and Habegger, Nathan}, TITLE = {On the homotopy theory of simply connected four manifolds}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {29}, YEAR = {1990}, NUMBER = {4}, PAGES = {419--440}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57N13 (55P10 55Q52)}, MRNUMBER = {91h:57006}, MRREVIEWER = {Laurence R. Taylor}, } @article{Cochran-Orr(1993), AUTHOR = {Cochran, Tim D. and Orr, Kent E.}, TITLE = {Not all links are concordant to boundary links}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {138}, YEAR = {1993}, NUMBER = {3}, PAGES = {519--554}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57Q45 (57M25)}, MRNUMBER = {95c:57042}, MRREVIEWER = {J. P. Levine}, } @article{Cochran-Orr(1994), AUTHOR = {Cochran, Tim D. and Orr, Kent E.}, TITLE = {Homology boundary links and {B}lanchfield forms: concordance classification and new tangle-theoretic constructions}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {33}, YEAR = {1994}, NUMBER = {3}, PAGES = {397--427}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57Q45 (57Q60)}, MRNUMBER = {95f:57041}, MRREVIEWER = {J. P. Levine}, } @article{Cochran-Orr-Teichner(2003), AUTHOR = {Cochran, Tim D. and Orr, Kent E. and Teichner, Peter}, TITLE = {Knot concordance, {W}hitney towers and {$L\sp 2$}-signatures}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {157}, YEAR = {2003}, NUMBER = {2}, PAGES = {433--519}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57M25 (57M27 57Rxx 58Jxx)}, MRNUMBER = {1 973 052}, } @article {Cochran-Teichner(2007), AUTHOR = {Cochran, Tim D. and Teichner, Peter}, TITLE = {Knot concordance and von {N}eumann {$\rho$}-invariants}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {137}, YEAR = {2007}, NUMBER = {2}, PAGES = {337--379}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {57M25 (57N70)}, MRNUMBER = {2309149 (2008f:57005)}, MRREVIEWER = {Swatee Naik}, DOI = {10.1215/S0012-7094-07-13723-2}, URL = {http://dx.doi.org/10.1215/S0012-7094-07-13723-2}, } @article {Cogolludo-Florens(2007), AUTHOR = {Cogolludo Agust{\'{\i}}n, J. I. and Florens, V.}, TITLE = {Twisted {A}lexander polynomials of plane algebraic curves}, JOURNAL = {J. Lond. Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {76}, YEAR = {2007}, NUMBER = {1}, PAGES = {105--121}, ISSN = {0024-6107}, MRCLASS = {57M05 (14H50 55N33 57Q10)}, MRNUMBER = {2351611 (2008h:57003)}, MRREVIEWER = {Laurentiu G. Maxim}, DOI = {10.1112/jlms/jdm004}, URL = {http://dx.doi.org/10.1112/jlms/jdm004}, } @book{Cohen(1970b), AUTHOR = {Cohen, Joel M.}, TITLE = {Stable homotopy}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1970}, PAGES = {v+194}, MRCLASS = {55.40}, MRNUMBER = {42 \#8486}, MRREVIEWER = {R. M. F. Moss}, } @book{Cohen(1973), AUTHOR = {Cohen, Marshall M.}, TITLE = {A course in simple-homotopy theory}, NOTE = {Graduate Texts in Mathematics, Vol. 10}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1973}, PAGES = {x+144}, MRCLASS = {57C10}, MRNUMBER = {50 \#14762}, MRREVIEWER = {R. M. F. Moss}, } @article {Cohen(1973OmegaSigma), AUTHOR = {Cohen, Fred}, TITLE = {Homology of {$\Omega ^{(n+1)}\Sigma ^{(n+1)}X$} and {$C_{(n+1)}X,\,n>0$}}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {79}, YEAR = {1973}, PAGES = {1236--1241 (1974)}, ISSN = {0002-9904}, MRCLASS = {55G20 (55D35)}, MRNUMBER = {0339176 (49 \#3939)}, MRREVIEWER = {D. W. Anderson}, } @article {Cohen(1973braid), AUTHOR = {Cohen, Fred}, TITLE = {Cohomology of braid spaces}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {79}, YEAR = {1973}, PAGES = {763--766}, ISSN = {0002-9904}, MRCLASS = {55B25}, MRNUMBER = {0321074 (47 \#9607)}, MRREVIEWER = {S. Gitler}, } @article{Cohen(1979), AUTHOR = {Cohen, Joel M.}, TITLE = {von {N}eumann dimension and the homology of covering spaces}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {30}, YEAR = {1979}, NUMBER = {118}, PAGES = {133--142}, ISSN = {0033-5606}, CODEN = {QJMAAT}, MRCLASS = {20J05 (46L10)}, MRNUMBER = {81i:20060}, MRREVIEWER = {Alain Connes}, } @incollection {Cohen(1987), AUTHOR = {Cohen, F. R.}, TITLE = {A course in some aspects of classical homotopy theory}, BOOKTITLE = {Algebraic topology ({S}eattle, {W}ash., 1985)}, SERIES = {Lecture Notes in Math.}, VOLUME = {1286}, PAGES = {1--92}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1987}, MRCLASS = {55Qxx (55-02 55Pxx)}, MRNUMBER = {922923 (89e:55027)}, MRREVIEWER = {Paul Selick}, DOI = {10.1007/BFb0078738}, URL = {http://dx.doi.org/10.1007/BFb0078738}, } @article{Cohen(1988), AUTHOR = {Cohen, Joel M.}, TITLE = {${L}\sp 2$-cohomology in topology, algebra, and analysis}, NOTE = {Third National Conference on Topology (Italian) (Trieste, 1986)}, JOURNAL = {Rend. Circ. Mat. Palermo (2) Suppl.}, FJOURNAL = {Rendiconti del Circolo Matematico di Palermo. Serie II. Supplemento}, VOLUME = {18}, YEAR = {1988}, PAGES = {31--36}, MRCLASS = {58G12 (22E41 46L80 46M20 55N35 57R20 58G10)}, MRNUMBER = {89h:58181}, MRREVIEWER = {J. S. Joel}, } @book{Cohen(1989), AUTHOR = {Cohen, Daniel E.}, TITLE = {Combinatorial group theory: a topological approach}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1989}, PAGES = {x+310}, ISBN = {0-521-34133-7; 0-521-34936-2}, MRCLASS = {20-01 (20E06 20F05 57M05 57M10 57M20)}, MRNUMBER = {91d:20001}, MRREVIEWER = {Stephen J. Pride}, } @article {Cohen-Cohen-Kuhn-Neisendorfer(1983), AUTHOR = {Cohen, F. R. and Cohen, R. L. and Kuhn, N. J. and Neisendorfer, J. L.}, TITLE = {Bundles over configuration spaces}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {104}, YEAR = {1983}, NUMBER = {1}, PAGES = {47--54}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {55P35 (55R50)}, MRNUMBER = {683727 (84m:55009)}, MRREVIEWER = {V. P. Snaith}, URL = {http://projecteuclid.org/euclid.pjm/1102723817}, } @article{Cohen-Cohen-Mann-Milgram(1993), AUTHOR = {Cohen, F. R. and Cohen, R. L. and Mann, B. M. and Milgram, R. J.}, TITLE = {The homotopy type of rational functions}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {213}, YEAR = {1993}, NUMBER = {1}, PAGES = {37--47}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {55P42 (55P15)}, MRNUMBER = {94a:55006}, MRREVIEWER = {Donald M. Davis}, } @article {Cohen-Handel(1978), AUTHOR = {Cohen, F. R. and Handel, D.}, TITLE = {{$k$}-regular embeddings of the plane}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {72}, YEAR = {1978}, NUMBER = {1}, PAGES = {201--204}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57-XX}, MRNUMBER = {524347 (80e:57033)}, MRREVIEWER = {Donald M. Davis}, DOI = {10.2307/2042564}, URL = {http://dx.doi.org/10.2307/2042564}, } @book {Cohen-Lada-May(1976), AUTHOR = {Cohen, Frederick R. and Lada, Thomas J. and May, J. Peter}, TITLE = {The homology of iterated loop spaces}, SERIES = {Lecture Notes in Mathematics, Vol. 533}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1976}, PAGES = {vii+490}, MRCLASS = {55G25 (55D35)}, MRNUMBER = {0436146 (55 \#9096)}, MRREVIEWER = {Peter J. Eccles}, } @incollection {Cohen-Mahowald-Milgram(1978), AUTHOR = {Cohen, F. R. and Mahowald, M. E. and Milgram, R. J.}, TITLE = {The stable decomposition for the double loop space of a sphere}, BOOKTITLE = {Algebraic and geometric topology ({P}roc. {S}ympos. {P}ure {M}ath., {S}tanford {U}niv., {S}tanford, {C}alif., 1976), {P}art 2}, SERIES = {Proc. Sympos. Pure Math., XXXII}, PAGES = {225--228}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1978}, MRCLASS = {55P35 (55P42)}, MRNUMBER = {520543 (80j:55009)}, MRREVIEWER = {P. W. H. Lemmens}, } @article {Cohen-May-Taylor(1979more), AUTHOR = {Cohen, F. R. and May, J. P. and Taylor, L. R.}, TITLE = {Splitting of some more spaces}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {86}, YEAR = {1979}, NUMBER = {2}, PAGES = {227--236}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {55P10}, MRNUMBER = {538744 (81b:55016)}, MRREVIEWER = {Stanley Kochman}, DOI = {10.1017/S0305004100056048}, URL = {http://dx.doi.org/10.1017/S0305004100056048}, } @article {Cohen-May-Taylor(1979), AUTHOR = {Cohen, F. R. and May, J. P. and Taylor, L. R.}, TITLE = {Splitting of certain spaces {$CX$}}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {84}, YEAR = {1978}, NUMBER = {3}, PAGES = {465--496}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {55P47 (55Q35)}, MRNUMBER = {503007 (80a:55010)}, MRREVIEWER = {V. P. Snaith}, DOI = {10.1017/S0305004100055298}, URL = {http://dx.doi.org/10.1017/S0305004100055298}, } @incollection {Cohen-Neisendorfer(1984), AUTHOR = {Cohen, F. R. and Neisendorfer, J. A.}, TITLE = {A construction of {$p$}-local {$H$}-spaces}, BOOKTITLE = {Algebraic topology, {A}arhus 1982 ({A}arhus, 1982)}, SERIES = {Lecture Notes in Math.}, VOLUME = {1051}, PAGES = {351--359}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1984}, MRCLASS = {55P45 (55P35)}, MRNUMBER = {764588 (86e:55011)}, MRREVIEWER = {Charles A. McGibbon}, DOI = {10.1007/BFb0075576}, URL = {http://dx.doi.org/10.1007/BFb0075576}, } @incollection {Cohen-Suciu(2008), AUTHOR = {Cohen, Daniel C. and Suciu, Alexander I.}, TITLE = {The boundary manifold of a complex line arrangement}, BOOKTITLE = {Groups, homotopy and configuration spaces}, SERIES = {Geom. Topol. Monogr.}, VOLUME = {13}, PAGES = {105--146}, PUBLISHER = {Geom. Topol. Publ., Coventry}, YEAR = {2008}, MRCLASS = {32S22 (57M27)}, MRNUMBER = {2508203 (2010c:32051)}, MRREVIEWER = {Henry K. Schenck}, DOI = {10.2140/gtm.2008.13.105}, URL = {http://dx.doi.org/10.2140/gtm.2008.13.105}, } @article {Cohen-Suciu(2006), AUTHOR = {Cohen, Daniel C. and Suciu, Alexander I.}, TITLE = {Boundary manifolds of projective hypersurfaces}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {206}, YEAR = {2006}, NUMBER = {2}, PAGES = {538--566}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {14J70 (16W50 32S22 32S35 55M30)}, MRNUMBER = {2263714 (2007j:14064)}, MRREVIEWER = {Henry K. Schenck}, DOI = {10.1016/j.aim.2005.10.003}, URL = {http://dx.doi.org/10.1016/j.aim.2005.10.003}, } @article {Cohen-Suciu(1999characteristic), AUTHOR = {Cohen, Daniel C. and Suciu, Alexander I.}, TITLE = {Characteristic varieties of arrangements}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {127}, YEAR = {1999}, NUMBER = {1}, PAGES = {33--53}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {32S22 (52C35)}, MRNUMBER = {1692519 (2000m:32036)}, MRREVIEWER = {Hiroaki Terao}, DOI = {10.1017/S0305004199003576}, URL = {http://dx.doi.org/10.1017/S0305004199003576}, } @article {Cohen-Suciu(1999(Alexander), AUTHOR = {Cohen, Daniel C. and Suciu, Alexander I.}, TITLE = {Alexander invariants of complex hyperplane arrangements}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {351}, YEAR = {1999}, NUMBER = {10}, PAGES = {4043--4067}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {52B30 (20F34 57M05)}, MRNUMBER = {1475679 (99m:52019)}, MRREVIEWER = {Richard Randell}, DOI = {10.1090/S0002-9947-99-02206-0}, URL = {http://dx.doi.org/10.1090/S0002-9947-99-02206-0}, } @article {Cohen-Suciu(1998), AUTHOR = {Cohen, Daniel C. and Suciu, Alexander I.}, TITLE = {Homology of iterated semidirect products of free groups}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {126}, YEAR = {1998}, NUMBER = {1-3}, PAGES = {87--120}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20J05 (20F36 57M05)}, MRNUMBER = {1600518 (99e:20064)}, MRREVIEWER = {Paul Igodt}, DOI = {10.1016/S0022-4049(96)00153-3}, URL = {http://dx.doi.org/10.1016/S0022-4049(96)00153-3}, } @article {Cohen-Suciu(1995), AUTHOR = {Cohen, Daniel C. and Suciu, Alexander I.}, TITLE = {On {M}ilnor fibrations of arrangements}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {51}, YEAR = {1995}, NUMBER = {1}, PAGES = {105--119}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {32S55 (52B30)}, MRNUMBER = {1310725 (96e:32034)}, MRREVIEWER = {Richard Randell}, DOI = {10.1112/jlms/51.1.105}, URL = {http://dx.doi.org/10.1112/jlms/51.1.105}, } @article{Cohn(1964), AUTHOR = {Cohn, P. M.}, TITLE = {Free ideal rings}, JOURNAL = {J. Algebra}, VOLUME = {1}, YEAR = {1964}, PAGES = {47--69}, MRCLASS = {16.20}, MRNUMBER = {28 \#5095}, MRREVIEWER = {D. Zelinsky}, } @book{Cohn(1977), AUTHOR = {Cohn, Paul Moritz}, TITLE = {Skew field constructions}, NOTE = {London Mathematical Society Lecture Note Series, No. 27}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1977}, PAGES = {xii+253}, MRCLASS = {16A40}, MRNUMBER = {57 \#3190}, MRREVIEWER = {L. A. Koifman}, } @book{Cohn(1980), AUTHOR = {Cohn, Donald L.}, TITLE = {Measure theory}, PUBLISHER = {Birkh\"auser Boston}, ADDRESS = {Mass.}, YEAR = {1980}, PAGES = {ix+373}, ISBN = {3-7643-3003-1}, MRCLASS = {28-01}, MRNUMBER = {81k:28001}, MRREVIEWER = {Dieter Hoffmann}, } @book{Cohn(1985), AUTHOR = {Cohn, P. M.}, TITLE = {Free rings and their relations}, EDITION = {Second}, PUBLISHER = {Academic Press Inc. [Harcourt Brace Jovanovich Publishers]}, ADDRESS = {London}, YEAR = {1985}, PAGES = {xxii+588}, ISBN = {0-12-179152-1}, MRCLASS = {16A06 (16-02)}, MRNUMBER = {87e:16006}, MRREVIEWER = {L. G. Makar-Limanov}, } @book{Cohn(1991), AUTHOR = {Cohn, P. M.}, TITLE = {Algebra. {V}ol. 3}, EDITION = {Second}, PUBLISHER = {John Wiley \& Sons Ltd.}, ADDRESS = {Chichester}, YEAR = {1991}, PAGES = {xii+474}, ISBN = {0-471-92840-2}, MRCLASS = {00A05 (08-01 13-01 20-01)}, MRNUMBER = {92c:00001}, MRREVIEWER = {Boris M. Schein}, } @book{Cohn(1995), AUTHOR = {Cohn, P. M.}, TITLE = {Skew fields}, SERIES = {Encyclopedia of Mathematics and its Applications}, VOLUME = {57}, NOTE = {Theory of general division rings}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1995}, PAGES = {xvi+500}, ISBN = {0-521-43217-0}, MRCLASS = {12E15 (16K40)}, MRNUMBER = {1349108 (97d:12003)}, MRREVIEWER = {Jan van Geel}, DOI = {10.1017/CBO9781139087193}, URL = {http://dx.doi.org/10.1017/CBO9781139087193}, } @book {Cohn(2006free), AUTHOR = {Cohn, P. M.}, TITLE = {Free ideal rings and localization in general rings}, SERIES = {New Mathematical Monographs}, VOLUME = {3}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {2006}, PAGES = {xxii+572}, ISBN = {978-0-521-85337-8; 0-521-85337-0}, MRCLASS = {16E60 (16K99 16S10 16U99)}, MRNUMBER = {2246388 (2007k:16020)}, MRREVIEWER = {Mike Prest}, DOI = {10.1017/CBO9780511542794}, URL = {http://dx.doi.org/10.1017/CBO9780511542794}, } @article {Cole(2006homotopycategories), AUTHOR = {Cole, Michael}, TITLE = {Many homotopy categories are homotopy categories}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {153}, YEAR = {2006}, NUMBER = {7}, PAGES = {1084--1099}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {55P42 (55U35)}, MRNUMBER = {MR2203021 (2006k:55015)}, MRREVIEWER = {Elias Gabriel Minian}, } @article {Cole(2006mixing), AUTHOR = {Cole, Michael}, TITLE = {Mixing model structures}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {153}, YEAR = {2006}, NUMBER = {7}, PAGES = {1016--1032}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {55P42 (55U35)}, MRNUMBER = {MR2203016 (2006j:55008)}, MRREVIEWER = {Birgit Richter}, } @article {Cole-Greenless-Kriz(2002), AUTHOR = {Cole, Michael and Greenlees, J. P. C. and Kriz, I.}, TITLE = {The universality of equivariant complex bordism}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {239}, YEAR = {2002}, NUMBER = {3}, PAGES = {455--475}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {55N91 (55N22 57R77)}, MRNUMBER = {MR1893848 (2003a:55011)}, MRREVIEWER = {Mark Hovey}, } @article {Cole-Greenless-Kriz(2000), AUTHOR = {Cole, Michael and Greenlees, J. P. C. and Kriz, I.}, TITLE = {Equivariant formal group laws}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {81}, YEAR = {2000}, NUMBER = {2}, PAGES = {355--386}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {55N22 (55N91)}, MRNUMBER = {MR1770613 (2001i:55006)}, MRREVIEWER = {Mark Hovey}, } @article {Connell-Hollingsworth(1969), AUTHOR = {Connell, E. H. and Hollingsworth, John}, TITLE = {Geometric groups and {W}hitehead torsion}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {140}, YEAR = {1969}, PAGES = {161--181}, ISSN = {0002-9947}, MRCLASS = {55.40}, MRNUMBER = {0242151 (39 \#3485)}, MRREVIEWER = {C. W. Patty}, } @article{Colliot-Thelene(1983), AUTHOR = {Colliot-Th{\'e}l{\`e}ne, Jean-Louis}, TITLE = {Hilbert's {T}heorem 90 for ${K}\sb{2}$, with application to the {C}how groups of rational surfaces}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {71}, YEAR = {1983}, NUMBER = {1}, PAGES = {1--20}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {14C35 (11R70 18F25)}, MRNUMBER = {85d:14016}, MRREVIEWER = {Daniel R. Grayson}, } @article {Conant-Schneiderman-Teichner(2017), AUTHOR = {Conant, Jim and Schneiderman, Rob and Teichner, Peter}, TITLE = {Cochran's {$\beta^i$}-invariants via twisted {W}hitney towers}, JOURNAL = {J. Knot Theory Ramifications}, FJOURNAL = {Journal of Knot Theory and its Ramifications}, VOLUME = {26}, YEAR = {2017}, NUMBER = {2}, PAGES = {1740012, 28}, ISSN = {0218-2165}, MRCLASS = {57M25 (57M27)}, MRNUMBER = {3604494}, MRREVIEWER = {Stefan K. Friedl}, DOI = {10.1142/S0218216517400120}, URL = {http://dx.doi.org/10.1142/S0218216517400120}, } @article {Conant-Schneiderman-Teichner(2016), AUTHOR = {Conant, James and Schneiderman, Robert and Teichner, Peter}, TITLE = {Geometric filtrations of string links and homology cylinders}, JOURNAL = {Quantum Topol.}, FJOURNAL = {Quantum Topology}, VOLUME = {7}, YEAR = {2016}, NUMBER = {2}, PAGES = {281--328}, ISSN = {1663-487X}, MRCLASS = {57M27 (17B01 18D05)}, MRNUMBER = {3459962}, MRREVIEWER = {Leandro Vendramin}, DOI = {10.4171/QT/77}, URL = {http://dx.doi.org/10.4171/QT/77}, } @article {Conant-Schneiderman-Teichner(2014), AUTHOR = {Conant, J. and Schneiderman, R. and Teichner, P.}, TITLE = {Milnor invariants and twisted {W}hitney towers}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {7}, YEAR = {2014}, NUMBER = {1}, PAGES = {187--224}, ISSN = {1753-8416}, MRCLASS = {57M25}, MRNUMBER = {3180617}, MRREVIEWER = {Neil R. Nicholson}, DOI = {10.1112/jtopol/jtt025}, URL = {http://dx.doi.org/10.1112/jtopol/jtt025}, } @inproceedings {Conant-Schneiderman-Teichner(2012universal), AUTHOR = {Conant, James and Schneiderman, Rob and Teichner, Peter}, TITLE = {Universal quadratic forms and {W}hitney tower intersection invariants}, BOOKTITLE = {Proceedings of the {F}reedman {F}est}, SERIES = {Geom. Topol. Monogr.}, VOLUME = {18}, PAGES = {35--60}, PUBLISHER = {Geom. Topol. Publ., Coventry}, YEAR = {2012}, MRCLASS = {57N13 (11E16)}, MRNUMBER = {3084231}, MRREVIEWER = {Mark A. C. Powell}, DOI = {10.2140/gtm.2012.18.35}, URL = {http://dx.doi.org/10.2140/gtm.2012.18.35}, } @article {Conant-Schneiderman-Teichner(2012Whitney), AUTHOR = {Conant, James and Schneiderman, Rob and Teichner, Peter}, TITLE = {Whitney tower concordance of classical links}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {16}, YEAR = {2012}, NUMBER = {3}, PAGES = {1419--1479}, ISSN = {1465-3060}, MRCLASS = {57M27 (57N10)}, MRNUMBER = {2967057}, MRREVIEWER = {Stefan K. Friedl}, DOI = {10.2140/gt.2012.16.1419}, URL = {http://dx.doi.org/10.2140/gt.2012.16.1419}, } @article {Conant-Schneiderman-Teichner(2012Tree), AUTHOR = {Conant, James and Schneiderman, Rob and Teichner, Peter}, TITLE = {Tree homology and a conjecture of {L}evine}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {16}, YEAR = {2012}, NUMBER = {1}, PAGES = {555--600}, ISSN = {1465-3060}, MRCLASS = {57M27 (57M25 57N10)}, MRNUMBER = {2916294}, MRREVIEWER = {Marko Kranjc}, DOI = {10.2140/gt.2012.16.555}, URL = {http://dx.doi.org/10.2140/gt.2012.16.555}, } @article {Conant-Schneiderman-Teichner(2011), AUTHOR = {Conant, Jim and Schneiderman, Rob and Teichner, Peter}, TITLE = {Higher-order intersections in low-dimensional topology}, JOURNAL = {Proc. Natl. Acad. Sci. USA}, FJOURNAL = {Proceedings of the National Academy of Sciences of the United States of America}, VOLUME = {108}, YEAR = {2011}, NUMBER = {20}, PAGES = {8131--8138}, ISSN = {1091-6490}, MRCLASS = {57N13 (57M25 57N70 57R80)}, MRNUMBER = {2806650}, MRREVIEWER = {Marko Kranjc}, DOI = {10.1073/pnas.1018581108}, URL = {http://dx.doi.org/10.1073/pnas.1018581108}, } @Unpublished{Conant-Schneiderman-Teichner(2010), author = {Conant, James and Schneiderman, Rob and Teichner, Peter}, title = {Higher Order Intersections in Low-Dimensional Topology}, note = {Preprint, arXiv:1011.6026v1 [math.GT], to appear in the {P}roceedings of the {N}ational {A}cademy}, year = {2010}, } @article {Conlon(1972), AUTHOR = {Conlon, Lawrence}, TITLE = {A class of variationally complete representations}, JOURNAL = {J. Differential Geometry}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {7}, YEAR = {1972}, PAGES = {149--160}, ISSN = {0022-040X}, MRCLASS = {57E25}, MRNUMBER = {MR0377954 (51 \#14123)}, MRREVIEWER = {A. Morimoto}, } @article {Conner(1956), AUTHOR = {Conner, P. E.}, TITLE = {The {N}eumann's problem for differential forms on {R}iemannian manifolds}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {20}, YEAR = {1956}, PAGES = {56}, ISSN = {0065-9266}, MRCLASS = {31.0X}, MRNUMBER = {MR0078467 (17,1197e)}, MRREVIEWER = {S. S. Cairns}, } @book{Conner-Floyd(1964), AUTHOR = {Conner, P. E. and Floyd, E. E.}, TITLE = {Differentiable periodic maps}, PUBLISHER = {Academic Press Inc.}, ADDRESS = {Publishers, New York}, YEAR = {1964}, PAGES = {vii+148}, MRCLASS = {57.10 (55.36)}, MRNUMBER = {31 \#750}, MRREVIEWER = {E. Dyer}, } @Book{Conner-Floyd(1966), Author = {Conner, P. E. and Floyd, E. E.}, Title = {The relation of cobordism to {K}-theories}, FSeries = {Lecture Notes in Mathematics}, Series = {Lect. Notes Math.}, ISSN = {0075-8434}, Volume = {28}, Year = {1966}, Publisher = {Springer, Cham}, Language = {English}, DOI = {10.1007/BFb0071091}, zbMATH = {3258845}, Zbl = {0161.42802} } @incollection {Conner-Raymond(1978realizing), AUTHOR = {Conner, P. E. and Raymond, Frank}, TITLE = {Realizing automorphisms of {$\pi _{1}$} by homeomorphisms}, BOOKTITLE = {Algebraic and geometric topology ({P}roc. {S}ympos. {P}ure {M}ath., {S}tanford {U}niv., {S}tanford, {C}alif., 1976), {P}art 1}, SERIES = {Proc. Sympos. Pure Math., XXXII}, PAGES = {393--400}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1978}, MRCLASS = {57N65}, MRNUMBER = {520513 (80e:57015)}, MRREVIEWER = {Ya. A. Izrailevich}, } @article {Conner-Raymond(1978deforming), AUTHOR = {Conner, P. E. and Raymond, Frank}, TITLE = {Deforming homotopy equivalences to homeomorphisms in aspherical manifolds}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {83}, YEAR = {1977}, NUMBER = {1}, PAGES = {36--85}, ISSN = {0002-9904}, MRCLASS = {57E30}, MRNUMBER = {0467777 (57 \#7629)}, MRREVIEWER = {F. Laudenbach}, } @incollection {Conner-Raymond(1975), AUTHOR = {Conner, P. E. and Raymond, Frank}, TITLE = {Realizing finite groups of homeomorphisms from homotopy classes of self-homotopy-equivalences}, BOOKTITLE = {Manifolds---{T}okyo 1973 ({P}roc. {I}nternat. {C}onf., {T}okyo, 1973)}, PAGES = {231--237}, PUBLISHER = {Univ. Tokyo Press}, ADDRESS = {Tokyo}, YEAR = {1975}, MRCLASS = {57E05 (55D10)}, MRNUMBER = {0368045 (51 \#4287)}, MRREVIEWER = {E. C. Turner}, } @incollection {Conner-Raymond(1971fibring), AUTHOR = {Conner, Pierre and Raymond, Frank}, TITLE = {A fibering theorem for injective toral actions}, BOOKTITLE = {Algebraic topology ({P}roc. {S}ympos. {P}ure {M}ath., {V}ol. {XXII}, {U}niv. {W}isconsin, {M}adison, {W}is., 1970)}, PAGES = {81--86}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1971}, MRCLASS = {57E15}, MRNUMBER = {0326766 (48 \#5109)}, MRREVIEWER = {J. A. Schafer}, } @article {Conner-Raymond(1971operations), AUTHOR = {Conner, P. E. and Raymond, Frank}, TITLE = {Injective operations of the toral groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {10}, YEAR = {1971}, PAGES = {283--296}, ISSN = {0040-9383}, MRCLASS = {57.10}, MRNUMBER = {0281218 (43 \#6937)}, MRREVIEWER = {Deane Montgomery}, } @incollection {Conner-Raymond(1970), AUTHOR = {Conner, P. E. and Raymond, Frank}, TITLE = {Actions of compact {L}ie groups on aspherical manifolds}, BOOKTITLE = {Topology of {M}anifolds ({P}roc. {I}nst., {U}niv. of {G}eorgia, {A}thens, {G}a., 1969)}, PAGES = {227--264}, PUBLISHER = {Markham, Chicago, Ill.}, YEAR = {1970}, MRCLASS = {57.05 (54.00)}, MRNUMBER = {0271958 (42 \#6839)}, MRREVIEWER = {Deane Montgomery}, } @inproceedings {Conner-Raymond-Weinberger(1972), AUTHOR = {Conner, P. E. and Raymond, Frank and Weinberger, Peter J.}, TITLE = {Manifolds with no periodic maps}, BOOKTITLE = {Proceedings of the {S}econd {C}onference on {C}ompact {T}ransformation {G}roups ({U}niv. {M}assachusetts, {A}mherst, {M}ass., 1971), {P}art {II}}, PAGES = {81--108. Lecture Notes in Math., Vol. 299}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1972}, MRCLASS = {57E10}, MRNUMBER = {0358836 (50 \#11295)}, MRREVIEWER = {R. Schultz}, } @article{Connes(1976a), AUTHOR = {Connes, A.}, TITLE = {Classification of injective factors. {C}ases ${I}{I}\sb{1},$ ${I}{I}\sb{\infty },$ ${I}{I}{I}\sb{\lambda },$ $\lambda \not=1$}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {104}, YEAR = {1976}, NUMBER = {1}, PAGES = {73--115}, MRCLASS = {46L10}, MRNUMBER = {56 \#12908}, MRREVIEWER = {Francois Combes}, } @inproceedings {Conner+Raymond+Weinberger(1972), AUTHOR = {Conner, P. E. and Raymond, Frank and Weinberger, Peter J.}, TITLE = {Manifolds with no periodic maps}, BOOKTITLE = {Proceedings of the {S}econd {C}onference on {C}ompact {T}ransformation {G}roups ({U}niv. {M}assachusetts, {A}mherst, {M}ass., 1971), {P}art {II}}, PAGES = {81--108. Lecture Notes in Math., Vol. 299}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1972}, MRCLASS = {57E10}, MRNUMBER = {MR0358836 (50 \#11295)}, MRREVIEWER = {R. Schultz}, } @article{Connes(1985a), AUTHOR = {Connes, Alain}, TITLE = {Noncommutative differential geometry}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {62}, YEAR = {1985}, PAGES = {257--360}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {58G12 (16A61 18F25 19D55 19K56 46L80 53C99)}, MRNUMBER = {87i:58162}, MRREVIEWER = {Jonathan M. Rosenberg}, } @book{Connes(1994), AUTHOR = {Connes, Alain}, TITLE = {Noncommutative geometry}, PUBLISHER = {Academic Press Inc.}, ADDRESS = {San Diego, CA}, YEAR = {1994}, PAGES = {xiv+661}, ISBN = {0-12-185860-X}, MRCLASS = {46Lxx (19K56 22D25 58B30 58G12 81T13 81V22 81V70)}, MRNUMBER = {95j:46063}, MRREVIEWER = {John Roe}, } @article{Connes-Cuntz(1988), AUTHOR = {Connes, A. and Cuntz, J.}, TITLE = {Quasi homomorphismes, cohomologie cyclique et positivit\'e}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {114}, YEAR = {1988}, NUMBER = {3}, PAGES = {515--526}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {46L80 (19K99 58B15 58G12)}, MRNUMBER = {89h:46098}, MRREVIEWER = {Jonathan M. Rosenberg}, } @book {Connes-Cuntz_Guentner-Higson-Kaminker-Roberts(2004), AUTHOR = {Connes, A. and Cuntz, J. and Guentner, E. and Higson, N. and Kaminker, J. and Roberts, J. E.}, TITLE = {Noncommutative geometry}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {1831}, NOTE = {Lectures given at the C.I.M.E. Summer School held in Martina Franca, September 3--9, 2000, Edited by S. Doplicher and R. Longo, Fondazione C.I.M.E.. [C.I.M.E. Foundation]}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2004}, PAGES = {xiv+343}, ISBN = {3-540-20357-5}, MRCLASS = {00B25 (58-06 58B34)}, MRNUMBER = {2067646 (2005b:00021)}, } @article{Connes-Gromov-Moscovici(1993), AUTHOR = {Connes, A. and Gromov, M. and Moscovici, H.}, TITLE = {Group cohomology with {L}ipschitz control and higher signatures}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {3}, YEAR = {1993}, NUMBER = {1}, PAGES = {1--78}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {19K56 (19E99 46L87 57R99 58G12)}, MRNUMBER = {93m:19011}, MRREVIEWER = {Chi Wai Leung}, } @article {Connes-Kreimer(1998a), AUTHOR = {Connes, Alain and Kreimer, Dirk}, TITLE = {Hopf algebras, renormalization and noncommutative geometry}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {199}, YEAR = {1998}, NUMBER = {1}, PAGES = {203--242}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {81T15 (16W30 46L87 81T18)}, MRNUMBER = {99h:81137}, MRREVIEWER = {Raimar Wulkenhaar}, } @article {Connes-Kreimer(1999a), AUTHOR = {Connes, Alain and Kreimer, Dirk}, TITLE = {Renormalization in quantum field theory and the {R}iemann-{H}ilbert problem}, JOURNAL = {J. High Energy Phys.}, FJOURNAL = {The Journal of High Energy Physics}, YEAR = {1999}, VOLUME = {9}, PAGES = {Paper 24, 8 pp. (electronic)}, ISSN = {1029-8479}, MRCLASS = {81T15 (16W30 81T75)}, MRNUMBER = {2001j:81133}, } @article{Connes-Moscovici(1979), AUTHOR = {Connes, Alain and Moscovici, Henri}, TITLE = {The ${L}\sp{2}$-index theorem for homogeneous spaces}, JOURNAL = {Bull. Amer. Math. Soc. (N.S.)}, FJOURNAL = {American Mathematical Society. Bulletin. New Series}, VOLUME = {1}, YEAR = {1979}, NUMBER = {4}, PAGES = {688--690}, ISSN = {0002-9904}, CODEN = {BAMOAD}, MRCLASS = {58G10 (22E45)}, MRNUMBER = {80g:58046}, MRREVIEWER = {A. Verona}, } @article {Connes+Weiss(1980), AUTHOR = {Connes, A. and Weiss, B.}, TITLE = {Property {${\rm T}$} and asymptotically invariant sequences}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {37}, YEAR = {1980}, NUMBER = {3}, PAGES = {209--210}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {28D15 (22D40)}, MRNUMBER = {MR599455 (82e:28023b)}, MRREVIEWER = {V. Losert}, } @article{Connes-Moscovici(1982), AUTHOR = {Connes, Alain and Moscovici, Henri}, TITLE = {The ${L}\sp{2}$-index theorem for homogeneous spaces of {L}ie groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {115}, YEAR = {1982}, NUMBER = {2}, PAGES = {291--330}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {58G12 (22E27 22E45 22E46 43A25 46L99 55R50)}, MRNUMBER = {84f:58108}, MRREVIEWER = {Jonathan M. Rosenberg}, } @incollection {Connes-Moscovici(1982a), AUTHOR = {Connes, Alain and Moscovici, Henri}, TITLE = {${L}\sp{2}$-index theory on homogeneous spaces and discrete series representations}, BOOKTITLE = {Operator algebras and applications, Part I (Kingston, Ont., 1980)}, PAGES = {419--433}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, R.I.}, YEAR = {1982}, MRCLASS = {58G10 (22E45 46M20)}, MRNUMBER = {84a:58076}, } @article{Connes-Moscovici(1990), AUTHOR = {Connes, Alain and Moscovici, Henri}, TITLE = {Cyclic cohomology, the {N}ovikov conjecture and hyperbolic groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {29}, YEAR = {1990}, NUMBER = {3}, PAGES = {345--388}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {58G12 (19D55 19K56 46L80 57R20)}, MRNUMBER = {92a:58137}, MRREVIEWER = {Jeffrey Fox}, } @article{Connes-Moscovici(1995), AUTHOR = {Connes, A. and Moscovici, H.}, TITLE = {The local index formula in noncommutative geometry}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {5}, YEAR = {1995}, NUMBER = {2}, PAGES = {174--243}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G12 (46L87 58B30)}, MRNUMBER = {96e:58149}, MRREVIEWER = {Thomas Ackermann}, } @article {Connes-Shlyakhtenko(2005), AUTHOR = {Connes, Alain and Shlyakhtenko, Dimitri}, TITLE = {{$L\sp 2$}-Homology for von {N}eumann algebras}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {586}, YEAR = {2005}, PAGES = {125--168}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {46L10}, MRNUMBER = {MR2180603}, } @article{Connes-Sullivan-Teleman(1994), AUTHOR = {Connes, Alain and Sullivan, Dennis and Teleman, Nicolas}, TITLE = {Quasiconformal mappings, operators on {H}ilbert space, and local formulae for characteristic classes}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {33}, YEAR = {1994}, NUMBER = {4}, PAGES = {663--681}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {58G12 (19D55 30C65 57N99 58B30)}, MRNUMBER = {95g:58232}, MRREVIEWER = {John Roe}, } @article {Connolly(1973), AUTHOR = {Connolly, Francis X.}, TITLE = {Linking numbers and surgery}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {12}, YEAR = {1973}, PAGES = {389--409}, ISSN = {0040-9383}, MRCLASS = {57D65}, MRNUMBER = {0334245}, MRREVIEWER = {J. L. Shaneson}, DOI = {10.1016/0040-9383(73)90031-1}, URL = {https://doi-org.ezp.lib.unimelb.edu.au/10.1016/0040-9383(73)90031-1}, } @article {Connolly-Davis(2004), AUTHOR = {Connolly, Francis X. and Davis, James F.}, TITLE = {The surgery obstruction groups of the infinite dihedral group}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {8}, YEAR = {2004}, PAGES = {1043--1078 (electronic)}, ISSN = {1465-3060}, MRCLASS = {57R67 (19G24 19J25)}, MRNUMBER = {MR2087078}, } @article {Connolly-Davis-Khan(2014H1), AUTHOR = {Connolly, Frank and Davis, James F. and Khan, Qayum}, TITLE = {Topological rigidity and {$H_1$}-negative involutions on tori}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {18}, YEAR = {2014}, NUMBER = {3}, PAGES = {1719--1768}, ISSN = {1465-3060}, MRCLASS = {57S17 (57R67)}, MRNUMBER = {3228461}, MRREVIEWER = {Ronald M. Dotzel}, DOI = {10.2140/gt.2014.18.1719}, URL = {http://dx.doi.org/10.2140/gt.2014.18.1719}, } @article {Connolly-Davis-Khan(2015), AUTHOR = {Connolly, Frank and Davis, James F. and Khan, Qayum}, TITLE = {Topological rigidity and actions on contractible manifolds with discrete singular set}, JOURNAL = {Trans. Amer. Math. Soc. Ser. B}, FJOURNAL = {Transactions of the American Mathematical Society. Series B}, VOLUME = {2}, YEAR = {2015}, PAGES = {113--133}, ISSN = {2330-0000}, MRCLASS = {57S30 (57R91)}, MRNUMBER = {3427570}, MRREVIEWER = {Stratos Prassidis}, DOI = {10.1090/btran/9}, URL = {https://doi.org/10.1090/btran/9}, } @article{Connolly-Kozniewski(1986), AUTHOR = {Connolly, Frank X. and Ko{\'z}niewski, Tadeusz}, TITLE = {Finiteness properties of classifying spaces of proper $\Gamma$-actions}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {41}, YEAR = {1986}, NUMBER = {1}, PAGES = {17--36}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {57S30 (20J05)}, MRNUMBER = {87j:57026}, MRREVIEWER = {T. tom Dieck}, } @article{Connolly-Kozniewski(1990), AUTHOR = {Connolly, Frank X. and Ko{\'z}niewski, Tadeusz}, TITLE = {Rigidity and crystallographic groups. {I}}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {99}, YEAR = {1990}, NUMBER = {1}, PAGES = {25--48}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57N70 (20H15 57S30)}, MRNUMBER = {91g:57019}, MRREVIEWER = {Christopher W. Stark}, } @incollection {Connolly-Kozniewski(1991), AUTHOR = {Connolly, Frank and Ko\'{z}niewski, Tadeusz}, TITLE = {Examples of lack of rigidity in crystallographic groups}, BOOKTITLE = {Algebraic topology {P}ozna\'{n} 1989}, SERIES = {Lecture Notes in Math.}, VOLUME = {1474}, PAGES = {139--145}, PUBLISHER = {Springer, Berlin}, YEAR = {1991}, MRCLASS = {57S05 (19B99 19D35)}, MRNUMBER = {1133897}, MRREVIEWER = {A. A. Ranicki}, DOI = {10.1007/BFb0084742}, URL = {https://doi.org/10.1007/BFb0084742}, } @article {Connolly-Kozniewski(1995), AUTHOR = {Connolly, Frank X. and Ko{\'z}niewski, Tadeusz}, TITLE = {{${\rm Nil}$} groups in {$K$}-theory and surgery theory}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {7}, YEAR = {1995}, NUMBER = {1}, PAGES = {45--76}, ISSN = {0933-7741}, CODEN = {FOMAEF}, MRCLASS = {19D35 (19J25 57R67)}, MRNUMBER = {95j:19003}, MRREVIEWER = {Oliver Attie}, } @article{Connolly-Lueck(1989), AUTHOR = {Connolly, Frank X. and L{\"u}ck, Wolfgang}, TITLE = {The involution on the equivariant {W}hitehead group}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {3}, YEAR = {1989}, NUMBER = {2}, PAGES = {123--140}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {57S17 (18F25 19B99 57Q10 57R80)}, MRNUMBER = {91d:57021}, MRREVIEWER = {Karl Heinz Dovermann}, } @article {Connolly-Prassidis(2002a), AUTHOR = {Connolly, Frank X. and Prassidis, Stratos}, TITLE = {On the exponent of the ${N}{K}\sb 0$-groups of virtually infinite cyclic groups}, JOURNAL = {Canad. Math. Bull.}, FJOURNAL = {Canadian Mathematical Bulletin. Bulletin Canadien de Math\'ematiques}, VOLUME = {45}, YEAR = {2002}, NUMBER = {2}, PAGES = {180--195}, ISSN = {0008-4395}, CODEN = {CMBUA3}, MRCLASS = {19A31}, MRNUMBER = {1 904 082}, } @article {Connolly-Prassidis(2002b), AUTHOR = {Connolly, Frank X. and Prassidis, Stratos}, TITLE = {On the exponent of the cokernel of the forget-control map on ${K}\sb 0$-groups}, JOURNAL = {Fund. Math.}, FJOURNAL = {Fundamenta Mathematicae}, VOLUME = {172}, YEAR = {2002}, NUMBER = {3}, PAGES = {201--216}, ISSN = {0016-2736}, MRCLASS = {19A31 (57Nxx)}, MRNUMBER = {1 898 685}, } @article {Connolly-Ranicki(2005), AUTHOR = {Connolly, Frank and Ranicki, Andrew}, TITLE = {On the calculation of {UN}il}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {195}, YEAR = {2005}, NUMBER = {1}, PAGES = {205--258}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {57R67 (19J25 57N15)}, MRNUMBER = {MR2145796 (2006f:57036)}, MRREVIEWER = {Ross Staffeldt}, } @article {Connolly-da-Silva(1995), AUTHOR = {Connolly, Frank X. and da Silva, M{\'a}rio O. M.}, TITLE = {The groups {$N\sp rK\sb 0(\bold Z\pi)$} are finitely generated {$\bold Z[\bold N\sp r]$}-modules if {$\pi$} is a finite group}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {9}, YEAR = {1995}, NUMBER = {1}, PAGES = {1--11}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19A31}, MRNUMBER = {96m:19004}, MRREVIEWER = {Les Reid}, } @article{Connolly-daSilva(1990), AUTHOR = {Connolly, Frank X. and da Silva, M{\'a}rio O. M.}, TITLE = {The groups ${N}\sp r{K}\sb 0(\bold {Z}\pi)$ are finitely generated $\bold {Z}[\bold {N}\sp r]$-modules if $\pi$ is a finite group}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {9}, YEAR = {1995}, NUMBER = {1}, PAGES = {1--11}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19A31}, MRNUMBER = {96m:19004}, MRREVIEWER = {Les Reid}, } @inproceedings {Conner-Raymond(1972), AUTHOR = {Conner, P. E. and Raymond, Frank}, TITLE = {Manifolds with few periodic homeomorphisms}, BOOKTITLE = {Proceedings of the {S}econd {C}onference on {C}ompact {T}ransformation {G}roups ({U}niv. {M}assachusetts, {A}mherst, {M}ass., 1971), {P}art {II}}, PAGES = {1--75. Lecture Notes in Math., Vol. 299}, YEAR = {1972}, MRCLASS = {57E10}, MRNUMBER = {0358835}, MRREVIEWER = {R. Schultz}, } @article{Consani(1993), AUTHOR = {Consani, Caterina}, TITLE = {${\mathcal K}$-theory of blow-ups and vector bundles on the cone over a surface}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {7}, YEAR = {1993}, NUMBER = {3}, PAGES = {269--284}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19E08}, MRNUMBER = {94i:19005}, MRREVIEWER = {Steven E. Landsburg}, } @incollection {Conway(1970), AUTHOR = {Conway, J. H.}, TITLE = {An enumeration of knots and links, and some of their algebraic properties}, BOOKTITLE = {Computational Problems in Abstract Algebra (Proc. Conf., Oxford, 1967) }, PAGES = {329--358}, PUBLISHER = {Pergamon}, ADDRESS = {Oxford}, YEAR = {1970}, MRCLASS = {55.20}, MRNUMBER = {41 \#2661}, MRREVIEWER = {H. E. Debrunner}, } @book{Conway(1990), AUTHOR = {Conway, John B.}, TITLE = {A course in functional analysis}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1990}, PAGES = {xvi+399}, ISBN = {0-387-97245-5}, MRCLASS = {46-01 (47-01)}, MRNUMBER = {91e:46001}, } @book{Conway(1995), AUTHOR = {Conway, John B.}, TITLE = {Functions of one complex variable. {I}{I}}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1995}, PAGES = {xvi+394}, ISBN = {0-387-94460-5}, MRCLASS = {30-01}, MRNUMBER = {96i:30001}, MRREVIEWER = {P. Lappan}, } @book{Conway-Sloane(1993), AUTHOR = {Conway, J. H. and Sloane, N. J. A.}, TITLE = {Sphere packings, lattices and groups}, EDITION = {Second}, NOTE = {With additional contributions by E. Bannai, R. E. Borcherds, J. Leech, S. P. Norton, A. M. Odlyzko, R. A. Parker, L. Queen and B. B. Venkov}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1993}, PAGES = {xliv+679}, ISBN = {0-387-97912-3}, MRCLASS = {11H31 (05B40 11H06 20D08 52C07 52C17 94B75)}, MRNUMBER = {93h:11069}, } @Article{Conway-Crowley-Powell-Sixt(2023), Author = {Conway, Anthony and Crowley, Diarmuid and Powell, Mark and Sixt, Joerg}, Title = {Simply connected manifolds with large homotopy stable classes}, FJournal = {Journal of the Australian Mathematical Society}, Journal = {J. Aust. Math. Soc.}, ISSN = {1446-7887}, Volume = {115}, Number = {2}, Pages = {172--203}, Year = {2023}, Language = {English}, DOI = {10.1017/S1446788722000167}, Keywords = {57R65,57R67}, zbMATH = {7738136} } @article {Cooper(1995), AUTHOR = {Cooper, Daryl}, TITLE = {Quasi-isometries of hyperbolic space are almost isometries}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {123}, YEAR = {1995}, NUMBER = {7}, PAGES = {2221--2227}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {53C23 (30C65 30F40 57M99)}, MRNUMBER = {MR1307505 (95m:53061)}, MRREVIEWER = {William Dunbar}, } @article{Cooper-Culler-Gillet-Long-Shalen(1994), AUTHOR = {Cooper, D. and Culler, M. and Gillet, H. and Long, D. D. and Shalen, P. B.}, TITLE = {Plane curves associated to character varieties of $3$-manifolds}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {118}, YEAR = {1994}, NUMBER = {1}, PAGES = {47--84}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57N10 (57M25)}, MRNUMBER = {95g:57029}, MRREVIEWER = {Serge L. Tabachnikov}, } @article {Cooper-Lackenby-Purcell(2010), AUTHOR = {Cooper, Daryl and Lackenby, Marc and Purcell, Jessica S.}, TITLE = {The length of unknotting tunnels}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {10}, YEAR = {2010}, NUMBER = {2}, PAGES = {637--661}, ISSN = {1472-2747}, MRCLASS = {57M25 (57M50)}, MRNUMBER = {2606795 (2011c:57014)}, MRREVIEWER = {Luisa Paoluzzi}, DOI = {10.2140/agt.2010.10.637}, URL = {http://dx.doi.org/10.2140/agt.2010.10.637}, } @book{Coornaert-Delzant-Papadopoulos(1990), AUTHOR = {Coornaert, M. and Delzant, T. and Papadopoulos, A.}, TITLE = {G\'eom\'etrie et th\'eorie des groupes}, NOTE = {Les groupes hyperboliques de Gromov. [Gromov hyperbolic groups], With an English summary}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1990}, PAGES = {x+165}, ISBN = {3-540-52977-2}, MRCLASS = {57M07 (20F32)}, MRNUMBER = {92f:57003}, MRREVIEWER = {John Meier}, } @book{Coornaert-Papadopoulos(1993), AUTHOR = {Coornaert, Michel and Papadopoulos, Athanase}, TITLE = {Symbolic dynamics and hyperbolic groups}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1993}, PAGES = {viii+138}, ISBN = {3-540-56499-3}, MRCLASS = {58F03 (20F32 53C23 57M50)}, MRNUMBER = {94d:58054}, MRREVIEWER = {Michael L. Mihalik}, } @article {Coram-Duvall(1977), AUTHOR = {Coram, D. S. and Duvall, Jr., P. F.}, TITLE = {Approximate fibrations}, JOURNAL = {Rocky Mountain J. Math.}, FJOURNAL = {The Rocky Mountain Journal of Mathematics}, VOLUME = {7}, YEAR = {1977}, NUMBER = {2}, PAGES = {275--288}, ISSN = {0035-7596}, MRCLASS = {55D05}, MRNUMBER = {0442921 (56 \#1296)}, MRREVIEWER = {C. W. Patty}, } @article {Cordier-Porter(1997), AUTHOR = {Cordier, Jean-Marc and Porter, Timothy}, TITLE = {Homotopy coherent category theory}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {349}, YEAR = {1997}, NUMBER = {1}, PAGES = {1--54}, ISSN = {0002-9947}, MRCLASS = {55U35 (18A30 18A40 55P55 55U10)}, MRNUMBER = {1376543}, MRREVIEWER = {Kathryn P. Hess}, DOI = {10.1090/S0002-9947-97-01752-2}, URL = {https://doi.org/10.1090/S0002-9947-97-01752-2}, } @article {Cordier-Porter(1986), AUTHOR = {Cordier, Jean-Marc and Porter, Timothy}, TITLE = {Vogt's theorem on categories of homotopy coherent diagrams}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {100}, YEAR = {1986}, NUMBER = {1}, PAGES = {65--90}, ISSN = {0305-0041}, MRCLASS = {55P99 (18D20)}, MRNUMBER = {838654}, MRREVIEWER = {R. M. Vogt}, DOI = {10.1017/S0305004100065877}, URL = {https://doi.org/10.1017/S0305004100065877}, } @book {Cornea-Lupton-Oprea-Tanre(2003), AUTHOR = {Cornea, Octav and Lupton, Gregory and Oprea, John and Tanr{\'e}, Daniel}, TITLE = {Lusternik-{S}chnirelmann category}, SERIES = {Mathematical Surveys and Monographs}, VOLUME = {103}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {2003}, PAGES = {xviii+330}, ISBN = {0-8218-3403-5}, MRCLASS = {55M30 (53D35 55P62 55Q25 57R17)}, MRNUMBER = {1990857 (2004e:55001)}, MRREVIEWER = {Samuel B. Smith}, } @incollection {Cortinaz(2011), AUTHOR = {Corti{\~n}as, Guillermo}, TITLE = {Algebraic v. topological {$K$}-theory: a friendly match}, BOOKTITLE = {Topics in algebraic and topological {$K$}-theory}, SERIES = {Lecture Notes in Math.}, VOLUME = {2008}, PAGES = {103--165}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2011}, MRCLASS = {19-02 (46L80)}, MRNUMBER = {2762555 (2012c:19001)}, MRREVIEWER = {Ralf Meyer}, DOI = {10.1007/978-3-642-15708-0_3}, URL = {http://dx.doi.org/10.1007/978-3-642-15708-0_3}, } @incollection {Cortinas(2008), AUTHOR = {Corti{\~n}as, Guillermo}, TITLE = {Algebraic v. topological {$K$}-theory: a friendly match}, BOOKTITLE = {Topics in algebraic and topological {$K$}-theory}, SERIES = {Lecture Notes in Math.}, VOLUME = {2008}, PAGES = {103--165}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2011}, MRCLASS = {19-02 (46L80)}, MRNUMBER = {2762555 (2012c:19001)}, MRREVIEWER = {Ralf Meyer}, DOI = {10.1007/978-3-642-15708-0_3}, URL = {http://dx.doi.org/10.1007/978-3-642-15708-0_3}, } @article {Cortinas-Ellis(2014), AUTHOR = {Corti{\~n}as, Guillermo and Ellis, Eugenia}, TITLE = {Isomorphism conjectures with proper coefficients}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {218}, YEAR = {2014}, NUMBER = {7}, PAGES = {1224--1263}, ISSN = {0022-4049}, MRCLASS = {19-XX}, MRNUMBER = {3168494}, DOI = {10.1016/j.jpaa.2013.11.016}, URL = {http://dx.doi.org/10.1016/j.jpaa.2013.11.016}, } @inproceedings {Cortinas-Guccione-Villamayor(1989), AUTHOR = {Corti{\~n}as, Guillermo and Guccione, Jorge and Villamayor, Orlando E.}, TITLE = {Cyclic homology of {$K[{\bf Z}/p\cdot{\bf Z}]$}}, BOOKTITLE = {Proceedings of Research Symposium on $K$-Theory and its Applications (Ibadan, 1987)}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {2}, YEAR = {1989}, PAGES = {603--616}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {18G30 (19D55)}, MRNUMBER = {90i:18006}, MRREVIEWER = {Sue Geller}, } @article {Cortinas-Haesemeyer-Schlichting-Weibel(2008), AUTHOR = {Corti{\~n}as, G. and Haesemeyer, C. and Schlichting, M. and Weibel, C.}, TITLE = {Cyclic homology, cdh-cohomology and negative {$K$}-theory}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {167}, YEAR = {2008}, NUMBER = {2}, PAGES = {549--573}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {19Dxx (16E40)}, MRNUMBER = {MR2415380}, } @article {Cortinas-Haesemeyer-Walker-Weibel(20013), AUTHOR = {Corti{\~n}as, G. and Haesemeyer, C. and Walker, M. E. and Weibel, C.}, TITLE = {{$K$}-theory of cones of smooth varieties}, JOURNAL = {J. Algebraic Geom.}, FJOURNAL = {Journal of Algebraic Geometry}, VOLUME = {22}, YEAR = {2013}, NUMBER = {1}, PAGES = {13--34}, ISSN = {1056-3911}, MRCLASS = {19D50 (14C35 19E20)}, MRNUMBER = {2993045}, MRREVIEWER = {Bin Zhang}, DOI = {10.1090/S1056-3911-2011-00583-3}, URL = {http://dx.doi.org/10.1090/S1056-3911-2011-00583-3}, } @article {Cortinas-Tartaglia(2014), AUTHOR = {Corti{\~n}as, Guillermo and Tartaglia, Gisela}, TITLE = {Operator ideals and assembly maps in {$K$}-theory}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {142}, YEAR = {2014}, NUMBER = {4}, PAGES = {1089--1099}, ISSN = {0002-9939}, MRCLASS = {Preliminary Data}, MRNUMBER = {3162232}, DOI = {10.1090/S0002-9939-2013-11837-X}, URL = {http://dx.doi.org/10.1090/S0002-9939-2013-11837-X}, } @article {Cortinas-Tartaglia(2018Hilbert), AUTHOR = {Corti\~{n}as, Guillermo and Tartaglia, Gisela}, TITLE = {Compact operators and algebraic {$K$}-theory for groups which act properly and isometrically on {H}ilbert space}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"{u}r die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {734}, YEAR = {2018}, PAGES = {265--292}, ISSN = {0075-4102}, MRCLASS = {46L40 (19K33)}, MRNUMBER = {3739319}, MRREVIEWER = {Vicumpriya S. Perera}, DOI = {10.1515/crelle-2014-0154}, URL = {https://doi.org/10.1515/crelle-2014-0154}, } @article {Cortinaz-Thom(2012), AUTHOR = {Corti{\~n}as, Guillermo and Thom, Andreas}, TITLE = {Algebraic geometry of topological spaces {I}}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {209}, YEAR = {2012}, NUMBER = {1}, PAGES = {83--131}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {19D35 (14P10 18A40 55R05)}, MRNUMBER = {2979510}, MRREVIEWER = {Ross Staffeldt}, DOI = {10.1007/s11511-012-0082-6}, URL = {http://dx.doi.org/10.1007/s11511-012-0082-6}, } @article {Cortinaz+Thom(2008), AUTHOR = {Corti{\~n}as, Guillermo and Thom, Andreas}, TITLE = {Comparison between algebraic and topological {$K$}-theory of locally convex algebras}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {218}, YEAR = {2008}, NUMBER = {1}, PAGES = {266--307}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {46L80 (19K56 47L20)}, MRNUMBER = {MR2409415}, } @article {Cortinaz+Thom(2007), AUTHOR = {Corti{\~n}as, Guillermo and Thom, Andreas}, TITLE = {Bivariant algebraic {$K$}-theory}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {610}, YEAR = {2007}, PAGES = {71--123}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {19K35 (19D99 46L80)}, MRNUMBER = {MR2359851 (2008i:19003)}, MRREVIEWER = {Christian Voigt}, } @article {Costenoble-Waner(1992a), AUTHOR = {Costenoble, S. R. and Waner, S.}, TITLE = {Equivariant {P}oincar\'e duality}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {The Michigan Mathematical Journal}, VOLUME = {39}, YEAR = {1992}, NUMBER = {2}, PAGES = {325--351}, ISSN = {0026-2285}, MRCLASS = {55N25 (55M05 55N91 57P10 57R91)}, MRNUMBER = {93d:55007}, MRREVIEWER = {Jan-Alve Svensson}, } @article{Costenoble-Waner(1992b), AUTHOR = {Costenoble, S. R. and Waner, S.}, TITLE = {The equivariant {S}pivak normal bundle and equivariant surgery}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {The Michigan Mathematical Journal}, VOLUME = {39}, YEAR = {1992}, NUMBER = {3}, PAGES = {415--424}, ISSN = {0026-2285}, MRCLASS = {57R65 (55N25)}, MRNUMBER = {94d:57058}, MRREVIEWER = {Ian Hambleton}, } @article {Costenoble-Waner(1992c), AUTHOR = {Costenoble, S. R. and Waner, S.}, TITLE = {{$G$}-transversality revisited}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {116}, YEAR = {1992}, NUMBER = {2}, PAGES = {535--546}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57R91 (55N91 55S91 57R85)}, MRNUMBER = {92m:57044}, MRREVIEWER = {Jos{\'e} Carlos de Souza Kiihl}, } @article {Costenoble-Waner(1992d), AUTHOR = {Costenoble, S. R. and Waner, S.}, TITLE = {The equivariant {T}hom isomorphism theorem}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {152}, YEAR = {1992}, NUMBER = {1}, PAGES = {21--39}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {55N91 (55N25 55R91 57R91)}, MRNUMBER = {93c:55005}, MRREVIEWER = {L. Gaunce Lewis, Jr.}, } @article{Costenoble-Waner(1993), AUTHOR = {Costenoble, S. R. and Waner, S.}, TITLE = {Equivariant simple {P}oincar\'e duality}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {The Michigan Mathematical Journal}, VOLUME = {40}, YEAR = {1993}, NUMBER = {3}, PAGES = {577--604}, ISSN = {0026-2285}, MRCLASS = {55N91 (55P91 57Q10 57R91)}, MRNUMBER = {94m:55006}, MRREVIEWER = {Karl Heinz Dovermann}, } @article{Coulhon-Grigoryan(1997), AUTHOR = {Coulhon, Thierry and Grigor'yan, Alexander}, TITLE = {On-diagonal lower bounds for heat kernels and {M}arkov chains}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {89}, YEAR = {1997}, NUMBER = {1}, PAGES = {133--199}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {58G11 (35K05 47D07 60J15)}, MRNUMBER = {MR1458975 (98e:58159)}, MRREVIEWER = {Gilles Carron}, } @article{Coulhon-Grigoryan-Pittet(2001), AUTHOR = {Coulhon, T. and Grigor'yan, A. and Pittet, C.}, TITLE = {A geometric approach to on-diagonal heat kernel lower bounds on groups}, JOURNAL = {Ann. Inst. Fourier (Grenoble)}, FJOURNAL = {Universit\'e de Grenoble. Annales de l'Institut Fourier}, VOLUME = {51}, YEAR = {2001}, NUMBER = {6}, PAGES = {1763--1827}, ISSN = {0373-0956}, CODEN = {AIFUA7}, MRCLASS = {20F69 (05C35 22E30 58J35 60B15)}, MRNUMBER = {MR1871289 (2002m:20067)}, MRREVIEWER = {Vadim A. Ka{\u\i}manovich}, } @Book{Coulhon-Saloff-Coste-Varopoulos(1992), AUTHOR = {Varopoulos, N. Th. and Saloff-Coste, L. and Coulhon, T.}, TITLE = {Analysis and geometry on groups}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1992}, PAGES = {xii+156}, ISBN = {0-521-35382-3}, MRCLASS = {43A80 (47D03 47F05 58G11 60B15)}, MRNUMBER = {95f:43008}, MRREVIEWER = {A. Hulanicki}, } @book{Courant-Hilbert(1968a), AUTHOR = {Courant, R. and Hilbert, D.}, TITLE = {Methoden der mathematischen {P}hysik. {I}}, NOTE = {Dritte Auflage, Heidelberger Taschenb\"ucher, Band 30}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1968}, PAGES = {xv+469}, MRCLASS = {00A05 (69.00)}, MRNUMBER = {49 \#8778}, } @book {Courant-Hilbert(1989), AUTHOR = {Courant, R. and Hilbert, D.}, TITLE = {Methods of mathematical physics. {V}ol. {II}}, SERIES = {Wiley Classics Library}, NOTE = {Partial differential equations, Reprint of the 1962 original, A Wiley-Interscience Publication}, PUBLISHER = {John Wiley \& Sons Inc.}, ADDRESS = {New York}, YEAR = {1989}, PAGES = {xxii+830}, ISBN = {0-471-50439-4}, MRCLASS = {35-00 (00A05 01A75)}, MRNUMBER = {MR1013360 (90k:35001)}, } @article {Coward-Lackenby(2011), AUTHOR = {Coward, Alexander and Lackenby, Marc}, TITLE = {Unknotting genus one knots}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {86}, YEAR = {2011}, NUMBER = {2}, PAGES = {383--399}, ISSN = {0010-2571}, MRCLASS = {57M25 (57N10)}, MRNUMBER = {2775133 (2012b:57008)}, MRREVIEWER = {Ichiro Torisu}, DOI = {10.4171/CMH/227}, URL = {http://dx.doi.org/10.4171/CMH/227}, } @article {Cowling+Haagerup(1989), AUTHOR = {Cowling, Michael and Haagerup, Uffe}, TITLE = {Completely bounded multipliers of the {F}ourier algebra of a simple {L}ie group of real rank one}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {96}, YEAR = {1989}, NUMBER = {3}, PAGES = {507--549}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {22E27 (22E40 43A22 43A80 46J99)}, MRNUMBER = {MR996553 (90h:22008)}, MRREVIEWER = {Christopher Meaney}, } @book {Crabb-James(1998), AUTHOR = {Crabb, Michael and James, Ioan}, TITLE = {Fibrewise homotopy theory}, SERIES = {Springer Monographs in Mathematics}, PUBLISHER = {Springer-Verlag London Ltd.}, ADDRESS = {London}, YEAR = {1998}, PAGES = {viii+341}, ISBN = {1-85233-014-7}, MRCLASS = {55-02 (55M20 55P42 55R99 55T10 55T20)}, MRNUMBER = {MR1646248 (99k:55001)}, MRREVIEWER = {J. P. C. Greenlees}, } @article {Crainic(1999a), AUTHOR = {Crainic, Marius}, TITLE = {Cyclic cohomology of \'etale groupoids: the general case}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {17}, YEAR = {1999}, NUMBER = {4}, PAGES = {319--362}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19D55 (55R20 55T05 55T10 57R32)}, MRNUMBER = {2000j:19002}, MRREVIEWER = {Guillermo Corti\~{n}as}, } @book{Crowell-Fox(1977), AUTHOR = {Crowell, Richard H. and Fox, Ralph H.}, TITLE = {Introduction to knot theory}, NOTE = {Reprint of the 1963 original, Graduate Texts in Mathematics, No. 57}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1977}, PAGES = {x+182}, MRCLASS = {55A25}, MRNUMBER = {56 \#3829}, } @article {Crowley(2011), AUTHOR = {Crowley, Diarmuid J.}, TITLE = {On the mapping class groups of {$\#_r(S^p\times S^p)$} for {$p=3,7$}}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {269}, YEAR = {2011}, NUMBER = {3-4}, PAGES = {1189--1199}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {57R52 (55P10 57R19)}, MRNUMBER = {2860283}, MRREVIEWER = {A. A. Ranicki}, DOI = {10.1007/s00209-010-0777-3}, URL = {http://dx.doi.org/10.1007/s00209-010-0777-3}, } @article {Crowley(2010), AUTHOR = {Crowley, Diarmuid}, TITLE = {The smooth structure set of {$S^p\times S^q$}}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {148}, YEAR = {2010}, PAGES = {15--33}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {57R55 (57R65)}, MRNUMBER = {2721618}, DOI = {10.1007/s10711-010-9513-8}, URL = {http://dx.doi.org/10.1007/s10711-010-9513-8}, } @article {Crowley-Escher(2003), AUTHOR = {Crowley, Diarmuid and Escher, Christine M.}, TITLE = {A classification of {$S^3$}-bundles over {$S^4$}}, JOURNAL = {Differential Geom. Appl.}, FJOURNAL = {Differential Geometry and its Applications}, VOLUME = {18}, YEAR = {2003}, NUMBER = {3}, PAGES = {363--380}, ISSN = {0926-2245}, CODEN = {DGAPEO}, MRCLASS = {55R15 (53C21 55R40 57T35)}, MRNUMBER = {1975035 (2004e:55020)}, MRREVIEWER = {Krishnan Shankar}, DOI = {10.1016/S0926-2245(03)00012-3}, URL = {http://dx.doi.org/10.1016/S0926-2245(03)00012-3}, } @article {Crowley-Goette(2013), AUTHOR = {Crowley, Diarmuid and Goette, Sebastian}, TITLE = {Kreck-{S}tolz invariants for quaternionic line bundles}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {365}, YEAR = {2013}, NUMBER = {6}, PAGES = {3193--3225}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {58J28 (57R55)}, MRNUMBER = {3034463}, MRREVIEWER = {Man-Ho Ho}, DOI = {10.1090/S0002-9947-2012-05732-1}, URL = {http://dx.doi.org/10.1090/S0002-9947-2012-05732-1}, } @article {Crowley-Loeh(2015), AUTHOR = {Crowley, Diarmuid and L{\"o}h, Clara}, TITLE = {Functorial seminorms on singular homology and (in)flexible manifolds}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {15}, YEAR = {2015}, NUMBER = {3}, PAGES = {1453--1499}, ISSN = {1472-2747}, MRCLASS = {57N65 (55N10 55N35 55P62)}, MRNUMBER = {3361142}, DOI = {10.2140/agt.2015.15.1453}, URL = {http://dx.doi.org/10.2140/agt.2015.15.1453}, } @article {Crowley-Macko(2019), AUTHOR = {Crowley, Diarmuid and Macko, Tibor}, TITLE = {On the cardinality of the manifold set}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {200}, YEAR = {2019}, PAGES = {265--285}, ISSN = {0046-5755,1572-9168}, MRCLASS = {57R65 (57R67)}, MRNUMBER = {3956195}, MRREVIEWER = {Yang\ Su}, DOI = {10.1007/s10711-018-0370-1}, URL = {https://doi.org/10.1007/s10711-018-0370-1}, } @article {Crowley-Macko(2011), AUTHOR = {Crowley, Diarmuid and Macko, Tibor}, TITLE = {The additivity of the {$\rho$}-invariant and periodicity in topological surgery}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {11}, YEAR = {2011}, NUMBER = {4}, PAGES = {1915--1959}, ISSN = {1472-2747}, MRCLASS = {57R65 (57S25)}, MRNUMBER = {2826928 (2012g:57056)}, MRREVIEWER = {A. A. Ranicki}, } @article {Crowley-Schick(2013), AUTHOR = {Crowley, Diarmuid and Schick, Thomas}, TITLE = {The {G}romoll filtration, {$KO$}-characteristic classes and metrics of positive scalar curvature}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {17}, YEAR = {2013}, NUMBER = {3}, PAGES = {1773--1789}, ISSN = {1465-3060}, MRCLASS = {57R60 (53C21 53C27 58B20)}, MRNUMBER = {3073935}, DOI = {10.2140/gt.2013.17.1773}, URL = {http://dx.doi.org/10.2140/gt.2013.17.1773}, } @article {Crowley-Sixt(2011), AUTHOR = {Crowley, Diarmuid and Sixt, J{\"o}rg}, TITLE = {Stably diffeomorphic manifolds and {$l_{2q+1}(\Bbb Z[\pi])$}}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {23}, YEAR = {2011}, NUMBER = {3}, PAGES = {483--538}, ISSN = {0933-7741}, CODEN = {FOMAEF}, MRCLASS = {57R67 (19G24 19J25 57R80)}, MRNUMBER = {2805192 (2012e:57056)}, MRREVIEWER = {A. A. Ranicki}, DOI = {10.1515/FORM.2011.016}, URL = {http://dx.doi.org/10.1515/FORM.2011.016}, } @article {Crowley-Skopenkov(2011), AUTHOR = {Crowley, Diarmuid and Skopenkov, Arkadiy}, TITLE = {A classification of smooth embeddings of four-manifolds in seven-space, {II}}, JOURNAL = {Internat. J. Math.}, FJOURNAL = {International Journal of Mathematics}, VOLUME = {22}, YEAR = {2011}, NUMBER = {6}, PAGES = {731--757}, ISSN = {0129-167X}, MRCLASS = {57R40 (57R52 57R65)}, MRNUMBER = {2812086 (2012h:57051)}, MRREVIEWER = {Stefano Vidussi}, DOI = {10.1142/S0129167X11006969}, URL = {http://dx.doi.org/10.1142/S0129167X11006969}, } @article {Crowley-Wraith(2017), AUTHOR = {Crowley, Diarmuid and Wraith, David J.}, TITLE = {Positive {R}icci curvature on highly connected manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {106}, YEAR = {2017}, NUMBER = {2}, PAGES = {187--243}, ISSN = {0022-040X}, MRCLASS = {57N16 (53C20)}, MRNUMBER = {3662991}, DOI = {10.4310/jdg/1497405625}, URL = {http://dx.doi.org/10.4310/jdg/1497405625}, } @article {Crwoley-Zvengrowski(2008), AUTHOR = {Crowley, Diarmuid J. and Zvengrowski, Peter D.}, TITLE = {On the non-invariance of span and immersion co-dimension for manifolds}, JOURNAL = {Arch. Math. (Brno)}, FJOURNAL = {Universitatis Masarykianae Brunensis. Facultas Scientiarum Naturalium. Archivum Mathematicum}, VOLUME = {44}, YEAR = {2008}, NUMBER = {5}, PAGES = {353--365}, ISSN = {0044-8753}, MRCLASS = {57R25 (57R20 57R55)}, MRNUMBER = {2501572 (2010a:57045)}, MRREVIEWER = {J{\'u}lius Korba{\v{s}}}, } @incollection {Culler(1984), AUTHOR = {Culler, Marc}, TITLE = {Finite groups of outer automorphisms of a free group}, BOOKTITLE = {Contributions to group theory}, SERIES = {Contemp. Math.}, VOLUME = {33}, PAGES = {197--207}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1984}, MRCLASS = {20E05 (20B25 20F34 57M05)}, MRNUMBER = {86g:20027}, MRREVIEWER = {G. Peter Scott}, } @article{Culler-Gordon-Luecke-Shalen(1987), AUTHOR = {Culler, Marc and Gordon, C. McA. and Luecke, J. and Shalen, Peter B.}, TITLE = {Dehn surgery on knots}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {125}, YEAR = {1987}, NUMBER = {2}, PAGES = {237--300}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57N12 (57M25 57M40)}, MRNUMBER = {88a:57026}, MRREVIEWER = {John Hempel}, } @article {Crawley-Boevey-Kropholler-Linnell(1988), AUTHOR = {Crawley-Boevey, W. W. and Kropholler, P. H. and Linnell, P. A.}, TITLE = {Torsion-free soluble groups, completions, and the zero divisor conjecture}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {54}, YEAR = {1988}, NUMBER = {2-3}, PAGES = {181--196}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {16A27 (20C07)}, MRNUMBER = {MR963543 (89j:16015)}, MRREVIEWER = {Donald S. Passman}, } @article{Culler-Shalen(1983), AUTHOR = {Culler, Marc and Shalen, Peter B.}, TITLE = {Varieties of group representations and splittings of $3$-manifolds}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {117}, YEAR = {1983}, NUMBER = {1}, PAGES = {109--146}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57N10}, MRNUMBER = {84k:57005}, MRREVIEWER = {G. Peter Scott}, } @article{Culler-Shalen(1993), AUTHOR = {Culler, Marc and Shalen, Peter B.}, TITLE = {Hyperbolic volume and mod $p$ homology}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {68}, YEAR = {1993}, NUMBER = {3}, PAGES = {494--509}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57M50 (30F40)}, MRNUMBER = {95e:57024}, MRREVIEWER = {Colin C. Adams}, } @article{Culler-Shalen(1994a), AUTHOR = {Culler, Marc and Shalen, Peter B.}, TITLE = {Volumes of hyperbolic {H}aken manifolds. {I}}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {118}, YEAR = {1994}, NUMBER = {2}, PAGES = {285--329}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57M50 (57N10)}, MRNUMBER = {95g:57023}, MRREVIEWER = {Darren D. Long}, } @article{Culler-Shalen(1994b), AUTHOR = {Culler, Marc and Shalen, Peter B.}, TITLE = {The volume of a hyperbolic $3$-manifold with {B}etti number $2$}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {120}, YEAR = {1994}, NUMBER = {4}, PAGES = {1281--1288}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57M50 (20H10)}, MRNUMBER = {94f:57012}, MRREVIEWER = {Alan W. Reid}, } @article{Culler-Vogtmann(1986), AUTHOR = {Culler, Marc and Vogtmann, Karen}, TITLE = {Moduli of graphs and automorphisms of free groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {84}, YEAR = {1986}, NUMBER = {1}, PAGES = {91--119}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20F28 (20J05 57S30)}, MRNUMBER = {87f:20048}, MRREVIEWER = {Christopher W. Stark}, } @incollection{Culler-Vogtmann(1991), AUTHOR = {Culler, Marc and Vogtmann, Karen}, TITLE = {The boundary of outer space in rank two}, BOOKTITLE = {Arboreal group theory (Berkeley, CA, 1988)}, PAGES = {189--230}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1991}, MRCLASS = {57M07}, MRNUMBER = {92i:57001}, MRREVIEWER = {G. Peter Scott}, } @article{Cuntz(1981), AUTHOR = {Cuntz, Joachim}, TITLE = {${K}$-theory for certain ${C}\sp{\ast} $-algebras}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {113}, YEAR = {1981}, NUMBER = {1}, PAGES = {181--197}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {46L05 (16A54 18G99 46M20 58G12)}, MRNUMBER = {84c:46058}, MRREVIEWER = {Vern Paulsen}, } @article {Cuntz(1983), AUTHOR = {Cuntz, Joachim}, TITLE = {${K}$-theoretic amenability for discrete groups}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {344}, YEAR = {1983}, PAGES = {180--195}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {46L80 (19K99)}, MRNUMBER = {86e:46064}, MRREVIEWER = {Autorreferat}, } @article {Cuntz(1987), AUTHOR = {Cuntz, Joachim}, TITLE = {A new look at ${K}{K}$-theory}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {1}, YEAR = {1987}, NUMBER = {1}, PAGES = {31--51}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {46L80 (19K99 46M20)}, MRNUMBER = {89a:46142}, MRREVIEWER = {Claude Schochet}, } @article {Cuntz(1993), AUTHOR = {Cuntz, J.}, TITLE = {A survey of some aspects of noncommutative geometry}, JOURNAL = {Jahresber. Deutsch. Math.-Verein.}, FJOURNAL = {Jahresbericht der Deutschen Mathematiker-Vereinigung}, VOLUME = {95}, YEAR = {1993}, NUMBER = {2}, PAGES = {60--84}, ISSN = {0012-0456}, CODEN = {JDMVA7}, MRCLASS = {46L87 (19D55 19Kxx 46L80)}, MRNUMBER = {94c:46137}, MRREVIEWER = {Carla Farsi}, } @incollection {Cuntz(1997), AUTHOR = {Cuntz, Joachim}, TITLE = {Excision in periodic cyclic theory for topological algebras}, BOOKTITLE = {Cyclic cohomology and noncommutative geometry (Waterloo, ON, 1995)}, PAGES = {43--53}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1997}, MRCLASS = {19D55 (19K56 46H05 46M20)}, MRNUMBER = {99b:19003}, MRREVIEWER = {Erlend Dahl}, } @article {Cuntz(1997b), AUTHOR = {Cuntz, Joachim}, TITLE = {Bivariante ${K}$-{T}heorie f\"ur lokalkonvexe {A}lgebren und der {C}hern-{C}onnes-{C}harakter}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, VOLUME = {2}, YEAR = {1997}, PAGES = {139--182 (electronic)}, ISSN = {1431-0643}, MRCLASS = {19K35 (18G60 19D55 19L10 46H05 46L80 46M20)}, MRNUMBER = {98h:19006}, MRREVIEWER = {Jonathan M. Rosenberg}, } @incollection {Cuntz(1998a), AUTHOR = {Cuntz, Joachim}, TITLE = {A general construction of bivariant ${K}$-theories on the category of ${C}\sp \ast$-algebras}, BOOKTITLE = {Operator algebras and operator theory (Shanghai, 1997)}, PAGES = {31--43}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1998}, MRCLASS = {46L80 (19K35 46M15)}, MRNUMBER = {2000b:46125}, MRREVIEWER = {Vicumpriya S. Perera}, } @article {Cuntz(1998b), AUTHOR = {Cuntz, Joachim}, TITLE = {Morita invariance in cyclic homology for nonunital algebras}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {15}, YEAR = {1998}, NUMBER = {4}, PAGES = {301--305}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {16E40 (19D55 46L80)}, MRNUMBER = {99k:16016}, MRREVIEWER = {Kevin P. Knudson}, } @article {Cuntz(2001), AUTHOR = {Cuntz, Joachim}, TITLE = {Quantum spaces and their noncommutative topology}, JOURNAL = {Notices Amer. Math. Soc.}, FJOURNAL = {Notices of the American Mathematical Society}, VOLUME = {48}, YEAR = {2001}, NUMBER = {8}, PAGES = {793--799}, ISSN = {0002-9920}, CODEN = {AMNOAN}, MRCLASS = {58B34 (19D55 19K35 46L85 58J42)}, MRNUMBER = {2002g:58006}, MRREVIEWER = {Victor Nistor}, } @article {Cuntz(2002), AUTHOR = {Cuntz, J.}, TITLE = {Noncommutative simplicial complexes and the {B}aum-{C}onnes conjecture}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {12}, YEAR = {2002}, NUMBER = {2}, PAGES = {307--329}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58J22 (19K33 46L80 46L85)}, MRNUMBER = {MR1911662 (2003f:58045)}, MRREVIEWER = {Jean-Louis Tu}, } @incollection{Cuntz(2004), AUTHOR = {Cuntz, Joachim}, TITLE = {Cyclic theory, bivariant {$K$}-theory and the bivariant {C}hern-{C}onnes character}, BOOKTITLE = {Cyclic homology in non-commutative geometry}, SERIES = {Encyclopaedia Math. Sci.}, VOLUME = {121}, PAGES = {1--71}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2004}, MRCLASS = {19D55 (46L80 58J42)}, MRNUMBER = {2052771}, } @article {Cuntz(2004Laudatio), AUTHOR = {Cuntz, Joachim}, TITLE = {Laudatio auf {P}rof. {F}riedrich {H}irzebruch}, JOURNAL = {Mitt. Dtsch. Math.-Ver.}, FJOURNAL = {Mitteilungen der Deutschen Mathematiker-Vereinigung}, VOLUME = {12}, YEAR = {2004}, NUMBER = {4}, PAGES = {287}, ISSN = {0947-4471}, MRCLASS = {01A70}, MRNUMBER = {2110687}, } @incollection {Cuntz(2005cyclic), AUTHOR = {Cuntz, Joachim}, TITLE = {Bivariant {$K$}- and cyclic theories}, BOOKTITLE = {Handbook of {$K$}-theory. {V}ol. 1, 2}, PAGES = {655--702}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2005}, MRCLASS = {19K35 (37B10 46L35 46L80)}, MRNUMBER = {2181832 (2007f:19006)}, MRREVIEWER = {Ralf Meyer}, DOI = {10.1007/978-3-540-27855-9_14}, URL = {http://dx.doi.org/10.1007/978-3-540-27855-9_14}, } @article {Cuntz(2005Weyl), AUTHOR = {Cuntz, Joachim}, TITLE = {Bivariant {$K$}-theory and the {W}eyl algebra}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {35}, YEAR = {2005}, NUMBER = {1-2}, PAGES = {93--137}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {46L80 (19K99 46H99 46M15)}, MRNUMBER = {2240217 (2008a:46068)}, MRREVIEWER = {Vladimir Manuilov}, DOI = {10.1007/s10977-005-3464-0}, URL = {http://dx.doi.org/10.1007/s10977-005-3464-0}, } @incollection {Cuntz(2006), AUTHOR = {Cuntz, Joachim}, TITLE = {An algebraic description of boundary maps used in index theory}, BOOKTITLE = {Operator {A}lgebras: {T}he {A}bel {S}ymposium 2004}, SERIES = {Abel Symp.}, VOLUME = {1}, PAGES = {61--86}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {2006}, MRCLASS = {46L80 (19K56 47G30 58J22)}, MRNUMBER = {2265043 (2007m:46114)}, MRREVIEWER = {{\'E}ric Leichtnam}, DOI = {10.1007/978-3-540-34197-0_3}, URL = {http://dx.doi.org/10.1007/978-3-540-34197-0_3}, } @incollection {Cuntz(2008), AUTHOR = {Cuntz, Joachim}, TITLE = {{$C^*$}-algebras associated with the {$ax+b$}-semigroup over {$\Bbb N$}}, BOOKTITLE = {{$K$}-theory and noncommutative geometry}, SERIES = {EMS Ser. Congr. Rep.}, PAGES = {201--215}, PUBLISHER = {Eur. Math. Soc., Z\"urich}, YEAR = {2008}, MRCLASS = {46L05 (22D25)}, MRNUMBER = {2513338 (2010i:46086)}, MRREVIEWER = {Sriwulan Adji}, DOI = {10.4171/060-1/8}, URL = {http://dx.doi.org/10.4171/060-1/8}, } @article {Cuntz(2013), AUTHOR = {Cuntz, Joachim}, TITLE = {Quillen's work on the foundations of cyclic cohomology}, JOURNAL = {J. K-Theory}, FJOURNAL = {Journal of K-Theory. K-Theory and its Applications in Algebra, Geometry, Analysis \& Topology}, VOLUME = {11}, YEAR = {2013}, NUMBER = {3}, PAGES = {559--574}, ISSN = {1865-2433}, MRCLASS = {19-03 (19D55)}, MRNUMBER = {3101408}, DOI = {10.1017/is012011006jkt201}, URL = {http://dx.doi.org/10.1017/is012011006jkt201}, } @article {Cuntz-Deninger-Laca(2013), AUTHOR = {Cuntz, Joachim and Deninger, Christopher and Laca, Marcelo}, TITLE = {{$C^*$}-algebras of {T}oeplitz type associated with algebraic number fields}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {355}, YEAR = {2013}, NUMBER = {4}, PAGES = {1383--1423}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {46L05 (11M55 11R04 22D25)}, MRNUMBER = {3037019}, MRREVIEWER = {Jun-ping Liu}, DOI = {10.1007/s00208-012-0826-9}, URL = {http://dx.doi.org/10.1007/s00208-012-0826-9}, } @proceedings {Cuntz-Echterhoff(2000), TITLE = {${C}\sp *$-algebras}, BOOKTITLE = {Proceedings of the SFB Workshop held at the University of M\"unster, M\"unster, March 8--12, 1999}, EDITOR = {Cuntz, Joachim and Echterhoff, Siegfried}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2000}, PAGES = {x+272}, ISBN = {3-540-67562-0}, MRCLASS = {46-06 (46Lxx)}, MRNUMBER = {2001g:46002}, } @article {Cuntz-Echterhoff-LI(2013), AUTHOR = {Cuntz, Joachim and Echterhoff, Siegfried and Li, Xin}, TITLE = {On the {$K$}-theory of crossed products by automorphic semigroup actions}, JOURNAL = {Q. J. Math.}, FJOURNAL = {The Quarterly Journal of Mathematics}, VOLUME = {64}, YEAR = {2013}, NUMBER = {3}, PAGES = {747--784}, ISSN = {0033-5606}, MRCLASS = {19Dxx}, MRNUMBER = {3094498}, DOI = {10.1093/qmath/hat021}, URL = {http://dx.doi.org/10.1093/qmath/hat021}, } @incollection {Cuntz-Higson(1987), AUTHOR = {Cuntz, Joachim and Higson, Nigel}, TITLE = {Kuiper's theorem for {H}ilbert modules}, BOOKTITLE = {Operator algebras and mathematical physics (Iowa City, Iowa, 1985)}, PAGES = {429--435}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1987}, MRCLASS = {46L05 (46L80)}, MRNUMBER = {88f:46108}, MRREVIEWER = {Vern Paulsen}, } @article {Cuntz-Li(2012), AUTHOR = {Cuntz, Joachim and Li, Xin}, TITLE = {Erratum to ``{${\rm C}^*$}-algebras associated with integral domains and crossed products by actions on adele spaces''}, JOURNAL = {J. Noncommut. Geom.}, FJOURNAL = {Journal of Noncommutative Geometry}, VOLUME = {6}, YEAR = {2012}, NUMBER = {4}, PAGES = {819--821}, ISSN = {1661-6952}, MRCLASS = {46L55 (11R04 11R56 19K33 46L05 46L80)}, MRNUMBER = {2990126}, DOI = {10.4171/JNCG/107}, URL = {http://dx.doi.org/10.4171/JNCG/107}, } @article {Cuntz-Li(2011_polynomial), AUTHOR = {Cuntz, Joachim and Li, Xin}, TITLE = {K-theory for ring {${\rm C}^*$}-algebras attached to polynomial rings over finite fields}, JOURNAL = {J. Noncommut. Geom.}, FJOURNAL = {Journal of Noncommutative Geometry}, VOLUME = {5}, YEAR = {2011}, NUMBER = {3}, PAGES = {331--349}, ISSN = {1661-6952}, MRCLASS = {46L80 (19K14 46L05)}, MRNUMBER = {2817642 (2012g:46108)}, MRREVIEWER = {Vicumpriya S. Perera}, DOI = {10.4171/JNCG/78}, URL = {http://dx.doi.org/10.4171/JNCG/78}, } @article {Cuntz-Li(2011), AUTHOR = {Cuntz, Joachim and Li, Xin}, TITLE = {{$C^\ast$}-algebras associated with integral domains and crossed products by actions on adele spaces}, JOURNAL = {J. Noncommut. Geom.}, FJOURNAL = {Journal of Noncommutative Geometry}, VOLUME = {5}, YEAR = {2011}, NUMBER = {1}, PAGES = {1--37}, ISSN = {1661-6952}, MRCLASS = {46Lxx (11R04 11R56 22Dxx)}, MRNUMBER = {2746649}, DOI = {10.4171/JNCG/68}, URL = {http://dx.doi.org/10.4171/JNCG/68}, } @incollection {Cuntz-Li(2010), AUTHOR = {Cuntz, Joachim and Li, Xin}, TITLE = {The regular {$C^\ast$}-algebra of an integral domain}, BOOKTITLE = {Quanta of maths}, SERIES = {Clay Math. Proc.}, VOLUME = {11}, PAGES = {149--170}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2010}, MRCLASS = {46Lxx (11M55 11R04)}, MRNUMBER = {2732050}, } @book {Cuntz-Meyer-Rosenberg(2007), AUTHOR = {Cuntz, Joachim and Meyer, Ralf and Rosenberg, Jonathan M.}, TITLE = {Topological and bivariant {$K$}-theory}, SERIES = {Oberwolfach Seminars}, VOLUME = {36}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {2007}, PAGES = {xii+262}, ISBN = {978-3-7643-8398-5}, MRCLASS = {19-02 (19K35 19K56 46L80 58J20)}, MRNUMBER = {2340673 (2008j:19001)}, MRREVIEWER = {Evgeni{\u\i} V. Troitski{\u\i}}, } @incollection{Cuntz-Quillen(1995), AUTHOR = {Cuntz, Joachim and Quillen, Daniel}, TITLE = {Operators on noncommutative differential forms and cyclic homology}, BOOKTITLE = {Geometry, topology, \& physics}, PAGES = {77--111}, PUBLISHER = {Internat. Press}, ADDRESS = {Cambridge, MA}, YEAR = {1995}, MRCLASS = {19D55 (18G60 46L87 58B30)}, MRNUMBER = {96j:19004}, MRREVIEWER = {Erlend Dahl}, } @article{Cuntz-Quillen(1996), AUTHOR = {Cuntz, Joachim and Quillen, Daniel}, TITLE = {Excision in bivariant periodic cyclic cohomology}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {127}, YEAR = {1997}, NUMBER = {1}, PAGES = {67--98}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {19D55 (46L80 46L85)}, MRNUMBER = {98g:19003}, MRREVIEWER = {Jacek Brodzki}, } @article {Cuntz-Vershik(2013), AUTHOR = {Cuntz, Joachim and Vershik, Anatoly}, TITLE = {{$C^\ast$}-algebras associated with endomorphisms and polymorphsims of compact abelian groups}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {321}, YEAR = {2013}, NUMBER = {1}, PAGES = {157--179}, ISSN = {0010-3616}, MRCLASS = {46L55 (22C05)}, MRNUMBER = {3089668}, MRREVIEWER = {Xiao Chun Fang}, } @article{Curtis(1971), AUTHOR = {Curtis, Edward B.}, TITLE = {Simplicial homotopy theory}, JOURNAL = {Advances in Math.}, VOLUME = {6}, YEAR = {1971}, PAGES = {107--209 (1971)}, MRCLASS = {55.40}, MRNUMBER = {43 \#5529}, MRREVIEWER = {A. L. Bousfield}, } @article {Cuntz-Thom(2006), AUTHOR = {Cuntz, Joachim and Thom, Andreas}, TITLE = {Algebraic {$K$}-theory and locally convex algebras}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {334}, YEAR = {2006}, NUMBER = {2}, PAGES = {339--371}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {46L80 (19K35 46H99 46M20)}, MRNUMBER = {MR2207702 (2006j:46070)}, MRREVIEWER = {Jonathan M. Rosenberg}, } @book{Curtis-Rainer(1990), AUTHOR = {Curtis, Charles W. and Reiner, Irving}, TITLE = {Methods of representation theory. {V}ol. {I}}, SERIES = {Wiley Classics Library}, NOTE = {With applications to finite groups and orders, Reprint of the 1981 original, A Wiley-Interscience Publication}, PUBLISHER = {John Wiley \& Sons Inc.}, ADDRESS = {New York}, YEAR = {1990}, PAGES = {xxiv+819}, ISBN = {0-471-52367-4}, MRCLASS = {20-02 (01A75 11R33 20Cxx)}, MRNUMBER = {MR1038525 (90k:20001)}, } @book{Curtis-Reiner(1981), AUTHOR = {Curtis, Charles W. and Reiner, Irving}, TITLE = {Methods of representation theory. {V}ol. {I}}, NOTE = {With applications to finite groups and orders, Pure and Applied Mathematics, A Wiley-Interscience Publication}, PUBLISHER = {John Wiley \&\ Sons Inc.}, ADDRESS = {New York}, YEAR = {1981}, PAGES = {xxi+819}, ISBN = {0-471-18994-4}, MRCLASS = {20-02 (10C30 12A57 20Cxx)}, MRNUMBER = {82i:20001}, MRREVIEWER = {J. L. Alperin}, } @book{Curtis-Reiner(1987), AUTHOR = {Curtis, Charles W. and Reiner, Irving}, TITLE = {Methods of representation theory. {V}ol. {I}{I}}, NOTE = {With applications to finite groups and orders, A Wiley-Interscience Publication}, PUBLISHER = {John Wiley \& Sons Inc.}, ADDRESS = {New York}, YEAR = {1987}, PAGES = {xviii+951}, ISBN = {0-471-88871-0}, MRCLASS = {20-02 (11Exx 18F25 19A31 19B28 19C99 20Cxx)}, MRNUMBER = {88f:20002}, MRREVIEWER = {J. L. Alperin}, } @article{Dai(1991), AUTHOR = {Dai, Xianzhe}, TITLE = {Adiabatic limits, nonmultiplicativity of signature, and {L}eray spectral sequence}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {4}, YEAR = {1991}, NUMBER = {2}, PAGES = {265--321}, ISSN = {0894-0347}, MRCLASS = {58G10 (55T10 58G25)}, MRNUMBER = {92f:58169}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article{Dai-Fang(2000), AUTHOR = {Dai, Xianzhe and Fang, Hao}, TITLE = {Analytic torsion and {R}-torsion for manifolds with boundary}, JOURNAL = {Asian J. Math.}, FJOURNAL = {The Asian Journal of Mathematics}, VOLUME = {4}, YEAR = {2000}, NUMBER = {3}, PAGES = {695--714}, ISSN = {1093-6106}, MRCLASS = {58J52 (57Q10 58J35)}, MRNUMBER = {2001j:58057}, MRREVIEWER = {Leonid Friedlander}, } @article {Dai-Freed(1994a), AUTHOR = {Dai, Xianzhe and Freed, Daniel S.}, TITLE = {$\eta$-invariants and determinant lines}, NOTE = {Topology and physics}, JOURNAL = {J. Math. Phys.}, FJOURNAL = {Journal of Mathematical Physics}, VOLUME = {35}, YEAR = {1994}, NUMBER = {10}, PAGES = {5155--5194}, ISSN = {0022-2488}, CODEN = {JMAPAQ}, MRCLASS = {58G26 (58G20)}, MRNUMBER = {96a:58204}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @incollection {Dai-Melrose(2012), AUTHOR = {Dai, Xianzhe and Melrose, Richard B.}, TITLE = {Adiabatic limit, heat kernel and analytic torsion}, BOOKTITLE = {Metric and differential geometry}, SERIES = {Progr. Math.}, VOLUME = {297}, PAGES = {233--298}, PUBLISHER = {Birkh\"auser/Springer, Basel}, YEAR = {2012}, MRCLASS = {58J52 (35K08 57Q10 58J28)}, MRNUMBER = {3220445}, } @article {Dasbach-Lalin(2009), AUTHOR = {Dasbach, Oliver T. and Lalin, Matilde N.}, TITLE = {Mahler measure under variations of the base group}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {21}, YEAR = {2009}, NUMBER = {4}, PAGES = {621--637}, ISSN = {0933-7741}, CODEN = {FOMAEF}, MRCLASS = {11R06 (16S34)}, MRNUMBER = {2541476 (2010m:11127)}, MRREVIEWER = {Oleg V. Ogievetsky}, DOI = {10.1515/FORUM.2009.031}, URL = {http://dx.doi.org/10.1515/FORUM.2009.031}, } @inproceedings {Dasbach-Lalin(2008), AUTHOR = {Dasbach, Oliver T. and Lal{\'{\i}}n, Matilde N.}, TITLE = {On the recurrence of coefficients in the {L}\"uck-{F}uglede-{K}adison determinant}, BOOKTITLE = {Proceedings of the ``{S}egundas {J}ornadas de {T}eor\'\i a de {N}\'umeros''}, SERIES = {Bibl. Rev. Mat. Iberoamericana}, PAGES = {119--134}, PUBLISHER = {Rev. Mat. Iberoamericana, Madrid}, YEAR = {2008}, MRCLASS = {11C20 (05C25 16S34 33C20)}, MRNUMBER = {2603901 (2011d:11059)}, MRREVIEWER = {Mateja Pre{\v{s}}ern}, } @book {Daverman(1986), AUTHOR = {Daverman, Robert J.}, TITLE = {Decompositions of manifolds}, SERIES = {Pure and Applied Mathematics}, VOLUME = {124}, PUBLISHER = {Academic Press Inc.}, ADDRESS = {Orlando, FL}, YEAR = {1986}, PAGES = {xii+317}, ISBN = {0-12-204220-4}, MRCLASS = {57-01 (54B15)}, MRNUMBER = {MR872468 (88a:57001)}, MRREVIEWER = {Du{\v{s}}an Repov{\v{s}}}, } @incollection {Daverman(1994), AUTHOR = {Daverman, Robert J.}, TITLE = {Fundamental group isomorphisms between compact $4$-manifolds and their boundaries}, BOOKTITLE = {Low-dimensional topology (Knoxville, TN, 1992)}, PAGES = {31--34}, PUBLISHER = {Internat. Press}, ADDRESS = {Cambridge, MA}, YEAR = {1994}, MRCLASS = {57N13 (57M05)}, MRNUMBER = {96a:57046}, MRREVIEWER = {Katura Miyazaki}, } @book {Davermann(2007), AUTHOR = {Daverman, Robert J.}, TITLE = {Decompositions of manifolds}, NOTE = {Reprint of the 1986 original}, PUBLISHER = {AMS Chelsea Publishing, Providence, RI}, YEAR = {2007}, PAGES = {xii+317}, ISBN = {978-0-8218-4372-7}, MRCLASS = {57-01 (54B15)}, MRNUMBER = {MR2341468 (2008d:57001)}, } @book {Davermann-Sher(2002), TITLE = {Handbook of geometric topology}, EDITOR = {Daverman, R. J. and Sher, R. B.}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {2002}, PAGES = {x+1133}, ISBN = {0-444-82432-4}, MRCLASS = {57-06 (55-06)}, MRNUMBER = {1886666 (2002k:57002)}, } @book {Davidson(1996), AUTHOR = {Davidson, Kenneth R.}, TITLE = {{$C\sp *$}-algebras by example}, SERIES = {Fields Institute Monographs}, VOLUME = {6}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {1996}, PAGES = {xiv+309}, ISBN = {0-8218-0599-1}, MRCLASS = {46Lxx (46-01)}, MRNUMBER = {97i:46095}, MRREVIEWER = {Robert S. Doran}, } @article {Davis(1989), AUTHOR = {Davis, Michael W.}, TITLE = {The cohomology of a {C}oxeter group with group ring coefficients}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {91}, YEAR = {1998}, NUMBER = {2}, PAGES = {297--314}, ISSN = {0012-7094}, MRCLASS = {20F55 (20J05 57M07)}, MRNUMBER = {1600586}, MRREVIEWER = {Peter W. Donovan}, DOI = {10.1215/S0012-7094-98-09113-X}, URL = {http://dx.doi.org/10.1215/S0012-7094-98-09113-X}, } @article {Davis(1987), AUTHOR = {Davis, Michael W.}, TITLE = {Some aspherical manifolds}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {55}, YEAR = {1987}, NUMBER = {1}, PAGES = {105--139}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {57S30 (57R15 57R19)}, MRNUMBER = {MR883666 (88j:57044)}, MRREVIEWER = {Martin Scharlemann}, } @article {Davis(1983), AUTHOR = {Davis, Michael W.}, TITLE = {Groups generated by reflections and aspherical manifolds not covered by {E}uclidean space}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {117}, YEAR = {1983}, NUMBER = {2}, PAGES = {293--324}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57S30 (20F38 51F15)}, MRNUMBER = {MR690848 (86d:57025)}, MRREVIEWER = {B. N. Apanasov}, } @incollection {Davis(1984), AUTHOR = {Davis, Michael W.}, TITLE = {Coxeter groups and aspherical manifolds}, BOOKTITLE = {Algebraic topology, Aarhus 1982 (Aarhus, 1982)}, SERIES = {Lecture Notes in Math.}, VOLUME = {1051}, PAGES = {197--221}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1984}, MRCLASS = {57S30 (05C25 20F32)}, MRNUMBER = {MR764580 (86c:57041)}, MRREVIEWER = {Allan Edmonds}, } @article{Davis(1998), AUTHOR = {Davis, James F.}, TITLE = {The rational symmetric signature of manifolds with finite fundamental group}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {37}, YEAR = {1998}, NUMBER = {4}, PAGES = {895--911}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57R91 (57S17)}, MRNUMBER = {99c:57065}, MRREVIEWER = {Charles Livingston}, } @incollection {Davis(1998buildings), AUTHOR = {Davis, Michael W.}, TITLE = {Buildings are {${\rm CAT}(0)$}}, BOOKTITLE = {Geometry and cohomology in group theory (Durham, 1994)}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {252}, PAGES = {108--123}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1998}, MRCLASS = {20F65 (20E42 57M07)}, MRNUMBER = {MR1709955 (2000i:20068)}, MRREVIEWER = {John Meier}, } @incollection {Davis(2000), AUTHOR = {Davis, James F.}, TITLE = {Manifold aspects of the {N}ovikov conjecture}, BOOKTITLE = {Surveys on surgery theory, Vol. 1}, PAGES = {195--224}, PUBLISHER = {Princeton Univ. Press}, ADDRESS = {Princeton, NJ}, YEAR = {2000}, MRCLASS = {57R20 (57R19 57R65)}, MRNUMBER = {1 747 536}, } @incollection {Davis(2000Poin), AUTHOR = {Davis, Michael W.}, TITLE = {Poincar\'e duality groups}, BOOKTITLE = {Surveys on surgery theory, Vol. 1}, SERIES = {Ann. of Math. Stud.}, VOLUME = {145}, PAGES = {167--193}, PUBLISHER = {Princeton Univ. Press}, ADDRESS = {Princeton, NJ}, YEAR = {2000}, MRCLASS = {57M07 (20J05 57P10 57R19)}, MRNUMBER = {MR1747535 (2001b:57001)}, MRREVIEWER = {Yurij V. Muranov}, } @incollection {Davis(2001), AUTHOR = {Davis, Michael W.}, TITLE = {Exotic aspherical manifolds}, BOOKTITLE = {Topology of high-dimensional manifolds, No. 1, 2 (Trieste, 2001)}, SERIES = {ICTP Lect. Notes}, VOLUME = {9}, PAGES = {371--404}, PUBLISHER = {Abdus Salam Int. Cent. Theoret. Phys., Trieste}, YEAR = {2002}, MRCLASS = {57P99 (57Q99 57R55)}, MRNUMBER = {MR1937019 (2004a:57031)}, } @incollection {Davis(2002), AUTHOR = {Davis, Michael W.}, TITLE = {Nonpositive curvature and reflection groups}, BOOKTITLE = {Handbook of geometric topology}, PAGES = {373--422}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {2002}, MRCLASS = {53C23 (20F36 20F55 20F65 57M60)}, MRNUMBER = {MR1886674 (2002m:53061)}, MRREVIEWER = {Athanase Papadopoulos}, } @InCollection{Davis(2002exotic), author = {Davis, M.}, title = {Exotic aspherical manifolds}, editor = {Farrell, T. and G\"ottsche, L. and L{\"u}ck, Wolfgang}, booktitle = {High dimensional manifold theory}, note = {Proceedings of the summer school ``High dimensional manifold theory'' in Trieste May/June 2001, Number~2. http://www.ictp.trieste.it/\~{}pub\_off/lectures/vol9.html}, pages = {371--404}, publisher = {Abdus Salam International Centre for Theoretical Physics, Trieste}, year = 2002, series = {ICTP Lecture Notes}, number = 9, } @incollection {Davis(2005Borel4), AUTHOR = {Davis, James F.}, TITLE = {The {B}orel/{N}ovikov conjectures and stable diffeomorphisms of 4-manifolds}, BOOKTITLE = {Geometry and topology of manifolds}, SERIES = {Fields Inst. Commun.}, VOLUME = {47}, PAGES = {63--76}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2005}, MRCLASS = {57N13 (57R67)}, MRNUMBER = {2189926 (2006j:57040)}, MRREVIEWER = {Masayuki Yamasaki}, } @book {Davis(2008book), AUTHOR = {Davis, Michael W.}, TITLE = {The geometry and topology of {C}oxeter groups}, SERIES = {London Mathematical Society Monographs Series}, VOLUME = {32}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {2008}, PAGES = {xvi+584}, ISBN = {978-0-691-13138-2; 0-691-13138-4}, MRCLASS = {20F55 (05B45 05C25 20Jxx 51-02 57M07)}, MRNUMBER = {MR2360474}, } @book {Davis(2008cox), AUTHOR = {Davis, Michael W.}, TITLE = {The geometry and topology of {C}oxeter groups}, SERIES = {London Mathematical Society Monographs Series}, VOLUME = {32}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {2008}, PAGES = {xvi+584}, ISBN = {978-0-691-13138-2; 0-691-13138-4}, MRCLASS = {20F55 (05B45 05C25 20Jxx 51-02 57M07)}, MRNUMBER = {MR2360474}, } @incollection{Davis(2006Borel+Novikov), AUTHOR = {Davis, James F.}, TITLE = {The {B}orel/{N}ovikov conjectures and stable diffeomorphisms of 4-manifolds}, BOOKTITLE = {Geometry and topology of manifolds}, SERIES = {Fields Inst. Commun.}, VOLUME = {47}, PAGES = {63--76}, PUBLISHER = {Amer. Math. Soc., Providence, RI}, YEAR = {2005}, MRCLASS = {57N13 (57R67)}, MRNUMBER = {2189926}, MRREVIEWER = {Masayuki Yamasaki}, } @article {Davis(2006), AUTHOR = {Davis, Daniel G.}, TITLE = {Homotopy fixed points for {$L\sb {K(n)}(E\sb n\wedge X)$} using the continuous action}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {206}, YEAR = {2006}, NUMBER = {3}, PAGES = {322--354}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55P43 (55M20 55P42 55T99)}, MRNUMBER = {MR2235364 (2007b:55008)}, MRREVIEWER = {Mark W. Johnson}, } @article{Davis(2012work), AUTHOR = {Davis, James F.}, TITLE = {The work of {T}om {F}arrell and {L}owell {J}ones in topology and geometry}, JOURNAL = {Pure Appl. Math. Q.}, FJOURNAL = {Pure and Applied Mathematics Quarterly}, VOLUME = {8}, YEAR = {2012}, NUMBER = {1}, PAGES = {1--14}, ISSN = {1558-8599}, MRCLASS = {57R67 (01A60 19J25 57-03)}, MRNUMBER = {2900078}, MRREVIEWER = {A. A. Ranicki}, } @article {Davis-Dymara-Januszkiewicz(2007), AUTHOR = {Davis, Michael W. and Dymara, Jan and Januszkiewicz, Tadeusz and Okun, Boris}, TITLE = {Weighted {$L\sp 2$}-cohomology of {C}oxeter groups}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {11}, YEAR = {2007}, PAGES = {47--138}, MRCLASS = {20J06 (46L10 57M07)}, MRNUMBER = {MR2287919}, } @incollection {Davis-Hausmann(1989), AUTHOR = {Davis, Michael W. and Hausmann, Jean-Claude}, TITLE = {Aspherical manifolds without smooth or {PL} structure}, BOOKTITLE = {Algebraic topology (Arcata, CA, 1986)}, SERIES = {Lecture Notes in Math.}, VOLUME = {1370}, PAGES = {135--142}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1989}, MRCLASS = {57M35 (57Q15 57R10)}, MRNUMBER = {MR1000373 (90f:57016)}, MRREVIEWER = {Jo{\v{z}}e Vrabec}, } @article{Davis-Januszkiewicz(1991), AUTHOR = {Davis, Michael W. and Januszkiewicz, Tadeusz}, TITLE = {Hyperbolization of polyhedra}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {34}, YEAR = {1991}, NUMBER = {2}, PAGES = {347--388}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57Q05 (53C20)}, MRNUMBER = {92h:57036}, MRREVIEWER = {Werner Ballmann}, } @article {Davis-Januszkiewicz(2000), AUTHOR = {Davis, Michael W. and Januszkiewicz, Tadeusz}, TITLE = {Right-angled {A}rtin groups are commensurable with right-angled {C}oxeter groups}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {153}, YEAR = {2000}, NUMBER = {3}, PAGES = {229--235}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20F36 (20F55 57M07)}, MRNUMBER = {MR1783167 (2001m:20056)}, MRREVIEWER = {Thomas Brady}, } @article {Davis-Januszkiewicz-Leary(2007), AUTHOR = {Davis, M. W. and Januszkiewicz, T. and Leary, I. J.}, TITLE = {The {$l\sp 2$}-cohomology of hyperplane complements}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {1}, YEAR = {2007}, NUMBER = {3}, PAGES = {301--309}, ISSN = {1661-7207}, MRCLASS = {58Jxx (52Cxx)}, MRNUMBER = {MR2314047}, } @article {Davis-Januszkiewicz-Scott(2003), AUTHOR = {Davis, M. and Januszkiewicz, T. and Scott, R.}, TITLE = {Fundamental groups of blow-ups}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {177}, YEAR = {2003}, NUMBER = {1}, PAGES = {115--179}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {57M60 (53C22 57M50 57N16)}, MRNUMBER = {MR1985196 (2004c:57030)}, MRREVIEWER = {Athanase Papadopoulos}, } @article {Davis-Januszkiewicz-Weinberger(2001), AUTHOR = {Davis, Michael W. and Januszkiewicz, Tadeusz and Weinberger, Shmuel}, TITLE = {Relative hyperbolization and aspherical bordisms: an addendum to ``{H}yperbolization of polyhedra'' [{J}.\ {D}ifferential {G}eom.\ {\bf 34} (1991), no.\ 2, 347--388; {MR}1131435 (92h:57036)] by {D}avis and {J}anuszkiewicz}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {58}, YEAR = {2001}, NUMBER = {3}, PAGES = {535--541}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57Q05 (53C20)}, MRNUMBER = {MR1906785 (2003e:57038)}, } @book {Davis-Kirk(2001), AUTHOR = {Davis, James F. and Kirk, Paul}, TITLE = {Lecture notes in algebraic topology}, SERIES = {Graduate Studies in Mathematics}, VOLUME = {35}, PUBLISHER = {American Mathematical Society, Providence, RI}, YEAR = {2001}, PAGES = {xvi+367}, ISBN = {0-8218-2160-1}, MRCLASS = {55-01 (57-01)}, MRNUMBER = {1841974}, MRREVIEWER = {Don Shimamoto}, DOI = {10.1090/gsm/035}, URL = {http://dx.doi.org/10.1090/gsm/035}, } @article {Davis-Ji-Juna-Pineda_Lafont(2012), AUTHOR = {Davis, James F. and Ji, Lizhen and Juan-Pineda, Daniel and Lafont, Jean-Fran{\c{c}}ois and Prassidis, Stratos}, TITLE = {Preface [{S}pecial issue: {I}n honor of {F}. {T}homas {F}arrell and {L}owell {E}. {J}ones]}, JOURNAL = {Pure Appl. Math. Q.}, FJOURNAL = {Pure and Applied Mathematics Quarterly}, VOLUME = {8}, YEAR = {2012}, NUMBER = {1}, PAGES = {front matter}, ISSN = {1558-8599}, MRCLASS = {01A70}, MRNUMBER = {2900076}, } @book {Dat(2010), AUTHOR = {Dat, Jean-Fran{\c{c}}ois and Orlik, Sascha and Rapoport, Michael}, TITLE = {Period domains over finite and {$p$}-adic fields}, SERIES = {Cambridge Tracts in Mathematics}, VOLUME = {183}, PUBLISHER = {Cambridge University Press, Cambridge}, YEAR = {2010}, PAGES = {xxii+372}, ISBN = {978-0-521-19769-4}, MRCLASS = {22E50 (14F30 14L35 20G40 22E41)}, MRNUMBER = {2676072}, MRREVIEWER = {Volker J. Heiermann}, DOI = {10.1017/CBO9780511762482}, URL = {http://dx.doi.org/10.1017/CBO9780511762482}, } @article {Dat(2009Fini), AUTHOR = {Dat, Jean-Francois}, TITLE = {Finitude pour les repr\'esentations lisses de groupes {$p$}-adiques}, JOURNAL = {J. Inst. Math. Jussieu}, FJOURNAL = {Journal of the Institute of Mathematics of Jussieu. JIMJ. Journal de l'Institut de Math\'ematiques de Jussieu}, VOLUME = {8}, YEAR = {2009}, NUMBER = {2}, PAGES = {261--333}, ISSN = {1474-7480}, MRCLASS = {22E50}, MRNUMBER = {2485794}, DOI = {10.1017/S1474748008000054}, URL = {http://dx.doi.org/10.1017/S1474748008000054}, } @article {Dat(2009rep), AUTHOR = {Dat, J.-F.}, TITLE = {Repr\'esentations lisses {$p$}-temp\'er\'ees des groupes {$p$}-adiques}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {131}, YEAR = {2009}, NUMBER = {1}, PAGES = {227--255}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {22E50}, MRNUMBER = {2488490}, DOI = {10.1353/ajm.0.0041}, URL = {http://dx.doi.org/10.1353/ajm.0.0041}, } @article {Dat(2007), AUTHOR = {Dat, J.-F.}, TITLE = {Th\'eorie de {L}ubin-{T}ate non-ab\'elienne et repr\'esentations elliptiques}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {169}, YEAR = {2007}, NUMBER = {1}, PAGES = {75--152}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {22E50 (11S37)}, MRNUMBER = {2308851}, MRREVIEWER = {Volker J. Heiermann}, DOI = {10.1007/s00222-007-0044-3}, URL = {http://dx.doi.org/10.1007/s00222-007-0044-3}, } @article {Dat(2003), AUTHOR = {Dat, J.-F.}, TITLE = {Quelques propri\'et\'es des idempotents centraux des groupes {$p$}-adiques}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {554}, YEAR = {2003}, PAGES = {69--103}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {22E50}, MRNUMBER = {1952169}, MRREVIEWER = {Bertrand Lemaire}, DOI = {10.1515/crll.2003.009}, URL = {http://dx.doi.org/10.1515/crll.2003.009}, } @article {Dat(2000), AUTHOR = {Dat, J.-F.}, TITLE = {On the {$K_0$} of a {$p$}-adic group}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {140}, YEAR = {2000}, NUMBER = {1}, PAGES = {171--226}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {22E50 (19A99)}, MRNUMBER = {1779801}, MRREVIEWER = {Bertrand Lemaire}, DOI = {10.1007/s002220050360}, URL = {http://dx.doi.org/10.1007/s002220050360}, } @article {Dat(1999), AUTHOR = {Dat, J.-F.}, TITLE = {Caract\`eres \`a valeurs dans le centre de {B}ernstein}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {508}, YEAR = {1999}, PAGES = {61--83}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {22E50}, MRNUMBER = {1676870}, MRREVIEWER = {David Manderscheid}, DOI = {10.1515/crll.1999.031}, URL = {http://dx.doi.org/10.1515/crll.1999.031}, } @article{Davis-Katz(1993), AUTHOR = {Davis, James F. and Katz, Gabriel}, TITLE = {Equivariant semicharacteristics and induction}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {51}, YEAR = {1993}, NUMBER = {1}, PAGES = {41--52}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {57R85 (19A22 57R67 57S17)}, MRNUMBER = {95a:57043}, MRREVIEWER = {Christopher W. Stark}, } @article{Davis-Khan-Ranicki(2011), author="Davis, James F. and Khan, Qayum and Ranicki, Andrew", title="{Algebraic $K$-theory over the infinite dihedral group: an algebraic approach.}", language="English", journal="Algebr. Geom. Topol.", volume="11", number="4", pages="2391-2436", year="2011", doi={10.2140/agt.2011.11.2391}, abstract="{Summary: Two types of Nil-groups arise in the codimension 1 splitting obstruction theory for homotopy equivalences of finite CW-complexes: the Farrell-Bass Nil-groups in the nonseparating case when the fundamental group is an HNN extension and the Waldhausen Nil-groups in the separating case when the fundamental group is an amalgamated free product. We obtain a general Nil-Nil theorem in algebraic $K$-theory relating the two types of Nil-groups. The infinite dihedral group is a free product and has an index 2 subgroup which is an HNN extension, so both cases arise if the fundamental group surjects onto the infinite dihedral group. The Nil-Nil theorem implies that the two types of the reduced $\widetilde {\text {Nil}}$-groups arising from such a fundamental group are isomorphic. There is also a topological application: in the finite-index case of an amalgamated free product, a homotopy equivalence of finite CW-complexes is semisplit along a separating subcomplex.}", reviewer="{}", keywords="{Nil group; $K$-theory; Farrell-Jones conjecture}", classmath="{19D35 (Negative $K$-theory, NK and Nil) 57R19 (Algebraic topology on manifolds) }", } @article {Davis-Fowler-Lafont(2014), AUTHOR = {Davis, Michael W and Fowler, Jim and Lafont, Jean-Fran{\c{c}}ois}, TITLE = {Aspherical manifolds that cannot be triangulated}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {14}, YEAR = {2014}, NUMBER = {2}, PAGES = {795--803}, ISSN = {1472-2747}, MRCLASS = {Preliminary Data}, MRNUMBER = {3159970}, DOI = {10.2140/agt.2014.14.795}, URL = {http://dx.doi.org/10.2140/agt.2014.14.795}, } @incollection {Davis-Leary(2003asph), AUTHOR = {Davis, M. W. and Leary, I. J.}, TITLE = {Some examples of discrete group actions on aspherical manifolds}, BOOKTITLE = {High-dimensional manifold topology}, PAGES = {139--150}, PUBLISHER = {World Sci. Publ., River Edge, NJ}, YEAR = {2003}, MRCLASS = {57S99}, MRNUMBER = {MR2048719 (2005f:57050)}, MRREVIEWER = {Dev Prakash Sinha}, } @article {Davis-Leary(2003Artin), AUTHOR = {Davis, M. W. and Leary, I. J.}, TITLE = {The {$l\sp 2$}-cohomology of {A}rtin groups}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {Journal of the London Mathematical Society. Second Series}, VOLUME = {68}, YEAR = {2003}, NUMBER = {2}, PAGES = {493--510}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {57M07 (20F36 20J05)}, MRNUMBER = {MR1994696 (2004f:57002)}, MRREVIEWER = {Brent Everitt}, } @article{Davis-Livingston(1991a), AUTHOR = {Davis, James F. and Livingston, Charles}, TITLE = {Alexander polynomials of periodic knots}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {30}, YEAR = {1991}, NUMBER = {4}, PAGES = {551--564}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57M25}, MRNUMBER = {92k:57008}, MRREVIEWER = {Jonathan A. Hillman}, } @article{Davis-Livingston(1991b), AUTHOR = {Davis, James F. and Livingston, Charles}, TITLE = {Periodic knots, {S}mith theory, and {M}urasugi's congruence}, JOURNAL = {Enseign. Math. (2)}, FJOURNAL = {L'Enseignement Math\'ematique. Revue Internationale. IIe S\'erie}, VOLUME = {37}, YEAR = {1991}, NUMBER = {1-2}, PAGES = {1--9}, ISSN = {0013-8584}, CODEN = {ENMAAR}, MRCLASS = {57M25}, MRNUMBER = {92f:57012}, MRREVIEWER = {Jonathan A. Hillman}, } @article{Davis-Lueck(1998), AUTHOR = {Davis, James F. and L{\"u}ck, Wolfgang}, TITLE = {Spaces over a category and assembly maps in isomorphism conjectures in ${K}$- and ${L}$-theory}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {15}, YEAR = {1998}, NUMBER = {3}, PAGES = {201--252}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {55N20 (19D10)}, MRNUMBER = {99m:55004}, MRREVIEWER = {A. A. Ranicki}, } @article {Davis-Lueck(2003), AUTHOR = {Davis, James F. and L{\"u}ck, Wolfgang}, TITLE = {The {$p$}-chain spectral sequence}, NOTE = {Special issue in honor of Hyman Bass on his seventieth birthday. Part I}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {30}, YEAR = {2003}, NUMBER = {1}, PAGES = {71--104}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {55P42 (19B28 19D50 55T99 57R67)}, MRNUMBER = {MR2061848 (2005h:55008)}, MRREVIEWER = {V. P. Snaith}, } @article {Davis-Lueck(2013), AUTHOR = {Davis, James F. and L{\"u}ck, Wolfgang}, TITLE = {The topological ${K}$-theory of certain crystallographic groups}, JOURNAL = {Journal of Non-Commutative Geometry}, VOLUME = {7}, YEAR = {2013}, PAGES = {373--431}, } @Article{Davis-Lueck(2021), Author = {James F. {Davis} and Wolfgang {L\"uck}}, Title = {{Manifolds homotopy equivalent to certain torus bundles over Lens spaces}}, FJournal = {{Communications on Pure and Applied Mathematics}}, Journal = {{Commun. Pure Appl. Math.}}, ISSN = {0010-3640}, Volume = {74}, Number = {11}, Pages = {2348--2397}, Year = {2021}, Publisher = {Wiley, Hoboken, NJ}, Language = {English}, DOI = {10.1002/cpa.21941}, MSC2010 = {57R19 57N65 57R65 55P10} } @article {Davis-Lueck(2024), AUTHOR = {Davis, James and L\"uck, Wolfgang}, TITLE = {On {N}ielsen realization and manifold models for classifying spaces}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {377}, YEAR = {2024}, NUMBER = {11}, PAGES = {7557--7600}, ISSN = {0002-9947,1088-6850}, MRCLASS = {57S17 (18F25 19Kxx 19Lxx 55R35)}, MRNUMBER = {4806190}, DOI = {10.1090/tran/9155}, URL = {https://doi.org/10.1090/tran/9155}, } @article {Davis-Meier(2002), AUTHOR = {Davis, Michael W. and Meier, John}, TITLE = {The topology at infinity of {C}oxeter groups and buildings}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {77}, YEAR = {2002}, NUMBER = {4}, PAGES = {746--766}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57M07 (20F55 20F69 51E24)}, MRNUMBER = {MR1949112 (2004d:57001)}, MRREVIEWER = {Ross Geoghegan}, } @incollection {Davis-Meier(2003), AUTHOR = {Davis, Michael W. and Meier, John}, TITLE = {Reflection groups and {$\rm CAT(0)$} complexes with exotic local structures}, BOOKTITLE = {High-dimensional manifold topology}, PAGES = {151--158}, PUBLISHER = {World Sci. Publ., River Edge, NJ}, YEAR = {2003}, MRCLASS = {57M07 (20F55)}, MRNUMBER = {MR2048720 (2005c:57002)}, MRREVIEWER = {Thomas Delzant}, } @article {Davis-Meier(2007), AUTHOR = {Davis, Michael W. and Meier, John}, TITLE = {Erratum to: ``{T}he topology at infinity of {C}oxeter groups and buildings'' [{C}omment. {M}ath. {H}elv. {\bf 77} (2002), no. 4, 746--766}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {82}, YEAR = {2007}, NUMBER = {1}, PAGES = {235--236}, ISSN = {0010-2571}, MRCLASS = {57M07 (20F55 20F69 51E24)}, MRNUMBER = {MR2296063 (2007k:57002)}, } @Article{Davis-Milgram(1985), author = {Davis, James F. and Milgram, R.J.}, title = {A survey on the space form problem}, journal = {Math. reports}, volume = 2, pages = {223--283}, year = 1985, } @incollection {Davis-Moussong(1999), AUTHOR = {Davis, M. W. and Moussong, G.}, TITLE = {Notes on nonpositively curved polyhedra}, BOOKTITLE = {Low dimensional topology (Eger, 1996/Budapest, 1998)}, SERIES = {Bolyai Soc. Math. Stud.}, VOLUME = {8}, PAGES = {11--94}, PUBLISHER = {J\'anos Bolyai Math. Soc.}, ADDRESS = {Budapest}, YEAR = {1999}, MRCLASS = {57M60 (20F55 53C23)}, MRNUMBER = {MR1747268 (2001b:57040)}, MRREVIEWER = {Igor Rivin}, } @article {Davis-Okun(2001), AUTHOR = {Davis, Michael W. and Okun, Boris}, TITLE = {Vanishing theorems and conjectures for the {$\ell\sp 2$}-homology of right-angled {C}oxeter groups}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {5}, YEAR = {2001}, PAGES = {7--74 (electronic)}, ISSN = {1465-3060}, MRCLASS = {58J22 (20F55 20F65 20J05 57S30)}, MRNUMBER = {MR1812434 (2002e:58039)}, MRREVIEWER = {Daan Krammer}, } @article {Davis-Okun(2004), AUTHOR = {Davis, Michael W. and Okun, Boris}, TITLE = {{$l\sp 2$}-homology of right-angled {C}oxeter groups based on barycentric subdivisions}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {140}, YEAR = {2004}, NUMBER = {2-3}, PAGES = {197--202}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {20J05 (20F55 20F65 57M07)}, MRNUMBER = {MR2074916 (2005c:20088)}, } @article {Davis-Okun-Zheng(1999), AUTHOR = {Davis, Michael W. and Okun, Boris and Zheng, Fangyang}, TITLE = {Piecewise {E}uclidean structures and {E}berlein's rigidity theorem in the singular case}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry and Topology}, VOLUME = {3}, YEAR = {1999}, PAGES = {303--330 (electronic)}, ISSN = {1465-3060}, MRCLASS = {53C24 (57S30)}, MRNUMBER = {MR1714914 (2000j:53054)}, MRREVIEWER = {Igor Belegradek}, } @article {Davis-Olshanskii(2011), AUTHOR = {Davis, Tara C. and Olshanskii, Alexander Yu.}, TITLE = {Subgroup distortion in wreath products of cyclic groups}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {215}, YEAR = {2011}, NUMBER = {12}, PAGES = {2987--3004}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {20E22 (20F65)}, MRNUMBER = {2811580 (2012e:20065)}, MRREVIEWER = {H. Heineken}, DOI = {10.1016/j.jpaa.2011.04.018}, URL = {http://dx.doi.org/10.1016/j.jpaa.2011.04.018}, } @article {Davis-Pearson(2003), AUTHOR = {Davis, James F. and Pearson, Kimberly}, TITLE = {The {G}romov-{L}awson-{R}osenberg conjecture for cocompact {F}uchsian groups}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {131}, YEAR = {2003}, NUMBER = {11}, PAGES = {3571--3578 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {53C21 (19L41 19L64 57R15)}, MRNUMBER = {MR1991770 (2004f:53039)}, MRREVIEWER = {Paul D. Mitchener}, DOI = {10.1090/S0002-9939-03-06905-3}, URL = {http://dx.doi.org/10.1090/S0002-9939-03-06905-3}, } @article{Davis-Quinn-Reich(2011), author="Davis, James F. and Quinn, Frank and Reich, Holger", title="{Algebraic $K$-theory over the infinite dihedral group: a controlled topology approach.}", language="English", journal="J. Topol.", volume="4", number="3", pages="505-528", year="2011", doi={10.1112/jtopol/jtr009}, abstract="{Summary: We use controlled topology applied to the action of the infinite dihedral group on a partially compactified plane and deduce two consequences for algebraic K-theory. The first is that the family in the $K$-theoretic Farrell-Jones conjecture can be reduced to only those virtually cyclic groups that admit a surjection with finite kernel onto a cyclic group. The second is that the Waldhausen Nil groups for a group that maps epimorphically onto the infinite dihedral group can be computed in terms of the Farrell-Bass Nil groups of the index 2 subgroup that maps surjectively to the infinite cyclic group.}", reviewer="{}", classmath="{19D35 (Negative $K$-theory, NK and Nil) }", } @article{Davis-Weinberger(1986), AUTHOR = {Davis, James F. and Weinberger, Shmuel}, TITLE = {Group actions on homology spheres}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {86}, YEAR = {1986}, NUMBER = {2}, PAGES = {209--231}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57S17 (57R67)}, MRNUMBER = {87k:57031}, MRREVIEWER = {Amir H. Assadi}, } @article{Davis-Weinberger(1996), AUTHOR = {Davis, James F. and Weinberger, Shmuel}, TITLE = {Obstructions to propagation of group actions}, JOURNAL = {Bol. Soc. Mat. Mexicana (3)}, FJOURNAL = {Sociedad Matem\'atica Mexicana. Bolet\'\i n. Tercera Serie}, VOLUME = {2}, YEAR = {1996}, NUMBER = {1}, PAGES = {1--14}, ISSN = {1405-213X}, MRCLASS = {57R67 (57S25)}, MRNUMBER = {97i:57038}, MRREVIEWER = {Ian Hambleton}, } @article {DeBlois-Friedl-Vidussi(2014), AUTHOR = {DeBlois, Jason and Friedl, Stefan and Vidussi, Stefano}, TITLE = {Rank gradients of infinite cyclic covers of 3-manifolds}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {Michigan Mathematical Journal}, VOLUME = {63}, YEAR = {2014}, NUMBER = {1}, PAGES = {65--81}, ISSN = {0026-2285}, MRCLASS = {57N10}, MRNUMBER = {3189468}, } @book {deBoor-Hoellig-Riemenschneider(1993), AUTHOR = {de Boor, C. and H{\"o}llig, K. and Riemenschneider, S.}, TITLE = {Box splines}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1993}, PAGES = {xviii+200}, ISBN = {0-387-94101-0}, MRCLASS = {65-02 (65D07)}, MRNUMBER = {94k:65004}, MRREVIEWER = {Charles K. Chui}, } @article {Concini-Procesi-Salvetti(2004), AUTHOR = {De Concini, C. and Procesi, C. and Salvetti, M.}, TITLE = {On the equation of degree 6}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {79}, YEAR = {2004}, NUMBER = {3}, PAGES = {605--617}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {55R37 (55R80 57M25)}, MRNUMBER = {2081728 (2005e:55021)}, MRREVIEWER = {P. Orlik}, DOI = {10.1007/s00014-004-0809-x}, URL = {http://dx.doi.org/10.1007/s00014-004-0809-x}, } @article {Concini-Procesi-Salvetti(2001), AUTHOR = {De Concini, C. and Procesi, C. and Salvetti, M.}, TITLE = {Arithmetic properties of the cohomology of braid groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {40}, YEAR = {2001}, NUMBER = {4}, PAGES = {739--751}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {20J06 (20F36)}, MRNUMBER = {1851561 (2002f:20082)}, MRREVIEWER = {D. F. Holt}, DOI = {10.1016/S0040-9383(99)00081-6}, URL = {http://dx.doi.org/10.1016/S0040-9383(99)00081-6}, } @article {Concini-Procesi-Salvetti(1999), AUTHOR = {De Concini, Corrado and Procesi, Claudio and Salvetti, Mario and Stumbo, Fabio}, TITLE = {Arithmetic properties of the cohomology of {A}rtin groups}, JOURNAL = {Ann. Scuola Norm. Sup. Pisa Cl. Sci. (4)}, FJOURNAL = {Annali della Scuola Normale Superiore di Pisa. Classe di Scienze. Serie IV}, VOLUME = {28}, YEAR = {1999}, NUMBER = {4}, PAGES = {695--717}, ISSN = {0391-173X}, CODEN = {PSNAAI}, MRCLASS = {20F36 (20J06)}, MRNUMBER = {1760537 (2001f:20078)}, MRREVIEWER = {Stephen P. Humphries}, URL = {http://www.numdam.org/item?id=ASNSP_1999_4_28_4_695_0}, } @article{DeGeorge-Wallach(1978), AUTHOR = {de George, David L. and Wallach, Nolan R.}, TITLE = {Limit formulas for multiplicities in ${L}\sp{2}(\Gamma \backslash {G})$}, JOURNAL = {Ann. Math. (2)}, VOLUME = {107}, YEAR = {1978}, NUMBER = {1}, PAGES = {133--150}, MRCLASS = {22E45 (58G99)}, MRNUMBER = {58 \#11231}, MRREVIEWER = {J. J. Duistermaat}, } @article{DeGeorge-Wallach(1979), AUTHOR = {DeGeorge, David L. and Wallach, Nolan R.}, TITLE = {Limit formulas for multiplicities in ${L}\sp{2}(\Gamma \backslash {G})$. {I}{I}. {T}he tempered spectrum}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {109}, YEAR = {1979}, NUMBER = {3}, PAGES = {477--495}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {22E30 (43A85 43A90)}, MRNUMBER = {81g:22010}, MRREVIEWER = {J. A. C. Kolk}, } @article {Degrijse(2013), AUTHOR = {Degrijse, Dieter}, TITLE = {On a filtration of the second cohomology of nilpotent {L}ie algebras}, JOURNAL = {J. Lie Theory}, FJOURNAL = {Journal of Lie Theory}, VOLUME = {23}, YEAR = {2013}, NUMBER = {2}, PAGES = {551--573}, ISSN = {0949-5932}, MRCLASS = {17B56 (17B30)}, MRNUMBER = {3113522}, MRREVIEWER = {Jos{\'e} Mar{\'{\i}}a Ancochea Berm{\'u}dez}, } @article {Degrijse-Hausmann-Lueck-Patchkoria-Schwede(2023), AUTHOR = {Degrijse, Dieter and Hausmann, Markus and L\"uck, Wolfgang and Patchkoria, Irakli and Schwede, Stefan}, TITLE = {Proper {E}quivariant {S}table {H}omotopy {T}heory}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {288}, YEAR = {2023}, NUMBER = {1432}, ISSN = {0065-9266,1947-6221}, ISBN = {978-1-4704-6704-3; 978-1-4704-7574-1}, MRCLASS = {55P91}, MRNUMBER = {4627088}, DOI = {10.1090/memo/1432}, URL = {https://doi.org/10.1090/memo/1432}, } @article {Degrijse-Koehl-Petrosyan(2015), AUTHOR = {Degrijse, D. and K{\"o}hl, R. and Petrosyan, N.}, TITLE = {Classifying spaces with virtually cyclic stabilizers for linear groups}, JOURNAL = {Transform. Groups}, FJOURNAL = {Transformation Groups}, VOLUME = {20}, YEAR = {2015}, NUMBER = {2}, PAGES = {381--394}, ISSN = {1083-4362}, MRCLASS = {20Jxx (20Gxx)}, MRNUMBER = {3348560}, DOI = {10.1007/s00031-015-9307-z}, URL = {http://dx.doi.org/10.1007/s00031-015-9307-z}, } @article {Degrijse-Petrosyan(2014), AUTHOR = {Degrijse, Dieter and Petrosyan, Nansen}, TITLE = {Geometric dimension of groups for the family of virtually cyclic subgroups}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {7}, YEAR = {2014}, NUMBER = {3}, PAGES = {697--726}, ISSN = {1753-8416}, MRCLASS = {20F65}, MRNUMBER = {3252961}, MRREVIEWER = {Aditi Kar}, DOI = {10.1112/jtopol/jtt045}, URL = {http://dx.doi.org/10.1112/jtopol/jtt045}, } @article {Degrijse-Martinez-Peres(2016), AUTHOR = {Degrijse, Dieter and Mart\'{\i}nez-P\'{e}rez, Conchita}, TITLE = {Dimension invariants for groups admitting a cocompact model for proper actions}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"{u}r die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {721}, YEAR = {2016}, PAGES = {233--249}, ISSN = {0075-4102}, MRCLASS = {55R35 (20F65 20J05)}, MRNUMBER = {3574882}, MRREVIEWER = {Ram\'{o}n J. Flores}, DOI = {10.1515/crelle-2014-0061}, URL = {https://doi.org/10.1515/crelle-2014-0061}, } @article {Degrijse-Petrosyan(2015), AUTHOR = {Degrijse, Dieter and Petrosyan, Nansen}, TITLE = {Bredon cohomological dimensions for groups acting on {$\rm CAT(0)$}-spaces}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {9}, YEAR = {2015}, NUMBER = {4}, PAGES = {1231--1265}, ISSN = {1661-7207,1661-7215}, MRCLASS = {20J06 (20F34 20F65 20F67 20H20)}, MRNUMBER = {3428413}, MRREVIEWER = {Conchita\ Mart\'{\i}nez-P\'{e}rez}, DOI = {10.4171/GGD/339}, URL = {https://doi.org/10.4171/GGD/339}, } @article {Degrijse-Petrosyan(2013), AUTHOR = {Degrijse, Dieter and Petrosyan, Nansen}, TITLE = {Commensurators and classifying spaces with virtually cyclic stabilizers}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {7}, YEAR = {2013}, NUMBER = {3}, PAGES = {543--555}, ISSN = {1661-7207}, MRCLASS = {55R35 (20F65 43A10)}, MRNUMBER = {3095708}, DOI = {10.4171/GGD/196}, URL = {http://dx.doi.org/10.4171/GGD/196}, } @article {Degrijse-Petrosyan(2012), AUTHOR = {Degrijse, Dieter and Petrosyan, Nansen}, TITLE = {On the cohomology of split {L}ie algebra extensions}, JOURNAL = {J. Lie Theory}, FJOURNAL = {Journal of Lie Theory}, VOLUME = {22}, YEAR = {2012}, NUMBER = {1}, PAGES = {1--15}, ISSN = {0949-5932}, MRCLASS = {17B56}, MRNUMBER = {2859025}, MRREVIEWER = {Rosa Mar{\'{\i}}a Navarro}, } @article {Degrijse-Petrosyan(2011), AUTHOR = {Degrijse, Dieter and Petrosyan, Nansen}, TITLE = {Characteristic classes for cohomology of split {H}opf algebra extensions}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {332}, YEAR = {2011}, PAGES = {366--385}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16T05 (16E40 17B56 18G40 20J06)}, MRNUMBER = {2774692 (2012e:16077)}, MRREVIEWER = {Guillermo Corti{\~n}as}, DOI = {10.1016/j.jalgebra.2011.01.018}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2011.01.018}, } @book {Dehorny-Dynnikov-Rolfsen-Wiest(2008), AUTHOR = {Dehornoy, Patrick and Dynnikov, Ivan and Rolfsen, Dale and Wiest, Bert}, TITLE = {Ordering braids}, SERIES = {Mathematical Surveys and Monographs}, VOLUME = {148}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {2008}, PAGES = {x+323}, ISBN = {978-0-8218-4431-1}, MRCLASS = {20F36 (06F15 20F60 20M05 57M60)}, MRNUMBER = {2463428 (2009j:20046)}, MRREVIEWER = {Stephen P. Humphries}, } @book {de_la_Harpe(1972), AUTHOR = {de la Harpe, Pierre}, TITLE = {Classical {B}anach-{L}ie algebras and {B}anach-{L}ie groups of operators in {H}ilbert space}, SERIES = {Lecture Notes in Mathematics, Vol. 285}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1972}, PAGES = {iii+160}, MRCLASS = {17B65 (22E65 46H99 47D99)}, MRNUMBER = {0476820 (57 \#16372)}, MRREVIEWER = {Raymond Streater}, } @article {delaHarpe(1988), AUTHOR = {de la Harpe, Pierre}, TITLE = {Groupes hyperboliques, alg\`ebres d'op\'erateurs et un th\'eor\`eme de {J}olissaint}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus des S\'eances de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {307}, YEAR = {1988}, NUMBER = {14}, PAGES = {771--774}, ISSN = {0249-6291}, CODEN = {CASMEI}, MRCLASS = {22D25 (20F38 22E40 46L80 58G12)}, MRNUMBER = {90d:22005}, MRREVIEWER = {Alain Valette}, } @book {delaHarpe(2000), AUTHOR = {de la Harpe, Pierre}, TITLE = {Topics in geometric group theory}, PUBLISHER = {University of Chicago Press}, ADDRESS = {Chicago, IL}, YEAR = {2000}, PAGES = {vi+310}, ISBN = {0-226-31719-6; 0-226-31721-8}, MRCLASS = {20F65 (20F69 57M07)}, MRNUMBER = {2001i:20081}, MRREVIEWER = {Lee Mosher}, } @incollection {deRham(1964), AUTHOR = {de Rham, G.}, TITLE = {Reidemeister's torsion invariant and rotations of ${S}\sp n$}, BOOKTITLE = {Differential Analysis, Bombay Colloq.}, PAGES = {27--36}, PUBLISHER = {Oxford Univ. Press}, ADDRESS = {London}, YEAR = {1964}, MRCLASS = {57.47}, MRNUMBER = {32 \#8355}, MRREVIEWER = {A. Haefliger}, } @book {deRham(1984), AUTHOR = {de Rham, Georges}, TITLE = {Differentiable manifolds}, NOTE = {Forms, currents, harmonic forms, Translated from the French by F. R. Smith, With an introduction by S. S. Chern}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1984}, PAGES = {x+167}, ISBN = {3-540-13463-8}, MRCLASS = {58A14 (55N99 58-01)}, MRNUMBER = {85m:58005}, } @book{DeVore-Lorentz(1993), AUTHOR = {DeVore, Ronald A. and Lorentz, George G.}, TITLE = {Constructive approximation}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1993}, PAGES = {x+449}, ISBN = {3-540-50627-6}, MRCLASS = {41-02 (41A10 41A15 41A35 41A36 42A10)}, MRNUMBER = {95f:41001}, MRREVIEWER = {V. Totik}, } @article{Deitmar(1995a), AUTHOR = {Deitmar, Anton}, TITLE = {Higher torsion zeta functions}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {110}, YEAR = {1995}, NUMBER = {1}, PAGES = {109--128}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {58G26 (57Q10)}, MRNUMBER = {96a:58205}, MRREVIEWER = {Alexander Fel{\cprime}shtyn}, } @article{Deitmar(1996), AUTHOR = {Deitmar, Anton}, TITLE = {Product expansions for zeta functions attached to locally symmetric spaces of higher rank}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {82}, YEAR = {1996}, NUMBER = {1}, PAGES = {71--90}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {58G26 (58F20)}, MRNUMBER = {97e:58227}, MRREVIEWER = {Alexander Fel{\cprime}shtyn}, } @article{Deitmar(1996a), AUTHOR = {Deitmar, Anton}, TITLE = {A determinant formula for the generalized {S}elberg zeta function}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {47}, YEAR = {1996}, NUMBER = {188}, PAGES = {435--453}, ISSN = {0033-5606}, CODEN = {QJMAAT}, MRCLASS = {11M36 (11F72)}, MRNUMBER = {98i:11069}, MRREVIEWER = {Shin-ya Koyama}, } @article{Deitmar(1996b), AUTHOR = {Deitmar, Anton}, TITLE = {Torus actions on compact quotients}, JOURNAL = {J. Lie Theory}, FJOURNAL = {Journal of Lie Theory}, VOLUME = {6}, YEAR = {1996}, NUMBER = {2}, PAGES = {179--190}, ISSN = {0949-5932}, MRCLASS = {22E41 (22E40 57S20)}, MRNUMBER = {98m:22015}, } @article{Deitmar(1997a), AUTHOR = {Deitmar, Anton}, TITLE = {A {L}efschetz formula for flows}, JOURNAL = {Math. Res. Lett.}, FJOURNAL = {Mathematical Research Letters}, VOLUME = {4}, YEAR = {1997}, NUMBER = {4}, PAGES = {513--520}, ISSN = {1073-2780}, MRCLASS = {58F20 (58G26)}, MRNUMBER = {98m:58108}, MRREVIEWER = {Alexander Fel{\cprime}shtyn}, } @article{Deitmar(1997b), AUTHOR = {Deitmar, Anton}, TITLE = {On the index of {D}irac operators on arithmetic quotients}, JOURNAL = {Bull. Austral. Math. Soc.}, FJOURNAL = {Bulletin of the Australian Mathematical Society}, VOLUME = {56}, YEAR = {1997}, NUMBER = {3}, PAGES = {489--497}, ISSN = {0004-9727}, CODEN = {ALNBAB}, MRCLASS = {58G10 (11F72 22E40)}, MRNUMBER = {99c:58148}, MRREVIEWER = {Shin-ya Koyama}, } @article{Deitmar(1998a), AUTHOR = {Deitmar, Anton}, TITLE = {Regularized and ${L}\sp 2$-determinants}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {76}, YEAR = {1998}, NUMBER = {1}, PAGES = {150--174}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {58G26}, MRNUMBER = {98m:58143}, MRREVIEWER = {Steven Rosenberg}, } @article{Deitmar(1998b), AUTHOR = {Deitmar, Anton}, TITLE = {Geometric zeta-functions on $p$-adic groups}, JOURNAL = {Math. Japon.}, FJOURNAL = {Mathematica Japonica}, VOLUME = {47}, YEAR = {1998}, NUMBER = {1}, PAGES = {1--17}, ISSN = {0025-5513}, CODEN = {MAJAA9}, MRCLASS = {11S40 (11F72 11F75 11M36 22E40)}, MRNUMBER = {98m:11130}, MRREVIEWER = {W. A. Z{\'u}\~{n}iga Galindo}, } @article{Deitmar(1998c), AUTHOR = {Deitmar, Anton}, TITLE = {Equivariant torsion of locally symmetric spaces}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {182}, YEAR = {1998}, NUMBER = {2}, PAGES = {205--227}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {58G26}, MRNUMBER = {99i:58153}, MRREVIEWER = {Alexander Fel{\cprime}shtyn}, } @article {Deitmar(1998d), AUTHOR = {Deitmar, Anton}, TITLE = {Erratum to: ``{G}eometric zeta functions on $p$-adic groups'' [{M}ath.\ {J}apon.\ {\bf 47} (1998), no. 1, 1--17; {M}{R} 98m:11130]}, JOURNAL = {Math. Japon.}, FJOURNAL = {Mathematica Japonica}, VOLUME = {48}, YEAR = {1998}, NUMBER = {1}, PAGES = {91}, ISSN = {0025-5513}, CODEN = {MAJAA9}, MRCLASS = {11S40 (11F72 11F75 11M36 22E40)}, MRNUMBER = {99f:11153}, } @article {Deitmar+Deninger(2003), AUTHOR = {Deitmar, Anton and Deninger, Chistopher}, TITLE = {A dynamical {L}efschetz trace formula for algebraic {A}nosov diffeomorphisms}, JOURNAL = {Abh. Math. Sem. Univ. Hamburg}, FJOURNAL = {Abhandlungen aus dem Mathematischen Seminar der Universit\"at Hamburg}, VOLUME = {73}, YEAR = {2003}, PAGES = {81--98}, ISSN = {0025-5858}, CODEN = {AMHAAJ}, MRCLASS = {37D20 (37C27 58J50)}, MRNUMBER = {MR2028508 (2004j:37046)}, MRREVIEWER = {Yuri A. Kordyukov}, } @article{Dekimpe-Igodt(1997), AUTHOR = {Dekimpe, Karel and Igodt, Paul}, TITLE = {Polycyclic-by-finite groups admit a bounded-degree polynomial structure}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {129}, YEAR = {1997}, NUMBER = {1}, PAGES = {121--140}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20H15 (20F16 57S30)}, MRNUMBER = {99c:20071}, MRREVIEWER = {Daniel Segal}, } @article{Dekimpe-Igoldt-Lee(1996), AUTHOR = {Dekimpe, Karel and Igodt, Paul and Lee, Kyung Bai}, TITLE = {Polynomial structures for nilpotent groups}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {348}, YEAR = {1996}, NUMBER = {1}, PAGES = {77--97}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {20F18 (20H15 22E40 57S99)}, MRNUMBER = {96e:20051}, MRREVIEWER = {Michel Nguiffo B. Boyom}, } @incollection {Deligne(1987), AUTHOR = {Deligne, P.}, TITLE = {Le d\'eterminant de la cohomologie}, BOOKTITLE = {Current trends in arithmetical algebraic geometry (Arcata, Calif., 1985)}, PAGES = {93--177}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1987}, MRCLASS = {32L10 (11G25 14F12 14H99 32G13 58G11)}, MRNUMBER = {89b:32038}, MRREVIEWER = {Daniel S. Freed}, } @article {Deligne(1978), AUTHOR = {Deligne, Pierre}, TITLE = {Extensions centrales non r\'{e}siduellement finies de groupes arithm\'{e}tiques}, JOURNAL = {C. R. Acad. Sci. Paris S\'{e}r. A-B}, FJOURNAL = {Comptes Rendus Hebdomadaires des S\'{e}ances de l'Acad\'{e}mie des Sciences. S\'{e}ries A et B}, VOLUME = {287}, YEAR = {1978}, NUMBER = {4}, PAGES = {A203--A208}, ISSN = {0151-0509}, MRCLASS = {20G35 (22E45)}, MRNUMBER = {507760}, MRREVIEWER = {James E. Humphreys}, } @article{Deligne-Griffith-Morgan-Sullivan(1975), AUTHOR = {Deligne, Pierre and Griffiths, Phillip and Morgan, John and Sullivan, Dennis}, TITLE = {Real homotopy theory of {K}\"ahler manifolds}, JOURNAL = {Invent. Math.}, VOLUME = {29}, YEAR = {1975}, NUMBER = {3}, PAGES = {245--274}, MRCLASS = {32C10 (57D15)}, MRNUMBER = {52 \#3584}, MRREVIEWER = {M. F. Atiyah}, } @article{Deligne-Lusztig(1976), AUTHOR = {Deligne, P. and Lusztig, G.}, TITLE = {Representations of reductive groups over finite fields}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {103}, YEAR = {1976}, NUMBER = {1}, PAGES = {103--161}, MRCLASS = {20G05 (14M15)}, MRNUMBER = {52 \#14076}, MRREVIEWER = {S. I. Gelfand}, } @article {Deligne-Mostow(1986), AUTHOR = {Deligne, P. and Mostow, G. D.}, TITLE = {Monodromy of hypergeometric functions and nonlattice integral monodromy}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {63}, YEAR = {1986}, PAGES = {5--89}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {22E40 (32G20 33A30)}, MRNUMBER = {849651 (88a:22023a)}, MRREVIEWER = {Shigeaki Tsuyumine}, URL = {http://www.numdam.org/item?id=PMIHES_1986__63__5_0}, } @article{Delzant(1997), AUTHOR = {Delzant, Thomas}, TITLE = {Sur l'anneau d'un groupe hyperbolique}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {324}, YEAR = {1997}, NUMBER = {4}, PAGES = {381--384}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {20F32 (20C07)}, MRNUMBER = {97k:20063}, } @article{Deninger(1989), AUTHOR = {Deninger, Christopher}, TITLE = {Higher regulators and {H}ecke ${L}$-series of imaginary quadratic fields. {I}}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {96}, YEAR = {1989}, NUMBER = {1}, PAGES = {1--69}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11G40 (11R42 11R70 14G10 19F27)}, MRNUMBER = {90f:11041}, MRREVIEWER = {James Milne}, } @article{Deninger(1990), AUTHOR = {Deninger, Christopher}, TITLE = {Higher regulators and {H}ecke ${L}$-series of imaginary quadratic fields. {I}{I}}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {132}, YEAR = {1990}, NUMBER = {1}, PAGES = {131--158}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {19F27 (11G09 11G40 11R42 11R70)}, MRNUMBER = {91i:19003}, MRREVIEWER = {James Milne}, } @article{Deninger(1991), AUTHOR = {Deninger, Christopher}, TITLE = {On the $\Gamma$-factors attached to motives}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {104}, YEAR = {1991}, NUMBER = {2}, PAGES = {245--261}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11G40 (11G09 11G35 14F30 14G10 14G25)}, MRNUMBER = {92i:11065}, MRREVIEWER = {Dorian Goldfeld}, } @article{Deninger(1992), AUTHOR = {Deninger, Christopher}, TITLE = {Local ${L}$-factors of motives and regularized determinants}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {107}, YEAR = {1992}, NUMBER = {1}, PAGES = {135--150}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11G40 (11G09 14F20 58G26)}, MRNUMBER = {93a:11056}, MRREVIEWER = {Min Ho Lee}, } @article{Deninger(1993), AUTHOR = {Deninger, Christopher}, TITLE = {Lefschetz trace formulas and explicit formulas in analytic number theory}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {441}, YEAR = {1993}, PAGES = {1--15}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {11M36 (11G40 11R42)}, MRNUMBER = {95d:11110}, MRREVIEWER = {V. Kumar Murty}, } @incollection {Deninger(1994), AUTHOR = {Deninger, Christopher}, TITLE = {Motivic ${L}$-functions and regularized determinants}, BOOKTITLE = {Motives (Seattle, WA, 1991)}, PAGES = {707--743}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1994}, MRCLASS = {11G40 (11G09 11G35 14G10)}, MRNUMBER = {94m:11077}, MRREVIEWER = {Henri Darmon}, } @incollection {Deninger(1994z), AUTHOR = {Deninger, Christopher}, TITLE = {Evidence for a cohomological approach to analytic number theory}, BOOKTITLE = {First European Congress of Mathematics, Vol.\ I (Paris, 1992)}, PAGES = {491--510}, PUBLISHER = {Birkh\"auser}, ADDRESS = {Basel}, YEAR = {1994}, MRCLASS = {11M36 (11G40 11M41 14G10)}, MRNUMBER = {96m:11075}, MRREVIEWER = {Ze-Li Dou}, } @article{Deninger(1995), AUTHOR = {Deninger, Christopher}, TITLE = {Higher order operations in {D}eligne cohomology}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {120}, YEAR = {1995}, NUMBER = {2}, PAGES = {289--315}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11G40 (11G05 14F99)}, MRNUMBER = {96f:11085}, MRREVIEWER = {H{\'e}l{\`e}ne Esnault}, } @article{Deninger(1997a), AUTHOR = {Deninger, Christopher}, TITLE = {Deligne periods of mixed motives, ${K}$-theory and the entropy of certain ${\mathbb{Z}}\sp n$-actions}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {10}, YEAR = {1997}, NUMBER = {2}, PAGES = {259--281}, ISSN = {0894-0347}, MRCLASS = {11G40 (19E08 19F27 28D20)}, MRNUMBER = {97k:11101}, MRREVIEWER = {Jan Nekov{\'a}{\v{r}}}, } @inproceedings {Deninger(1998), AUTHOR = {Deninger, Christopher}, TITLE = {Some analogies between number theory and dynamical systems on foliated spaces}, BOOKTITLE = {Proceedings of the {I}nternational {C}ongress of {M}athematicians, {V}ol. {I} ({B}erlin, 1998)}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, YEAR = {1998}, VOLUME = {Extra Vol. I}, PAGES = {163--186 (electronic)}, ISSN = {1431-0635}, MRCLASS = {11G40 (11M36 14G10 58F18)}, MRNUMBER = {MR1648030 (99g:11084)}, MRREVIEWER = {Jan Nekov{\'a}{\v{r}}}, } @incollection {Deninger(2000), AUTHOR = {Deninger, Christopher}, TITLE = {On dynamical systems and their possible significance for arithmetic geometry}, BOOKTITLE = {Regulators in analysis, geometry and number theory}, SERIES = {Progr. Math.}, VOLUME = {171}, PAGES = {29--87}, PUBLISHER = {Birkh\"auser Boston}, ADDRESS = {Boston, MA}, YEAR = {2000}, MRCLASS = {11G40 (11G35 14G40 37A45)}, MRNUMBER = {MR1724887 (2001g:11102)}, MRREVIEWER = {Ze-Li Dou}, } @article {Deninger(2001), AUTHOR = {Deninger, Christopher}, TITLE = {Number theory and dynamical systems on foliated spaces}, JOURNAL = {Jahresber. Deutsch. Math.-Verein.}, FJOURNAL = {Jahresbericht der Deutschen Mathematiker-Vereinigung}, VOLUME = {103}, YEAR = {2001}, NUMBER = {3}, PAGES = {79--100}, ISSN = {0012-0456}, CODEN = {JDMVA7}, MRCLASS = {58J42 (11G40 11M36 11R42 37C27 58J22)}, MRNUMBER = {MR1873325 (2003d:58041)}, MRREVIEWER = {Matilde Marcolli}, } @incollection {Deninger(2002nature), AUTHOR = {Deninger, Christopher}, TITLE = {On the nature of the ``explicit formulas'' in analytic number theory---a simple example}, BOOKTITLE = {Number theoretic methods ({I}izuka, 2001)}, SERIES = {Dev. Math.}, VOLUME = {8}, PAGES = {97--118}, PUBLISHER = {Kluwer Acad. Publ.}, ADDRESS = {Dordrecht}, YEAR = {2002}, MRCLASS = {11M36 (11M38 14H52 58J22)}, MRNUMBER = {MR1974137 (2004f:11093)}, MRREVIEWER = {Matilde Marcolli}, } @incollection {Deninger(2002note), AUTHOR = {Deninger, Christopher}, TITLE = {A note on arithmetic topology and dynamical systems}, BOOKTITLE = {Algebraic number theory and algebraic geometry}, SERIES = {Contemp. Math.}, VOLUME = {300}, PAGES = {99--114}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2002}, MRCLASS = {14F20 (11F23 37C25 37C27)}, MRNUMBER = {MR1936368 (2004c:14030)}, MRREVIEWER = {Matilde Marcolli}, } @article {Deninger(2006Fuglentramen), AUTHOR = {Deninger, Christopher}, TITLE = {Fuglede-{K}adison determinants and entropy for actions of discrete amenable groups}, JOURNAL = {J. Amer. Math. Soc.}, FJOURNAL = {Journal of the American Mathematical Society}, VOLUME = {19}, YEAR = {2006}, NUMBER = {3}, PAGES = {737--758 (electronic)}, ISSN = {0894-0347}, MRCLASS = {37A35 (22D25 37B40 43A07 46L55)}, MRNUMBER = {MR2220105 (2007b:37010)}, MRREVIEWER = {Thomas Ward}, DOI = {10.1090/S0894-0347-06-00519-4}, URL = {http://dx.doi.org/10.1090/S0894-0347-06-00519-4}, } @incollection{Deninger(2008), author = {Deninger, Christopher}, title = {Analogies between analysis on foliated spaces and arithmetic geometry}, booktitle = {Groups and {A}nalysis: {T}he {L}egacy of {H}ermann {W}eyl}, publisher = {Cambridge University Press}, number = {354}, series = {LMS Lecture Note Series}, pages = {174--190}, year = {2008}, } @article {Deninger(2009Mahler), AUTHOR = {Deninger, Christopher}, TITLE = {Mahler measures and {F}uglede-{K}adison determinants}, JOURNAL = {M\"unster J. Math.}, FJOURNAL = {M\"unster Journal of Mathematics}, VOLUME = {2}, YEAR = {2009}, PAGES = {45--63}, ISSN = {1867-5778}, MRCLASS = {37Axx (11Rxx 28D20)}, MRNUMBER = {MR2545607}, } @incollection {Deninger(2009entropy), AUTHOR = {Deninger, Christopher}, TITLE = {{$p$}-adic entropy and a {$p$}-adic {F}uglede-{K}adison determinant}, BOOKTITLE = {Algebra, arithmetic, and geometry: in honor of {Y}u. {I}. {M}anin. {V}ol. {I}}, SERIES = {Progr. Math.}, VOLUME = {269}, PAGES = {423--442}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {2009}, MRCLASS = {37P35 (11R06 11S82 37A35 37C85 37P20)}, MRNUMBER = {2641178 (2011k:37143)}, MRREVIEWER = {Thomas Ward}, DOI = {10.1007/978-0-8176-4745-2_10}, URL = {http://dx.doi.org/10.1007/978-0-8176-4745-2_10}, } @article {Deninger(2011), AUTHOR = {Deninger, Christopher}, TITLE = {Determinants on von {N}eumann algebras, {M}ahler measures and {L}japunov exponents}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {651}, YEAR = {2011}, PAGES = {165--185}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {46L10 (11R06 37A35 47C15)}, MRNUMBER = {2774314 (2012g:46087)}, MRREVIEWER = {Fyodor A. Sukochev}, DOI = {10.1515/CRELLE.2011.012}, URL = {http://dx.doi.org/10.1515/CRELLE.2011.012}, } @incollection {Deninger(2012), AUTHOR = {Deninger, Christopher}, TITLE = {Regulators, entropy and infinite determinants}, BOOKTITLE = {Regulators}, SERIES = {Contemp. Math.}, VOLUME = {571}, PAGES = {117--134}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2012}, MRCLASS = {19F27 (11G40 11M36 11R06 46L10)}, MRNUMBER = {2953411}, MRREVIEWER = {Thomas Ward}, DOI = {10.1090/conm/571/11324}, URL = {http://dx.doi.org/10.1090/conm/571/11324}, } @article {Deninger-Schmidt(2007), AUTHOR = {Deninger, Christopher and Schmidt, Klaus}, TITLE = {Expansive algebraic actions of discrete residually finite amenable groups and their entropy}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {27}, YEAR = {2007}, NUMBER = {3}, PAGES = {769--786}, ISSN = {0143-3857}, MRCLASS = {37A35 (37B40)}, MRNUMBER = {MR2322178 (2008d:37009)}, MRREVIEWER = {A. I. Danilenko}, DOI = {10.1017/S0143385706000939}, URL = {http://dx.doi.org/10.1017/S0143385706000939}, } @article {Deninger+Singhoff(2002), AUTHOR = {Deninger, Christopher and Singhof, Wilhelm}, TITLE = {Real polarizable {H}odge structures arising from foliations}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {21}, YEAR = {2002}, NUMBER = {4}, PAGES = {377--399}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {32J25 (53C12 58J10)}, MRNUMBER = {MR1910458 (2003e:32035)}, MRREVIEWER = {Jes{\'u}s A. {\'A}lvarez L{\'o}pez}, } @incollection {Deninger+Singhoff(2001), AUTHOR = {Deninger, Christopher and Singhof, Wilhelm}, TITLE = {A note on dynamical trace formulas}, BOOKTITLE = {Dynamical, spectral, and arithmetic zeta functions ({S}an {A}ntonio, {TX}, 1999)}, SERIES = {Contemp. Math.}, VOLUME = {290}, PAGES = {41--55}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2001}, MRCLASS = {58J35 (37C30 53C12 58J20 58J47)}, MRNUMBER = {MR1868467 (2002k:58054)}, MRREVIEWER = {Jes{\'u}s A. {\'A}lvarez L{\'o}pez}, } @article {Deninger+Schmidt(2007), AUTHOR = {Deninger, Christopher and Schmidt, Klaus}, TITLE = {Expansive algebraic actions of discrete residually finite amenable groups and their entropy}, JOURNAL = {Ergodic Theory Dynam. Systems}, FJOURNAL = {Ergodic Theory and Dynamical Systems}, VOLUME = {27}, YEAR = {2007}, NUMBER = {3}, PAGES = {769--786}, ISSN = {0143-3857}, MRCLASS = {37A35 (37B40)}, MRNUMBER = {MR2322178 (2008d:37009)}, MRREVIEWER = {A. I. Danilenko}, } @article {Deninger+Werner(2005), AUTHOR = {Deninger, Christopher and Werner, Annette}, TITLE = {Vector bundles on {$p$}-adic curves and parallel transport}, JOURNAL = {Ann. Sci. \'Ecole Norm. Sup. (4)}, FJOURNAL = {Annales Scientifiques de l'\'Ecole Normale Sup\'erieure. Quatri\`eme S\'erie}, VOLUME = {38}, YEAR = {2005}, NUMBER = {4}, PAGES = {553--597}, ISSN = {0012-9593}, CODEN = {ASENAH}, MRCLASS = {14G20 (14F05 14H60)}, MRNUMBER = {MR2172951 (2007b:14043)}, MRREVIEWER = {Frank Herrlich}, } @incollection {Deninger+Werner(2007), AUTHOR = {Deninger, Christopher and Werner, Annette}, TITLE = {On {T}annaka duality for vector bundles on {$p$}-adic curves}, BOOKTITLE = {Algebraic cycles and motives. {V}ol. 2}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {344}, PAGES = {94--111}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {2007}, MRCLASS = {14G20 (14H60 18D10)}, MRNUMBER = {MR2187151 (2008m:14041)}, MRREVIEWER = {Alessandra Bertapelle}, } @proceedings {Dennis(1982AlgKI), TITLE = {Algebraic {$K$}-theory. {P}art {I}}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {966}, BOOKTITLE = {Proceedings of a {C}onference held in {O}berwolfach, {J}une 16--20, 1980}, EDITOR = {Dennis, R. Keith}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1982}, PAGES = {viii+407}, ISBN = {3-540-11965-5}, MRCLASS = {18-06 (16-06 16A54 18F25)}, MRNUMBER = {MR689363 (84a:18001a)}, } @proceedings {Dennis(1982AlgKII), TITLE = {Algebraic {$K$}-theory. {P}art {II}}, SERIES = {Lecture Notes in Mathematics}, VOLUME = {967}, BOOKTITLE = {Proceedings of a {C}onference held at {O}berwolfach, {J}une 16--20, 1980}, EDITOR = {Dennis, R. Keith}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1982}, PAGES = {viii+409}, ISBN = {3-540-11966-3}, MRCLASS = {18-06 (16-06 16A54 18F25)}, MRNUMBER = {MR689386 (84a:18001b)}, } @incollection {Dennis(1977), AUTHOR = {Dennis, R. Keith}, TITLE = {The structure of the unit group of group rings}, BOOKTITLE = {Ring theory, {II} ({P}roc. {S}econd {C}onf., {U}niv. {O}klahoma, {N}orman, {O}kla., 1975)}, PAGES = {103--130. Lecture Notes in Pure and Appl. Math., Vol. 26}, PUBLISHER = {Dekker}, ADDRESS = {New York}, YEAR = {1977}, MRCLASS = {16A26}, MRNUMBER = {MR0444697 (56 \#3047)}, MRREVIEWER = {S. K. Sehgal}, } @article {Dennis(1976), AUTHOR = {Dennis, R. Keith}, TITLE = {Units of group rings}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {43}, YEAR = {1976}, NUMBER = {2}, PAGES = {655--664}, ISSN = {0021-8693}, MRCLASS = {20C05}, MRNUMBER = {MR0424914 (54 \#12872)}, MRREVIEWER = {S. Yuan}, } @article {Dennis(1975), AUTHOR = {Dennis, R. Keith}, TITLE = {The {$GE_{2}$} property for discrete subrings of {${\bf C}$}}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {50}, YEAR = {1975}, PAGES = {77--82}, ISSN = {0002-9939}, MRCLASS = {20G20 (12A25)}, MRNUMBER = {MR0376891 (51 \#13066)}, MRREVIEWER = {Bruno Harris}, } @inproceedings {Dennis(1973), AUTHOR = {Dennis, R. Keith}, TITLE = {Stability for {$K_{2}$}}, BOOKTITLE = {Proceedings of the {C}onference on {O}rders, {G}roup {R}ings and {R}elated {T}opics ({O}hio {S}tate {U}niv., {C}olumbus, {O}hio, 1972)}, PAGES = {85--94. Lecture Notes in Math., Vol. 353}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1973}, MRCLASS = {16A42}, MRNUMBER = {MR0347892 (50 \#393)}, MRREVIEWER = {J.-P. Lafon}, } @article {Dennis-Geller(1976), AUTHOR = {Dennis, R. Keith and Geller, Susan C.}, TITLE = {{$K_{i}$} of upper triangular matrix rings}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {56}, YEAR = {1976}, PAGES = {73--78}, ISSN = {0002-9939}, MRCLASS = {18F25}, MRNUMBER = {MR0404392 (53 \#8194)}, MRREVIEWER = {Jean-Louis Loday}, } @incollection {Denis-Igusa(1982), AUTHOR = {Dennis, R. Keith and Igusa, Kiyoshi}, TITLE = {Hochschild homology and the second obstruction for pseudoisotopy}, BOOKTITLE = {Algebraic {$K$}-theory, {P}art {I} ({O}berwolfach, 1980)}, SERIES = {Lecture Notes in Math.}, VOLUME = {966}, PAGES = {7--58}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1982}, MRCLASS = {18F25 (57R52)}, MRNUMBER = {MR689365 (84m:18014)}, MRREVIEWER = {Jean-Louis Loday}, } @article{Dennis-Keating-Stein(1976), AUTHOR = {Dennis, R. Keith and Keating, Michael E. and Stein, Michael R.}, TITLE = {Lower bounds for the order of ${K}\sb{2}({\mathbb{{Z}}}{G})$ and ${W}h\sb{2}({G})$}, JOURNAL = {Math. Ann.}, VOLUME = {223}, YEAR = {1976}, NUMBER = {2}, PAGES = {97--103}, MRCLASS = {12A80 (57D60 18F25)}, MRNUMBER = {54 \#279}, MRREVIEWER = {A. Dress}, } @article {Dennis-Kruesmeyer(1979), AUTHOR = {Dennis, R. Keith and Krusemeyer, Mark I.}, TITLE = {{$K_{2}(A[X,\,Y]/XY)$}, a problem of {S}wan, and related computations}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {15}, YEAR = {1979}, NUMBER = {2}, PAGES = {125--148}, ISSN = {0022-4049}, MRCLASS = {18F25 (14F05)}, MRNUMBER = {MR535181 (80j:18018)}, MRREVIEWER = {A. A. Ranicki}, DOI = {10.1016/0022-4049(79)90029-X}, URL = {http://dx.doi.org/10.1016/0022-4049(79)90029-X}, } @article {Dennis-Magid(1975), AUTHOR = {Dennis, R. Keith and Magid, Andy R.}, TITLE = {{$K_{2}$} of von {N}eumann regular rings}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {6}, YEAR = {1975}, PAGES = {49--59}, ISSN = {0022-4049}, MRCLASS = {13D15}, MRNUMBER = {MR0422247 (54 \#10238)}, MRREVIEWER = {M. E. Keating}, } @article {Dennis-Magurn(1984), AUTHOR = {Dennis, Keith and Magurn, Bruce and Vaserstein, Leonid}, TITLE = {Generalized {E}uclidean group rings}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {351}, YEAR = {1984}, PAGES = {113--128}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {16A26 (16A42 18F25 57Q10)}, MRNUMBER = {MR749679 (85f:16012)}, MRREVIEWER = {K. W. Roggenkamp}, } @article {Dennis-Stein(1975), AUTHOR = {Dennis, R. Keith and Stein, Michael R.}, TITLE = {{$K_{2}$} of discrete valuation rings}, JOURNAL = {Advances in Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {18}, YEAR = {1975}, NUMBER = {2}, PAGES = {182--238}, ISSN = {0001-8708}, MRCLASS = {18F25 (13H10)}, MRNUMBER = {MR0437620 (55 \#10544)}, MRREVIEWER = {M. E. Keating}, } @article {Dennis-Stein(1974), AUTHOR = {Dennis, R. Keith and Stein, Michael R.}, TITLE = {Injective stability for {$K_{2}$} of local rings}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {80}, YEAR = {1974}, PAGES = {1010--1013}, ISSN = {0002-9904}, MRCLASS = {13D15}, MRNUMBER = {MR0371880 (51 \#8097)}, MRREVIEWER = {J.-P. Lafon}, } @incollection {Dennis-Stein(1973), AUTHOR = {Dennis, R. Keith and Stein, Michael R.}, TITLE = {The functor {$K_{2}$}: a survey of computations and problems}, BOOKTITLE = {Algebraic {$K$}-theory, {II}: ``{C}lassical'' algebraic {$K$}-theory and connections with arithmetic ({P}roc. {C}onf., {S}eattle {R}es. {C}enter, {B}attelle {M}emorial {I}nst., 1972)}, PAGES = {243--280. Lecture Notes in Math., Vol. 342}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1973}, MRCLASS = {18F25}, MRNUMBER = {MR0354815 (50 \#7292)}, MRREVIEWER = {J. E. Humphreys}, } @article {Dennis-Stein(1972), AUTHOR = {Dennis, R. Keith and Stein, Michael R.}, TITLE = {A new exact sequence for {$K_{2}$} and some consequences for rings of integers}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {78}, YEAR = {1972}, PAGES = {600--603}, ISSN = {0002-9904}, MRCLASS = {13D15}, MRNUMBER = {MR0302631 (46 \#1775)}, MRREVIEWER = {A. V. Geramita}, } @article {Deo-Varadarajan(1991), AUTHOR = {Deo, Satya and Varadarajan, K.}, TITLE = {Isomorphic {B}urnside rings}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {139}, YEAR = {1991}, NUMBER = {2}, PAGES = {468--483}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20C10 (19A22)}, MRNUMBER = {MR1113786 (92d:20010)}, MRREVIEWER = {Esther Beneish}, } @Book {deRham(1955), author = {de Rham, G.}, title = {Vari\'et\'es Diff\'erentiables}, publisher = {Hermann}, address = {Paris}, year = 1955, } @article{Dessai-Jung(1998), AUTHOR = {Dessai, Anand and Jung, Rainer}, TITLE = {On the rigidity theorem for elliptic genera}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {350}, YEAR = {1998}, NUMBER = {10}, PAGES = {4195--4220}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {58G10 (11F11 19L47 57R15)}, MRNUMBER = {98m:58130}, MRREVIEWER = {Mark Hovey}, } @article {Devinatz-Hopkins(2004), AUTHOR = {Devinatz, Ethan S. and Hopkins, Michael J.}, TITLE = {Homotopy fixed point spectra for closed subgroups of the {M}orava stabilizer groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {43}, YEAR = {2004}, NUMBER = {1}, PAGES = {1--47}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P43 (55N22 55T15)}, MRNUMBER = {MR2030586 (2004i:55012)}, MRREVIEWER = {R. E. Stong}, } @article {Devinatz-Hopkins-Smith(1988), AUTHOR = {Devinatz, Ethan S. and Hopkins, Michael J. and Smith, Jeffrey H.}, TITLE = {Nilpotence and stable homotopy theory. {I}}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {128}, YEAR = {1988}, NUMBER = {2}, PAGES = {207--241}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {55Q10 (55P42 55Q52)}, MRNUMBER = {960945 (89m:55009)}, MRREVIEWER = {Frederick Cohen}, DOI = {10.2307/1971440}, URL = {http://dx.doi.org/10.2307/1971440}, } @book{Dicks(1980), AUTHOR = {Dicks, Warren}, TITLE = {Groups, trees and projective modules}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1980}, PAGES = {ix+127}, ISBN = {3-540-09974-3}, MRCLASS = {20F34 (16A27 20C07)}, MRNUMBER = {82j:20079}, MRREVIEWER = {Martha K. Smith}, } @article {Dicks(1983), AUTHOR = {Dicks, Warren}, TITLE = {The {H}{N}{N} construction for rings}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {81}, YEAR = {1983}, NUMBER = {2}, PAGES = {434--487}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16A05 (16A54 16A60)}, MRNUMBER = {85c:16005}, MRREVIEWER = {L. G. Makar-Limanov}, } @book{Dicks-Dunwoody(1989), AUTHOR = {Dicks, Warren and Dunwoody, M. J.}, TITLE = {Groups acting on graphs}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1989}, PAGES = {xvi+283}, ISBN = {0-521-23033-0}, MRCLASS = {20-02 (05C25 57M05)}, MRNUMBER = {91b:20001}, MRREVIEWER = {D. E. Cohen}, } @article {Dicks-Herbera-Sanchez(2004), AUTHOR = {Dicks, Warren and Herbera, Dolors and S{\'a}nchez, Javier}, TITLE = {On a theorem of {I}an {H}ughes about division rings of fractions}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {32}, YEAR = {2004}, NUMBER = {3}, PAGES = {1127--1149}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {16S34 (12E15 16K40 16S35)}, MRNUMBER = {2063801 (2005h:16043)}, MRREVIEWER = {Peter A. Linnell}, DOI = {10.1081/AGB-120027970}, URL = {http://dx.doi.org/10.1081/AGB-120027970}, } @article{Dicks-Kropholler(1995), AUTHOR = {Dicks, Warren and Kropholler, Peter H.}, TITLE = {Free groups and almost equivariant maps}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {27}, YEAR = {1995}, NUMBER = {4}, PAGES = {319--326}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {20E05}, MRNUMBER = {96e:20031}, MRREVIEWER = {{\u{I}}. Ya. Subbotin}, } @article {Dicks-Kropholler-Leary-Thomas(2002), AUTHOR = {Dicks, Warren and Kropholler, Peter H. and Leary, Ian J. and Thomas, Simon}, TITLE = {Classifying spaces for proper actions of locally finite groups}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {5}, YEAR = {2002}, NUMBER = {4}, PAGES = {453--480}, ISSN = {1433-5883}, CODEN = {JGTHFQ}, MRCLASS = {20Fxx}, MRNUMBER = {1 931 370}, } @article {Dicks-Linnell, AUTHOR = {Dicks, Warren and Linnell, Peter A.}, TITLE = {{$L\sp 2$}-{B}etti numbers of one-relator groups}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {337}, YEAR = {2007}, NUMBER = {4}, PAGES = {855--874}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {20J05 (16S34 20F05)}, MRNUMBER = {MR2285740 (2007m:20076)}, MRREVIEWER = {E. F. Robertson}, } @article{Dicks-Menal(1979), AUTHOR = {Dicks, Warren and Menal, Pere}, TITLE = {The group rings that are semifirs}, JOURNAL = {J. London Math. Soc. (2)}, FJOURNAL = {The Journal of the London Mathematical Society. Second Series}, VOLUME = {19}, YEAR = {1979}, NUMBER = {2}, PAGES = {288--290}, ISSN = {0024-6107}, CODEN = {JLMSAK}, MRCLASS = {16A06 (16A26)}, MRNUMBER = {80g:16002}, MRREVIEWER = {P. M. Cohn}, } @article {Dicks-Schick(2002), AUTHOR = {Dicks, Warren and Schick, Thomas}, TITLE = {The spectral measure of certain elements of the complex group ring of a wreath product}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {93}, YEAR = {2002}, PAGES = {121--137}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {58Jxx (57Nxx)}, MRNUMBER = {1 934 693}, } @article{Dieck(1971), AUTHOR = {tom Dieck, Tammo}, TITLE = {Partitions of unity in homotopy theory}, JOURNAL = {Composito Math.}, VOLUME = {23}, YEAR = {1971}, PAGES = {159--167}, MRCLASS = {55D10}, MRNUMBER = {45 \#2702}, MRREVIEWER = {Ronald Brown}, } @article{Dieck(1972), AUTHOR = {tom Dieck, Tammo}, TITLE = {Orbittypen und \"aquivariante {H}omologie. {I}}, JOURNAL = {Arch. Math. (Basel)}, VOLUME = {23}, YEAR = {1972}, PAGES = {307--317}, MRCLASS = {57D85}, MRNUMBER = {46 \#10017}, MRREVIEWER = {W. Metzler}, } @article{Dieck(1974), AUTHOR = {tom Dieck, Tammo}, TITLE = {On the homotopy type of classifying spaces}, JOURNAL = {Manuscripta Math.}, VOLUME = {11}, YEAR = {1974}, PAGES = {41--49}, MRCLASS = {55F40}, MRNUMBER = {50 \#3222}, MRREVIEWER = {A. H. Clark}, } @book {Dieck(1975), AUTHOR = {tom Dieck, Tammo}, TITLE = {The {B}urnside ring and equivariant stable homotopy}, NOTE = {Lecture notes by Michael C. Bix}, PUBLISHER = {Department of Mathematics, University of Chicago, Chicago, Ill.}, YEAR = {1975}, PAGES = {ii+46}, MRCLASS = {57E15}, MRNUMBER = {MR0423389 (54 \#11368)}, MRREVIEWER = {Czes Kosniowski}, } @book{Dieck(1979), AUTHOR = {tom Dieck, Tammo}, TITLE = {Transformation groups and representation theory}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1979}, PAGES = {viii+309}, ISBN = {3-540-09720-1}, MRCLASS = {57S25 (20C99 55N25)}, MRNUMBER = {82c:57025}, MRREVIEWER = {V. P. Snaith}, } @article{Dieck(1981), AUTHOR = {tom Dieck, Tammo}, TITLE = {\"{U}ber projektive {M}oduln und {E}ndlichkeitshindernisse bei {T}ransformationsgruppen}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {34}, YEAR = {1981}, NUMBER = {2-3}, PAGES = {135--155}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {57S17 (18F25)}, MRNUMBER = {82k:57028}, MRREVIEWER = {R. K. Lashof}, } @book{Dieck(1987), AUTHOR = {tom Dieck, Tammo}, TITLE = {Transformation groups}, PUBLISHER = {Walter de Gruyter \& Co.}, ADDRESS = {Berlin}, YEAR = {1987}, PAGES = {x+312}, ISBN = {3-11-009745-1}, MRCLASS = {57Sxx (57-02)}, MRNUMBER = {89c:57048}, MRREVIEWER = {Shmuel Weinberger}, } @proceedings {Dieck(1988), TITLE = {Algebraic topology and transformation groups}, BOOKTITLE = {Proceedings of the conference held in G\"ottingen, August 23--29, 1987}, EDITOR = {tom Dieck, T.}, NOTE = {Mathematica Gottingensis}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1988}, PAGES = {vi+298}, ISBN = {3-540-50528-8}, MRCLASS = {57-06}, MRNUMBER = {89g:57001}, } @article{Dieck(1990), AUTHOR = {tom Dieck, Tammo}, TITLE = {Symmetric homology planes}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {286}, YEAR = {1990}, NUMBER = {1-3}, PAGES = {143--152}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {14J26 (14F45 14J50 57N13)}, MRNUMBER = {90m:14033}, MRREVIEWER = {Takao Fujita}, } @article{Dieck(1990a), AUTHOR = {tom Dieck, Tammo}, TITLE = {Linear plane divisors of homology planes}, JOURNAL = {J. Fac. Sci. Univ. Tokyo Sect. IA Math.}, FJOURNAL = {Journal of the Faculty of Science. University of Tokyo. Section IA. Mathematics}, VOLUME = {37}, YEAR = {1990}, NUMBER = {1}, PAGES = {33--69}, ISSN = {0040-8980}, CODEN = {JFTMAT}, MRCLASS = {14J26 (14C20 14F45 52B30)}, MRNUMBER = {91f:14033}, MRREVIEWER = {De-Qi Zhang}, } @book{Dieck(1991), AUTHOR = {tom Dieck, Tammo}, TITLE = {Topologie}, PUBLISHER = {Walter de Gruyter \& Co.}, ADDRESS = {Berlin}, YEAR = {1991}, PAGES = {x+401}, ISBN = {3-11-013187-0; 3-11-012463-7}, MRCLASS = {55-01 (57-01)}, MRNUMBER = {93f:55001}, MRREVIEWER = {J. M. Boardman}, } @article{Dieck(1992b), AUTHOR = {tom Dieck, Tammo}, TITLE = {Homology planes without cancellation property}, JOURNAL = {Arch. Math. (Basel)}, FJOURNAL = {Archiv der Mathematik. Archives of Mathematics. Archives Math\'ematiques}, VOLUME = {59}, YEAR = {1992}, NUMBER = {2}, PAGES = {105--114}, ISSN = {0003-889X}, CODEN = {ACVMAL}, MRCLASS = {14E05 (14M20)}, MRNUMBER = {93i:14012}, MRREVIEWER = {Claire Voisin}, } @article{Dieck(1994a), AUTHOR = {tom Dieck, Tammo}, TITLE = {Symmetrische {B}r\"ucken und {K}notentheorie zu den {D}ynkin-{D}iagrammen vom {T}yp ${B}$}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {451}, YEAR = {1994}, PAGES = {71--88}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {57M25 (20F36)}, MRNUMBER = {95h:57006}, MRREVIEWER = {Hugh Reynolds Morton}, } @article{Dieck(1997a), AUTHOR = {tom Dieck, Tammo}, TITLE = {Bridges with pillars: a graphical calculus of knot algebra}, NOTE = {Special issue on braid groups and related topics (Jerusalem, 1995)}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {78}, YEAR = {1997}, NUMBER = {1-2}, PAGES = {21--38}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {57M25 (20F38 20F55)}, MRNUMBER = {98j:57006}, MRREVIEWER = {Sergei V. Chmutov}, } @article{Dieck(1997b), AUTHOR = {tom Dieck, Tammo}, TITLE = {On tensor representations of knot algebras}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {93}, YEAR = {1997}, NUMBER = {2}, PAGES = {163--176}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {57M25 (17B37 20F36)}, MRNUMBER = {99i:57011}, MRREVIEWER = {Alexander Balinsky}, } @article{Dieck(1997c), AUTHOR = {tom Dieck, Tammo}, TITLE = {Categories of rooted cylinder ribbons and their representations}, NOTE = {Dedicated to Martin Kneser on the occasion of his 70th birthday}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {494}, YEAR = {1998}, PAGES = {35--63}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {18D10 (17B37 20F36 57M25)}, MRNUMBER = {99h:18010}, MRREVIEWER = {Yu. N. Bespalov}, } @book{Dieck(2000), AUTHOR = {tom Dieck, Tammo}, TITLE = {Topologie}, PUBLISHER = {Walter de Gruyter \& Co.}, ADDRESS = {Berlin}, YEAR = {2000}, NOTE = {2. Auflage}, } @book {Dieck(2008), AUTHOR = {tom Dieck, Tammo}, TITLE = {Algebraic topology}, SERIES = {EMS Textbooks in Mathematics}, PUBLISHER = {European Mathematical Society (EMS), Z\"urich}, YEAR = {2008}, PAGES = {xii+567}, ISBN = {978-3-03719-048-7}, MRCLASS = {55-01}, MRNUMBER = {2456045 (2009f:55001)}, MRREVIEWER = {Donald M. Davis}, DOI = {10.4171/048}, URL = {http://dx.doi.org/10.4171/048}, } @book{Dieck-Hambleton(1988), AUTHOR = {tom Dieck, Tammo and Hambleton, Ian}, TITLE = {Surgery theory and geometry of representations}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1988}, PAGES = {viii+115}, ISBN = {3-7643-2204-7}, MRCLASS = {57R65 (57R67 57S17)}, MRNUMBER = {89g:57047}, MRREVIEWER = {A. A. Ranicki}, } @article{Dieck-Haring-Oldenburg(1998), AUTHOR = {tom Dieck, Tammo and H{\"a}ring-Oldenburg, Reinhard}, TITLE = {Quantum groups and cylinder braiding}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {10}, YEAR = {1998}, NUMBER = {5}, PAGES = {619--639}, ISSN = {0933-7741}, CODEN = {FOMAEF}, MRCLASS = {20F36 (16W30 17B37 18D10)}, MRNUMBER = {99g:20071}, MRREVIEWER = {Mitsuhiro Takeuchi}, } @article{Dieck-Petrie(1982), AUTHOR = {tom Dieck, Tammo and Petrie, Ted}, TITLE = {Homotopy representations of finite groups}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {56}, YEAR = {1982}, PAGES = {129--169 (1983)}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {57S17}, MRNUMBER = {86b:57020}, MRREVIEWER = {C. B. Thomas}, } @article{Dieck-Petrie(1990), AUTHOR = {tom Dieck, Tammo and Petrie, Ted}, TITLE = {Contractible affine surfaces of {K}odaira dimension one}, JOURNAL = {Japan. J. Math. (N.S.)}, FJOURNAL = {Japanese Journal of Mathematics. New Series}, VOLUME = {16}, YEAR = {1990}, NUMBER = {1}, PAGES = {147--169}, ISSN = {0289-2316}, CODEN = {JJMAAK}, MRCLASS = {14J26 (14F45 14M20)}, MRNUMBER = {91j:14027}, MRREVIEWER = {R. V. Gurjar}, } @article {Diep-Kuku-Tho(1999), AUTHOR = {Diep, Do Ngoc and Kuku, Aderemi O. and Tho, Nguyen Quoc}, TITLE = {Noncommutative {C}hern characters of compact {L}ie group ${C}\sp \ast$-algebras}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {17}, YEAR = {1999}, NUMBER = {3}, PAGES = {195--208}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19D55 (19K35 19L10 19L47 22E47 46L05 55N91)}, MRNUMBER = {2001a:19002}, MRREVIEWER = {Jonathan M. Rosenberg}, } @article {Diep-Kuku-Tho(2000), AUTHOR = {Diep, Do Ngoc and Kuku, Aderemi O. and Tho, Nguyen Quoc}, TITLE = {Non-commutative {C}hern characters of compact quantum group}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {226}, YEAR = {2000}, NUMBER = {1}, PAGES = {311--331}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {19-XX}, MRNUMBER = {1 749 891}, } @book{Dieudonne(1976), AUTHOR = {Dieudonn{\'e}, J.}, TITLE = {Grundz\"uge der modernen {A}nalysis. {B}and 3}, NOTE = {Translated from the second French edition by Herbert Gollek, Rolf Sulanke and Peter Wintgen, Logik und Grundlagen der Mathematik, 18}, PUBLISHER = {Vieweg}, ADDRESS = {Braunschweig}, YEAR = {1976}, PAGES = {396}, ISBN = {3-528-08370-0}, MRCLASS = {58-01 (00A05)}, MRNUMBER = {58 \#24308}, } @Book{Dieudonne(1989), AUTHOR = {Dieudonn{\'e}, Jean}, TITLE = {A history of algebraic and differential topology. 1900--1960}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1989}, PAGES = {xxii+648}, ISBN = {0-8176-3388-X}, MRCLASS = {01A60 (55-02 55-03 57-02 57-03)}, MRNUMBER = {90g:01029}, MRREVIEWER = {Saunders Mac Lane}, } @book{Digne-Michel(1991), AUTHOR = {Digne, Fran{\c{c}}ois and Michel, Jean}, TITLE = {Representations of finite groups of {L}ie type}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1991}, PAGES = {iv+159}, ISBN = {0-521-40117-8; 0-521-40648-X}, MRCLASS = {20G05 (20-02 20C33 20G40)}, MRNUMBER = {92g:20063}, MRREVIEWER = {Bhama Srinivasan}, } @book{Dimca(1992), AUTHOR = {Dimca, Alexandru}, TITLE = {Singularities and topology of hypersurfaces}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1992}, PAGES = {xvi+263}, ISBN = {0-387-97709-0}, MRCLASS = {32Sxx (14J70 32S25 32S50 57M25 57R45 58C27)}, MRNUMBER = {94b:32058}, MRREVIEWER = {Aleksandr G. Aleksandrov}, } @article{Dimovski-Geoghegan(1990), AUTHOR = {Dimovski, Don{\v{c}}o and Geoghegan, Ross}, TITLE = {One-parameter fixed point theory}, JOURNAL = {Forum Math.}, FJOURNAL = {Forum Mathematicum}, VOLUME = {2}, YEAR = {1990}, NUMBER = {2}, PAGES = {125--154}, ISSN = {0933-7741}, CODEN = {FOMAEF}, MRCLASS = {55M20 (57Q20 57Q40 57Q65)}, MRNUMBER = {91e:55002}, MRREVIEWER = {Helga Schirmer}, } @book{Dixmier(1969), AUTHOR = {Dixmier, Jacques}, TITLE = {Les alg\`ebres d'op\'erateurs dans l'espace hilbertien (alg\`ebres de von {N}eumann)}, NOTE = {Deuxi\`eme \'edition, revue et augment\'ee, Cahiers Scientifiques, Fasc. XXV}, PUBLISHER = {Gauthier-Villars \'Editeur, Paris}, YEAR = {1969}, PAGES = {x+367}, MRCLASS = {46LXX}, MRNUMBER = {50 \#5482}, } @book{Dixmier(1977), AUTHOR = {Dixmier, Jacques}, TITLE = {${C}\sp*$-algebras}, NOTE = {Translated from the French by Francis Jellett, North-Holland Mathematical Library, Vol. 15}, PUBLISHER = {North-Holland Publishing Co.}, ADDRESS = {Amsterdam}, YEAR = {1977}, PAGES = {xiii+492}, ISBN = {0-7204-0762-1}, MRCLASS = {46L05}, MRNUMBER = {56 \#16388}, } @book{Dixmier(1981), AUTHOR = {Dixmier, Jacques}, TITLE = {von {N}eumann algebras}, NOTE = {With a preface by E. C. Lance, Translated from the second French edition by F. Jellett}, PUBLISHER = {North-Holland Publishing Co.}, ADDRESS = {Amsterdam}, YEAR = {1981}, PAGES = {xxxviii+437}, ISBN = {0-444-86308-7}, MRCLASS = {46-02 (16A30 22D25 46Lxx)}, MRNUMBER = {83a:46004}, } @book {Dixon-duSaztoy-Mann_Segal(1999), AUTHOR = {Dixon, J. D. and du Sautoy, M. P. F. and Mann, A. and Segal, D.}, TITLE = {Analytic pro-{$p$} groups}, SERIES = {Cambridge Studies in Advanced Mathematics}, VOLUME = {61}, EDITION = {Second}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1999}, PAGES = {xviii+368}, ISBN = {0-521-65011-9}, MRCLASS = {20E18 (20G30)}, MRNUMBER = {1720368 (2000m:20039)}, MRREVIEWER = {Alexander Lubotzky}, DOI = {10.1017/CBO9780511470882}, URL = {http://dx.doi.org/10.1017/CBO9780511470882}, } @book {Dixon-Mortimer(1996), AUTHOR = {Dixon, John D. and Mortimer, Brian}, TITLE = {Permutation groups}, SERIES = {Graduate Texts in Mathematics}, VOLUME = {163}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1996}, PAGES = {xii+346}, ISBN = {0-387-94599-7}, MRCLASS = {20B05 (20-01 20B07)}, MRNUMBER = {1409812 (98m:20003)}, MRREVIEWER = {Martin W. Liebeck}, } @article {Dobrowolski(2012), AUTHOR = {Dobrowolski, Edward}, TITLE = {On a question of {S}chinzel about the length and {M}ahler's measure of polynomials that have a zero on the unit circle}, JOURNAL = {Acta Arith.}, FJOURNAL = {Acta Arithmetica}, VOLUME = {155}, YEAR = {2012}, NUMBER = {4}, PAGES = {453--463}, ISSN = {0065-1036}, CODEN = {AARIA9}, MRCLASS = {11R06 (12D99 26C99)}, MRNUMBER = {2997581}, MRREVIEWER = {Michael J. Mossinghoff}, DOI = {10.4064/aa155-4-8}, URL = {http://dx.doi.org/10.4064/aa155-4-8}, } @article {Dobrowolski(2006), AUTHOR = {Dobrowolski, Edward}, TITLE = {Mahler's measure of a polynomial in terms of the number of its monomials}, JOURNAL = {Acta Arith.}, FJOURNAL = {Acta Arithmetica}, VOLUME = {123}, YEAR = {2006}, NUMBER = {3}, PAGES = {201--231}, ISSN = {0065-1036}, CODEN = {AARIA9}, MRCLASS = {11R09 (11C08)}, MRNUMBER = {2263255 (2007g:11135)}, MRREVIEWER = {Lenny Fukshansky}, DOI = {10.4064/aa123-3-1}, URL = {http://dx.doi.org/10.4064/aa123-3-1}, } @article {Dobrowolski(1991), AUTHOR = {Dobrowolski, Edward}, TITLE = {Mahler's measure of a polynomial in function of the number of its coefficients}, JOURNAL = {Canad. Math. Bull.}, FJOURNAL = {Canadian Mathematical Bulletin. Bulletin Canadien de Math\'ematiques}, VOLUME = {34}, YEAR = {1991}, NUMBER = {2}, PAGES = {186--195}, ISSN = {0008-4395}, CODEN = {CMBUA3}, MRCLASS = {11R09 (11C08)}, MRNUMBER = {1113295 (92f:11138)}, MRREVIEWER = {Christopher Smyth}, DOI = {10.4153/CMB-1991-030-5}, URL = {http://dx.doi.org/10.4153/CMB-1991-030-5}, } @article {Dobrowolski(1979), AUTHOR = {Dobrowolski, E.}, TITLE = {On a question of {L}ehmer and the number of irreducible factors of a polynomial}, JOURNAL = {Acta Arith.}, FJOURNAL = {Polska Akademia Nauk. Instytut Matematyczny. Acta Arithmetica}, VOLUME = {34}, YEAR = {1979}, NUMBER = {4}, PAGES = {391--401}, ISSN = {0065-1036}, CODEN = {AARIA9}, MRCLASS = {10F25 (12A15)}, MRNUMBER = {543210 (80i:10040)}, MRREVIEWER = {D. H. Lehmer}, } @incollection {Dobrowolski-Lawton-Schinzel(1983), AUTHOR = {Dobrowolski, E. and Lawton, W. and Schinzel, A.}, TITLE = {On a problem of {L}ehmer}, BOOKTITLE = {Studies in pure mathematics}, PAGES = {135--144}, PUBLISHER = {Birkh\"auser}, ADDRESS = {Basel}, YEAR = {1983}, MRCLASS = {11R04}, MRNUMBER = {820217 (87e:11120)}, MRREVIEWER = {Christopher Smyth}, } @article{Dodziuk(1976), AUTHOR = {Dodziuk, Jozef}, TITLE = {Finite-difference approach to the {H}odge theory of harmonic forms}, JOURNAL = {Amer. J. Math.}, VOLUME = {98}, YEAR = {1976}, NUMBER = {1}, PAGES = {79--104}, MRCLASS = {58A10 (58G99)}, MRNUMBER = {53 \#11642}, MRREVIEWER = {D. B. Fuks}, } @article{Dodziuk(1977), AUTHOR = {Dodziuk, Jozef}, TITLE = {de {R}ham-{H}odge theory for ${L}\sp{2}$-cohomology of infinite coverings}, JOURNAL = {Topology}, VOLUME = {16}, YEAR = {1977}, NUMBER = {2}, PAGES = {157--165}, MRCLASS = {58G10}, MRNUMBER = {56 \#3898}, MRREVIEWER = {M. F. Atiyah}, } @article{Dodziuk(1979), AUTHOR = {Dodziuk, Jozef}, TITLE = {${L}\sp{2}$\ harmonic forms on rotationally symmetric {R}iemannian manifolds}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {77}, YEAR = {1979}, NUMBER = {3}, PAGES = {395--400}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {58A14 (53C99 58G99)}, MRNUMBER = {81e:58004}, MRREVIEWER = {H. Wu}, } @article{Dodziuk(1981), AUTHOR = {Dodziuk, Jozef}, TITLE = {Sobolev spaces of differential forms and de {R}ham-{H}odge isomorphism}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {16}, YEAR = {1981}, NUMBER = {1}, PAGES = {63--73}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {58A14 (53C20)}, MRNUMBER = {83e:58001}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article{Dodziuk(1981b), AUTHOR = {Dodziuk, Jozef}, TITLE = {Vanishing theorems for square-integrable harmonic forms}, JOURNAL = {Proc. Indian Acad. Sci. Math. Sci.}, FJOURNAL = {Indian Academy of Sciences. Proceedings. Mathematical Sciences}, VOLUME = {90}, YEAR = {1981}, NUMBER = {1}, PAGES = {21--27}, ISSN = {0370-0089}, MRCLASS = {58A14}, MRNUMBER = {83h:58006}, } @InCollection{Dodziuk(1982), author = {Dodziuk, J.}, title = {$L^2$-harmonic forms on complete manifolds}, booktitle = {Seminar on differential geometry}, publisher = {Princeton University Press}, year = 1982, volume = 102, series = {Annals of mathematics studies}, pages = {291-302}, } @incollection {Dodziuk-Mathai(1997), AUTHOR = {Dodziuk, Jozef and Mathai, Varghese}, TITLE = {Approximating ${L}\sp 2$ invariants of amenable covering spaces: a heat kernel approach}, BOOKTITLE = {Lipa's legacy (New York, 1995)}, PAGES = {151--167}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1997}, MRCLASS = {58G11 (58G18 58G25)}, MRNUMBER = {98j:58106}, MRREVIEWER = {Edward L. Bueler}, } @Article{Dodziuk-Mathai(1998), AUTHOR = {Dodziuk, Jozef and Mathai, Varghese}, TITLE = {Approximating ${L}\sp 2$ invariants of amenable covering spaces: a combinatorial approach}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {154}, YEAR = {1998}, NUMBER = {2}, PAGES = {359--378}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G26 (43A07 57M10)}, MRNUMBER = {99e:58201}, MRREVIEWER = {Tadeusz Januszkiewicz}, } @article {Dodziuk-Linnell-Mathai-Schick_Yates(2003), AUTHOR = {Dodziuk, J{\'o}zef and Linnell, Peter and Mathai, Varghese and Schick, Thomas and Yates, Stuart}, TITLE = {Approximating {$L^2$}-invariants and the {A}tiyah conjecture}, NOTE = {Dedicated to the memory of J{\"u}rgen K. Moser}, JOURNAL = {Comm. Pure Appl. Math.}, FJOURNAL = {Communications on Pure and Applied Mathematics}, VOLUME = {56}, YEAR = {2003}, NUMBER = {7}, PAGES = {839--873}, ISSN = {0010-3640}, CODEN = {CPAMA}, MRCLASS = {58J50 (11J81)}, MRNUMBER = {MR1990479 (2004g:58040)}, MRREVIEWER = {Alan L. Carey}, DOI = {10.1002/cpa.10076}, URL = {http://dx.doi.org/10.1002/cpa.10076}, } @article{Dodziuk-Patodi(1976), AUTHOR = {Dodziuk, J. and Patodi, V. K.}, TITLE = {Riemannian structures and triangulations of manifolds}, JOURNAL = {J. Indian Math. Soc. (N.S.)}, VOLUME = {40}, YEAR = {1976}, NUMBER = {1-4}, PAGES = {1--52 (1977)}, MRCLASS = {58G10 (57D20)}, MRNUMBER = {58 \#7742}, MRREVIEWER = {M. L. Gromov}, } @Article{Dold(1955), Author = {Albrecht {Dold}}, Title = {{\"Uber fasernweise Homotopie\"aquivalenz von Faserr\"aumen.}}, FJournal = {{Mathematische Zeitschrift}}, Journal = {{Math. Z.}}, ISSN = {0025-5874; 1432-1823/e}, Volume = {62}, Pages = {111--136}, Year = {1955}, Publisher = {Springer, Berlin/Heidelberg}, Language = {German}, DOI = {10.1007/BF01180627}, Zbl = {0064.17403} } @article {Dold(1956), AUTHOR = {Dold, Albrecht}, TITLE = {Erzeugende der {T}homschen {A}lgebra {${\mathfrak{N}}$}}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {65}, YEAR = {1956}, PAGES = {25--35}, ISSN = {0025-5874,1432-1823}, MRCLASS = {55.0X}, MRNUMBER = {79269}, MRREVIEWER = {W.\ S.\ Massey}, DOI = {10.1007/BF01473868}, URL = {https://doi.org/10.1007/BF01473868}, } @article{Dold(1958), AUTHOR = {Dold, Albrecht}, TITLE = {Homology of symmetric products and other functors of complexes}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {68}, YEAR = {1958}, PAGES = {54--80}, MRCLASS = {55.00}, MRNUMBER = {20 \#3537}, MRREVIEWER = {Sze-tsen Hu}, } @article{Dold(1960), author = {Dold, Albrecht}, title = {{Zur Homotopietheorie der Kettenkomplexe}}, journal = {Mathematische Annalen}, year = {1960}, volume = {140}, pages = {278--298}, } @article{Dold(1963), AUTHOR = {Dold, Albrecht}, TITLE = {Partitions of unity in the theory of fibrations}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {78}, YEAR = {1963}, PAGES = {223--255}, MRCLASS = {55.50}, MRNUMBER = {27 \#5264}, MRREVIEWER = {E. Fadell}, } @article{Dold(1965), AUTHOR = {Dold, Albrecht}, TITLE = {Fixed point index and fixed point theorem for {E}uclidean neighborhood retracts}, JOURNAL = {Topology}, VOLUME = {4}, YEAR = {1965}, PAGES = {1--8}, MRCLASS = {55.36}, MRNUMBER = {33 \#1850}, MRREVIEWER = {F. Raymond}, } @Book{Dold(1966), Author = {Albrecht {Dold}}, Title = {{Halbexakte Homotopiefunktoren}}, FJournal = {{Lecture Notes in Mathematics}}, Journal = {{Lect. Notes Math.}}, ISSN = {0075-8434}, Volume = {12}, Year = {1966}, Publisher = {Springer, Cham}, Language = {German}, DOI = {10.1007/BFb0084856}, MSC2010 = {55-02 55P65}, Zbl = {0136.00801} } @InProceedings{Dold(1972), author = {Dold, A.}, title = {Relations between ordinary and extraordinary homology}, booktitle = {Algebraic Topology: a student's guide, Lecture Note Series 4}, year = 1972, editor = {Adams, J.F.}, pages = {167--177}, organization = {London Math. Soc.}, publisher = {Cambridge Univ. Press}, } @article{Dold(1974), AUTHOR = {Dold, Albrecht}, TITLE = {The fixed point index of fibre-preserving maps}, JOURNAL = {Invent. Math.}, VOLUME = {25}, YEAR = {1974}, PAGES = {281--297}, MRCLASS = {55C20 (55F05)}, MRNUMBER = {52 \#1673}, MRREVIEWER = {E. Fadell}, } @article{Dold(1976), AUTHOR = {Dold, Albrecht}, TITLE = {The fixed point transfer of fibre-preserving maps}, JOURNAL = {Math. Z.}, VOLUME = {148}, YEAR = {1976}, NUMBER = {3}, PAGES = {215--244}, MRCLASS = {55C20}, MRNUMBER = {55 \#6416}, MRREVIEWER = {E. Fadell}, } @book{Dold(1980), AUTHOR = {Dold, Albrecht}, TITLE = {Lectures on algebraic topology}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1980}, PAGES = {xi+377}, ISBN = {3-540-10369-4}, MRCLASS = {55-01}, MRNUMBER = {82c:55001}, } @article {Dold-Lashof(1959), AUTHOR = {Dold, Albrecht and Lashof, Richard}, TITLE = {Principal quasi-fibrations and fibre homotopy equivalence of bundles. }, JOURNAL = {Illinois J. Math.}, FJOURNAL = {Illinois Journal of Mathematics}, VOLUME = {3}, YEAR = {1959}, PAGES = {285--305}, ISSN = {0019-2082}, MRCLASS = {55.00}, MRNUMBER = {0101521 (21 \#331)}, MRREVIEWER = {Sze-tsen Hu}, } @article {Dold-Puppe(1958), AUTHOR = {Dold, Albrecht and Puppe, Dieter}, TITLE = {Non-additive functors, their derived functors, and the suspension homomorphism}, JOURNAL = {Proc. Nat. Acad. Sci. U.S.A.}, VOLUME = {44}, YEAR = {1958}, PAGES = {1065--1068}, MRCLASS = {18.00 (55.00)}, MRNUMBER = {MR0096719 (20 \#3202)}, MRREVIEWER = {J. F. Adams}, } @article {Dold-Puppe(1961), AUTHOR = {Dold, Albrecht and Puppe, Dieter}, TITLE = {Homologie nicht-additiver {F}unktoren. {A}nwendungen}, JOURNAL = {Ann. Inst. Fourier Grenoble}, FJOURNAL = {Universit\'e de Grenoble. Annales de l'Institut Fourier}, VOLUME = {11}, YEAR = {1961}, PAGES = {201--312}, ISSN = {0373-0956}, MRCLASS = {18.20}, MRNUMBER = {MR0150183 (27 \#186)}, MRREVIEWER = {P. J. Hilton}, } @inproceedings {Dold-Puppe(1980), AUTHOR = {Dold, Albrecht and Puppe, Dieter}, TITLE = {Duality, trace, and transfer}, BOOKTITLE = {Proceedings of the International Conference on Geometric Topology (Warsaw, 1978)}, PAGES = {81--102}, PUBLISHER = {PWN}, ADDRESS = {Warsaw}, YEAR = {1980}, MRCLASS = {55P25 (55P42 55R05)}, MRNUMBER = {83f:55005}, } @article {Dold-Puppe(1983), AUTHOR = {Dold, A. and Puppe, D.}, TITLE = {Duality, trace and transfer}, NOTE = {Topology (Moscow, 1979)}, JOURNAL = {Trudy Mat. Inst. Steklov.}, FJOURNAL = {Akademiya Nauk SSSR. Trudy Matematicheskogo Instituta imeni V. A. Steklova}, VOLUME = {154}, YEAR = {1983}, PAGES = {81--97}, ISSN = {0371-9685}, MRCLASS = {55P25}, MRNUMBER = {MR733829 (85i:55007)}, } @article{Donaldson(1983), AUTHOR = {Donaldson, S. K.}, TITLE = {An application of gauge theory to four-dimensional topology}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {18}, YEAR = {1983}, NUMBER = {2}, PAGES = {279--315}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57N13 (53C05 57R10 57R55 58E15)}, MRNUMBER = {85c:57015}, MRREVIEWER = {R. C. Kirby}, } @article{Donaldson(1985), AUTHOR = {Donaldson, S. K.}, TITLE = {Anti self-dual {Y}ang-{M}ills connections over complex algebraic surfaces and stable vector bundles}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {50}, YEAR = {1985}, NUMBER = {1}, PAGES = {1--26}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {58E15 (14F99 53C05 57R99)}, MRNUMBER = {86h:58038}, MRREVIEWER = {S. Ramanan}, } @article{Donaldson(1986), AUTHOR = {Donaldson, S. K.}, TITLE = {Connections, cohomology and the intersection forms of $4$-manifolds}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {24}, YEAR = {1986}, NUMBER = {3}, PAGES = {275--341}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57R55 (32C10 32G05 32J15 53C05 58G10)}, MRNUMBER = {88g:57033}, MRREVIEWER = {Ronald J. Stern}, } @article{Donaldson(1987a), AUTHOR = {Donaldson, S. K.}, TITLE = {Irrationality and the $h$-cobordism conjecture}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {26}, YEAR = {1987}, NUMBER = {1}, PAGES = {141--168}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57R80 (32C10 32G13 32J15 57N13 58E15 58G30)}, MRNUMBER = {88j:57035}, MRREVIEWER = {David R. Morrison}, } @article{Donaldson(1987b), AUTHOR = {Donaldson, S. K.}, TITLE = {The orientation of {Y}ang-{M}ills moduli spaces and $4$-manifold topology}, JOURNAL = {J. Differential Geom.}, FJOURNAL = {Journal of Differential Geometry}, VOLUME = {26}, YEAR = {1987}, NUMBER = {3}, PAGES = {397--428}, ISSN = {0022-040X}, CODEN = {JDGEAS}, MRCLASS = {57R19 (32C10 32G13 57N13 57R55 58E15)}, MRNUMBER = {88j:57020}, MRREVIEWER = {Nicholas Buchdahl}, } @article{Donaldson(1990), AUTHOR = {Donaldson, S. K.}, TITLE = {Polynomial invariants for smooth four-manifolds}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {29}, YEAR = {1990}, NUMBER = {3}, PAGES = {257--315}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57R57 (57N13 57R55 58D27)}, MRNUMBER = {92a:57035}, MRREVIEWER = {Ronald J. Stern}, } @article{Donaldson(1993), AUTHOR = {Donaldson, S. K.}, TITLE = {The approximation of instantons}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {3}, YEAR = {1993}, NUMBER = {2}, PAGES = {179--200}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58E15 (53C07 57R57)}, MRNUMBER = {94k:58030}, MRREVIEWER = {C. S. Sharma}, } @incollection {Donaldson(1994z), AUTHOR = {Donaldson, S. K.}, TITLE = {Gauge theory and four-manifold topology}, BOOKTITLE = {First European Congress of Mathematics, Vol.\ I (Paris, 1992)}, PAGES = {121--151}, PUBLISHER = {Birkh\"auser}, ADDRESS = {Basel}, YEAR = {1994}, MRCLASS = {57R55 (14J10 57R15 57R57)}, MRNUMBER = {96g:57035}, MRREVIEWER = {Zhenbo Qin}, } @book{Donaldson-Kronheimer(1990), AUTHOR = {Donaldson, S. K. and Kronheimer, P. B.}, TITLE = {The geometry of four-manifolds}, NOTE = {Oxford Science Publications}, PUBLISHER = {The Clarendon Press Oxford University Press}, ADDRESS = {New York}, YEAR = {1990}, PAGES = {x+440}, ISBN = {0-19-853553-8}, MRCLASS = {57R57 (57N13 57R55 58D27 58G05)}, MRNUMBER = {92a:57036}, MRREVIEWER = {Ronald J. Stern}, } @proceedings {Donaldson-Thomas(1990), TITLE = {Geometry of low-dimensional manifolds. 1}, BOOKTITLE = {Proceedings of the symposium held in Durham, July 1989}, EDITOR = {Donaldson, S. K. and Thomas, C. B.}, NOTE = {Gauge theory and algebraic surfaces}, PUBLISHER = {Cambridge University Press}, ADDRESS = {Cambridge}, YEAR = {1990}, PAGES = {xiv+259}, ISBN = {0-521-39978-5}, MRCLASS = {57-06}, MRNUMBER = {93b:57001}, } @article{Donnelly(1981), AUTHOR = {Donnelly, Harold}, TITLE = {The differential form spectrum of hyperbolic space}, JOURNAL = {Manuscripta Math.}, FJOURNAL = {Manuscripta Mathematica}, VOLUME = {33}, YEAR = {1980/81}, NUMBER = {3-4}, PAGES = {365--385}, ISSN = {0025-2611}, CODEN = {MSMHB2}, MRCLASS = {58G25}, MRNUMBER = {82f:58085}, MRREVIEWER = {H. D. Fegan}, } @article{Donnelly(1981a), AUTHOR = {Donnelly, Harold}, TITLE = {On ${L}\sp{2}$-{B}etti numbers for abelian groups}, JOURNAL = {Canad. Math. Bull.}, FJOURNAL = {Canadian Mathematical Bulletin}, VOLUME = {24}, YEAR = {1981}, NUMBER = {1}, PAGES = {91--95}, ISSN = {0008-4395}, CODEN = {CMBUA3}, MRCLASS = {58G10}, MRNUMBER = {82f:58078}, MRREVIEWER = {H. D. Fegan}, } @article{Donnelly(1983), AUTHOR = {Donnelly, Harold}, TITLE = {On the spectrum of towers}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {87}, YEAR = {1983}, NUMBER = {2}, PAGES = {322--329}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {58G25}, MRNUMBER = {84j:58128}, MRREVIEWER = {Andreas Nestke}, } @article{Donnelly(1987), AUTHOR = {Donnelly, Harold}, TITLE = {Essential spectrum and heat kernel}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {75}, YEAR = {1987}, NUMBER = {2}, PAGES = {362--381}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G11 (35P05)}, MRNUMBER = {89m:58194}, MRREVIEWER = {David Gurarie}, } @article{Donnelly-Fefferman(1983), AUTHOR = {Donnelly, Harold and Fefferman, Charles}, TITLE = {${L}\sp{2}$-cohomology and index theorem for the {B}ergman metric}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {118}, YEAR = {1983}, NUMBER = {3}, PAGES = {593--618}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {32F15 (35N15 58G30)}, MRNUMBER = {85f:32029}, MRREVIEWER = {G. M. Khenkin}, } @article{Donnelly-Fefferman(1983a), AUTHOR = {Donnelly, Harold and Fefferman, Charles}, TITLE = {${L}\sb{2}$\ cohomology of the {B}ergman metric}, JOURNAL = {Proc. Nat. Acad. Sci. U.S.A.}, FJOURNAL = {Proceedings of the National Academy of Sciences of the United States of America}, VOLUME = {80}, YEAR = {1983}, NUMBER = {10 i.}, PAGES = {3136--3137}, ISSN = {0027-8424}, CODEN = {PNASA6}, MRCLASS = {32F15 (32H10 58G07 58G10)}, MRNUMBER = {84g:32028}, } @article{Donnelly-Xavier(1984), AUTHOR = {Donnelly, Harold and Xavier, Frederico}, TITLE = {On the differential form spectrum of negatively curved {R}iemannian manifolds}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {106}, YEAR = {1984}, NUMBER = {1}, PAGES = {169--185}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {58G25 (53C20)}, MRNUMBER = {85i:58115}, MRREVIEWER = {Akira Asada}, } @article {Douady(1995Cerf), AUTHOR = {Douady, Adrien}, TITLE = {Sur les travaux de {J}ean {C}erf}, JOURNAL = {Gaz. Math.}, FJOURNAL = {Gazette des Math\'ematiciens}, VOLUME = {64}, YEAR = {1995}, PAGES = {5--15}, ISSN = {0224-8999}, MRCLASS = {57-03 (01A70 57Q35 57R52)}, MRNUMBER = {MR1334441 (96e:57001)}, MRREVIEWER = {A. A. Ranicki}, } @incollection {Douady(1995cohomologie), AUTHOR = {Douady, Adrien}, TITLE = {Cohomologie des groupes compacts totalement discontinus (d'apr\`es {T}ate)}, BOOKTITLE = {S\'eminaire Bourbaki, Vol.\ 5}, PAGES = {Exp.\ No.\ 189, 287--298}, PUBLISHER = {Soc. Math. France}, ADDRESS = {Paris}, YEAR = {1995}, MRCLASS = {57T10}, MRNUMBER = {1 603 474}, } @book{Douglas(1980), AUTHOR = {Douglas, Ronald G.}, TITLE = {${C}\sp{\ast} $-algebra extensions and ${K}$-homology}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, N.J.}, YEAR = {1980}, PAGES = {vii+84}, ISBN = {0-691-08265-0; 0-691-08266-9}, MRCLASS = {46M20 (46L05 47C15 55N15 58G12)}, MRNUMBER = {82c:46082}, MRREVIEWER = {M. F. Atiyah}, } @article{Dovermann(1981), AUTHOR = {Dovermann, Karl Heinz}, TITLE = {${Z}\sb{2}$\ surgery theory}, JOURNAL = {Michigan Math. J.}, FJOURNAL = {The Michigan Mathematical Journal}, VOLUME = {28}, YEAR = {1981}, NUMBER = {3}, PAGES = {267--287}, ISSN = {0026-2285}, MRCLASS = {57R65 (57S17)}, MRNUMBER = {83b:57019}, MRREVIEWER = {Gerald A. Anderson}, } @article {Dovermann-Rothenberg(1988), AUTHOR = {Dovermann, Karl Heinz and Rothenberg, Melvin}, TITLE = {Equivariant surgery and classifications of finite group actions on manifolds}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {71}, YEAR = {1988}, NUMBER = {379}, PAGES = {viii+117}, ISSN = {0065-9266,1947-6221}, MRCLASS = {57S17 (57R65 57R67 57R85)}, MRNUMBER = {920965}, MRREVIEWER = {S\"{o}ren\ Illman}, DOI = {10.1090/memo/0379}, URL = {https://doi.org/10.1090/memo/0379}, } @incollection {Dovermann-Rothenberg(1980), AUTHOR = {Dovermann, Karl Heinz and Rothenberg, Melvin}, TITLE = {An equivariant surgery sequence and equivariant diffeomorphism and homeomorphism classification (a survey)}, BOOKTITLE = {Topology {S}ymposium, {S}iegen 1979 ({P}roc. {S}ympos., {U}niv. {S}iegen, {S}iegen, 1979)}, SERIES = {Lecture Notes in Math.}, VOLUME = {788}, PAGES = {257--280}, PUBLISHER = {Springer, Berlin}, YEAR = {1980}, ISBN = {3-540-09968-9}, MRCLASS = {57R67 (57S17)}, MRNUMBER = {585663}, MRREVIEWER = {Czes\ Kosniowski}, } @article{Dovermann-Masuda(1995), AUTHOR = {Dovermann, Karl Heinz and Masuda, Mikiya}, TITLE = {Algebraic realization of manifolds with group actions}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {113}, YEAR = {1995}, NUMBER = {2}, PAGES = {304--338}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {57R95 (57R91 57S15)}, MRNUMBER = {96i:57039}, MRREVIEWER = {Ian Hambleton}, } @article{Dovermann-Masuda-Suh(1994a), AUTHOR = {Dovermann, Karl Heinz and Masuda, Mikiya and Suh, Dong Youp}, TITLE = {Algebraic realization of equivariant vector bundles}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {448}, YEAR = {1994}, PAGES = {31--64}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {14P05 (14P25 55R05 57R91)}, MRNUMBER = {95g:14059}, MRREVIEWER = {N. V. Ivanov}, } @article{Dovermann-Masuda-Suh(1994b), AUTHOR = {Dovermann, Karl Heinz and Masuda, Mikiya and Suh, Dong Youp}, TITLE = {Nonisomorphic algebraic models of a smooth manifold with group action}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {123}, YEAR = {1995}, NUMBER = {1}, PAGES = {55--61}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57S17 (14P25)}, MRNUMBER = {95c:57058}, MRREVIEWER = {Allan Edmonds}, } @article {Dovermann-Petrie(1983), AUTHOR = {Dovermann, Karl Heinz and Petrie, Ted}, TITLE = {{$G$}-surgery. {III}. {A}n induction theorem for equivariant surgery}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {105}, YEAR = {1983}, NUMBER = {6}, PAGES = {1369--1403}, ISSN = {0002-9327}, CODEN = {AJMAAN}, MRCLASS = {57R67 (57S17)}, MRNUMBER = {MR722002 (85h:57039)}, MRREVIEWER = {A. A. Ranicki}, } @article {Dovermann-Petrie(1982), AUTHOR = {Dovermann, Karl Heinz and Petrie, Ted}, TITLE = {{$G$} surgery. {II}}, JOURNAL = {Mem. Amer. Math. Soc.}, FJOURNAL = {Memoirs of the American Mathematical Society}, VOLUME = {37}, YEAR = {1982}, NUMBER = {260}, PAGES = {xxiii+118}, ISSN = {0065-9266}, CODEN = {MAMCAU}, MRCLASS = {57R65 (57R67 57R91 57S17 57S25)}, MRNUMBER = {MR652862 (84c:57025)}, MRREVIEWER = {Czes Kosniowski}, } @incollection {Dovermann-Rothenberg(1986), AUTHOR = {Dovermann, Karl Heinz and Rothenberg, Melvin}, TITLE = {An algebraic approach to the generalized {W}hitehead group}, BOOKTITLE = {Transformation groups, Pozna\'n 1985}, PAGES = {92--114}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1986}, MRCLASS = {57S17 (57Q10 57R80)}, MRNUMBER = {88f:57070}, MRREVIEWER = {Amir H. Assadi}, } @book{Dovermann-Schultz(1990), AUTHOR = {Dovermann, Karl Heinz and Schultz, Reinhard}, TITLE = {Equivariant surgery theories and their periodicity properties}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1990}, PAGES = {vi+227}, ISBN = {3-540-53042-8}, MRCLASS = {57R67 (57S17)}, MRNUMBER = {92c:57032}, MRREVIEWER = {Amir H. Assadi}, } @article {Dowdall+Kapovich+Leininger(2017), AUTHOR = {Dowdall, Spencer and Kapovich, Ilya and Leininger, Christopher J.}, TITLE = {Endomorphisms, train track maps, and fully irreducible monodromies}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {11}, YEAR = {2017}, NUMBER = {4}, PAGES = {1179--1200}, ISSN = {1661-7207}, MRCLASS = {20F65 (37C85 57M05)}, MRNUMBER = {3737279}, MRREVIEWER = {Alexander Fel\cprime shtyn}, DOI = {10.4171/GGD/425}, URL = {https://doi.org/10.4171/GGD/425}, } @article {Dowker(1955local-dim-of-normal), AUTHOR = {Dowker, C. H.}, TITLE = {Local dimension of normal spaces}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, FJOURNAL = {The Quarterly Journal of Mathematics. Oxford. Second Series}, VOLUME = {6}, YEAR = {1955}, PAGES = {101--120}, ISSN = {0033-5606}, MRCLASS = {54.0X}, MRNUMBER = {MR0086286 (19,157a)}, MRREVIEWER = {M. Henriksen}, } @article {Dowker(1947map), AUTHOR = {Dowker, C. H.}, TITLE = {Mapping theorems for non-compact spaces}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {69}, YEAR = {1947}, PAGES = {200--242}, ISSN = {0002-9327}, MRCLASS = {56.0X}, MRNUMBER = {MR0020771 (8,594g)}, MRREVIEWER = {H. Freudenthal}, } @article {Dowker(1947imb), AUTHOR = {Dowker, C. H.}, TITLE = {An imbedding theorem for paracompact metric spaces}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {14}, YEAR = {1947}, PAGES = {639--645}, ISSN = {0012-7094}, MRCLASS = {56.0X}, MRNUMBER = {MR0022344 (9,196g)}, MRREVIEWER = {J. Dieudonn{\'e}}, } @article {Dowker(1952), AUTHOR = {Dowker, C. H.}, TITLE = {Topology of metric complexes}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {74}, YEAR = {1952}, PAGES = {555--577}, ISSN = {0002-9327}, MRCLASS = {56.0X}, MRNUMBER = {0048020}, MRREVIEWER = {E. Spanier}, } @article {Dowker(1948), AUTHOR = {Dowker, C. H.}, TITLE = {An extension of {A}lexandroff's mapping theorem}, JOURNAL = {Bull. Amer. Math. Soc.}, VOLUME = {54}, YEAR = {1948}, PAGES = {386--391}, MRCLASS = {56.0X}, MRNUMBER = {MR0024622 (9,523e)}, MRREVIEWER = {J. Dieudonn{\'e}}, } @article {Dranishnikov(2010Lustrnik), AUTHOR = {Dranishnikov, Alexander}, TITLE = {The {L}usternik-{S}chnirelmann category and the fundamental group}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {10}, YEAR = {2010}, NUMBER = {2}, PAGES = {917--924}, ISSN = {1472-2747}, MRCLASS = {55M30}, MRNUMBER = {2629770 (2011h:55007)}, MRREVIEWER = {Rainer L{\"o}wen}, DOI = {10.2140/agt.2010.10.917}, URL = {http://dx.doi.org/10.2140/agt.2010.10.917}, } @article {Dranishnikov(2009approach), AUTHOR = {Dranishnikov, A.}, TITLE = {Cohomological approach to asymptotic dimension}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {141}, YEAR = {2009}, PAGES = {59--86}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F69 (18G99)}, MRNUMBER = {2520063 (2011a:20114)}, DOI = {10.1007/s10711-008-9343-0}, URL = {http://dx.doi.org/10.1007/s10711-008-9343-0}, } @article {Dranishnikov-RuDyak(2009Berstein_svarc), AUTHOR = {Dranishnikov, Alexander N. and Rudyak, Yuli B.}, TITLE = {On the {B}erstein-{S}varc theorem in dimension 2}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {146}, YEAR = {2009}, NUMBER = {2}, PAGES = {407--413}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {55M30}, MRNUMBER = {2475974 (2009k:55005)}, MRREVIEWER = {John F. Oprea}, DOI = {10.1017/S0305004108001904}, URL = {http://dx.doi.org/10.1017/S0305004108001904}, } @article {Dranishnikov(2009_2-dim_fund_gr), AUTHOR = {Dranishnikov, Alexander N.}, TITLE = {On the {L}usternik-{S}chnirelmann category of spaces with 2-dimensional fundamental group}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {137}, YEAR = {2009}, NUMBER = {4}, PAGES = {1489--1497}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {55M30}, MRNUMBER = {2465675 (2009i:55006)}, MRREVIEWER = {Jean-Baptiste Gatsinzi}, DOI = {10.1090/S0002-9939-08-09770-0}, URL = {http://dx.doi.org/10.1090/S0002-9939-08-09770-0}, } @article {Dranishnikov(2008Coxeter), AUTHOR = {Dranishnikov, Alexander}, TITLE = {On asymptotic dimension of amalgamated products and right-angled {C}oxeter groups}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {8}, YEAR = {2008}, NUMBER = {3}, PAGES = {1281--1293}, ISSN = {1472-2747}, MRCLASS = {20F65 (20F55 20F69)}, MRNUMBER = {2443244 (2009k:20096)}, MRREVIEWER = {Goulnara N. Arzhantseva}, DOI = {10.2140/agt.2008.8.1281}, URL = {http://dx.doi.org/10.2140/agt.2008.8.1281}, } @article {Dranishnikov(2006), AUTHOR = {Dranishnikov, A. N.}, TITLE = {Groups with a polynomial dimension growth}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {119}, YEAR = {2006}, PAGES = {1--15}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F65}, MRNUMBER = {2247644 (2007c:20099)}, MRREVIEWER = {Piotr W. Nowak}, DOI = {10.1007/s10711-005-9026-z}, URL = {http://dx.doi.org/10.1007/s10711-005-9026-z}, } @article {Dranishnikov-Ferry-Weinberger(2003), AUTHOR = {Dranishnikov, A. N. and Ferry, Steven C. and Weinberger, Shmuel}, TITLE = {Large {R}iemannian manifolds which are flexible}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {157}, YEAR = {2003}, NUMBER = {3}, PAGES = {919--938}, ISSN = {0003-486X}, MRCLASS = {53C23 (19K35 57R65)}, MRNUMBER = {1983785}, MRREVIEWER = {Paul D. Mitchener}, DOI = {10.4007/annals.2003.157.919}, URL = {https://doi.org/10.4007/annals.2003.157.919}, } @article {Dranishnikov-Ferry-Weinberger(2008), AUTHOR = {Dranishnikov, A. N. and Ferry, S. C. and Weinberger, S. A.}, TITLE = {An etale approach to the {N}ovikov conjecture}, JOURNAL = {Comm. Pure Appl. Math.}, FJOURNAL = {Communications on Pure and Applied Mathematics}, VOLUME = {61}, YEAR = {2008}, NUMBER = {2}, PAGES = {139--155}, ISSN = {0010-3640}, CODEN = {CPAMA}, MRCLASS = {57R67 (54D35 55P42)}, MRNUMBER = {2368371 (2008j:57054)}, MRREVIEWER = {A. A. Ranicki}, DOI = {10.1002/cpa.20222}, URL = {http://dx.doi.org/10.1002/cpa.20222}, } @article {Dranishnikov-Gong-Lafforgue-Yu(2002), AUTHOR = {Dranishnikov, A. N. and Gong, G. and Lafforgue, V. and Yu, G.}, TITLE = {Uniform embeddings into {H}ilbert space and a question of {G}romov}, JOURNAL = {Canad. Math. Bull.}, FJOURNAL = {Canadian Mathematical Bulletin. Bulletin Canadien de Math\'ematiques}, VOLUME = {45}, YEAR = {2002}, NUMBER = {1}, PAGES = {60--70}, ISSN = {0008-4395}, CODEN = {CMBUA3}, MRCLASS = {57N20 (46C05 54E40)}, MRNUMBER = {1 884 134}, MRREVIEWER = {Alain Valette}, } @article {Dranishnikov-Rudyak(2009systolic), AUTHOR = {Dranishnikov, Alexander N. and Rudyak, Yuli B.}, TITLE = {Stable systolic category of manifolds and the cup-length}, JOURNAL = {J. Fixed Point Theory Appl.}, FJOURNAL = {Journal of Fixed Point Theory and Applications}, VOLUME = {6}, YEAR = {2009}, NUMBER = {1}, PAGES = {165--177}, ISSN = {1661-7738}, MRCLASS = {55M30 (53C23 57N65)}, MRNUMBER = {2558490 (2011c:55008)}, DOI = {10.1007/s11784-009-0118-5}, URL = {http://dx.doi.org/10.1007/s11784-009-0118-5}, } @article {Dranishnikov-Smith(2007), AUTHOR = {Dranishnikov, A. N. and Smith, J.}, TITLE = {On asymptotic {A}ssouad-{N}agata dimension}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {154}, YEAR = {2007}, NUMBER = {4}, PAGES = {934--952}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {54F45 (20H15 55M10)}, MRNUMBER = {2294641 (2008m:54041)}, DOI = {10.1016/j.topol.2006.10.010}, URL = {http://dx.doi.org/10.1016/j.topol.2006.10.010}, } @article {Dress(1969), AUTHOR = {Dress, Andreas}, TITLE = {A characterisation of solvable groups}, JOURNAL = {Math. Z.}, VOLUME = {110}, YEAR = {1969}, PAGES = {213--217}, MRCLASS = {20.80}, MRNUMBER = {40 \#1491}, MRREVIEWER = {R. Schmidt}, } @incollection {Dress(1973), AUTHOR = {Dress, Andreas W. M.}, TITLE = {Contributions to the theory of induced representations}, BOOKTITLE = {Algebraic $K$-theory, II: ``Classical'' algebraic $K$-theory and connections with arithmetic (Proc. Conf., Battelle Memorial Inst., Seattle, Wash., 1972)}, PAGES = {183--240. Lecture Notes in Math., Vol. 342}, PUBLISHER = {Springer}, ADDRESS = {Berlin}, YEAR = {1973}, MRCLASS = {20C20 (18F25 18H10)}, MRNUMBER = {52 \#5787}, MRREVIEWER = {S. B. Conlon}, } @article{Dress(1975), AUTHOR = {Dress, Andreas W. M.}, TITLE = {Induction and structure theorems for orthogonal representations of finite groups}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {102}, YEAR = {1975}, NUMBER = {2}, PAGES = {291--325}, MRCLASS = {20C15 (18F25)}, MRNUMBER = {52 \#8235}, MRREVIEWER = {Winfried Scharlau}, } @article{Dress(1994a), AUTHOR = {Dress, Andreas W. M.}, TITLE = {One more shortcut to {G}alois theory}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {110}, YEAR = {1995}, NUMBER = {1}, PAGES = {129--140}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {16W20 (12F10)}, MRNUMBER = {95m:16023}, MRREVIEWER = {Vesselin Drensky}, } @article{Dress(1995), AUTHOR = {Dress, Andreas W. M.}, TITLE = {Basic noncommutative {G}alois theory}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {110}, YEAR = {1995}, NUMBER = {1}, PAGES = {141--173}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {16W20 (12F10 16K20 16S35)}, MRNUMBER = {95m:16024}, MRREVIEWER = {Vesselin Drensky}, } @article {Dress-Kuku(1981), AUTHOR = {Dress, Andreas W. M. and Kuku, Aderemi O.}, TITLE = {The {C}artan map for equivariant higher algebraic ${K}$-groups}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {9}, YEAR = {1981}, NUMBER = {7}, PAGES = {727--746}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {18F25 (20C99)}, MRNUMBER = {82i:18014}, MRREVIEWER = {Jean-Louis Loday}, } @incollection {Dress-Kuku(1982), AUTHOR = {Dress, Andreas W. M. and Kuku, Aderemi O.}, TITLE = {A convenient setting for equivariant higher algebraic ${K}$-theory}, BOOKTITLE = {Algebraic $K$-theory, Part I (Oberwolfach, 1980)}, PAGES = {59--68}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1982}, MRCLASS = {18F25 (20C07)}, MRNUMBER = {84k:18007}, } @article {Dress-Siebeneicher(1989), AUTHOR = {Dress, Andreas W. M. and Siebeneicher, Christian}, TITLE = {The {B}urnside ring of the infinite cyclic group and its relations to the necklace algebra, {$\lambda$}-rings, and the universal ring of {W}itt vectors}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {78}, YEAR = {1989}, NUMBER = {1}, PAGES = {1--41}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {18F30 (13F25)}, MRNUMBER = {90k:18015}, MRREVIEWER = {William H. Gustafson}, } @article {Dress-Siebeneicher-Yoshida(1988), AUTHOR = {Dress, Andreas W. M. and Siebeneicher, Christian}, TITLE = {The {B}urnside ring of profinite groups and the {W}itt vector construction}, JOURNAL = {Adv. in Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {70}, YEAR = {1988}, NUMBER = {1}, PAGES = {87--132}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {20E18 (12G99)}, MRNUMBER = {89m:20025}, MRREVIEWER = {H.-G. R{\"u}ck}, } @incollection {Dress-Siebeneicher-Yoshida(1991), AUTHOR = {Dress, Andreas and Siebeneicher, Christian and Yoshida, Tomoyuki}, TITLE = {Applications of {B}urnside rings in elementary group theory}, BOOKTITLE = {S\'eminaire Lotharingien de Combinatoire (Salzburg, 1990)}, SERIES = {Publ. Inst. Rech. Math. Av.}, VOLUME = {462}, PAGES = {71--81}, PUBLISHER = {Univ. Louis Pasteur}, ADDRESS = {Strasbourg}, YEAR = {1991}, MRCLASS = {19A22 (20C99)}, MRNUMBER = {93j:19001}, } @article {Dress-Siebeneicher-Yoshida(1992), AUTHOR = {Dress, Andreas W. M. and Siebeneicher, Christian and Yoshida, Tomoyuki}, TITLE = {An application of {B}urnside rings in elementary finite group theory}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {91}, YEAR = {1992}, NUMBER = {1}, PAGES = {27--44}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {20C99}, MRNUMBER = {92k:20018}, MRREVIEWER = {Esther Beneish}, } @article {Dress-Vallejo(1993), AUTHOR = {Dress, Andreas W. M. and Vallejo, Ernesto}, TITLE = {A simple proof for a result by {K}ratzer and {T}h\'evenaz concerning the embedding of the {B}urnside ring into its ghost ring}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {154}, YEAR = {1993}, NUMBER = {2}, PAGES = {356--359}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {19A22 (20C99)}, MRNUMBER = {MR1206125 (94a:19001)}, MRREVIEWER = {J{\"u}rgen Ritter}, } @article {Dries+Wilkie(1984), AUTHOR = {van den Dries, L. and Wilkie, A. J.}, TITLE = {Gromov's theorem on groups of polynomial growth and elementary logic}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {89}, YEAR = {1984}, NUMBER = {2}, PAGES = {349--374}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20F05 (03H05 20F26)}, MRNUMBER = {MR751150 (85k:20101)}, MRREVIEWER = {J. J. Cross}, } @article {Drinfeld(2004), AUTHOR = {Drinfeld, Vladimir}, TITLE = {D{G} quotients of {DG} categories}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {272}, YEAR = {2004}, NUMBER = {2}, PAGES = {643--691}, ISSN = {0021-8693}, MRCLASS = {18E30}, MRNUMBER = {2028075}, MRREVIEWER = {Peter J\o rgensen}, DOI = {10.1016/j.jalgebra.2003.05.001}, URL = {https://doi.org/10.1016/j.jalgebra.2003.05.001}, } @article{Dror-Farjoun(1987), AUTHOR = {Dror Farjoun, E.}, TITLE = {Homotopy theories for diagrams of spaces}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {101}, YEAR = {1987}, NUMBER = {1}, PAGES = {181--189}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {55P91 (18G30 55N91 55P10 55T15)}, MRNUMBER = {88h:55013}, MRREVIEWER = {Paul Selick}, } @incollection {Dror-Farjoun(1987a), AUTHOR = {Dror Farjoun, Emmanuel}, TITLE = {Homotopy and homology of diagrams of spaces}, BOOKTITLE = {Algebraic topology (Seattle, Wash., 1985)}, PAGES = {93--134}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1987}, MRCLASS = {55P65}, MRNUMBER = {89b:55012}, MRREVIEWER = {J. P. May}, } @book{Dror-Farjoun(1996), AUTHOR = {Farjoun, Emmanuel Dror}, TITLE = {Cellular spaces, null spaces and homotopy localization}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1996}, PAGES = {xiv+199}, ISBN = {3-540-60604-1}, MRCLASS = {55P60 (55-02 55P65)}, MRNUMBER = {98f:55010}, MRREVIEWER = {Carles Casacuberta}, } @article{Dror-Farjoun-Zabrodsky(1986), AUTHOR = {Dror Farjoun, E. and Zabrodsky, A.}, TITLE = {Homotopy equivalence between diagrams of spaces}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {41}, YEAR = {1986}, NUMBER = {2-3}, PAGES = {169--182}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55P99}, MRNUMBER = {87g:55021}, MRREVIEWER = {J. P. May}, } @article {Drutu(2002), AUTHOR = {Dru{\c{t}}u, Cornelia}, TITLE = {Quasi-isometry invariants and asymptotic cones}, NOTE = {International Conference on Geometric and Combinatorial Methods in Group Theory and Semigroup Theory (Lincoln, NE, 2000)}, JOURNAL = {Internat. J. Algebra Comput.}, FJOURNAL = {International Journal of Algebra and Computation}, VOLUME = {12}, YEAR = {2002}, NUMBER = {1-2}, PAGES = {99--135}, ISSN = {0218-1967}, MRCLASS = {20F65 (20F67 20F69 53C23)}, MRNUMBER = {MR1902363 (2003g:20069)}, MRREVIEWER = {Michel Coornaert}, } @book {Drutu+Kapovich(2018), AUTHOR = {Dru\c{t}u, Cornelia and Kapovich, Michael}, TITLE = {Geometric group theory}, SERIES = {American Mathematical Society Colloquium Publications}, VOLUME = {63}, NOTE = {With an appendix by Bogdan Nica}, PUBLISHER = {American Mathematical Society, Providence, RI}, YEAR = {2018}, PAGES = {xx+819}, ISBN = {978-1-4704-1104-6}, MRCLASS = {20F65 (20E08 20F05 20F16 20F18 20F67 20F69 57M07)}, MRNUMBER = {3753580}, MRREVIEWER = {Igor Belegradek}, DOI = {10.1090/coll/063}, URL = {https://doi.org/10.1090/coll/063}, } @article {Drutu+Sapir(2005nonlinres), AUTHOR = {Dru{\c{t}}u, Cornelia and Sapir, Mark}, TITLE = {Non-linear residually finite groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {284}, YEAR = {2005}, NUMBER = {1}, PAGES = {174--178}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20E26}, MRNUMBER = {MR2115010 (2005i:20045)}, MRREVIEWER = {Avinoam Mann}, } @article {Drutu+Sapir(2005decay), AUTHOR = {Dru{\c{t}}u, Cornelia and Sapir, Mark}, TITLE = {Relatively hyperbolic groups with rapid decay property}, JOURNAL = {Int. Math. Res. Not.}, FJOURNAL = {International Mathematics Research Notices}, YEAR = {2005}, VOLUME = {19}, PAGES = {1181--1194}, ISSN = {1073-7928}, MRCLASS = {20F67}, MRNUMBER = {MR2147058 (2006d:20077)}, MRREVIEWER = {Paul D. Mitchener}, } @article {Drutu+Sapir(2005tree), AUTHOR = {Dru{\c{t}}u, Cornelia and Sapir, Mark}, TITLE = {Tree-graded spaces and asymptotic cones of groups}, NOTE = {With an appendix by Denis Osin and Sapir}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {44}, YEAR = {2005}, NUMBER = {5}, PAGES = {959--1058}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {20F67 (57M07)}, MRNUMBER = {MR2153979 (2006d:20078)}, MRREVIEWER = {Ilya Kapovich}, } @article {Dubois-Friedl-Lueck(2016), AUTHOR = {Dubois, J{\'e}r{\^o}me and Friedl, Stefan and L{\"u}ck, Wolfgang}, TITLE = {The {$L^2$}-{A}lexander torsion of 3-manifolds}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {9}, YEAR = {2016}, NUMBER = {3}, PAGES = {889--926}, ISSN = {1753-8416}, MRCLASS = {Preliminary Data}, MRNUMBER = {3551842}, DOI = {10.1112/jtopol/jtw013}, URL = {http://dx.doi.org/10.1112/jtopol/jtw013}, } @article {Dubois-Friedl-Lueck(2015symmetric), AUTHOR = {Dubois, J{\'e}r{\^o}me and Friedl, Stefan and L{\"u}ck, Wolfgang}, TITLE = {The {L}2--{A}lexander torsion is symmetric}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {15}, YEAR = {2015}, NUMBER = {6}, PAGES = {3599--3612}, ISSN = {1472-2747}, MRCLASS = {57M27 (57Q10)}, MRNUMBER = {3450772}, DOI = {10.2140/agt.2015.15.3599}, URL = {http://dx.doi.org/10.2140/agt.2015.15.3599}, } @article {Dubois-Friedl-Lueck(2015CRMASP), AUTHOR = {Dubois, J{\'e}r{\^o}me and Friedl, Stefan and L{\"u}ck, Wolfgang}, TITLE = {The {$L^2$}-{A}lexander torsions of 3-manifolds}, JOURNAL = {C. R. Math. Acad. Sci. Paris}, FJOURNAL = {Comptes Rendus Math\'ematique. Acad\'emie des Sciences. Paris}, VOLUME = {353}, YEAR = {2015}, NUMBER = {1}, PAGES = {69--73}, ISSN = {1631-073X}, MRCLASS = {Preliminary Data}, MRNUMBER = {3285150}, DOI = {10.1016/j.crma.2014.10.012}, URL = {http://dx.doi.org/10.1016/j.crma.2014.10.012}, } @incollection {Dubois-Friedl-Lueck(2015flavors), author = {Dubois, Jerome and Friedl, Stefan and L\"uck, Wolfgang}, title = {Three flavors of twisted knot invariants}, BOOKTITLE = {Introduction to modern mathematics}, series = {Advanced Lecture in Mathematics}, VOLUME = {33}, YEAR = {2015}, PAGES = {143-170}, PUBLISHER = {International Press}, } @article{Dubois-Wegner(2010), AUTHOR = {Dubois, J{\'e}r{\^o}me and Wegner, Christian}, TITLE = {{$L^2$}-{A}lexander invariant for torus knots}, JOURNAL = {C. R. Math. Acad. Sci. Paris}, FJOURNAL = {Comptes Rendus Math\'ematique. Acad\'emie des Sciences. Paris}, VOLUME = {348}, YEAR = {2010}, NUMBER = {21-22}, PAGES = {1185--1189}, ISSN = {1631-073X}, MRCLASS = {57M27 (57M25)}, MRNUMBER = {2738924}, DOI = {10.1016/j.crma.2010.10.008}, URL = {http://dx.doi.org/10.1016/j.crma.2010.10.008}, } @article {Dubois-Wegner(2015), AUTHOR = {Dubois, J{\'e}r{\^o}me and Wegner, Christian}, TITLE = {Weighted {$L^2$}-invariants and applications to knot theory}, JOURNAL = {Commun. Contemp. Math.}, FJOURNAL = {Communications in Contemporary Mathematics}, VOLUME = {17}, YEAR = {2015}, NUMBER = {1}, PAGES = {1450010, 29}, ISSN = {0219-1997}, MRCLASS = {57M25 (57M27)}, MRNUMBER = {3291974}, MRREVIEWER = {Teruhisa Kadokami}, DOI = {10.1142/S0219199714500102}, URL = {http://dx.doi.org/10.1142/S0219199714500102}, } @book{Dubrovin-Fomenko-Novikov(1984), AUTHOR = {Dubrovin, B. A. and Fomenko, A. T. and Novikov, S. P.}, TITLE = {Modern geometry---methods and applications. {P}art {I}}, NOTE = {The geometry of surfaces, transformation groups, and fields, Translated from the Russian by Robert G. Burns}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1984}, PAGES = {xv+464}, ISBN = {0-387-90872-2}, MRCLASS = {53-01 (00A05 58-01)}, MRNUMBER = {85a:53003}, } @book{Dubrovin-Fomenko-Novikov(1985), AUTHOR = {Dubrovin, B. A. and Fomenko, A. T. and Novikov, S. P.}, TITLE = {Modern geometry---methods and applications. {P}art {I}{I}}, NOTE = {The geometry and topology of manifolds, Translated from the Russian by Robert G. Burns}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1985}, PAGES = {xv+430}, ISBN = {0-387-96162-3}, MRCLASS = {53-01 (00A69 52-01 58-01 81-01)}, MRNUMBER = {86m:53001}, } @book{Dubrovin-Fomenko-Novikov(1990), AUTHOR = {Dubrovin, B. A. and Fomenko, A. T. and Novikov, S. P.}, TITLE = {Modern geometry---methods and applications. {P}art {I}{I}{I}}, NOTE = {Introduction to homology theory, Translated from the Russian by Robert G. Burns}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1990}, PAGES = {x+416}, ISBN = {0-387-97271-4}, MRCLASS = {55-02 (57-02 58-01)}, MRNUMBER = {91j:55001}, } @article{Duchamp-Reutenauer(1997), AUTHOR = {Duchamp, G{\'e}rard and Reutenauer, Christophe}, TITLE = {Un crit\`ere de rationalit\'e provenant de la g\'eom\'etrie non commutative}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {128}, YEAR = {1997}, NUMBER = {3}, PAGES = {613--622}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {22D15 (58B30)}, MRNUMBER = {99d:22009}, } @article {Dugger(2006), AUTHOR = {Dugger, Daniel}, TITLE = {Spectral enrichments of model categories}, JOURNAL = {Homology, Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {8}, YEAR = {2006}, NUMBER = {1}, PAGES = {1--30 (electronic)}, ISSN = {1532-0073}, MRCLASS = {55U35}, MRNUMBER = {MR2205213 (2006k:55034)}, MRREVIEWER = {Thomas H{\"u}ttemann}, } @article {Dugger(2005), AUTHOR = {Dugger, Daniel}, TITLE = {An {A}tiyah-{H}irzebruch spectral sequence for {$KR$}-theory}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {35}, YEAR = {2005}, NUMBER = {3-4}, PAGES = {213--256 (2006)}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19L64 (55S45 55T25)}, MRNUMBER = {MR2240234 (2007g:19004)}, MRREVIEWER = {G{\'e}rald Gaudens}, } @article {Dugger(2001presentations), AUTHOR = {Dugger, Daniel}, TITLE = {Combinatorial model categories have presentations}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {164}, YEAR = {2001}, NUMBER = {1}, PAGES = {177--201}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {18G55 (18E20 55U10)}, MRNUMBER = {MR1870516 (2002k:18022)}, MRREVIEWER = {Manuel Bullejos Lorenzo}, } @article {Dugger(2001universal), AUTHOR = {Dugger, Daniel}, TITLE = {Universal homotopy theories}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {164}, YEAR = {2001}, NUMBER = {1}, PAGES = {144--176}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {18G55 (18E20 55U10)}, MRNUMBER = {MR1870515 (2002k:18021)}, MRREVIEWER = {Manuel Bullejos Lorenzo}, } @article {Dugger(2001replacing), AUTHOR = {Dugger, Daniel}, TITLE = {Replacing model categories with simplicial ones}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {353}, YEAR = {2001}, NUMBER = {12}, PAGES = {5003--5027 (electronic)}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {55U35 (18G30 18G55)}, MRNUMBER = {MR1852091 (2002f:55043)}, MRREVIEWER = {David A. Blanc}, } @article {Dugger-Hollander-Isaksen(2004), AUTHOR = {Dugger, Daniel and Hollander, Sharon and Isaksen, Daniel C.}, TITLE = {Hypercovers and simplicial presheaves}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {136}, YEAR = {2004}, NUMBER = {1}, PAGES = {9--51}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {18F20 (55U35)}, MRNUMBER = {MR2034012 (2004k:18007)}, MRREVIEWER = {Manuel Bullejos Lorenzo}, } @article {Dugger-Isaksen(2008etal), AUTHOR = {Dugger, Daniel and Isaksen, Daniel C.}, TITLE = {Etale homotopy and sums-of-squares formulas}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {145}, YEAR = {2008}, NUMBER = {1}, PAGES = {1--25}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {55Nxx}, MRNUMBER = {MR2431636}, } @article {Dugger-Isaksen(2007), AUTHOR = {Dugger, Daniel and Isaksen, Daniel C.}, TITLE = {The {H}opf condition for bilinear forms over arbitrary fields}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {165}, YEAR = {2007}, NUMBER = {3}, PAGES = {943--964}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {11E39 (14F42)}, MRNUMBER = {MR2335798 (2008g:11064)}, MRREVIEWER = {Ramdorai Sujatha}, } @article {Dugger-Isaksen(2005sumofsquares), AUTHOR = {Dugger, Daniel and Isaksen, Daniel C.}, TITLE = {Algebraic {$K$}-theory and sums-of-squares formulas}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, VOLUME = {10}, YEAR = {2005}, PAGES = {357--366 (electronic)}, ISSN = {1431-0635}, MRCLASS = {11E25 (19E08)}, MRNUMBER = {MR2184457 (2006g:11077)}, MRREVIEWER = {Ramdorai Sujatha}, } @article {Dugger-Isaksen(2005motivic), AUTHOR = {Dugger, Daniel and Isaksen, Daniel C.}, TITLE = {Motivic cell structures}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {5}, YEAR = {2005}, PAGES = {615--652 (electronic)}, ISSN = {1472-2747}, MRCLASS = {55U35 (14F42)}, MRNUMBER = {MR2153114 (2007c:55015)}, MRREVIEWER = {Oliver R{\"o}ndigs}, } @incollection {Dugger-Isaksen(2004presheaves), AUTHOR = {Dugger, Daniel and Isaksen, Daniel C.}, TITLE = {Weak equivalences of simplicial presheaves}, BOOKTITLE = {Homotopy theory: relations with algebraic geometry, group cohomology, and algebraic {$K$}-theory}, SERIES = {Contemp. Math.}, VOLUME = {346}, PAGES = {97--113}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2004}, MRCLASS = {18F20 (55U35)}, MRNUMBER = {MR2066498 (2005e:18018)}, MRREVIEWER = {Timothy Porter}, } @article {Dugger-Isaksen(2004hypercover), AUTHOR = {Dugger, Daniel and Isaksen, Daniel C.}, TITLE = {Topological hypercovers and {$\Bbb A\sp 1$}-realizations}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {246}, YEAR = {2004}, NUMBER = {4}, PAGES = {667--689}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {55U35 (14F20 14F42)}, MRNUMBER = {MR2045835 (2005d:55026)}, MRREVIEWER = {Elias Gabriel Minian}, } @article {Dugger-Shipley(2009), AUTHOR = {Dugger, Daniel and Shipley, Brooke}, TITLE = {A curious example of triangulated-equivalent model categories which are not {Q}uillen equivalent}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {9}, YEAR = {2009}, NUMBER = {1}, PAGES = {135--166}, MRCLASS = {55Uxx (18Exx)}, MRNUMBER = {MR2482071}, } @article {Dugger-Shipley(2007enriched), AUTHOR = {Dugger, Daniel and Shipley, Brooke}, TITLE = {Enriched model categories and an application to additive endomorphism spectra}, JOURNAL = {Theory Appl. Categ.}, FJOURNAL = {Theory and Applications of Categories}, VOLUME = {18}, YEAR = {2007}, PAGES = {No. 15, 400--439 (electronic)}, ISSN = {1201-561X}, MRCLASS = {18D20 (55P42 55U35)}, MRNUMBER = {MR2342167 (2009d:18012)}, } @article {Dugger-Shipley(2007gradedalgebras), AUTHOR = {Dugger, Daniel and Shipley, Brooke}, TITLE = {Topological equivalences for differential graded algebras}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {212}, YEAR = {2007}, NUMBER = {1}, PAGES = {37--61}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {55U35 (18G55 55P43)}, MRNUMBER = {MR2319762 (2008e:55025)}, MRREVIEWER = {Paul Arne {\O}stv{\ae}r}, } @article {Dugger-Shipley(2006), AUTHOR = {Dugger, Daniel and Shipley, Brooke}, TITLE = {Postnikov extensions of ring spectra}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {6}, YEAR = {2006}, PAGES = {1785--1829 (electronic)}, ISSN = {1472-2747}, MRCLASS = {55P43 (55S45)}, MRNUMBER = {MR2263050 (2007g:55007)}, MRREVIEWER = {Donald M. Davis}, } @article {Dugger-Shipley(2004), AUTHOR = {Dugger, Daniel and Shipley, Brooke}, TITLE = {{$K$}-theory and derived equivalences}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {124}, YEAR = {2004}, NUMBER = {3}, PAGES = {587--617}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {19D99 (18E30 55U35)}, MRNUMBER = {MR2085176 (2005e:19005)}, MRREVIEWER = {Daniel C. Isaksen}, } @book{Duistermaat(1996), AUTHOR = {Duistermaat, J. J.}, TITLE = {The heat kernel {L}efschetz fixed point formula for the spin-$c$ {D}irac operator}, PUBLISHER = {Birkh\"auser Boston Inc.}, ADDRESS = {Boston, MA}, YEAR = {1996}, PAGES = {viii+247}, ISBN = {0-8176-3865-2}, MRCLASS = {58G10 (58F06 58G11)}, MRNUMBER = {97d:58181}, } @article {DuistermaatGuillemin(1975), AUTHOR = {Duistermaat, J. J. and Guillemin, V. W.}, TITLE = {The spectrum of positive elliptic operators and periodic bicharacteristics}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {29}, YEAR = {1975}, NUMBER = {1}, PAGES = {39--79}, ISSN = {0020-9910}, MRCLASS = {58G99 (35P05)}, MRNUMBER = {MR0405514 (53 \#9307)}, MRREVIEWER = {Alan Weinstein}, } @Book {Dummit-Foote(1999), author = {Dummit, David S. and Foote, Richard M.}, title = {Abstract algebra}, publisher = {Prentice Hall Inc.}, edition = {second}, year = {1999}, } @article{Dunbar-Meyerhoff(1994), AUTHOR = {Dunbar, William D. and Meyerhoff, G. Robert}, TITLE = {Volumes of hyperbolic $3$-orbifolds}, JOURNAL = {Indiana Univ. Math. J.}, FJOURNAL = {Indiana University Mathematics Journal}, VOLUME = {43}, YEAR = {1994}, NUMBER = {2}, PAGES = {611--637}, ISSN = {0022-2518}, CODEN = {IUMJAB}, MRCLASS = {57M50 (30F40)}, MRNUMBER = {95g:57024}, MRREVIEWER = {Colin C. Adams}, } @Article{Dundas(1997), author = {Dundas, B.I.}, title = {{Relative $K$-theory and topological cyclic homology}}, journal = {ActaMat}, volume = 179, pages = {223-242}, year = 1997, } @incollection {Dundas(2000), AUTHOR = {Dundas, Bj{\o}rn Ian}, TITLE = {The cyclotomic trace for symmetric monoidal categories}, BOOKTITLE = {Geometry and topology: Aarhus (1998)}, SERIES = {Contemp. Math.}, VOLUME = {258}, PAGES = {121--143}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {2000}, MRCLASS = {19D23 (18D20 19D55 55P43)}, MRNUMBER = {2002g:19002}, } @book {Dundas-Goodwillie-McCarthy(2013), AUTHOR = {Dundas, Bj{\o}rn Ian and Goodwillie, Thomas G. and McCarthy, Randy}, TITLE = {The local structure of algebraic {K}-theory}, SERIES = {Algebra and Applications}, VOLUME = {18}, PUBLISHER = {Springer-Verlag London Ltd.}, ADDRESS = {London}, YEAR = {2013}, PAGES = {xvi+435}, ISBN = {978-1-4471-4392-5; 978-1-4471-4393-2}, MRCLASS = {19-02 (16E40 19D55 55-02 55N99)}, MRNUMBER = {3013261}, MRREVIEWER = {Charles Weibel}, } @article{Dundas-McCarthy(1994), AUTHOR = {Dundas, Bj{\o}rn Ian and McCarthy, Randy}, TITLE = {Stable ${K}$-theory and topological {H}ochschild homology}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {140}, YEAR = {1994}, NUMBER = {3}, PAGES = {685--701}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {19D55 (18G60 19D06)}, MRNUMBER = {96e:19005a}, MRREVIEWER = {Ross Staffeldt}, } @article{Dundas-McCarthy(1995), AUTHOR = {Dundas, Bj{\o}rn Ian and McCarthy, Randy}, TITLE = {Erratum: ``{S}table ${K}$-theory and topological {H}ochschild homology''}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {142}, YEAR = {1995}, NUMBER = {2}, PAGES = {425--426}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {19D55 (18G60 19D06)}, MRNUMBER = {96e:19005b}, MRREVIEWER = {Ross Staffeldt}, } @article {Dundas-McCarthy(1996), AUTHOR = {Dundas, Bj{\o}rn Ian and McCarthy, Randy}, TITLE = {Topological {H}ochschild homology of ring functors and exact categories}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {109}, YEAR = {1996}, NUMBER = {3}, PAGES = {231--294}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {19D55 (16E40 18G30 18G60)}, MRNUMBER = {97i:19001}, MRREVIEWER = {Teimuraz Pirashvili}, } @article {Dunfield(2001), AUTHOR = {Dunfield, Nathan M.}, TITLE = {Alexander and {T}hurston norms of fibered 3-manifolds}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {200}, YEAR = {2001}, NUMBER = {1}, PAGES = {43--58}, ISSN = {0030-8730}, MRCLASS = {57N10 (57M50)}, MRNUMBER = {1863406}, URL = {https://doi.org/10.2140/pjm.2001.200.43}, } @article {Dunfield-Friedl-Jackson(2012), AUTHOR = {Dunfield, Nathan M. and Friedl, Stefan and Jackson, Nicholas}, TITLE = {Twisted {A}lexander polynomials of hyperbolic knots}, JOURNAL = {Exp. Math.}, FJOURNAL = {Experimental Mathematics}, VOLUME = {21}, YEAR = {2012}, NUMBER = {4}, PAGES = {329--352}, ISSN = {1058-6458}, MRCLASS = {57M25}, MRNUMBER = {3004250}, DOI = {10.1080/10586458.2012.669268}, URL = {http://dx.doi.org/10.1080/10586458.2012.669268}, } @article {Dunfield-Friedl-Jackson(2012), AUTHOR = {Dunfield, Nathan M. and Friedl, Stefan and Jackson, Nicholas}, TITLE = {Twisted {A}lexander polynomials of hyperbolic knots}, JOURNAL = {Exp. Math.}, FJOURNAL = {Experimental Mathematics}, VOLUME = {21}, YEAR = {2012}, NUMBER = {4}, PAGES = {329--352}, ISSN = {1058-6458}, MRCLASS = {57M25}, MRNUMBER = {3004250}, DOI = {10.1080/10586458.2012.669268}, URL = {http://dx.doi.org/10.1080/10586458.2012.669268}, } @article {Dunwoody(1972), AUTHOR = {Dunwoody, M. J.}, TITLE = {Relation modules}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {4}, YEAR = {1972}, PAGES = {151--155}, ISSN = {0024-6093}, MRCLASS = {20F05}, MRNUMBER = {MR0327915 (48 \#6257)}, MRREVIEWER = {K. W. Gruenberg}, } @article{Dunwoody(1975), AUTHOR = {Dunwoody, M. J.}, TITLE = {${K}\sb{2}(\mathbb{{Z}}\Pi )$ for $\Pi $ a group of order two or three}, JOURNAL = {J. London Math. Soc. (2)}, VOLUME = {11}, YEAR = {1975}, NUMBER = {4}, PAGES = {481--490}, MRCLASS = {18F25 (20C05)}, MRNUMBER = {52 \#10849}, MRREVIEWER = {L. R. Vermani}, } @article{Dunwoody(1979), AUTHOR = {Dunwoody, M. J.}, TITLE = {Accessibility and groups of cohomological dimension one}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {38}, YEAR = {1979}, NUMBER = {2}, PAGES = {193--215}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {20J05 (20E99)}, MRNUMBER = {80i:20024}, MRREVIEWER = {D. E. Cohen}, } @article{Dunwoody(1985), AUTHOR = {Dunwoody, M. J.}, TITLE = {The accessibility of finitely presented groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {81}, YEAR = {1985}, NUMBER = {3}, PAGES = {449--457}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20E06 (54H99 57M99)}, MRNUMBER = {87d:20037}, MRREVIEWER = {D. E. Cohen}, } @article {Dunwoody+Sageev(1999), AUTHOR = {Dunwoody, M. J. and Sageev, M. E.}, TITLE = {J{SJ}-splittings for finitely presented groups over slender groups}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {135}, YEAR = {1999}, NUMBER = {1}, PAGES = {25--44}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {20F65 (20E06 20E08 57M05 57M07 57N10)}, MRNUMBER = {MR1664694 (2000b:20050)}, MRREVIEWER = {Thomas Delzant}, } @article {Dunwoody-Swenson(2000), AUTHOR = {Dunwoody, M. J. and Swenson, E. L.}, TITLE = {The algebraic torus theorem}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {140}, YEAR = {2000}, NUMBER = {3}, PAGES = {605--637}, ISSN = {0020-9910}, MRCLASS = {20F65}, MRNUMBER = {1760752}, MRREVIEWER = {Ilya Kapovich}, DOI = {10.1007/s002220000063}, URL = {http://dx.doi.org/10.1007/s002220000063}, } @book{Dupont(1978), AUTHOR = {Dupont, Johan L.}, TITLE = {Curvature and characteristic classes}, NOTE = {Lecture Notes in Mathematics, Vol. 640}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1978}, PAGES = {viii+175}, ISBN = {3-540-08663-3}, MRCLASS = {57D20 (53-02)}, MRNUMBER = {58 \#18477}, MRREVIEWER = {D. Lehmann}, } @proceedings {Dupont-Madsen(1979), TITLE = {Algebraic topology, {A}arhus 1978}, BOOKTITLE = {Proceedings of a Symposium held at the University of Aarhus, Aarhus, August 7--12, 1978}, EDITOR = {Dupont, Johan Louis and Madsen, Ib Henning}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1979}, PAGES = {vi+695}, ISBN = {3-540-09721-X}, MRCLASS = {55-06 (18F25 57-06)}, MRNUMBER = {81b:55001}, } @article{Dwyer(1975), AUTHOR = {Dwyer, William G.}, TITLE = {Homology, {M}assey products and maps between groups}, JOURNAL = {J. Pure Appl. Algebra}, VOLUME = {6}, YEAR = {1975}, NUMBER = {2}, PAGES = {177--190}, MRCLASS = {55E35 (20J05)}, MRNUMBER = {52 \#6710}, MRREVIEWER = {Timothy Porter}, } @Article{Dwyer(1980), author = {Dwyer, W.G.}, title = {{Twisted homological stability for general linear group}}, journal = {Annals of Mathematics}, volume = 11, pages = {239--251}, year = 1980, } @incollection {Dwyer(1996), AUTHOR = {Dwyer, W. G.}, TITLE = {The centralizer decomposition of ${B}{G}$}, BOOKTITLE = {Algebraic topology: new trends in localization and periodicity (Sant Feliu de Gu\'\i xols, 1994)}, PAGES = {167--184}, PUBLISHER = {Birkh\"auser}, ADDRESS = {Basel}, YEAR = {1996}, MRCLASS = {55R35 (55P60)}, MRNUMBER = {97i:55028}, MRREVIEWER = {Haynes R. Miller}, } @article {Dwyertransfer(1996), AUTHOR = {Dwyer, W. G.}, TITLE = {Transfer maps for fibrations}, JOURNAL = {Math. Proc. Cambridge Philos. Soc.}, FJOURNAL = {Mathematical Proceedings of the Cambridge Philosophical Society}, VOLUME = {120}, YEAR = {1996}, NUMBER = {2}, PAGES = {221--235}, ISSN = {0305-0041}, CODEN = {MPCPCO}, MRCLASS = {55R12}, MRNUMBER = {MR1384465 (97h:55014)}, MRREVIEWER = {A. D. Elmendorf}, } @article{Dwyer(1997), AUTHOR = {Dwyer, W. G.}, TITLE = {Homology decompositions for classifying spaces of finite groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {36}, YEAR = {1997}, NUMBER = {4}, PAGES = {783--804}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55R35 (18E15 55R40)}, MRNUMBER = {97m:55016}, MRREVIEWER = {Francis Clarke}, } @article {Dwyer-Friedlander-Mitchell(1992), AUTHOR = {Dwyer, W. G. and Friedlander, E. M. and Mitchell, S. A.}, TITLE = {The generalized {B}urnside ring and the {$K$}-theory of a ring with roots of unity}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {6}, YEAR = {1992}, NUMBER = {4}, PAGES = {285--300}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19F99 (55P42)}, MRNUMBER = {MR1193146 (93m:19010)}, MRREVIEWER = {V. P. Snaith}, } @article {Dwyer(2008), AUTHOR = {Dwyer, Christopher}, TITLE = {Twisted equivariant {$K$}-theory for proper actions of discrete groups}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {38}, YEAR = {2008}, NUMBER = {2}, PAGES = {95--111}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {19L47 (55N15 55N91)}, MRNUMBER = {MR2366557 (2008k:19006)}, MRREVIEWER = {Thomas Schick}, } @article {Dwyer-Friedlander(1994), AUTHOR = {Dwyer, William G. and Friedlander, Eric M.}, TITLE = {Topological models for arithmetic}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {33}, YEAR = {1994}, NUMBER = {1}, PAGES = {1--24}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {19M05 (55N15)}, MRNUMBER = {1259512 (95h:19004)}, MRREVIEWER = {V. P. Snaith}, DOI = {10.1016/0040-9383(94)90032-9}, URL = {http://dx.doi.org/10.1016/0040-9383(94)90032-9}, } @article {Dwyer-Friedlander(1985), AUTHOR = {Dwyer, William G. and Friedlander, Eric M.}, TITLE = {Algebraic and etale {$K$}-theory}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {292}, YEAR = {1985}, NUMBER = {1}, PAGES = {247--280}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {18F25 (11R70 19F27 55N15)}, MRNUMBER = {805962 (87h:18013)}, MRREVIEWER = {A. J. Berrick}, DOI = {10.2307/2000179}, URL = {http://dx.doi.org/10.2307/2000179}, } @inproceedings {Dwyer-Friedlander(1984), AUTHOR = {Dwyer, William G. and Friedlander, Eric M.}, TITLE = {\'{E}tale {$K$}-theory of {A}zumaya algebras}, BOOKTITLE = {Proceedings of the {L}uminy conference on algebraic {$K$}-theory ({L}uminy, 1983)}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {34}, YEAR = {1984}, NUMBER = {2-3}, PAGES = {179--191}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {18F25 (14F99 19E08 19F27)}, MRNUMBER = {772057 (86j:18009)}, DOI = {10.1016/0022-4049(84)90035-5}, URL = {http://dx.doi.org/10.1016/0022-4049(84)90035-5}, } @article{Dwyer-Hopkins-Kan(1985), AUTHOR = {Dwyer, W. G. and Hopkins, M. J. and Kan, D. M.}, TITLE = {The homotopy theory of cyclic sets}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {291}, YEAR = {1985}, NUMBER = {1}, PAGES = {281--289}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {55P15 (18F25 19D55 55U35)}, MRNUMBER = {86m:55014}, MRREVIEWER = {Claude Schochet}, } @article{Dwyer-Kan(1980a), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Calculating simplicial localizations}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {18}, YEAR = {1980}, NUMBER = {1}, PAGES = {17--35}, ISSN = {0022-4049}, MRCLASS = {55U35 (18D20)}, MRNUMBER = {81h:55019}, MRREVIEWER = {Timothy Porter}, } @article{Dwyer-Kan(1980b), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Simplicial localizations of categories}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {17}, YEAR = {1980}, NUMBER = {3}, PAGES = {267--284}, ISSN = {0022-4049}, MRCLASS = {55U35 (18D20)}, MRNUMBER = {81h:55018}, MRREVIEWER = {Timothy Porter}, } @article{Dwyer-Kan(1983), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Function complexes for diagrams of simplicial sets}, JOURNAL = {Nederl. Akad. Wetensch. Indag. Math.}, FJOURNAL = {Koninklijke Nederlandse Akademie van Wetenschappen. Indagationes Mathematicae}, VOLUME = {45}, YEAR = {1983}, NUMBER = {2}, PAGES = {139--147}, ISSN = {0019-3577}, CODEN = {IMTHBJ}, MRCLASS = {55U10}, MRNUMBER = {85e:55038}, MRREVIEWER = {R. Fritsch}, } @article{Dwyer-Kan(1984a), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {A classification theorem for diagrams of simplicial sets}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {23}, YEAR = {1984}, NUMBER = {2}, PAGES = {139--155}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55P15 (55U35)}, MRNUMBER = {86c:55010a}, MRREVIEWER = {J. P. May}, } @article{Dwyer-Kan(1984b), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {An obstruction theory for diagrams of simplicial sets}, JOURNAL = {Nederl. Akad. Wetensch. Indag. Math.}, FJOURNAL = {Koninklijke Nederlandse Akademie van Wetenschappen. Indagationes Mathematicae}, VOLUME = {46}, YEAR = {1984}, NUMBER = {2}, PAGES = {139--146}, ISSN = {0019-3577}, CODEN = {IMTHBJ}, MRCLASS = {55P15 (55U35)}, MRNUMBER = {86c:55010c}, MRREVIEWER = {J. P. May}, } @article{Dwyer-Kan(1984c), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Realizing diagrams in the homotopy category by means of diagrams of simplicial sets}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {91}, YEAR = {1984}, NUMBER = {3}, PAGES = {456--460}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {55P15 (55U35)}, MRNUMBER = {86c:55010b}, MRREVIEWER = {J. P. May}, } @article{Dwyer-Kan(1984d), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Singular functors and realization functors}, JOURNAL = {Nederl. Akad. Wetensch. Indag. Math.}, FJOURNAL = {Koninklijke Nederlandse Akademie van Wetenschappen. Indagationes Mathematicae}, VOLUME = {46}, YEAR = {1984}, NUMBER = {2}, PAGES = {147--153}, ISSN = {0019-3577}, CODEN = {IMTHBJ}, MRCLASS = {55P15 (55U35)}, MRNUMBER = {86c:55010d}, MRREVIEWER = {J. P. May}, } @article{Dwyer-Kan(1985a), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Equivariant homotopy classification}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {35}, YEAR = {1985}, NUMBER = {3}, PAGES = {269--285}, ISSN = {0022-4049}, CODEN = {JPAAA2}, MRCLASS = {55P15 (55P91)}, MRNUMBER = {86h:55008}, MRREVIEWER = {Haynes R. Miller}, } @incollection {Dwyer-Kan(1985b), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Reducing equivariant homotopy theory to the theory of fibrations}, BOOKTITLE = {Conference on algebraic topology in honor of Peter Hilton (Saint John's, Nfld., 1983)}, PAGES = {35--49}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1985}, MRCLASS = {55P91 (55R05)}, MRNUMBER = {87h:55010}, } @incollection {Dwyer-Kan(1987), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Equivalences between homotopy theories of diagrams}, BOOKTITLE = {Algebraic topology and algebraic $K$-theory (Princeton, N.J., 1983)}, PAGES = {180--205}, PUBLISHER = {Princeton Univ. Press}, ADDRESS = {Princeton, NJ}, YEAR = {1987}, MRCLASS = {55U35 (18A25 18G30 55U10)}, MRNUMBER = {89d:55051}, MRREVIEWER = {L. Gaunce Lewis, Jr.}, } @article{Dwyer-Kan(1992), AUTHOR = {Dwyer, W. G. and Kan, D. M.}, TITLE = {Centric maps and realization of diagrams in the homotopy category}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {114}, YEAR = {1992}, NUMBER = {2}, PAGES = {575--584}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {55P65}, MRNUMBER = {92e:55011}, MRREVIEWER = {Timothy Porter}, } @incollection{Dwyer-Spalinski(1994), AUTHOR = {Dwyer, W. G. and Spali{\'n}ski, J.}, TITLE = {Homotopy theories and model categories}, BOOKTITLE = {Handbook of algebraic topology}, PAGES = {73--126}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {1995}, MRCLASS = {55Uxx (18E35)}, MRNUMBER = {96h:55014}, MRREVIEWER = {Yves F{\'e}lix}, } @incollection {Dwyer-Schick-Stolz(2003), AUTHOR = {Dwyer, William and Schick, Thomas and Stolz, Stephan}, TITLE = {Remarks on a conjecture of {G}romov and {L}awson}, BOOKTITLE = {High-dimensional manifold topology}, PAGES = {159--176}, PUBLISHER = {World Sci. Publ., River Edge, NJ}, YEAR = {2003}, MRCLASS = {53C20 (19L41 19L64 53C21)}, MRNUMBER = {MR2048721 (2005f:53043)}, MRREVIEWER = {J. P. C. Greenlees}, } @article {Dwyer-Weiss-Williams(2003), AUTHOR = {Dwyer, W. and Weiss, M. and Williams, B.}, TITLE = {A parametrized index theorem for the algebraic {$K$}-theory {E}uler class}, JOURNAL = {Acta Math.}, FJOURNAL = {Acta Mathematica}, VOLUME = {190}, YEAR = {2003}, NUMBER = {1}, PAGES = {1--104}, ISSN = {0001-5962}, CODEN = {ACMAA8}, MRCLASS = {19D10 (57R10 58J22 58J52)}, MRNUMBER = {MR1982793 (2004d:19004)}, MRREVIEWER = {Kiyoshi Igusa}, } @article{Dwyer-Wilkerson(1992), AUTHOR = {Dwyer, W. G. and Wilkerson, C. W.}, TITLE = {A cohomology decomposition theorem}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {31}, YEAR = {1992}, NUMBER = {2}, PAGES = {433--443}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {55R35 (55R40 55S10)}, MRNUMBER = {93h:55008}, MRREVIEWER = {J. P. May}, } @article{Dwyer-Wilkerson(1994), AUTHOR = {Dwyer, W. G. and Wilkerson, C. W.}, TITLE = {Homotopy fixed-point methods for {L}ie groups and finite loop spaces}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {139}, YEAR = {1994}, NUMBER = {2}, PAGES = {395--442}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {55R35 (55P35)}, MRNUMBER = {95e:55019}, MRREVIEWER = {Haynes R. Miller}, } @article {Dyer-Lashof(1962), AUTHOR = {Dyer, Eldon and Lashof, R. K.}, TITLE = {Homology of iterated loop spaces}, JOURNAL = {Amer. J. Math.}, FJOURNAL = {American Journal of Mathematics}, VOLUME = {84}, YEAR = {1962}, PAGES = {35--88}, ISSN = {0002-9327}, MRCLASS = {55.30 (55.40)}, MRNUMBER = {0141112 (25 \#4523)}, MRREVIEWER = {J. F. Adams}, } @article {Dyer-Lashof(1961Bott), AUTHOR = {Dyer, E. and Lashof, R.}, TITLE = {A topological proof of the {B}ott periodicity theorems}, JOURNAL = {Ann. Mat. Pura Appl. (4)}, FJOURNAL = {Annali di Matematica Pura ed Applicata. Serie Quarta}, VOLUME = {54}, YEAR = {1961}, PAGES = {231--254}, ISSN = {0003-4622}, MRCLASS = {55.50 (55.99)}, MRNUMBER = {0153018 (27 \#2987)}, MRREVIEWER = {E. C. Zeeman}, } @incollection {Dyer-Lashof(1961homology), AUTHOR = {Dyer, Eldon and Lashof, R. K.}, TITLE = {Homology of principal bundles}, BOOKTITLE = {Proc. {S}ympos. {P}ure {M}ath., {V}ol. {III}}, PAGES = {101--108}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, R.I.}, YEAR = {1961}, MRCLASS = {55.50}, MRNUMBER = {0124045 (23 \#A1365)}, MRREVIEWER = {W. S. Massey}, } @article {Earle-Eells(1967), AUTHOR = {Earle, C. J. and Eells, J.}, TITLE = {The diffeomorphism group of a compact {R}iemann surface}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {73}, YEAR = {1967}, PAGES = {557--559}, ISSN = {0002-9904}, MRCLASS = {57.55 (30.00)}, MRNUMBER = {0212840}, MRREVIEWER = {L. Keen}, } @article{Echterhof-Lueck-Philipps-Walters(2010), author = {Echterhoff, S. and L\"uck, W. and Philipps, C. and Walters, S.}, title = {The Structure of Crossed Products of Irrational Rotation Algebras by Finite Subgroups of $SL_2({\mathbb Z})$}, JOURNAL = {Crelle's Journal f\"ur reine und angewandte Mathematik}, VOLUME = {639}, YEAR = {2010}, PAGES = {141--221}, } @article{Elek(1996), AUTHOR = {Elek, G{\`a}bor}, TITLE = {Abelian coverings}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {141}, YEAR = {1996}, NUMBER = {2}, PAGES = {365--373}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {58G05 (46L99 58G11)}, MRNUMBER = {97k:58156}, MRREVIEWER = {Patrick T. McDonald}, } @article{Ebeling(1990), AUTHOR = {Ebeling, Wolfgang}, TITLE = {An example of two homeomorphic, nondiffeomorphic complete intersection surfaces}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {99}, YEAR = {1990}, NUMBER = {3}, PAGES = {651--654}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {57R57 (14M10 57R55)}, MRNUMBER = {91c:57038}, MRREVIEWER = {I. Dolgachev}, } @article {Eberlein(1982), AUTHOR = {Eberlein, Patrick}, TITLE = {A canonical form for compact nonpositively curved manifolds whose fundamental groups have nontrivial center}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {260}, YEAR = {1982}, NUMBER = {1}, PAGES = {23--29}, ISSN = {0025-5831}, CODEN = {MAANA3}, MRCLASS = {53C20 (53C21)}, MRNUMBER = {MR664362 (84h:53049)}, } @book{Eberlein(1996), AUTHOR = {Eberlein, Patrick B.}, TITLE = {Geometry of nonpositively curved manifolds}, PUBLISHER = {University of Chicago Press}, ADDRESS = {Chicago, IL}, YEAR = {1996}, PAGES = {vii+449}, ISBN = {0-226-18197-9; 0-226-18198-7}, MRCLASS = {53-02 (53C20 53C21 53C35)}, MRNUMBER = {98h:53002}, MRREVIEWER = {Mar{\'\i}a J. Druetta}, } @article{Eberlein-Heber(1990), AUTHOR = {Eberlein, Patrick B. and Heber, Jens}, TITLE = {A differential geometric characterization of symmetric spaces of higher rank}, JOURNAL = {Inst. Hautes \'Etudes Sci. Publ. Math.}, FJOURNAL = {Institut des Hautes \'Etudes Scientifiques. Publications Math\'ematiques}, VOLUME = {71}, YEAR = {1990}, PAGES = {33--44}, ISSN = {0073-8301}, CODEN = {PMIHA6}, MRCLASS = {53C20 (53C23)}, MRNUMBER = {91j:53022}, MRREVIEWER = {Midori Goto}, } @article {Ebert(2013), AUTHOR = {Ebert, Johannes}, TITLE = {A vanishing theorem for characteristic classes of odd-dimensional manifold bundles}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {684}, YEAR = {2013}, PAGES = {1--29}, ISSN = {0075-4102}, MRCLASS = {55R20 (58J20)}, MRNUMBER = {3181555}, MRREVIEWER = {Evgeni{\u\i} V. Troitski{\u\i}}, DOI = {10.1515/crelle-2012-0012}, URL = {http://dx.doi.org/10.1515/crelle-2012-0012}, } @article {Ebert(2011), AUTHOR = {Ebert, Johannes}, TITLE = {Algebraic independence of generalized {MMM}-classes}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {11}, YEAR = {2011}, NUMBER = {1}, PAGES = {69--105}, ISSN = {1472-2747}, MRCLASS = {55R40}, MRNUMBER = {2764037}, DOI = {10.2140/agt.2011.11.69}, URL = {http://dx.doi.org/10.2140/agt.2011.11.69}, } @article {Ebert(2010), AUTHOR = {Ebert, Johannes}, TITLE = {The icosahedral group and the homotopy of the stable mapping class group}, JOURNAL = {M\"unster J. Math.}, FJOURNAL = {M\"unster Journal of Mathematics}, VOLUME = {3}, YEAR = {2010}, PAGES = {221--231}, ISSN = {1867-5778}, MRCLASS = {55Q52 (55R35 55R40 57N05)}, MRNUMBER = {2775362}, MRREVIEWER = {Sadayoshi Kojima}, } @incollection {Ebert(2008stack), AUTHOR = {Ebert, Johannes}, TITLE = {On the topology of the moduli stack of stable curves}, BOOKTITLE = {Trends in mathematics}, PAGES = {57--67}, PUBLISHER = {Universit\"atsdrucke G\"ottingen, G\"ottingen}, YEAR = {2008}, MRCLASS = {14D23 (14H15)}, MRNUMBER = {2906040}, MRREVIEWER = {Stefan Schr{\"o}er}, } @article {Ebert(2008divisibility), AUTHOR = {Ebert, Johannes}, TITLE = {Divisibility of {M}iller-{M}orita-{M}umford classes of spin surface bundles}, JOURNAL = {Q. J. Math.}, FJOURNAL = {The Quarterly Journal of Mathematics}, VOLUME = {59}, YEAR = {2008}, NUMBER = {2}, PAGES = {207--212}, ISSN = {0033-5606}, MRCLASS = {57R20 (53C27)}, MRNUMBER = {2428076}, MRREVIEWER = {Darryl McCullough}, DOI = {10.1093/qmath/ham035}, URL = {http://dx.doi.org/10.1093/qmath/ham035}, } @book {Ebert(2006), AUTHOR = {Ebert, Johannes Felix}, TITLE = {Characteristic classes of spin surface bundles: applications of the {M}adsen-{W}eiss theory}, SERIES = {Bonner Mathematische Schriften [Bonn Mathematical Publications], 381}, NOTE = {Dissertation, Rheinische Friedrich-Wilhelms-Universit{\"a}t Bonn, Bonn, 2006}, PUBLISHER = {Universit\"at Bonn, Mathematisches Institut, Bonn}, YEAR = {2006}, PAGES = {i+95}, MRCLASS = {57R15 (55R10 57R22)}, MRNUMBER = {2762597}, } @article {Ebert-Giansiracusa(2011), AUTHOR = {Ebert, Johannes and Giansiracusa, Jeffrey}, TITLE = {Pontrjagin-{T}hom maps and the homology of the moduli stack of stable curves}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {349}, YEAR = {2011}, NUMBER = {3}, PAGES = {543--575}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {14D23 (14H10 55R40)}, MRNUMBER = {2754996}, MRREVIEWER = {Andrea Bruno}, DOI = {10.1007/s00208-010-0518-2}, URL = {http://dx.doi.org/10.1007/s00208-010-0518-2}, } @article {Ebert-Giansiracusa(2008), AUTHOR = {Ebert, Johannes and Giansiracusa, Jeffrey}, TITLE = {On the homotopy type of the {D}eligne-{M}umford compactification}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {8}, YEAR = {2008}, NUMBER = {4}, PAGES = {2049--2062}, ISSN = {1472-2747}, MRCLASS = {14H10 (32G15)}, MRNUMBER = {2452916}, MRREVIEWER = {Andrea Bruno}, DOI = {10.2140/agt.2008.8.2049}, URL = {http://dx.doi.org/10.2140/agt.2008.8.2049}, } @article {Ebert-Randal-Williams(2019), AUTHOR = {Ebert, Johannes and Randal-Williams, Oscar}, TITLE = {Infinite loop spaces and positive scalar curvature in the presence of a fundamental group}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {23}, YEAR = {2019}, NUMBER = {3}, PAGES = {1549--1610}, ISSN = {1465-3060}, MRCLASS = {19K35 (19K56 53C27 58J22)}, MRNUMBER = {3956897}, MRREVIEWER = {Cristian Ivanescu}, DOI = {10.2140/gt.2019.23.1549}, URL = {https://doi.org/10.2140/gt.2019.23.1549}, } @article {Ebert-Randal-Williams(2015), AUTHOR = {Ebert, Johannes and Randal-Williams, Oscar}, TITLE = {Torelli spaces of high-dimensional manifolds}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {8}, YEAR = {2015}, NUMBER = {1}, PAGES = {38--64}, ISSN = {1753-8416}, MRCLASS = {55R40 (11F75 55R20 55R60 57R65 57S05)}, MRNUMBER = {3335248}, MRREVIEWER = {J. M. Boardman}, DOI = {10.1112/jtopol/jtu014}, URL = {http://dx.doi.org/10.1112/jtopol/jtu014}, } @article {Ebert-Randal-Williams(2014), AUTHOR = {Ebert, Johannes and Randal-Williams, Oscar}, TITLE = {Generalised {M}iller-{M}orita-{M}umford classes for block bundles and topological bundles}, JOURNAL = {Algebr. Geom. Topol.}, FJOURNAL = {Algebraic \& Geometric Topology}, VOLUME = {14}, YEAR = {2014}, NUMBER = {2}, PAGES = {1181--1204}, ISSN = {1472-2747}, MRCLASS = {55R40 (55R60 57R20)}, MRNUMBER = {3180831}, MRREVIEWER = {Semen S. Podkorytov}, DOI = {10.2140/agt.2014.14.1181}, URL = {http://dx.doi.org/10.2140/agt.2014.14.1181}, } @article {Ebert-Randal-Williams(2012), AUTHOR = {Ebert, Johannes and Randal-Williams, Oscar}, TITLE = {Stable cohomology of the universal {P}icard varieties and the extended mapping class group}, JOURNAL = {Doc. Math.}, FJOURNAL = {Documenta Mathematica}, VOLUME = {17}, YEAR = {2012}, PAGES = {417--450}, ISSN = {1431-0635}, MRCLASS = {14H15 (14C22 32G15 55R40 57R22)}, MRNUMBER = {2946828}, MRREVIEWER = {Jeffrey Giansiracusa}, } @article {Ebert-Randal-Williams(2008), AUTHOR = {Ebert, Johannes and Randal-Williams, Oscar}, TITLE = {On the divisibility of characteristic classes of non-oriented surface bundles}, JOURNAL = {Topology Appl.}, FJOURNAL = {Topology and its Applications}, VOLUME = {156}, YEAR = {2008}, NUMBER = {2}, PAGES = {246--250}, ISSN = {0166-8641}, CODEN = {TIAPD9}, MRCLASS = {57R20 (57R75)}, MRNUMBER = {2475111}, MRREVIEWER = {Pedro Luiz Queiroz Pergher}, DOI = {10.1016/j.topol.2008.07.004}, URL = {http://dx.doi.org/10.1016/j.topol.2008.07.004}, } @article{Eckmann(1986), AUTHOR = {Eckmann, Beno}, TITLE = {Cyclic homology of groups and the {B}ass conjecture}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {61}, YEAR = {1986}, NUMBER = {2}, PAGES = {193--202}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {18F25 (19D55 20J05)}, MRNUMBER = {87i:18008}, MRREVIEWER = {L. N. Vaserstein}, } @incollection {Eckmann(1987), AUTHOR = {Eckmann, Beno}, TITLE = {Poincar\'e duality groups of dimension two are surface groups}, BOOKTITLE = {Combinatorial group theory and topology (Alta, Utah, 1984)}, SERIES = {Ann. of Math. Stud.}, VOLUME = {111}, PAGES = {35--51}, PUBLISHER = {Princeton Univ. Press}, ADDRESS = {Princeton, NJ}, YEAR = {1987}, MRCLASS = {57M05 (20J05)}, MRNUMBER = {MR895608 (88e:57001)}, MRREVIEWER = {F. E. A. Johnson}, } @article{Eckmann(1992a), AUTHOR = {Eckmann, Beno}, TITLE = {Amenable groups and {E}uler characteristic}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {67}, YEAR = {1992}, NUMBER = {3}, PAGES = {383--393}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57S20 (20F19 55P20)}, MRNUMBER = {93k:57070}, } @article{Eckmann(1994a), AUTHOR = {Eckmann, Beno}, TITLE = {Manifolds of even dimension with amenable fundamental group}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {69}, YEAR = {1994}, NUMBER = {4}, PAGES = {501--511}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57N13 (20J05 57Q45)}, MRNUMBER = {96e:57011}, MRREVIEWER = {Ross Geoghegan}, } @article{Eckmann(1996b), AUTHOR = {Eckmann, Beno}, TITLE = {Projective and {H}ilbert modules over group algebras, and finitely dominated spaces}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {71}, YEAR = {1996}, NUMBER = {3}, PAGES = {453--462}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57P10 (20C07 57Q12)}, MRNUMBER = {98h:57046a}, MRREVIEWER = {Carles Casacuberta}, } @article{Eckmann(1997), AUTHOR = {Eckmann, Beno}, TITLE = {$4$-manifolds, group invariants, and $l\sb 2$-{B}etti numbers}, JOURNAL = {Enseign. Math. (2)}, FJOURNAL = {L'Enseignement Math\'ematique. Revue Internationale. IIe S\'erie}, VOLUME = {43}, YEAR = {1997}, NUMBER = {3-4}, PAGES = {271--279}, ISSN = {0013-8584}, CODEN = {ENMAAR}, MRCLASS = {57M05 (20F05 55N25 55P20)}, MRNUMBER = {99b:57002}, MRREVIEWER = {Alain Valette}, } @incollection {Eckmann(1998), AUTHOR = {Eckmann, Beno}, TITLE = {Naissance des fibr\'es et homotopie}, BOOKTITLE = {Mat\'eriaux pour l'histoire des math\'ematiques au XX$\sp {\rm e}$ si\`ecle (Nice, 1996)}, PAGES = {21--36}, PUBLISHER = {Soc. Math. France}, ADDRESS = {Paris}, YEAR = {1998}, MRCLASS = {01A60 (55-03)}, MRNUMBER = {99h:01030}, MRREVIEWER = {Haynes R. Miller}, } @article{Eckmann(1999), AUTHOR = {Eckmann, Beno}, TITLE = {Approximating $l\sb 2$-{B}etti numbers of an amenable covering by ordinary {B}etti numbers}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {74}, YEAR = {1999}, NUMBER = {1}, PAGES = {150--155}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57R20}, MRNUMBER = {2000c:57050}, MRREVIEWER = {Serge L. Tabachnikov}, } @article {Eckmann(2000), AUTHOR = {Eckmann, Beno}, TITLE = {Introduction to $l\sb 2$-methods in topology: reduced $l\sb 2$-homology, harmonic chains, $l\sb 2$-{B}etti numbers}, NOTE = {Notes prepared by G.~Mislin}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {117}, YEAR = {2000}, PAGES = {183--219}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {57Q05 (16S34 20F05 57M07)}, MRNUMBER = {2001b:57054}, MRREVIEWER = {Alain Valette}, } @article {Eckmann(2001), AUTHOR = {Eckmann, Beno}, TITLE = {Idempotents in a complex group algebra, projective modules, and the von {N}eumann algebra}, JOURNAL = {Arch. Math. (Basel)}, FJOURNAL = {Archiv der Mathematik. Archives of Mathematics. Archives Math\'ematiques}, VOLUME = {76}, YEAR = {2001}, NUMBER = {4}, PAGES = {241--249}, ISSN = {0003-889X}, CODEN = {ACVMAL}, MRCLASS = {46Lxx (16S34 19A31 20C07 22D25 46Jxx)}, MRNUMBER = {1 825 003}, } @article {Eckmann-Hilton(1960), AUTHOR = {Eckmann, B. and Hilton, P. J.}, TITLE = {Homotopy groups of maps and exact sequences}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {34}, YEAR = {1960}, PAGES = {271--304}, ISSN = {0010-2571}, MRCLASS = {55.42}, MRNUMBER = {0123325 (23 \#A653)}, MRREVIEWER = {J. F. Adams}, } @article {Eckmann+Mueller(1980), AUTHOR = {Eckmann, Beno and M{\"u}ller, Heinz}, TITLE = {Poincar\'e duality groups of dimension two}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {55}, YEAR = {1980}, NUMBER = {4}, PAGES = {510--520}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57M20 (57P10)}, MRNUMBER = {MR604709 (82f:57002)}, MRREVIEWER = {R. M. F. Moss}, } @article{Eckmann-Linnell(1983), AUTHOR = {Eckmann, Beno and Linnell, Peter A.}, TITLE = {Poincar\'e duality groups of dimension two. {I}{I}}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {58}, YEAR = {1983}, NUMBER = {1}, PAGES = {111--114}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57M20 (20F38 57P10)}, MRNUMBER = {84i:57003}, MRREVIEWER = {R. M. F. Moss}, } @article {Echterhoff-Li-Nest(2018), AUTHOR = {Echterhoff, Siegfried and Li, Kang and Nest, Ryszard}, TITLE = {The orbit method for the {B}aum-{C}onnes conjecture for algebraic groups over local function fields}, JOURNAL = {J. Lie Theory}, FJOURNAL = {Journal of Lie Theory}, VOLUME = {28}, YEAR = {2018}, NUMBER = {2}, PAGES = {323--341}, ISSN = {0949-5932}, MRCLASS = {19K35 (20G25)}, MRNUMBER = {3714897}, MRREVIEWER = {Wemedh Aeal}, } @article {Echterhoff-Lueck-Phillips-Walters(2010), AUTHOR = {Echterhoff, Siegfried and L{\"u}ck, Wolfgang and Phillips, N. Christopher and Walters, Samuel}, TITLE = {The structure of crossed products of irrational rotation algebras by finite subgroups of {${\rm SL}_2(\Bbb Z)$}}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik. [Crelle's Journal]}, VOLUME = {639}, YEAR = {2010}, PAGES = {173--221}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {46L35 (19K14 46L05 46L55 46L80)}, MRNUMBER = {2608195 (2011c:46127)}, MRREVIEWER = {Ralf Meyer}, DOI = {10.1515/CRELLE.2010.015}, URL = {http://dx.doi.org/10.1515/CRELLE.2010.015}, } @article {Edidin-Graham(2000), AUTHOR = {Edidin, Dan and Graham, William}, TITLE = {Riemann-{R}och for equivariant {C}how groups}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {102}, YEAR = {2000}, NUMBER = {3}, PAGES = {567--594}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {14C40 (14L30 19E15)}, MRNUMBER = {MR1756110 (2001f:14018)}, MRREVIEWER = {Burt Totaro}, } @article {Edidin-Graham(2003), AUTHOR = {Edidin, Dan and Graham, William}, TITLE = {Riemann-{R}och for quotients and {T}odd classes of simplicial toric varieties}, NOTE = {Special issue in honor of Steven L. Kleiman}, JOURNAL = {Comm. Algebra}, FJOURNAL = {Communications in Algebra}, VOLUME = {31}, YEAR = {2003}, NUMBER = {8}, PAGES = {3735--3752}, ISSN = {0092-7872}, CODEN = {COALDM}, MRCLASS = {14C40 (14C35 14L30 14M25)}, MRNUMBER = {MR2007382 (2004h:14015)}, MRREVIEWER = {Anita Buckley}, } @article {Edidin-Graham(2008), AUTHOR = {Edidin, Dan and Graham, William}, TITLE = {Algebraic cycles and completions of equivariant {$K$}-theory}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {144}, YEAR = {2008}, NUMBER = {3}, PAGES = {489--524}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {14C40 (14C25 14L30 19D10)}, MRNUMBER = {MR2444304}, } @article{Edjvet(1984), AUTHOR = {Edjvet, M.}, TITLE = {Groups with balanced presentations}, JOURNAL = {Arch. Math. (Basel)}, FJOURNAL = {Archiv der Mathematik. Archives of Mathematics. Archives Math\'ematiques}, VOLUME = {42}, YEAR = {1984}, NUMBER = {4}, PAGES = {311--313}, ISSN = {0003-889X}, CODEN = {ACVMAL}, MRCLASS = {20F05}, MRNUMBER = {85m:20048}, MRREVIEWER = {R. St{\"o}hr}, } @article{Edmonds(1981), AUTHOR = {Edmonds, Allan L.}, TITLE = {Orientability of fixed point sets}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {82}, YEAR = {1981}, NUMBER = {1}, PAGES = {120--124}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {57S17 (55M35 57S25)}, MRNUMBER = {82h:57032}, MRREVIEWER = {Ian Hambleton}, } @Book{Edwards(1979), AUTHOR = {Edwards, R. E.}, TITLE = {Fourier series. {A} modern introduction. {V}ol. 1}, EDITION = {Second}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1979}, PAGES = {224}, ISBN = {0-387-90412-3}, MRCLASS = {42-01}, MRNUMBER = {80j:42001}, } @Book{Edwards(1982), AUTHOR = {Edwards, R. E.}, TITLE = {Fourier series. {V}ol. 2}, EDITION = {Second}, NOTE = {A modern introduction}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1982}, PAGES = {xi+369}, ISBN = {0-387-90651-7}, MRCLASS = {42-01}, MRNUMBER = {83k:42001}, } @article {Edwards-Geoghegan(1976stability), AUTHOR = {Edwards, David A. and Geoghegan, Ross}, TITLE = {Stability theorems in shape and pro-homotopy}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {222}, YEAR = {1976}, PAGES = {389--403}, ISSN = {0002-9947}, MRCLASS = {55D99}, MRNUMBER = {0423347}, MRREVIEWER = {Timothy Porter}, } @article {Edwards-Geoghegan(1975Correction), AUTHOR = {Edwards, D. A. and Geoghegan, Ross}, TITLE = {Correction to: ``{S}hapes of complexes, ends of manifolds, homotopy limits and the {W}all obstruction'' ({A}nn. of {M}ath. (2) {\bf 101} (1975), 521--535)}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {104}, YEAR = {1976}, NUMBER = {2}, PAGES = {389}, ISSN = {0003-486X}, MRCLASS = {55E05 (54C56 57C05)}, MRNUMBER = {0415610}, } @article {Edwards-Geoghegan(1976infinite), AUTHOR = {Edwards, David A. and Geoghegan, Ross}, TITLE = {Infinite-dimensional {W}hitehead and {V}ietoris theorems in shape and pro-homotopy}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {219}, YEAR = {1976}, PAGES = {351--360}, ISSN = {0002-9947}, MRCLASS = {55E05 (54C56)}, MRNUMBER = {0402735}, MRREVIEWER = {J. Dugundji}, } @article {Edwards-Geoghegan(1975stabilityTrans), AUTHOR = {Edwards, David A. and Geoghegan, Ross}, TITLE = {The stability problem in shape, and a {W}hitehead theorem in pro-homotopy}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {214}, YEAR = {1975}, PAGES = {261--277}, ISSN = {0002-9947}, MRCLASS = {55D99 (54C56)}, MRNUMBER = {0413095}, MRREVIEWER = {Timothy Porter}, } @article {Edwards-Geoghegan(1975/76), AUTHOR = {Edwards, David A. and Geoghegan, Ross}, TITLE = {Compacta weak shape equivalent to {ANR}'s}, JOURNAL = {Fund. Math.}, FJOURNAL = {Polska Akademia Nauk. Fundamenta Mathematicae}, VOLUME = {90}, YEAR = {1975/76}, NUMBER = {2}, PAGES = {115--124}, ISSN = {0016-2736}, MRCLASS = {55D15 (54C56)}, MRNUMBER = {0394643}, MRREVIEWER = {Timothy Porter}, } @article {Edwards-Geoghegan(1975Wall), AUTHOR = {Edwards, David A. and Geoghegan, Ross}, TITLE = {The {W}all obstruction in shape and pro-homotopy, with applications}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {81}, YEAR = {1975}, NUMBER = {5}, PAGES = {919--920}, ISSN = {0002-9904}, MRCLASS = {57C05 (55D10)}, MRNUMBER = {0375331}, MRREVIEWER = {Timothy Porter}, } @article {Edwards-Geoghegan(1975shapes), AUTHOR = {Edwards, David A. and Geoghegan, Ross}, TITLE = {Shapes of complexes, ends of manifolds, homotopy limits and the {W}all obstruction}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {101}, YEAR = {1975}, PAGES = {521--535}, ISSN = {0003-486X}, MRCLASS = {57C05 (54C56 55E05)}, MRNUMBER = {0375330}, MRREVIEWER = {J. Dugundji}, } @article {Edwards-Geoghegan(1975stabilityBull), AUTHOR = {Edwards, David A. and Geoghegan, Ross}, TITLE = {The stability problem in shape and a {W}hitehead theorem in pro-homotopy}, JOURNAL = {Bull. Amer. Math. Soc.}, FJOURNAL = {Bulletin of the American Mathematical Society}, VOLUME = {81}, YEAR = {1975}, PAGES = {438--440}, ISSN = {0002-9904}, MRCLASS = {55E05 (54C56)}, MRNUMBER = {0365562}, MRREVIEWER = {J. Dugundji}, } @book{Edwards-Hastings(1976), AUTHOR = {Edwards, David A. and Hastings, Harold M.}, TITLE = {\v {C}ech and {S}teenrod homotopy theories with applications to geometric topology}, NOTE = {Lecture Notes in Mathematics, Vol. 542}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1976}, PAGES = {vii+296}, MRCLASS = {55D99 (55B05)}, MRNUMBER = {55 \#1347}, MRREVIEWER = {Claude Schochet}, } @article{Effros(1989), AUTHOR = {Effros, Edward G.}, TITLE = {Why the circle is connected: an introduction to quantized topology}, JOURNAL = {Math. Intelligencer}, FJOURNAL = {The Mathematical Intelligencer}, VOLUME = {11}, YEAR = {1989}, NUMBER = {1}, PAGES = {27--34}, ISSN = {0343-6993}, CODEN = {MAINDC}, MRCLASS = {46L05 (22D25 81D07)}, MRNUMBER = {90d:46084}, MRREVIEWER = {Claude Schochet}, } @article{Efrat(1988), AUTHOR = {Efrat, Isaac}, TITLE = {Determinants of {L}aplacians on surfaces of finite volume}, JOURNAL = {Comm. Math. Phys.}, FJOURNAL = {Communications in Mathematical Physics}, VOLUME = {119}, YEAR = {1988}, NUMBER = {3}, PAGES = {443--451}, ISSN = {0010-3616}, CODEN = {CMPHAY}, MRCLASS = {58G25 (11F72)}, MRNUMBER = {90c:58184}, MRREVIEWER = {Werner Hoffmann}, } @article{Efrat(1993), AUTHOR = {Efrat, Isaac}, TITLE = {Dynamics of the continued fraction map and the spectral theory of ${\rm {S}{L}}(2,\bold {Z})$}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {114}, YEAR = {1993}, NUMBER = {1}, PAGES = {207--218}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11F72}, MRNUMBER = {94h:11052}, MRREVIEWER = {Shin-ya Koyama}, } @article{Efremov(1991b), AUTHOR = {Efremov, A. V.}, TITLE = {Cell decompositions and the {N}ovikov-{S}hubin invariants}, JOURNAL = {Uspekhi Mat. Nauk}, FJOURNAL = {Akademiya Nauk SSSR i Moskovskoe Matematicheskoe Obshchestvo. Uspekhi Matematicheskikh Nauk}, VOLUME = {46}, YEAR = {1991}, NUMBER = {3(279)}, PAGES = {189--190}, ISSN = {0042-1316}, MRCLASS = {58G25 (22E40 35P25)}, MRNUMBER = {92m:58143}, MRREVIEWER = {J. S. Joel}, } @article{Ehrlich(1979), AUTHOR = {Ehrlich, Karel}, TITLE = {Fibrations and a transfer map in algebraic ${K}$-theory}, JOURNAL = {J. Pure Appl. Algebra}, FJOURNAL = {Journal of Pure and Applied Algebra}, VOLUME = {14}, YEAR = {1979}, NUMBER = {2}, PAGES = {131--136}, ISSN = {0022-4049}, MRCLASS = {55R10 (18F25 57R10)}, MRNUMBER = {80g:55031}, MRREVIEWER = {Laurence R. Taylor}, } @incollection {Eichhorn(1986), AUTHOR = {Eichhorn, J.}, TITLE = {${L}\sb 2$-cohomology}, BOOKTITLE = {Geometric and algebraic topology}, PAGES = {215--237}, PUBLISHER = {PWN}, ADDRESS = {Warsaw}, YEAR = {1986}, MRCLASS = {58A14 (14F40 55N99 58G05)}, MRNUMBER = {89j:58005}, MRREVIEWER = {Maung Min-Oo}, } @incollection{Eichhorn(1989), AUTHOR = {Eichhorn, J{\"u}rgen}, TITLE = {The invariance of {S}obolev spaces over noncompact manifolds}, BOOKTITLE = {Symposium ``Partial Differential Equations'' (Holzhau, 1988)}, PAGES = {73--107}, PUBLISHER = {Teubner}, ADDRESS = {Leipzig}, YEAR = {1989}, MRCLASS = {58D15 (46E35)}, MRNUMBER = {1 105 801}, } @article{Eichhorn(1991a), AUTHOR = {Eichhorn, J{\"u}rgen}, TITLE = {The boundedness of connection coefficients and their derivatives}, JOURNAL = {Math. Nachr.}, FJOURNAL = {Mathematische Nachrichten}, VOLUME = {152}, YEAR = {1991}, PAGES = {145--158}, ISSN = {0025-584X}, CODEN = {MTMNAQ}, MRCLASS = {53C21}, MRNUMBER = {92k:53069}, MRREVIEWER = {Reinhard Illge}, } @article{Eichhorn(1991b), AUTHOR = {Eichhorn, J{\"u}rgen}, TITLE = {The {B}anach manifold structure of the space of metrics on noncompact manifolds}, JOURNAL = {Differential Geom. Appl.}, FJOURNAL = {Differential Geometry and its Applications}, VOLUME = {1}, YEAR = {1991}, NUMBER = {2}, PAGES = {89--108}, ISSN = {0926-2245}, CODEN = {DGAPEO}, MRCLASS = {58D17 (58D05 58D15)}, MRNUMBER = {94j:58028}, MRREVIEWER = {Olga Gil-Medrano}, } @incollection {Eichhorn(1992a), AUTHOR = {Eichhorn, J{\"u}rgen}, TITLE = {A priori estimates in geometry and {S}obolev spaces on open manifolds}, BOOKTITLE = {Partial differential equations, Part 1, 2 (Warsaw, 1990)}, PAGES = {141--146}, PUBLISHER = {Polish Acad. Sci.}, ADDRESS = {Warsaw}, YEAR = {1992}, MRCLASS = {58D15 (46E35)}, MRNUMBER = {93k:58036}, MRREVIEWER = {J{\'o}zef Dodziuk}, } @article{Eichhorn(1992b), AUTHOR = {Eichhorn, J{\"u}rgen}, TITLE = {Gauge theory on open manifolds of bounded geometry}, JOURNAL = {Internat. J. Modern Phys. A}, FJOURNAL = {International Journal of Modern Physics A. Particles and Fields. Gravitation. Cosmology. Nuclear Physics}, VOLUME = {7}, YEAR = {1992}, NUMBER = {17}, PAGES = {3927--3977}, ISSN = {0217-751X}, MRCLASS = {53C07 (58D27 58E15 81T13)}, MRNUMBER = {93k:53028}, MRREVIEWER = {David Groisser}, } @article{Eichhorn(1993a), AUTHOR = {Eichhorn, J{\"u}rgen}, TITLE = {The manifold structure of maps between open manifolds}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {11}, YEAR = {1993}, NUMBER = {3}, PAGES = {253--300}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {58D15}, MRNUMBER = {95b:58024}, MRREVIEWER = {David Groisser}, } @article{Eichhorn(1995), AUTHOR = {Eichhorn, J{\"u}rgen}, TITLE = {Spaces of {R}iemannian metrics on open manifolds}, JOURNAL = {Results Math.}, FJOURNAL = {Results in Mathematics. Resultate der Mathematik}, VOLUME = {27}, YEAR = {1995}, NUMBER = {3-4}, PAGES = {256--283}, ISSN = {0378-6218}, MRCLASS = {58D17 (58B20)}, MRNUMBER = {96g:58028}, MRREVIEWER = {Olga Gil-Medrano}, } @incollection {Eichhorn-Heber(1997), AUTHOR = {Eichhorn, J{\"u}rgen and Heber, Gerd}, TITLE = {The configuration space of gauge theory on open manifolds of bounded geometry}, BOOKTITLE = {Symplectic singularities and geometry of gauge fields (Warsaw, 1995)}, PAGES = {269--286}, PUBLISHER = {Polish Acad. Sci.}, ADDRESS = {Warsaw}, YEAR = {1997}, MRCLASS = {58D19 (22E65 53C07 81T13)}, MRNUMBER = {98d:58020}, MRREVIEWER = {Ambar Sengupta}, } @article{Eichhorn-Schmid(1996), AUTHOR = {Eichhorn, J{\"u}rgen and Schmid, Rudolf}, TITLE = {Form preserving diffeomorphisms on open manifolds}, JOURNAL = {Ann. Global Anal. Geom.}, FJOURNAL = {Annals of Global Analysis and Geometry}, VOLUME = {14}, YEAR = {1996}, NUMBER = {2}, PAGES = {147--176}, ISSN = {0232-704X}, CODEN = {AGAGDV}, MRCLASS = {58D05 (58D15 58G03)}, MRNUMBER = {97f:58020}, MRREVIEWER = {Nikolai K. Smolentsev}, } @article {Eilenberg+Ganea(1957), AUTHOR = {Eilenberg, Samuel and Ganea, Tudor}, TITLE = {On the {L}usternik-{S}chnirelmann category of abstract groups}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {65}, YEAR = {1957}, PAGES = {517--518}, ISSN = {0003-486X}, MRCLASS = {55.0X}, MRNUMBER = {MR0085510 (19,52d)}, MRREVIEWER = {J. C. Moore}, } @Article{Eilenberg-MacLane(1949), Author = {Eilenberg, Samuel and MacLane, Saunders}, Title = {Homology of spaces with operators. {II}}, FJournal = {Transactions of the American Mathematical Society}, Journal = {Trans. Am. Math. Soc.}, ISSN = {0002-9947}, Volume = {65}, Pages = {49--99}, Year = {1949}, Language = {English}, DOI = {10.2307/1990515}, zbMATH = {3052235}, Zbl = {0034.11101} } @book {Eisenbud(1995), AUTHOR = {Eisenbud, David}, TITLE = {Commutative algebra}, SERIES = {Graduate Texts in Mathematics}, VOLUME = {150}, NOTE = {With a view toward algebraic geometry}, PUBLISHER = {Springer-Verlag}, ADDRESS = {New York}, YEAR = {1995}, PAGES = {xvi+785}, ISBN = {0-387-94268-8; 0-387-94269-6}, MRCLASS = {13-01 (14A05)}, MRNUMBER = {97a:13001}, MRREVIEWER = {Matthew Miller}, } @article {Eisenbud-Hirsch-Neumann(1981), AUTHOR = {Eisenbud, David and Hirsch, Ulrich and Neumann, Walter}, TITLE = {Transverse foliations of {S}eifert bundles and self-homeomorphism of the circle}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici}, VOLUME = {56}, YEAR = {1981}, NUMBER = {4}, PAGES = {638--660}, ISSN = {0010-2571}, CODEN = {COMHAX}, MRCLASS = {57R30 (57M99 58F11)}, MRNUMBER = {656217 (83j:57016)}, MRREVIEWER = {Christopher W. Stark}, DOI = {10.1007/BF02566232}, URL = {http://dx.doi.org/10.1007/BF02566232}, } @book {Eisenbud-Neumann(1985), AUTHOR = {Eisenbud, David and Neumann, Walter}, TITLE = {Three-dimensional link theory and invariants of plane curve singularities}, SERIES = {Annals of Mathematics Studies}, VOLUME = {110}, PUBLISHER = {Princeton University Press}, ADDRESS = {Princeton, NJ}, YEAR = {1985}, PAGES = {vii+173}, ISBN = {0-691-08380-0; 0-691-08381-9}, MRCLASS = {57M25 (14H20 57S15)}, MRNUMBER = {817982 (87g:57007)}, MRREVIEWER = {Christopher W. Stark}, } @article {Eisermann(2007), AUTHOR = {Eisermann, Michael}, TITLE = {Knot colouring polynomials}, JOURNAL = {Pacific J. Math.}, FJOURNAL = {Pacific Journal of Mathematics}, VOLUME = {231}, YEAR = {2007}, NUMBER = {2}, PAGES = {305--336}, ISSN = {0030-8730}, CODEN = {PJMAAI}, MRCLASS = {57M27 (57M25)}, MRNUMBER = {2346499 (2008j:57014)}, MRREVIEWER = {Stefan K. Friedl}, DOI = {10.2140/pjm.2007.231.305}, URL = {http://dx.doi.org/10.2140/pjm.2007.231.305}, } @article{Elek(1998), AUTHOR = {Elek, G{\'a}bor}, TITLE = {Coarse cohomology and $l\sb p$-cohomology}, JOURNAL = {$K$-Theory}, FJOURNAL = {$K$-Theory. An Interdisciplinary Journal for the Development, Application, and Influence of $K$-Theory in the Mathematical Sciences}, VOLUME = {13}, YEAR = {1998}, NUMBER = {1}, PAGES = {1--22}, ISSN = {0920-3036}, CODEN = {KTHEEO}, MRCLASS = {58G12 (46L85)}, MRNUMBER = {99a:58148}, MRREVIEWER = {Mohammed E. B. Bekka}, } @article {Elek(2002), AUTHOR = {Elek, G{\'a}bor}, TITLE = {Amenable groups, topological entropy and {B}etti numbers}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {132}, YEAR = {2002}, PAGES = {315--335}, ISSN = {0021-2172}, CODEN = {ISJMAP}, MRCLASS = {37B40 (43A07 57R20)}, MRNUMBER = {MR1952628 (2003k:37026)}, MRREVIEWER = {Michael S. Farber}, } @article {Elek(2003a), AUTHOR = {Elek, G{\'a}bor}, TITLE = {On the analytic zero divisor conjecture of {L}innell}, JOURNAL = {Bull. London Math. Soc.}, FJOURNAL = {The Bulletin of the London Mathematical Society}, VOLUME = {35}, YEAR = {2003}, NUMBER = {2}, PAGES = {236--238}, ISSN = {0024-6093}, CODEN = {LMSBBT}, MRCLASS = {20C07 (16S34)}, MRNUMBER = {MR1952401 (2003m:20004)}, } @article {Elek(2003b), AUTHOR = {Elek, G{\'a}bor}, TITLE = {The amenability of affine algebras}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {264}, YEAR = {2003}, NUMBER = {2}, PAGES = {469--478}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16P90 (16U10 43A07)}, MRNUMBER = {MR1981416 (2004d:16043)}, MRREVIEWER = {Victor M. Petrogradsky}, } @article {Elek(2003c), AUTHOR = {Elek, G{\'a}bor}, TITLE = {The rank of finitely generated modules over group algebras}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {131}, YEAR = {2003}, NUMBER = {11}, PAGES = {3477--3485 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {43A07 (20C07)}, MRNUMBER = {MR1991759 (2004i:43003)}, MRREVIEWER = {Alan L. Carey}, } @article {Elek(2005a), AUTHOR = {Elek, G{\'a}bor}, TITLE = {On algebras that have almost finite dimensional representations}, JOURNAL = {J. Algebra Appl.}, FJOURNAL = {Journal of Algebra and its Applications}, VOLUME = {4}, YEAR = {2005}, NUMBER = {2}, PAGES = {179--186}, ISSN = {0219-4988}, MRCLASS = {16S99 (16P90)}, MRNUMBER = {MR2139264 (2006a:16038)}, MRREVIEWER = {P. M. Cohn}, } @article {Elek(2006), AUTHOR = {Elek, G{\'a}bor}, TITLE = {The amenability and non-amenability of skew fields}, JOURNAL = {Proc. Amer. Math. Soc.}, FJOURNAL = {Proceedings of the American Mathematical Society}, VOLUME = {134}, YEAR = {2006}, NUMBER = {3}, PAGES = {637--644 (electronic)}, ISSN = {0002-9939}, CODEN = {PAMYAR}, MRCLASS = {12E15 (43A07)}, MRNUMBER = {MR2180879 (2006h:12005)}, MRREVIEWER = {Jean-Paul Pier}, } @article {Elek(2006strong), AUTHOR = {Elek, G{\'a}bor}, TITLE = {The strong approximation conjecture holds for amenable groups}, JOURNAL = {J. Funct. Anal.}, FJOURNAL = {Journal of Functional Analysis}, VOLUME = {239}, YEAR = {2006}, NUMBER = {1}, PAGES = {345--355}, ISSN = {0022-1236}, CODEN = {JFUAAW}, MRCLASS = {43A07 (19K99 46L10 58J22)}, MRNUMBER = {MR2258227 (2007m:43001)}, MRREVIEWER = {Emmanuel C. Germain}, DOI = {10.1016/j.jfa.2005.12.016}, URL = {http://dx.doi.org/10.1016/j.jfa.2005.12.016}, } @article {Elek-Sos(2005), AUTHOR = {Elek, G{\'a}bor and S{\'o}s, Vera T.}, TITLE = {Paradoxical decompositions and growth conditions}, JOURNAL = {Combin. Probab. Comput.}, FJOURNAL = {Combinatorics, Probability and Computing}, VOLUME = {14}, YEAR = {2005}, NUMBER = {1-2}, PAGES = {81--105}, ISSN = {0963-5483}, MRCLASS = {43A07 (05C25 20P05)}, MRNUMBER = {MR2128084 (2006i:43001)}, } @article {Elek-Szarbo(2003), AUTHOR = {Elek, G. and Szab{\'o}, E.}, TITLE = {Invariant subspaces of {$p$}-adic {H}ilbert spaces}, JOURNAL = {Studia Sci. Math. Hungar.}, FJOURNAL = {Studia Scientiarum Mathematicarum Hungarica. A Quarterly of the Hungarian Academy of Sciences}, VOLUME = {40}, YEAR = {2003}, NUMBER = {1-2}, PAGES = {159--170}, ISSN = {0081-6906}, CODEN = {SSMHAX}, MRCLASS = {46S10 (20C07 47A15 47D03)}, MRNUMBER = {MR2002998 (2005e:46139)}, MRREVIEWER = {Bertin Diarra}, } @article {Elek-Szabo(2004), AUTHOR = {Elek, G{\'a}bor and Szab{\'o}, Endre}, TITLE = {Sofic groups and direct finiteness}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {280}, YEAR = {2004}, NUMBER = {2}, PAGES = {426--434}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16S34 (16E50 20C07)}, MRNUMBER = {MR2089244 (2005d:16041)}, MRREVIEWER = {Pere Ara}, } @article {Elek-Szabo(2005), AUTHOR = {Elek, G{\'a}bor and Szab{\'o}, Endre}, TITLE = {Hyperlinearity, essentially free actions and {$L^2$}-invariants. {T}he sofic property}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {332}, YEAR = {2005}, NUMBER = {2}, PAGES = {421--441}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {43A07 (46L10)}, MRNUMBER = {2178069}, MRREVIEWER = {M{\u{a}}d{\u{a}}lina Roxana Buneci}, DOI = {10.1007/s00208-005-0640-8}, URL = {http://dx.doi.org/10.1007/s00208-005-0640-8}, } @article {Elek-Szabo(2006), AUTHOR = {Elek, G{\'a}bor and Szab{\'o}, Endre}, TITLE = {On sofic groups}, JOURNAL = {J. Group Theory}, FJOURNAL = {Journal of Group Theory}, VOLUME = {9}, YEAR = {2006}, NUMBER = {2}, PAGES = {161--171}, ISSN = {1433-5883}, CODEN = {JGTHFQ}, MRCLASS = {20F65}, MRNUMBER = {MR2220572}, } @book {Eliashberg-Milman-Polterovich-Schoen(1995), TITLE = {Geometries in interaction}, EDITOR = {Eliashberg, Y. and Milman, V. and Polterovich, L. and Schoen, R.}, NOTE = {GAFA special issue in honor of Mikhail Gromov, Reprint of Geom.\ Funct.\ Anal.\ {\bf 5} (1995), no.\ 2}, PUBLISHER = {Birkh\"auser Verlag}, ADDRESS = {Basel}, YEAR = {1995}, PAGES = {i--xvi and 105--527}, ISBN = {3-7643-5260-4}, MRCLASS = {00B30 (53-06 58-06)}, MRNUMBER = {97g:00025}, } @book{Eliashberg-Mishachev(2002), AUTHOR = {Eliashberg, Y. and Mishachev, N.}, TITLE = {Introduction to the {$h$}-principle}, SERIES = {Graduate Studies in Mathematics}, VOLUME = {48}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {2002}, PAGES = {xviii+206}, ISBN = {0-8218-3227-1}, MRCLASS = {53D99 (57R17 58E99)}, MRNUMBER = {1909245 (2003g:53164)}, MRREVIEWER = {John B. Etnyre}, } @article {Elliott(2010), AUTHOR = {Elliott, George A.}, TITLE = {Towards a theory of classification}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {223}, YEAR = {2010}, NUMBER = {1}, PAGES = {30--48}, ISSN = {0001-8708}, CODEN = {ADMTA4}, MRCLASS = {18A22 (19K14 46L35 46L80)}, MRNUMBER = {2563210 (2011d:18001)}, DOI = {10.1016/j.aim.2009.07.018}, URL = {http://dx.doi.org/10.1016/j.aim.2009.07.018}, } @inproceedings {Elliott(1995), AUTHOR = {Elliott, George A.}, TITLE = {The classification problem for amenable {$C^*$}-algebras}, BOOKTITLE = {Proceedings of the {I}nternational {C}ongress of {M}athematicians, {V}ol.\ 1, 2 ({Z}\"urich, 1994)}, PAGES = {922--932}, PUBLISHER = {Birkh\"auser}, ADDRESS = {Basel}, YEAR = {1995}, MRCLASS = {46L05 (46L35 46L80 46M15)}, MRNUMBER = {1403992 (97g:46072)}, MRREVIEWER = {Robert S. Doran}, } @article {Elliott(1977), AUTHOR = {Elliott, George A.}, TITLE = {Appendix to: ``{C}ompact abelian groups of automorphisms of simple {$C\sp*$}-algebras'' ({I}nvent. {M}ath. {\bf 39} (1977), no. 1, 55--64) by {D}. {O}lesen, {G}. {K}. {P}edersen and {E}. {S}t\o rmer}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {39}, YEAR = {1977}, NUMBER = {1}, PAGES = {65--66}, ISSN = {0020-9910}, MRCLASS = {46L05}, MRNUMBER = {0440376 (55 \#13251)}, MRREVIEWER = {Ola Bratteli}, } @article {Elliott(1976), AUTHOR = {Elliott, George A.}, TITLE = {On the classification of inductive limits of sequences of semisimple finite-dimensional algebras}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {38}, YEAR = {1976}, NUMBER = {1}, PAGES = {29--44}, ISSN = {0021-8693}, MRCLASS = {46L05 (16A46)}, MRNUMBER = {0397420 (53 \#1279)}, MRREVIEWER = {Horst Behncke}, } @article {Elliott(1974), AUTHOR = {Elliott, George A.}, TITLE = {Derivations of matroid {$C^{\ast} $}-algebras. {II}}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {100}, YEAR = {1974}, PAGES = {407--422}, ISSN = {0003-486X}, MRCLASS = {46L05}, MRNUMBER = {0352999 (50 \#5485)}, MRREVIEWER = {B. Yood}, } @article {Elliott(1969), AUTHOR = {Elliott, George A.}, TITLE = {Derivations of matroid {$C^{\ast} $}-algebras}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {9}, YEAR = {1969/1970}, PAGES = {253--269}, ISSN = {0020-9910}, MRCLASS = {46.65}, MRNUMBER = {0265948 (42 \#857)}, MRREVIEWER = {B. Yood}, } @article {Elliott-Evans(1993), AUTHOR = {Elliott, George A. and Evans, David E.}, TITLE = {The structure of the irrational rotation {$C^*$}-algebra}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {138}, YEAR = {1993}, NUMBER = {3}, PAGES = {477--501}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {46L80 (46L05)}, MRNUMBER = {1247990 (94j:46066)}, MRREVIEWER = {Samuel Walters}, DOI = {10.2307/2946553}, URL = {http://dx.doi.org/10.2307/2946553}, } @article {Elliott-Gong(1996), AUTHOR = {Elliott, George A. and Gong, Guihua}, TITLE = {On the classification of {$C^*$}-algebras of real rank zero. {II}}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {144}, YEAR = {1996}, NUMBER = {3}, PAGES = {497--610}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {46L05 (19K56 46L80)}, MRNUMBER = {1426886 (98j:46055)}, DOI = {10.2307/2118565}, URL = {http://dx.doi.org/10.2307/2118565}, } @article {Eells-Kuiper(1962), AUTHOR = {Eells, Jr., James and Kuiper, Nicolaas H.}, TITLE = {An invariant for certain smooth manifolds}, JOURNAL = {Ann. Mat. Pura Appl. (4)}, FJOURNAL = {Annali di Matematica Pura ed Applicata. Serie Quarta}, VOLUME = {60}, YEAR = {1962}, PAGES = {93--110}, ISSN = {0003-4622}, MRCLASS = {57.32 (57.10)}, MRNUMBER = {156356}, DOI = {10.1007/BF02412768}, URL = {https://doi-org.ezp.lib.unimelb.edu.au/10.1007/BF02412768}, } @article{Elmendorf(1983), AUTHOR = {Elmendorf, A. D.}, TITLE = {Systems of fixed point sets}, JOURNAL = {Trans. Amer. Math. Soc.}, FJOURNAL = {Transactions of the American Mathematical Society}, VOLUME = {277}, YEAR = {1983}, NUMBER = {1}, PAGES = {275--284}, ISSN = {0002-9947}, CODEN = {TAMTAM}, MRCLASS = {57S99 (55N25)}, MRNUMBER = {84f:57029}, MRREVIEWER = {J. P. May}, } @incollection{Elmendorf-Kriz-Mandell-May(1995a), AUTHOR = {Elmendorf, A. D. and K{\v{r}}{\'\i}{\v{z}}, I. and Mandell, M. A. and May, J. P.}, TITLE = {Modern foundations for stable homotopy theory}, BOOKTITLE = {Handbook of algebraic topology}, PAGES = {213--253}, PUBLISHER = {North-Holland}, ADDRESS = {Amsterdam}, YEAR = {1995}, MRCLASS = {55P42}, MRNUMBER = {97d:55016}, MRREVIEWER = {J. M. Boardman}, } @book{Elmendorf-Kriz-Mandell-May(1997), AUTHOR = {Elmendorf, A. D. and Kriz, I. and Mandell, M. A. and May, J. P.}, TITLE = {Rings, modules, and algebras in stable homotopy theory}, NOTE = {With an appendix by M. Cole}, PUBLISHER = {American Mathematical Society}, ADDRESS = {Providence, RI}, YEAR = {1997}, PAGES = {xii+249}, ISBN = {0-8218-0638-6}, MRCLASS = {55N20 (19D10 19D55 55P42 55T25)}, MRNUMBER = {97h:55006}, MRREVIEWER = {Donald M. Davis}, } @Book{Elstrodt(1999), author = {Elstrodt, J\"urgen}, title = {{M}a\ss\ und {I}ntegrationstheorie}, publisher = {Springer}, note = {2. Auflage}, year = 1999, } @article {Elstrodt-Grunewald-Mennicke(1998Jahres), AUTHOR = {Elstrodt, J. and Grunewald, F.}, TITLE = {The {P}etersson scalar product}, JOURNAL = {Jahresber. Deutsch. Math.-Verein.}, FJOURNAL = {Jahresbericht der Deutschen Mathematiker-Vereinigung}, VOLUME = {100}, YEAR = {1998}, NUMBER = {4}, PAGES = {253--283}, ISSN = {0012-0456}, CODEN = {JDMVA7}, MRCLASS = {11F11 (11F12 11F25 11F30 11F37 11F46 11F66)}, MRNUMBER = {MR1671635 (2000d:11058)}, MRREVIEWER = {Thomas R. Shemanske}, } @book {Elstrodt-Grunewald-Mennicke(1998book), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {Groups acting on hyperbolic space}, SERIES = {Springer Monographs in Mathematics}, NOTE = {Harmonic analysis and number theory}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {1998}, PAGES = {xvi+524}, ISBN = {3-540-62745-6}, MRCLASS = {11F72 (11F12 11M36 22E40 57M50 57S30)}, MRNUMBER = {MR1483315 (98g:11058)}, MRREVIEWER = {Stefan K{\"u}hnlein}, } @incollection {Elstrodt-Grunewald-Mennicke(1990hyperbolic), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {Analysis and number theory in hyperbolic {$3$}-space}, BOOKTITLE = {Algebraic structures and number theory ({H}ong {K}ong, 1988)}, PAGES = {65--87}, PUBLISHER = {World Sci. Publ., Teaneck, NJ}, YEAR = {1990}, MRCLASS = {11E72 (11E45 11P21)}, MRNUMBER = {MR1098043}, } @incollection {Elstrodt-Grunewald-Mennicke(1990equadratic), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {Some examples of representation numbers of quadratic forms by quadratic forms}, BOOKTITLE = {Automorphic functions and their applications ({K}habarovsk, 1988)}, PAGES = {195--208}, PUBLISHER = {Acad. Sci. USSR Inst. Appl. Math.}, ADDRESS = {Khabarovsk}, YEAR = {1990}, MRCLASS = {11E12 (11E20)}, MRNUMBER = {MR1096977 (92a:11042)}, MRREVIEWER = {Angela Arenas}, } @article{Elstrodt-Grunewald-Mennicke(1990Kloostermann), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {Kloosterman sums for {C}lifford algebras and a lower bound for the positive eigenvalues of the {L}aplacian for congruence subgroups acting on hyperbolic spaces}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {101}, YEAR = {1990}, NUMBER = {3}, PAGES = {641--685}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {11F72 (11F55 11L05 22E40 58G25)}, MRNUMBER = {91j:11038}, MRREVIEWER = {Dorian Goldfeld}, } @article {Elstrodt-Grunewald-Mennicke(1988), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {Arithmetic applications of the hyperbolic lattice point theorem}, JOURNAL = {Proc. London Math. Soc. (3)}, FJOURNAL = {Proceedings of the London Mathematical Society. Third Series}, VOLUME = {57}, YEAR = {1988}, NUMBER = {2}, PAGES = {239--283}, ISSN = {0024-6115}, CODEN = {PLMTAL}, MRCLASS = {11E45 (11F72)}, MRNUMBER = {MR950591 (89g:11033)}, MRREVIEWER = {Dorothy Wallace}, DOI = {10.1112/plms/s3-57.2.239}, URL = {http://dx.doi.org/10.1112/plms/s3-57.2.239}, } @article {Elstrodt-Grunewald-Mennicke(1987Vahlen), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {Vahlen's group of {C}lifford matrices and spin-groups}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {196}, YEAR = {1987}, NUMBER = {3}, PAGES = {369--390}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {11E57 (11E88 15A66 20G15 20H15)}, MRNUMBER = {MR913663 (89b:11031)}, MRREVIEWER = {E. A. Connors}, DOI = {10.1007/BF01200359}, URL = {http://dx.doi.org/10.1007/BF01200359}, } @article {Elstrodt-Grunewald-Mennicke(1987Zeta), AUTHOR = {Elstrodt, J{\"u}rgen and Grunewald, Fritz and Mennicke, Jens}, TITLE = {Zeta-functions of binary {H}ermitian forms and special values of {E}isenstein series on three-dimensional hyperbolic space}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {277}, YEAR = {1987}, NUMBER = {4}, PAGES = {655--708}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {11E45 (11F55)}, MRNUMBER = {MR901712 (88m:11021)}, MRREVIEWER = {{\`E}. Gaigalas}, DOI = {10.1007/BF01457865}, URL = {http://dx.doi.org/10.1007/BF01457865}, } @incollection {Elstrodt-Grunewald-Mennicke(1986), AUTHOR = {Elstrodt, J{\"u}rgen and Grunewald, Fritz and Mennicke, Jens}, TITLE = {Eisenstein series for imaginary quadratic number fields}, BOOKTITLE = {The {S}elberg trace formula and related topics ({B}runswick, {M}aine, 1984)}, SERIES = {Contemp. Math.}, VOLUME = {53}, PAGES = {97--117}, PUBLISHER = {Amer. Math. Soc.}, ADDRESS = {Providence, RI}, YEAR = {1986}, MRCLASS = {11F66 (11F30 11M41)}, MRNUMBER = {MR853554 (88a:11050)}, MRREVIEWER = {K.-B. Gundlach}, } @incollection {Elstrodt-Grunewald-Mennicke(1985Selberg), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {The {S}elberg zeta-function for cocompact discrete subgroups of {${\rm PSL}(2,{\bf C})$}}, BOOKTITLE = {Elementary and analytic theory of numbers ({W}arsaw, 1982)}, SERIES = {Banach Center Publ.}, VOLUME = {17}, PAGES = {83--120}, PUBLISHER = {PWN}, ADDRESS = {Warsaw}, YEAR = {1985}, MRCLASS = {11F72 (11F06 58G25)}, MRNUMBER = {MR840474 (87h:11044)}, MRREVIEWER = {James Lee Hafner}, } @article {Elstrodt-Grunewald-Mennicke(1985extensions), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {On unramified {$A_m$}-extensions of quadratic number fields}, JOURNAL = {Glasgow Math. J.}, FJOURNAL = {Glasgow Mathematical Journal}, VOLUME = {27}, YEAR = {1985}, PAGES = {31--37}, ISSN = {0017-0895}, CODEN = {GLMJAS}, MRCLASS = {11R11 (11R37)}, MRNUMBER = {MR819826 (87e:11122)}, MRREVIEWER = {Charles J. Parry}, } @article {Elstrodt-Grunewald-Mennicke(1985Eisenstein), AUTHOR = {Elstrodt, J{\"u}rgen and Grunewald, Fritz and Mennicke, Jens}, TITLE = {Eisenstein series on three-dimensional hyperbolic space and imaginary quadratic number fields}, JOURNAL = {J. Reine Angew. Math.}, FJOURNAL = {Journal f\"ur die Reine und Angewandte Mathematik}, VOLUME = {360}, YEAR = {1985}, PAGES = {160--213}, ISSN = {0075-4102}, CODEN = {JRMAA8}, MRCLASS = {11F72 (11F12 11R11)}, MRNUMBER = {MR799662 (87c:11052)}, MRREVIEWER = {James Lee Hafner}, } @incollection {Elstrodt-Grunewald-Mennicke(1982group), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {On the group {${\rm PSL}_{2}({\bf Z}[i])$}}, BOOKTITLE = {Number theory days, 1980 ({E}xeter, 1980)}, SERIES = {London Math. Soc. Lecture Note Ser.}, VOLUME = {56}, PAGES = {255--283}, PUBLISHER = {Cambridge Univ. Press}, ADDRESS = {Cambridge}, YEAR = {1982}, MRCLASS = {10D07 (14K15 20G30)}, MRNUMBER = {MR697270 (84j:10024)}, MRREVIEWER = {T. Ono}, } @incollection {Elstrodt-Grunewald-Mennicke(1982integers), AUTHOR = {Elstrodt, J. and Grunewald, F. and Mennicke, J.}, TITLE = {{${\rm PSL}(2)$} over imaginary quadratic integers}, BOOKTITLE = {Arithmetic {C}onference ({M}etz, 1981)}, SERIES = {Ast\'erisque}, VOLUME = {94}, PAGES = {43--60}, PUBLISHER = {Soc. Math. France}, ADDRESS = {Paris}, YEAR = {1982}, MRCLASS = {10D07 (10C30)}, MRNUMBER = {MR702365 (84g:10051)}, MRREVIEWER = {W. W. Stothers}, } @article{Elworthy(1991), AUTHOR = {Elworthy, K. D. and Rosenberg, Steven}, TITLE = {Manifolds with wells of negative curvature}, NOTE = {With an appendix by Daniel Ruberman}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {103}, YEAR = {1991}, NUMBER = {3}, PAGES = {471--495}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {53C21 (58G11 58G25 58G32)}, MRNUMBER = {92a:53059}, MRREVIEWER = {J. S. Joel}, } @article{Elworthy(1993), AUTHOR = {Elworthy, K. D. and Rosenberg, Steven}, TITLE = {The {W}itten {L}aplacian on negatively curved simply connected manifolds}, JOURNAL = {Tokyo J. Math.}, FJOURNAL = {Tokyo Journal of Mathematics}, VOLUME = {16}, YEAR = {1993}, NUMBER = {2}, PAGES = {513--524}, ISSN = {0387-3870}, MRCLASS = {58G25 (53C20 53C21 58G03)}, MRNUMBER = {94j:58171}, MRREVIEWER = {J{\"u}rgen Eichhorn}, } @article{Elworthy(1996), AUTHOR = {Elworthy, K. D. and Rosenberg, S.}, TITLE = {Homotopy and homology vanishing theorems and the stability of stochastic flows}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {6}, YEAR = {1996}, NUMBER = {1}, PAGES = {51--78}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G32 (53C21)}, MRNUMBER = {97a:58198}, MRREVIEWER = {Yu. E. Gliklikh}, } @article{Elworthy-Li-Rosenberg(1998), AUTHOR = {Elworthy, K. D. and Li, X.-M. and Rosenberg, S.}, TITLE = {Bounded and ${L}\sp 2$ harmonic forms on universal covers}, JOURNAL = {Geom. Funct. Anal.}, FJOURNAL = {Geometric and Functional Analysis}, VOLUME = {8}, YEAR = {1998}, NUMBER = {2}, PAGES = {283--303}, ISSN = {1016-443X}, CODEN = {GFANFB}, MRCLASS = {58G32 (53C20 58A14)}, MRNUMBER = {99d:58180}, MRREVIEWER = {Gilles Carron}, } @article {Emerson-Meyer(2008Lefschetz), AUTHOR = {Emerson, Heath and Meyer, Ralf}, TITLE = {Equivariant {L}efschetz maps for simplicial complexes and smooth manifolds}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {345}, YEAR = {2009}, NUMBER = {3}, PAGES = {599--630}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {46Lxx (58Jxx)}, MRNUMBER = {MR2534110}, DOI = {10.1007/s00208-009-0367-z}, URL = {http://dx.doi.org/10.1007/s00208-009-0367-z}, } @article {Emerson-Meyer(2009rep), AUTHOR = {Emerson, Heath and Meyer, Ralf}, TITLE = {Equivariant representable {K}-theory}, JOURNAL = {J. Topol.}, FJOURNAL = {Journal of Topology}, VOLUME = {2}, YEAR = {2009}, NUMBER = {1}, PAGES = {123--156}, ISSN = {1753-8416}, MRCLASS = {19K35 (46L80)}, MRNUMBER = {MR2499440 (2010a:19003)}, MRREVIEWER = {Efton Park}, DOI = {10.1112/jtopol/jtp003}, URL = {http://dx.doi.org/10.1112/jtopol/jtp003}, } @incollection {Emerson-Meyer(2008coass), AUTHOR = {Emerson, Heath and Meyer, Ralf}, TITLE = {Coarse and equivariant co-assembly maps}, BOOKTITLE = {{$K$}-theory and noncommutative geometry}, SERIES = {EMS Ser. Congr. Rep.}, PAGES = {71--89}, PUBLISHER = {Eur. Math. Soc., Z\"urich}, YEAR = {2008}, MRCLASS = {19K35 (46L80)}, MRNUMBER = {MR2513333}, MRREVIEWER = {J{\'a}n {\v{S}}pakula}, DOI = {10.4171/060-1/3}, URL = {http://dx.doi.org/10.4171/060-1/3}, } @article {Emerson-Meyer(2007descent), AUTHOR = {Emerson, Heath and Meyer, Ralf}, TITLE = {A descent principle for the {D}irac--dual-{D}irac method}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {46}, YEAR = {2007}, NUMBER = {2}, PAGES = {185--209}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {57R77 (19D55 19K33 19K35 19K56 58J22)}, MRNUMBER = {MR2313071 (2008f:57038)}, MRREVIEWER = {Alberto Cavicchioli}, DOI = {10.1016/j.top.2007.02.001}, URL = {http://dx.doi.org/10.1016/j.top.2007.02.001}, } @article {Emerson-Meyer(2006dualizing), AUTHOR = {Emerson, Heath and Meyer, Ralf}, TITLE = {Dualizing the coarse assembly map}, JOURNAL = {J. Inst. Math. Jussieu}, FJOURNAL = {Journal of the Institute of Mathematics of Jussieu. JIMJ. Journal de l'Institut de Math\'ematiques de Jussieu}, VOLUME = {5}, YEAR = {2006}, NUMBER = {2}, PAGES = {161--186}, ISSN = {1474-7480}, MRCLASS = {19K35 (46L80 58J22)}, MRNUMBER = {MR2225040 (2007f:19007)}, MRREVIEWER = {Jean-Louis Tu}, DOI = {10.1017/S147474800500023X}, URL = {http://dx.doi.org/10.1017/S147474800500023X}, } @article {Emerson-Meyer(2006Euler), AUTHOR = {Emerson, Heath and Meyer, Ralf}, TITLE = {Euler characteristics and {G}ysin sequences for group actions on boundaries}, JOURNAL = {Math. Ann.}, FJOURNAL = {Mathematische Annalen}, VOLUME = {334}, YEAR = {2006}, NUMBER = {4}, PAGES = {853--904}, ISSN = {0025-5831}, CODEN = {MAANA}, MRCLASS = {19K35 (46L80)}, MRNUMBER = {MR2209260 (2007b:19006)}, MRREVIEWER = {Emmanuel C. Germain}, DOI = {10.1007/s00208-005-0747-y}, URL = {http://dx.doi.org/10.1007/s00208-005-0747-y}, } @article {Emmanouil(2009), AUTHOR = {Emmanouil, Ioannis}, TITLE = {Group splittings and integrality of traces}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {84}, YEAR = {2009}, NUMBER = {1}, PAGES = {171--187}, ISSN = {0010-2571}, MRCLASS = {20E08 (19A31 20C07)}, MRNUMBER = {MR2466080 (2009i:20056)}, MRREVIEWER = {Peter A. Linnell}, DOI = {10.4171/CMH/157}, URL = {http://dx.doi.org/10.4171/CMH/157}, } @article {Emmanouil(2008), AUTHOR = {Emmanouil, Ioannis and Passi, Inder Bir S.}, TITLE = {Group homology and extensions of groups}, JOURNAL = {Homology, Homotopy Appl.}, FJOURNAL = {Homology, Homotopy and Applications}, VOLUME = {10}, YEAR = {2008}, NUMBER = {1}, PAGES = {237--257}, ISSN = {1532-0073}, MRCLASS = {20J06 (16E40 16S34 19D55)}, MRNUMBER = {MR2386049 (2009a:20089)}, MRREVIEWER = {Sarah J. Witherspoon}, } @article {Emmanouil(2006a), AUTHOR = {Emmanouil, Ioannis}, TITLE = {On the trace of idempotent matrices over group algebras}, JOURNAL = {Math. Z.}, FJOURNAL = {Mathematische Zeitschrift}, VOLUME = {253}, YEAR = {2006}, NUMBER = {4}, PAGES = {709--733}, ISSN = {0025-5874}, CODEN = {MAZEAX}, MRCLASS = {16S34 (46L10)}, MRNUMBER = {MR2221096}, } @book {Emmanouil(2006), AUTHOR = {Emmanouil, Ioannis}, TITLE = {Idempotent matrices over complex group algebras}, SERIES = {Universitext}, PUBLISHER = {Springer-Verlag}, ADDRESS = {Berlin}, YEAR = {2006}, PAGES = {xiv+276}, ISBN = {978-3-540-27990-7; 3-540-27990-3}, MRCLASS = {16S34 (19A31 20C07 46L80)}, MRNUMBER = {MR2184145 (2006h:16043)}, MRREVIEWER = {Peter A. Linnell}, } @article {Emmanouil(1998b), AUTHOR = {Emmanouil, Ioannis}, TITLE = {Solvable groups and {B}ass' conjecture}, JOURNAL = {C. R. Acad. Sci. Paris S\'er. I Math.}, FJOURNAL = {Comptes Rendus de l'Acad\'emie des Sciences. S\'erie I. Math\'ematique}, VOLUME = {326}, YEAR = {1998}, NUMBER = {3}, PAGES = {283--287}, ISSN = {0764-4442}, CODEN = {CASMEI}, MRCLASS = {19A31 (15A99 20F16)}, MRNUMBER = {99h:19002}, MRREVIEWER = {Vitaly A. Roman{\cprime}kov}, } @article {Emmanouil(1998a), AUTHOR = {Emmanouil, Ioannis}, TITLE = {On a class of groups satisfying {B}ass' conjecture}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {132}, YEAR = {1998}, NUMBER = {2}, PAGES = {307--330}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {19A31 (16E20 19D55 20J05)}, MRNUMBER = {2000a:19001}, MRREVIEWER = {H. Bass}, } @article {Endo-Hironaka(1979), AUTHOR = {End{\^o}, Shizuo and Hironaka, Yumiko}, TITLE = {Finite groups with trivial class groups}, JOURNAL = {J. Math. Soc. Japan}, FJOURNAL = {Journal of the Mathematical Society of Japan}, VOLUME = {31}, YEAR = {1979}, NUMBER = {1}, PAGES = {161--174}, CODEN = {NISUBC}, MRCLASS = {12A57 (20D99)}, MRNUMBER = {MR519042 (81c:12018)}, MRREVIEWER = {Jacques Martinet}, } @article {Endo-Miyata(1980), AUTHOR = {End{\^o}, Shizuo and Miyata, Takehiko}, TITLE = {On the class groups of dihedral groups}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {63}, YEAR = {1980}, NUMBER = {2}, PAGES = {548--573}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {16A26 (12A57 16A54 20C99)}, MRNUMBER = {MR570730 (81h:16021)}, MRREVIEWER = {M. E. Keating}, } @article {Engel(2018), AUTHOR = {Engel, Alexander}, TITLE = {Banach strong {N}ovikov conjecture for polynomially contractible groups}, JOURNAL = {Adv. Math.}, FJOURNAL = {Advances in Mathematics}, VOLUME = {330}, YEAR = {2018}, PAGES = {148--172}, ISSN = {0001-8708}, MRCLASS = {46L80 (20F65 20F99 20J06 46L10)}, MRNUMBER = {3787543}, MRREVIEWER = {Vladimir Manuilov}, DOI = {10.1016/j.aim.2018.03.006}, URL = {https://doi.org/10.1016/j.aim.2018.03.006}, } @article{Engel-Marcinkowski(2020), AUTHOR = {Engel, Alexander and Marcinkowski, Micha\l }, TITLE = {Burghelea conjecture and asymptotic dimension of groups}, JOURNAL = {J. Topol. Anal.}, FJOURNAL = {Journal of Topology and Analysis}, VOLUME = {12}, YEAR = {2020}, NUMBER = {2}, PAGES = {321--356}, ISSN = {1793-5253,1793-7167}, MRCLASS = {20F65 (20J05 55R35)}, MRNUMBER = {4317270}, MRREVIEWER = {Jens\ Harlander}, DOI = {10.1142/S1793525319500559}, URL = {https://doi.org/10.1142/S1793525319500559}, } @book {Engelking(1978), AUTHOR = {Engelking, Ryszard}, TITLE = {Dimension theory}, NOTE = {Translated from the Polish and revised by the author, North-Holland Mathematical Library, 19}, PUBLISHER = {North-Holland Publishing Co., Amsterdam-Oxford-New York; PWN---Polish Scientific Publishers, Warsaw}, YEAR = {1978}, PAGES = {x+314 pp. (loose errata)}, ISBN = {0-444-85176-3}, MRCLASS = {54FXX}, MRNUMBER = {0482697}, MRREVIEWER = {Teodor Przymusinski}, } @article {Enkelmann-Lueck-Malte-Ullmann-Winges(2018), AUTHOR = {Enkelmann, Nils-Edvin and L\"{u}ck, Wolfgang and Pieper, Malte and Ullmann, Mark and Winges, Christoph}, TITLE = {On the {F}arrell--{J}ones conjecture for {W}aldhausen's {A}--theory}, JOURNAL = {Geom. Topol.}, FJOURNAL = {Geometry \& Topology}, VOLUME = {22}, YEAR = {2018}, NUMBER = {6}, PAGES = {3321--3394}, ISSN = {1465-3060}, MRCLASS = {19D10 (57Q10 57Q60)}, MRNUMBER = {3858766}, DOI = {10.2140/gt.2018.22.3321}, URL = {https://doi.org/10.2140/gt.2018.22.3321}, } @article{Epstein(1961), AUTHOR = {Epstein, D. B. A.}, TITLE = {Finite presentations of groups and $3$-manifolds}, JOURNAL = {Quart. J. Math. Oxford Ser. (2)}, VOLUME = {12}, YEAR = {1961}, PAGES = {205--212}, MRCLASS = {55.60 (54.78)}, MRNUMBER = {26 \#1867}, MRREVIEWER = {O. G. Harrold}, } @article{Epstein(1972), AUTHOR = {Epstein, D. B. A.}, TITLE = {Periodic flows on three-manifolds}, JOURNAL = {Ann. of Math. (2)}, VOLUME = {95}, YEAR = {1972}, PAGES = {66--82}, MRCLASS = {57.48}, MRNUMBER = {44 \#5981}, MRREVIEWER = {V. Poenaru}, } @article{Epstein(1976), AUTHOR = {Epstein, D. B. A.}, TITLE = {Foliations with all leaves compact}, JOURNAL = {Ann. Inst. Fourier (Grenoble)}, VOLUME = {26}, YEAR = {1976}, NUMBER = {1}, PAGES = {viii, 265--282}, MRCLASS = {57D30}, MRNUMBER = {54 \#8664}, MRREVIEWER = {Robert Roussarie}, } @book{Epstein-Cannon-Holt-Levy-Paterson-Thurston(1992), AUTHOR = {Epstein, David B. A. and Cannon, James W. and Holt, Derek F. and Levy, Silvio V. F. and Paterson, Michael S. and Thurston, William P.}, TITLE = {Word processing in groups}, PUBLISHER = {Jones and Bartlett Publishers}, ADDRESS = {Boston, MA}, YEAR = {1992}, PAGES = {xii+330}, ISBN = {0-86720-244-0}, MRCLASS = {20F10 (03D40 20-02 68Q70)}, MRNUMBER = {93i:20036}, MRREVIEWER = {Richard M. Thomas}, } @article{Epstein-Fujiwara(1997), AUTHOR = {Epstein, David B. A. and Fujiwara, Koji}, TITLE = {The second bounded cohomology of word-hyperbolic groups}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {36}, YEAR = {1997}, NUMBER = {6}, PAGES = {1275--1289}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {20J05 (20F32)}, MRNUMBER = {98k:20088}, MRREVIEWER = {Thomas Delzant}, } @article{Epstein-Millet-Tischler(1977), AUTHOR = {Epstein, D. B. A. and Millett, K. C. and Tischler, D.}, TITLE = {Leaves without holonomy}, JOURNAL = {J. London Math. Soc. (2)}, VOLUME = {16}, YEAR = {1977}, NUMBER = {3}, PAGES = {548--552}, MRCLASS = {57D30}, MRNUMBER = {57 \#4193}, MRREVIEWER = {Elmar Vogt}, } @article{Epstein-Vogt(1978), AUTHOR = {Epstein, D. B. A. and Vogt, E.}, TITLE = {A counterexample to the periodic orbit conjecture in codimension $3$}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {108}, YEAR = {1978}, NUMBER = {3}, PAGES = {539--552}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {57R30 (34C25 58F18 58F22 58F25)}, MRNUMBER = {80c:57014}, MRREVIEWER = {C. S. Hartzman}, } @article {Erschler(2011Fuerstenberg), AUTHOR = {Erschler, Anna}, TITLE = {Poisson-{F}urstenberg boundary of random walks on wreath products and free metabelian groups}, JOURNAL = {Comment. Math. Helv.}, FJOURNAL = {Commentarii Mathematici Helvetici. A Journal of the Swiss Mathematical Society}, VOLUME = {86}, YEAR = {2011}, NUMBER = {1}, PAGES = {113--143}, ISSN = {0010-2571}, MRCLASS = {60B15 (20F69 30F15 43A07 60G50 60J50)}, MRNUMBER = {2745278 (2011k:60013)}, MRREVIEWER = {Wolfgang Woess}, } @article {Erschler(2009), AUTHOR = {Erschler, Anna}, TITLE = {Random mappings of scaled graphs}, JOURNAL = {Probab. Theory Related Fields}, FJOURNAL = {Probability Theory and Related Fields}, VOLUME = {144}, YEAR = {2009}, NUMBER = {3-4}, PAGES = {543--579}, ISSN = {0178-8051}, CODEN = {PTRFEU}, MRCLASS = {20F69 (20P05 60B15)}, MRNUMBER = {2496442 (2010e:20068)}, MRREVIEWER = {Wolfgang Woess}, DOI = {10.1007/s00440-008-0154-x}, URL = {http://dx.doi.org/10.1007/s00440-008-0154-x}, } @article {Erschler(2007), AUTHOR = {Erschler, Anna}, TITLE = {Automatically presented groups}, JOURNAL = {Groups Geom. Dyn.}, FJOURNAL = {Groups, Geometry, and Dynamics}, VOLUME = {1}, YEAR = {2007}, NUMBER = {1}, PAGES = {47--59}, ISSN = {1661-7207}, MRCLASS = {20F69 (20E08 20F65)}, MRNUMBER = {2294247 (2008c:20080)}, MRREVIEWER = {Tullio G. Ceccherini-Silberstein}, DOI = {10.4171/GGD/3}, URL = {http://dx.doi.org/10.4171/GGD/3}, } @article{Erschler(2006a), AUTHOR = {Erschler, Anna}, TITLE = {Piecewise automatic groups}, JOURNAL = {Duke Math. J.}, FJOURNAL = {Duke Mathematical Journal}, VOLUME = {134}, YEAR = {2006}, NUMBER = {3}, PAGES = {591--613}, ISSN = {0012-7094}, CODEN = {DUMJAO}, MRCLASS = {20F65 (20F69 43A07 57M07)}, MRNUMBER = {MR2254627 (2007k:20086)}, MRREVIEWER = {Tullio G. Ceccherini-Silberstein}, } @article{Erschler(2006b), AUTHOR = {Erschler, Anna}, TITLE = {Isoperimetry for wreath products of {M}arkov chains and multiplicity of selfintersections of random walks}, JOURNAL = {Probab. Theory Related Fields}, FJOURNAL = {Probability Theory and Related Fields}, VOLUME = {136}, YEAR = {2006}, NUMBER = {4}, PAGES = {560--586}, ISSN = {0178-8051}, CODEN = {PTRFEU}, MRCLASS = {60J10 (60C05 60G50)}, MRNUMBER = {MR2257136 (2009a:60079)}, } @article {Erschler(2005recurrence), AUTHOR = {Erschler, Anna}, TITLE = {Critical constants for recurrence of random walks on {$G$}-spaces}, JOURNAL = {Ann. Inst. Fourier (Grenoble)}, FJOURNAL = {Universit\'e de Grenoble. Annales de l'Institut Fourier}, VOLUME = {55}, YEAR = {2005}, NUMBER = {2}, PAGES = {493--509}, ISSN = {0373-0956}, CODEN = {AIFUA7}, MRCLASS = {20F65 (20E08)}, MRNUMBER = {2147898 (2006c:20085)}, MRREVIEWER = {Anders Karlsson}, URL = {http://aif.cedram.org/item?id=AIF_2005__55_2_493_0}, } @article {Erschler(2005cones), AUTHOR = {Erschler, A. and Osin, D.}, TITLE = {Fundamental groups of asymptotic cones}, JOURNAL = {Topology}, FJOURNAL = {Topology. An International Journal of Mathematics}, VOLUME = {44}, YEAR = {2005}, NUMBER = {4}, PAGES = {827--843}, ISSN = {0040-9383}, CODEN = {TPLGAF}, MRCLASS = {20F69 (20F06 57M07)}, MRNUMBER = {2136537 (2006a:20080)}, MRREVIEWER = {Jonathan A. Hillman}, DOI = {10.1016/j.top.2005.02.003}, URL = {http://dx.doi.org/10.1016/j.top.2005.02.003}, } @article {Erschler(2005Annals), AUTHOR = {Erschler, Anna}, TITLE = {Boundary behavior for groups of subexponential growth}, JOURNAL = {Ann. of Math. (2)}, FJOURNAL = {Annals of Mathematics. Second Series}, VOLUME = {160}, YEAR = {2004}, NUMBER = {3}, PAGES = {1183--1210}, ISSN = {0003-486X}, CODEN = {ANMAAH}, MRCLASS = {20F65 (20F05 20P05 60G50)}, MRNUMBER = {2144977 (2006d:20072)}, MRREVIEWER = {Anders Karlsson}, DOI = {10.4007/annals.2004.160.1183}, URL = {http://dx.doi.org/10.4007/annals.2004.160.1183}, } @incollection {Erschler(2004randomwalks), AUTHOR = {Erschler, Anna}, TITLE = {Growth rates of small cancellation groups}, BOOKTITLE = {Random walks and geometry}, PAGES = {421--430}, PUBLISHER = {Walter de Gruyter GmbH \& Co. KG, Berlin}, YEAR = {2004}, MRCLASS = {20F06 (20F05)}, MRNUMBER = {2087793 (2005f:20061)}, MRREVIEWER = {Martin Edjvet}, } @article {Erschler(2004intermediategrowth), AUTHOR = {Erschler, Anna}, TITLE = {Not residually finite groups of intermediate growth, commensurability and non-geometricity}, JOURNAL = {J. Algebra}, FJOURNAL = {Journal of Algebra}, VOLUME = {272}, YEAR = {2004}, NUMBER = {1}, PAGES = {154--172}, ISSN = {0021-8693}, CODEN = {JALGA4}, MRCLASS = {20F05 (20F50 20F65)}, MRNUMBER = {2029029 (2004j:20066)}, MRREVIEWER = {Stephen P. Humphries}, DOI = {10.1016/j.jalgebra.2002.11.005}, URL = {http://dx.doi.org/10.1016/j.jalgebra.2002.11.005}, } @article {Erschler(2004Liouville), AUTHOR = {Erschler, Anna}, TITLE = {Liouville property for groups and manifolds}, JOURNAL = {Invent. Math.}, FJOURNAL = {Inventiones Mathematicae}, VOLUME = {155}, YEAR = {2004}, NUMBER = {1}, PAGES = {55--80}, ISSN = {0020-9910}, CODEN = {INVMBH}, MRCLASS = {43A85 (20P05 28D20 43A07 60B15 60G50 60J50)}, MRNUMBER = {2025301 (2005i:43023)}, MRREVIEWER = {Anatoly N. Kochubei}, DOI = {10.1007/s00222-003-0314-7}, URL = {http://dx.doi.org/10.1007/s00222-003-0314-7}, } @article {Erschler(2003profiles), AUTHOR = {Erschler, Anna}, TITLE = {On isoperimetric profiles of finitely generated groups}, JOURNAL = {Geom. Dedicata}, FJOURNAL = {Geometriae Dedicata}, VOLUME = {100}, YEAR = {2003}, PAGES = {157--171}, ISSN = {0046-5755}, CODEN = {GEMDAT}, MRCLASS = {20F65 (20E22 43A07)}, MRNUMBER = {2011120 (2004j:20087)}, MRREVIEWER = {Tullio G. Ceccherini-Silberstein}, DOI = {10.1023/A:1025849602376}, URL = {http://dx.doi.org/10.1023/A:1025849602376}, } @article {Erschler(2003drift), AUTHOR = {Erschler, Anna}, TITLE = {On drift and entropy growth for random walks on groups}, JOURNAL = {Ann. Probab.}, FJOURNAL = {The Annals of Probability}, VOLUME = {31}, YEAR = {2003}, NUMBER = {3}, PAGES = {1193--1204}, ISSN = {0091-1798}, CODEN = {APBYAE}, MRCLASS = {60B15 (20F69 20P05 43A05)}, MRNUMBER = {1988468 (2004c:60018)}, MRREVIEWER = {Anatoly N. Kochubei}, DOI = {10.1214/aop/1055425775}, URL = {http://dx.doi.org/10.1214/aop/1055425775}, } @article {Erschler(2002cyclic), AUTHOR = {Erschler-Dyubina, Anna}, TITLE = {On the geometry of infinite cyclic subgroups}, JOURNAL = {Israel J. Math.}, FJOURNAL = {Israel Journal of Mathematics}, VOLUME = {132}, YEAR = {2002}, PAGES